From 2e2e1312faeee78d7a2ccca15b8afa3ee359e2c8 Mon Sep 17 00:00:00 2001
From: robocoder <anthon.pang@gmail.com>
Date: Sun, 9 May 2010 04:19:42 +0000
Subject: [PATCH] refs #1235 - update libs
git-svn-id: http://dev.piwik.org/svn/trunk@2159 59fd770c-687e-43c8-a1e3-f5a4ff64c105
---
config/global.ini.php | 4 +-
libs/jquery/jquery-ui.js | 754 +-
libs/jquery/jquery.js | 165 +-
libs/jquery/original lib/jquery-ui.js | 12008 ++++++++++++++----------
libs/jquery/original lib/jquery.js | 6567 ++++++++-----
libs/jquery/themes/base/jquery-ui.css | 378 +-
6 files changed, 12268 insertions(+), 7608 deletions(-)
diff --git a/config/global.ini.php b/config/global.ini.php
index 45630d8475..223795ca00 100644
--- a/config/global.ini.php
+++ b/config/global.ini.php
@@ -143,8 +143,8 @@ datatable_archiving_maximum_rows_providers = 500
use_ajax_cdn = 0
; required AJAX library versions
-jquery_version = 1.3.2
-jqueryui_version = 1.7.2
+jquery_version = 1.4.2
+jqueryui_version = 1.8.1
swfobject_version = 2.2
; If set to 0, Flash widgets require separate HTTP requests
diff --git a/libs/jquery/jquery-ui.js b/libs/jquery/jquery-ui.js
index 013c0364a9..9ea846d658 100644
--- a/libs/jquery/jquery-ui.js
+++ b/libs/jquery/jquery-ui.js
@@ -1,10 +1,756 @@
-/*
- * jQuery UI 1.7.2
+/*!
+ * jQuery UI 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
* http://docs.jquery.com/UI
*/
-jQuery.ui||(function(c){var i=c.fn.remove,d=c.browser.mozilla&&(parseFloat(c.browser.version)<1.9);c.ui={version:"1.7.2",plugin:{add:function(k,l,n){var m=c.ui[k].prototype;for(var j in n){m.plugins[j]=m.plugins[j]||[];m.plugins[j].push([l,n[j]])}},call:function(j,l,k){var n=j.plugins[l];if(!n||!j.element[0].parentNode){return}for(var m=0;m<n.length;m++){if(j.options[n[m][0]]){n[m][1].apply(j.element,k)}}}},contains:function(k,j){return document.compareDocumentPosition?k.compareDocumentPosition(j)&16:k!==j&&k.contains(j)},hasScroll:function(m,k){if(c(m).css("overflow")=="hidden"){return false}var j=(k&&k=="left")?"scrollLeft":"scrollTop",l=false;if(m[j]>0){return true}m[j]=1;l=(m[j]>0);m[j]=0;return l},isOverAxis:function(k,j,l){return(k>j)&&(k<(j+l))},isOver:function(o,k,n,m,j,l){return c.ui.isOverAxis(o,n,j)&&c.ui.isOverAxis(k,m,l)},keyCode:{BACKSPACE:8,CAPS_LOCK:20,COMMA:188,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38}};if(d){var f=c.attr,e=c.fn.removeAttr,h="http://www.w3.org/2005/07/aaa",a=/^aria-/,b=/^wairole:/;c.attr=function(k,j,l){var m=l!==undefined;return(j=="role"?(m?f.call(this,k,j,"wairole:"+l):(f.apply(this,arguments)||"").replace(b,"")):(a.test(j)?(m?k.setAttributeNS(h,j.replace(a,"aaa:"),l):f.call(this,k,j.replace(a,"aaa:"))):f.apply(this,arguments)))};c.fn.removeAttr=function(j){return(a.test(j)?this.each(function(){this.removeAttributeNS(h,j.replace(a,""))}):e.call(this,j))}}c.fn.extend({remove:function(){c("*",this).add(this).each(function(){c(this).triggerHandler("remove")});return i.apply(this,arguments)},enableSelection:function(){return this.attr("unselectable","off").css("MozUserSelect","").unbind("selectstart.ui")},disableSelection:function(){return this.attr("unselectable","on").css("MozUserSelect","none").bind("selectstart.ui",function(){return false})},scrollParent:function(){var j;if((c.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){j=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(c.curCSS(this,"position",1))&&(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}else{j=this.parents().filter(function(){return(/(auto|scroll)/).test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!j.length?c(document):j}});c.extend(c.expr[":"],{data:function(l,k,j){return !!c.data(l,j[3])},focusable:function(k){var l=k.nodeName.toLowerCase(),j=c.attr(k,"tabindex");return(/input|select|textarea|button|object/.test(l)?!k.disabled:"a"==l||"area"==l?k.href||!isNaN(j):!isNaN(j))&&!c(k)["area"==l?"parents":"closest"](":hidden").length},tabbable:function(k){var j=c.attr(k,"tabindex");return(isNaN(j)||j>=0)&&c(k).is(":focusable")}});function g(m,n,o,l){function k(q){var p=c[m][n][q]||[];return(typeof p=="string"?p.split(/,?\s+/):p)}var j=k("getter");if(l.length==1&&typeof l[0]=="string"){j=j.concat(k("getterSetter"))}return(c.inArray(o,j)!=-1)}c.widget=function(k,j){var l=k.split(".")[0];k=k.split(".")[1];c.fn[k]=function(p){var n=(typeof p=="string"),o=Array.prototype.slice.call(arguments,1);if(n&&p.substring(0,1)=="_"){return this}if(n&&g(l,k,p,o)){var m=c.data(this[0],k);return(m?m[p].apply(m,o):undefined)}return this.each(function(){var q=c.data(this,k);(!q&&!n&&c.data(this,k,new c[l][k](this,p))._init());(q&&n&&c.isFunction(q[p])&&q[p].apply(q,o))})};c[l]=c[l]||{};c[l][k]=function(o,n){var m=this;this.namespace=l;this.widgetName=k;this.widgetEventPrefix=c[l][k].eventPrefix||k;this.widgetBaseClass=l+"-"+k;this.options=c.extend({},c.widget.defaults,c[l][k].defaults,c.metadata&&c.metadata.get(o)[k],n);this.element=c(o).bind("setData."+k,function(q,p,r){if(q.target==o){return m._setData(p,r)}}).bind("getData."+k,function(q,p){if(q.target==o){return m._getData(p)}}).bind("remove",function(){return m.destroy()})};c[l][k].prototype=c.extend({},c.widget.prototype,j);c[l][k].getterSetter="option"};c.widget.prototype={_init:function(){},destroy:function(){this.element.removeData(this.widgetName).removeClass(this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").removeAttr("aria-disabled")},option:function(l,m){var k=l,j=this;if(typeof l=="string"){if(m===undefined){return this._getData(l)}k={};k[l]=m}c.each(k,function(n,o){j._setData(n,o)})},_getData:function(j){return this.options[j]},_setData:function(j,k){this.options[j]=k;if(j=="disabled"){this.element[k?"addClass":"removeClass"](this.widgetBaseClass+"-disabled "+this.namespace+"-state-disabled").attr("aria-disabled",k)}},enable:function(){this._setData("disabled",false)},disable:function(){this._setData("disabled",true)},_trigger:function(l,m,n){var p=this.options[l],j=(l==this.widgetEventPrefix?l:this.widgetEventPrefix+l);m=c.Event(m);m.type=j;if(m.originalEvent){for(var k=c.event.props.length,o;k;){o=c.event.props[--k];m[o]=m.originalEvent[o]}}this.element.trigger(m,n);return !(c.isFunction(p)&&p.call(this.element[0],m,n)===false||m.isDefaultPrevented())}};c.widget.defaults={disabled:false};c.ui.mouse={_mouseInit:function(){var j=this;this.element.bind("mousedown."+this.widgetName,function(k){return j._mouseDown(k)}).bind("click."+this.widgetName,function(k){if(j._preventClickEvent){j._preventClickEvent=false;k.stopImmediatePropagation();return false}});if(c.browser.msie){this._mouseUnselectable=this.element.attr("unselectable");this.element.attr("unselectable","on")}this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName);(c.browser.msie&&this.element.attr("unselectable",this._mouseUnselectable))},_mouseDown:function(l){l.originalEvent=l.originalEvent||{};if(l.originalEvent.mouseHandled){return}(this._mouseStarted&&this._mouseUp(l));this._mouseDownEvent=l;var k=this,m=(l.which==1),j=(typeof this.options.cancel=="string"?c(l.target).parents().add(l.target).filter(this.options.cancel).length:false);if(!m||j||!this._mouseCapture(l)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){k.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(l)&&this._mouseDelayMet(l)){this._mouseStarted=(this._mouseStart(l)!==false);if(!this._mouseStarted){l.preventDefault();return true}}this._mouseMoveDelegate=function(n){return k._mouseMove(n)};this._mouseUpDelegate=function(n){return k._mouseUp(n)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);(c.browser.safari||l.preventDefault());l.originalEvent.mouseHandled=true;return true},_mouseMove:function(j){if(c.browser.msie&&!j.button){return this._mouseUp(j)}if(this._mouseStarted){this._mouseDrag(j);return j.preventDefault()}if(this._mouseDistanceMet(j)&&this._mouseDelayMet(j)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,j)!==false);(this._mouseStarted?this._mouseDrag(j):this._mouseUp(j))}return !this._mouseStarted},_mouseUp:function(j){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._preventClickEvent=(j.target==this._mouseDownEvent.target);this._mouseStop(j)}return false},_mouseDistanceMet:function(j){return(Math.max(Math.abs(this._mouseDownEvent.pageX-j.pageX),Math.abs(this._mouseDownEvent.pageY-j.pageY))>=this.options.distance)},_mouseDelayMet:function(j){return this.mouseDelayMet},_mouseStart:function(j){},_mouseDrag:function(j){},_mouseStop:function(j){},_mouseCapture:function(j){return true}};c.ui.mouse.defaults={cancel:null,distance:1,delay:0}})(jQuery);(function(a){a.widget("ui.draggable",a.extend({},a.ui.mouse,{_init:function(){if(this.options.helper=="original"&&!(/^(?:r|a|f)/).test(this.element.css("position"))){this.element[0].style.position="relative"}(this.options.addClasses&&this.element.addClass("ui-draggable"));(this.options.disabled&&this.element.addClass("ui-draggable-disabled"));this._mouseInit()},destroy:function(){if(!this.element.data("draggable")){return}this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy()},_mouseCapture:function(b){var c=this.options;if(this.helper||c.disabled||a(b.target).is(".ui-resizable-handle")){return false}this.handle=this._getHandle(b);if(!this.handle){return false}return true},_mouseStart:function(b){var c=this.options;this.helper=this._createHelper(b);this._cacheHelperProportions();if(a.ui.ddmanager){a.ui.ddmanager.current=this}this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};a.extend(this.offset,{click:{left:b.pageX-this.offset.left,top:b.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(b);this.originalPageX=b.pageX;this.originalPageY=b.pageY;if(c.cursorAt){this._adjustOffsetFromHelper(c.cursorAt)}if(c.containment){this._setContainment()}this._trigger("start",b);this._cacheHelperProportions();if(a.ui.ddmanager&&!c.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,b)}this.helper.addClass("ui-draggable-dragging");this._mouseDrag(b,true);return true},_mouseDrag:function(b,d){this.position=this._generatePosition(b);this.positionAbs=this._convertPositionTo("absolute");if(!d){var c=this._uiHash();this._trigger("drag",b,c);this.position=c.position}if(!this.options.axis||this.options.axis!="y"){this.helper[0].style.left=this.position.left+"px"}if(!this.options.axis||this.options.axis!="x"){this.helper[0].style.top=this.position.top+"px"}if(a.ui.ddmanager){a.ui.ddmanager.drag(this,b)}return false},_mouseStop:function(c){var d=false;if(a.ui.ddmanager&&!this.options.dropBehaviour){d=a.ui.ddmanager.drop(this,c)}if(this.dropped){d=this.dropped;this.dropped=false}if((this.options.revert=="invalid"&&!d)||(this.options.revert=="valid"&&d)||this.options.revert===true||(a.isFunction(this.options.revert)&&this.options.revert.call(this.element,d))){var b=this;a(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){b._trigger("stop",c);b._clear()})}else{this._trigger("stop",c);this._clear()}return false},_getHandle:function(b){var c=!this.options.handle||!a(this.options.handle,this.element).length?true:false;a(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==b.target){c=true}});return c},_createHelper:function(c){var d=this.options;var b=a.isFunction(d.helper)?a(d.helper.apply(this.element[0],[c])):(d.helper=="clone"?this.element.clone():this.element);if(!b.parents("body").length){b.appendTo((d.appendTo=="parent"?this.element[0].parentNode:d.appendTo))}if(b[0]!=this.element[0]&&!(/(fixed|absolute)/).test(b.css("position"))){b.css("position","absolute")}return b},_adjustOffsetFromHelper:function(b){if(b.left!=undefined){this.offset.click.left=b.left+this.margins.left}if(b.right!=undefined){this.offset.click.left=this.helperProportions.width-b.right+this.margins.left}if(b.top!=undefined){this.offset.click.top=b.top+this.margins.top}if(b.bottom!=undefined){this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top}},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){b.left+=this.scrollParent.scrollLeft();b.top+=this.scrollParent.scrollTop()}if((this.offsetParent[0]==document.body)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)){b={top:0,left:0}}return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var b=this.element.position();return{top:b.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:b.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else{return{top:0,left:0}}},_cacheMargins:function(){this.margins={left:(parseInt(this.element.css("marginLeft"),10)||0),top:(parseInt(this.element.css("marginTop"),10)||0)}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var e=this.options;if(e.containment=="parent"){e.containment=this.helper[0].parentNode}if(e.containment=="document"||e.containment=="window"){this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(e.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(e.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]}if(!(/^(document|window|parent)$/).test(e.containment)&&e.containment.constructor!=Array){var c=a(e.containment)[0];if(!c){return}var d=a(e.containment).offset();var b=(a(c).css("overflow")!="hidden");this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(b?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(b?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}else{if(e.containment.constructor==Array){this.containment=e.containment}}},_convertPositionTo:function(f,h){if(!h){h=this.position}var c=f=="absolute"?1:-1;var e=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=(/(html|body)/i).test(b[0].tagName);return{top:(h.top+this.offset.relative.top*c+this.offset.parent.top*c-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(g?0:b.scrollTop()))*c)),left:(h.left+this.offset.relative.left*c+this.offset.parent.left*c-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:b.scrollLeft())*c))}},_generatePosition:function(e){var h=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,i=(/(html|body)/i).test(b[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0])){this.offset.relative=this._getRelativeOffset()}var d=e.pageX;var c=e.pageY;if(this.originalPosition){if(this.containment){if(e.pageX-this.offset.click.left<this.containment[0]){d=this.containment[0]+this.offset.click.left}if(e.pageY-this.offset.click.top<this.containment[1]){c=this.containment[1]+this.offset.click.top}if(e.pageX-this.offset.click.left>this.containment[2]){d=this.containment[2]+this.offset.click.left}if(e.pageY-this.offset.click.top>this.containment[3]){c=this.containment[3]+this.offset.click.top}}if(h.grid){var g=this.originalPageY+Math.round((c-this.originalPageY)/h.grid[1])*h.grid[1];c=this.containment?(!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:(!(g-this.offset.click.top<this.containment[1])?g-h.grid[1]:g+h.grid[1])):g;var f=this.originalPageX+Math.round((d-this.originalPageX)/h.grid[0])*h.grid[0];d=this.containment?(!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:(!(f-this.offset.click.left<this.containment[0])?f-h.grid[0]:f+h.grid[0])):f}}return{top:(c-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(i?0:b.scrollTop())))),left:(d-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():i?0:b.scrollLeft())))}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");if(this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval){this.helper.remove()}this.helper=null;this.cancelHelperRemoval=false},_trigger:function(b,c,d){d=d||this._uiHash();a.ui.plugin.call(this,b,[c,d]);if(b=="drag"){this.positionAbs=this._convertPositionTo("absolute")}return a.widget.prototype._trigger.call(this,b,c,d)},plugins:{},_uiHash:function(b){return{helper:this.helper,position:this.position,absolutePosition:this.positionAbs,offset:this.positionAbs}}}));a.extend(a.ui.draggable,{version:"1.7.2",eventPrefix:"drag",defaults:{addClasses:true,appendTo:"parent",axis:false,cancel:":input,option",connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,delay:0,distance:1,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false}});a.ui.plugin.add("draggable","connectToSortable",{start:function(c,e){var d=a(this).data("draggable"),f=d.options,b=a.extend({},e,{item:d.element});d.sortables=[];a(f.connectToSortable).each(function(){var g=a.data(this,"sortable");if(g&&!g.options.disabled){d.sortables.push({instance:g,shouldRevert:g.options.revert});g._refreshItems();g._trigger("activate",c,b)}})},stop:function(c,e){var d=a(this).data("draggable"),b=a.extend({},e,{item:d.element});a.each(d.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;d.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert){this.instance.options.revert=true}this.instance._mouseStop(c);this.instance.options.helper=this.instance.options._helper;if(d.options.helper=="original"){this.instance.currentItem.css({top:"auto",left:"auto"})}}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",c,b)}})},drag:function(c,f){var e=a(this).data("draggable"),b=this;var d=function(i){var n=this.offset.click.top,m=this.offset.click.left;var g=this.positionAbs.top,k=this.positionAbs.left;var j=i.height,l=i.width;var p=i.top,h=i.left;return a.ui.isOver(g+n,k+m,p,h,j,l)};a.each(e.sortables,function(g){this.instance.positionAbs=e.positionAbs;this.instance.helperProportions=e.helperProportions;this.instance.offset.click=e.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=a(b).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return f.helper[0]};c.target=this.instance.currentItem[0];this.instance._mouseCapture(c,true);this.instance._mouseStart(c,true,true);this.instance.offset.click.top=e.offset.click.top;this.instance.offset.click.left=e.offset.click.left;this.instance.offset.parent.left-=e.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=e.offset.parent.top-this.instance.offset.parent.top;e._trigger("toSortable",c);e.dropped=this.instance.element;e.currentItem=e.element;this.instance.fromOutside=e}if(this.instance.currentItem){this.instance._mouseDrag(c)}}else{if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",c,this.instance._uiHash(this.instance));this.instance._mouseStop(c,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();if(this.instance.placeholder){this.instance.placeholder.remove()}e._trigger("fromSortable",c);e.dropped=false}}})}});a.ui.plugin.add("draggable","cursor",{start:function(c,d){var b=a("body"),e=a(this).data("draggable").options;if(b.css("cursor")){e._cursor=b.css("cursor")}b.css("cursor",e.cursor)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._cursor){a("body").css("cursor",d._cursor)}}});a.ui.plugin.add("draggable","iframeFix",{start:function(b,c){var d=a(this).data("draggable").options;a(d.iframeFix===true?"iframe":d.iframeFix).each(function(){a('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1000}).css(a(this).offset()).appendTo("body")})},stop:function(b,c){a("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});a.ui.plugin.add("draggable","opacity",{start:function(c,d){var b=a(d.helper),e=a(this).data("draggable").options;if(b.css("opacity")){e._opacity=b.css("opacity")}b.css("opacity",e.opacity)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._opacity){a(c.helper).css("opacity",d._opacity)}}});a.ui.plugin.add("draggable","scroll",{start:function(c,d){var b=a(this).data("draggable");if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){b.overflowOffset=b.scrollParent.offset()}},drag:function(d,e){var c=a(this).data("draggable"),f=c.options,b=false;if(c.scrollParent[0]!=document&&c.scrollParent[0].tagName!="HTML"){if(!f.axis||f.axis!="x"){if((c.overflowOffset.top+c.scrollParent[0].offsetHeight)-d.pageY<f.scrollSensitivity){c.scrollParent[0].scrollTop=b=c.scrollParent[0].scrollTop+f.scrollSpeed}else{if(d.pageY-c.overflowOffset.top<f.scrollSensitivity){c.scrollParent[0].scrollTop=b=c.scrollParent[0].scrollTop-f.scrollSpeed}}}if(!f.axis||f.axis!="y"){if((c.overflowOffset.left+c.scrollParent[0].offsetWidth)-d.pageX<f.scrollSensitivity){c.scrollParent[0].scrollLeft=b=c.scrollParent[0].scrollLeft+f.scrollSpeed}else{if(d.pageX-c.overflowOffset.left<f.scrollSensitivity){c.scrollParent[0].scrollLeft=b=c.scrollParent[0].scrollLeft-f.scrollSpeed}}}}else{if(!f.axis||f.axis!="x"){if(d.pageY-a(document).scrollTop()<f.scrollSensitivity){b=a(document).scrollTop(a(document).scrollTop()-f.scrollSpeed)}else{if(a(window).height()-(d.pageY-a(document).scrollTop())<f.scrollSensitivity){b=a(document).scrollTop(a(document).scrollTop()+f.scrollSpeed)}}}if(!f.axis||f.axis!="y"){if(d.pageX-a(document).scrollLeft()<f.scrollSensitivity){b=a(document).scrollLeft(a(document).scrollLeft()-f.scrollSpeed)}else{if(a(window).width()-(d.pageX-a(document).scrollLeft())<f.scrollSensitivity){b=a(document).scrollLeft(a(document).scrollLeft()+f.scrollSpeed)}}}}if(b!==false&&a.ui.ddmanager&&!f.dropBehaviour){a.ui.ddmanager.prepareOffsets(c,d)}}});a.ui.plugin.add("draggable","snap",{start:function(c,d){var b=a(this).data("draggable"),e=b.options;b.snapElements=[];a(e.snap.constructor!=String?(e.snap.items||":data(draggable)"):e.snap).each(function(){var g=a(this);var f=g.offset();if(this!=b.element[0]){b.snapElements.push({item:this,width:g.outerWidth(),height:g.outerHeight(),top:f.top,left:f.left})}})},drag:function(u,p){var g=a(this).data("draggable"),q=g.options;var y=q.snapTolerance;var x=p.offset.left,w=x+g.helperProportions.width,f=p.offset.top,e=f+g.helperProportions.height;for(var v=g.snapElements.length-1;v>=0;v--){var s=g.snapElements[v].left,n=s+g.snapElements[v].width,m=g.snapElements[v].top,A=m+g.snapElements[v].height;if(!((s-y<x&&x<n+y&&m-y<f&&f<A+y)||(s-y<x&&x<n+y&&m-y<e&&e<A+y)||(s-y<w&&w<n+y&&m-y<f&&f<A+y)||(s-y<w&&w<n+y&&m-y<e&&e<A+y))){if(g.snapElements[v].snapping){(g.options.snap.release&&g.options.snap.release.call(g.element,u,a.extend(g._uiHash(),{snapItem:g.snapElements[v].item})))}g.snapElements[v].snapping=false;continue}if(q.snapMode!="inner"){var c=Math.abs(m-e)<=y;var z=Math.abs(A-f)<=y;var j=Math.abs(s-w)<=y;var k=Math.abs(n-x)<=y;if(c){p.position.top=g._convertPositionTo("relative",{top:m-g.helperProportions.height,left:0}).top-g.margins.top}if(z){p.position.top=g._convertPositionTo("relative",{top:A,left:0}).top-g.margins.top}if(j){p.position.left=g._convertPositionTo("relative",{top:0,left:s-g.helperProportions.width}).left-g.margins.left}if(k){p.position.left=g._convertPositionTo("relative",{top:0,left:n}).left-g.margins.left}}var h=(c||z||j||k);if(q.snapMode!="outer"){var c=Math.abs(m-f)<=y;var z=Math.abs(A-e)<=y;var j=Math.abs(s-x)<=y;var k=Math.abs(n-w)<=y;if(c){p.position.top=g._convertPositionTo("relative",{top:m,left:0}).top-g.margins.top}if(z){p.position.top=g._convertPositionTo("relative",{top:A-g.helperProportions.height,left:0}).top-g.margins.top}if(j){p.position.left=g._convertPositionTo("relative",{top:0,left:s}).left-g.margins.left}if(k){p.position.left=g._convertPositionTo("relative",{top:0,left:n-g.helperProportions.width}).left-g.margins.left}}if(!g.snapElements[v].snapping&&(c||z||j||k||h)){(g.options.snap.snap&&g.options.snap.snap.call(g.element,u,a.extend(g._uiHash(),{snapItem:g.snapElements[v].item})))}g.snapElements[v].snapping=(c||z||j||k||h)}}});a.ui.plugin.add("draggable","stack",{start:function(b,c){var e=a(this).data("draggable").options;var d=a.makeArray(a(e.stack.group)).sort(function(g,f){return(parseInt(a(g).css("zIndex"),10)||e.stack.min)-(parseInt(a(f).css("zIndex"),10)||e.stack.min)});a(d).each(function(f){this.style.zIndex=e.stack.min+f});this[0].style.zIndex=e.stack.min+d.length}});a.ui.plugin.add("draggable","zIndex",{start:function(c,d){var b=a(d.helper),e=a(this).data("draggable").options;if(b.css("zIndex")){e._zIndex=b.css("zIndex")}b.css("zIndex",e.zIndex)},stop:function(b,c){var d=a(this).data("draggable").options;if(d._zIndex){a(c.helper).css("zIndex",d._zIndex)}}})})(jQuery);(function(a){a.widget("ui.droppable",{_init:function(){var c=this.options,b=c.accept;this.isover=0;this.isout=1;this.options.accept=this.options.accept&&a.isFunction(this.options.accept)?this.options.accept:function(e){return e.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};a.ui.ddmanager.droppables[this.options.scope]=a.ui.ddmanager.droppables[this.options.scope]||[];a.ui.ddmanager.droppables[this.options.scope].push(this);(this.options.addClasses&&this.element.addClass("ui-droppable"))},destroy:function(){var b=a.ui.ddmanager.droppables[this.options.scope];for(var c=0;c<b.length;c++){if(b[c]==this){b.splice(c,1)}}this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable")},_setData:function(b,c){if(b=="accept"){this.options.accept=c&&a.isFunction(c)?c:function(e){return e.is(c)}}else{a.widget.prototype._setData.apply(this,arguments)}},_activate:function(c){var b=a.ui.ddmanager.current;if(this.options.activeClass){this.element.addClass(this.options.activeClass)}(b&&this._trigger("activate",c,this.ui(b)))},_deactivate:function(c){var b=a.ui.ddmanager.current;if(this.options.activeClass){this.element.removeClass(this.options.activeClass)}(b&&this._trigger("deactivate",c,this.ui(b)))},_over:function(c){var b=a.ui.ddmanager.current;if(!b||(b.currentItem||b.element)[0]==this.element[0]){return}if(this.options.accept.call(this.element[0],(b.currentItem||b.element))){if(this.options.hoverClass){this.element.addClass(this.options.hoverClass)}this._trigger("over",c,this.ui(b))}},_out:function(c){var b=a.ui.ddmanager.current;if(!b||(b.currentItem||b.element)[0]==this.element[0]){return}if(this.options.accept.call(this.element[0],(b.currentItem||b.element))){if(this.options.hoverClass){this.element.removeClass(this.options.hoverClass)}this._trigger("out",c,this.ui(b))}},_drop:function(c,d){var b=d||a.ui.ddmanager.current;if(!b||(b.currentItem||b.element)[0]==this.element[0]){return false}var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var f=a.data(this,"droppable");if(f.options.greedy&&a.ui.intersect(b,a.extend(f,{offset:f.element.offset()}),f.options.tolerance)){e=true;return false}});if(e){return false}if(this.options.accept.call(this.element[0],(b.currentItem||b.element))){if(this.options.activeClass){this.element.removeClass(this.options.activeClass)}if(this.options.hoverClass){this.element.removeClass(this.options.hoverClass)}this._trigger("drop",c,this.ui(b));return this.element}return false},ui:function(b){return{draggable:(b.currentItem||b.element),helper:b.helper,position:b.position,absolutePosition:b.positionAbs,offset:b.positionAbs}}});a.extend(a.ui.droppable,{version:"1.7.2",eventPrefix:"drop",defaults:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"}});a.ui.intersect=function(q,j,o){if(!j.offset){return false}var e=(q.positionAbs||q.position.absolute).left,d=e+q.helperProportions.width,n=(q.positionAbs||q.position.absolute).top,m=n+q.helperProportions.height;var g=j.offset.left,c=g+j.proportions.width,p=j.offset.top,k=p+j.proportions.height;switch(o){case"fit":return(g<e&&d<c&&p<n&&m<k);break;case"intersect":return(g<e+(q.helperProportions.width/2)&&d-(q.helperProportions.width/2)<c&&p<n+(q.helperProportions.height/2)&&m-(q.helperProportions.height/2)<k);break;case"pointer":var h=((q.positionAbs||q.position.absolute).left+(q.clickOffset||q.offset.click).left),i=((q.positionAbs||q.position.absolute).top+(q.clickOffset||q.offset.click).top),f=a.ui.isOver(i,h,p,g,j.proportions.height,j.proportions.width);return f;break;case"touch":return((n>=p&&n<=k)||(m>=p&&m<=k)||(n<p&&m>k))&&((e>=g&&e<=c)||(d>=g&&d<=c)||(e<g&&d>c));break;default:return false;break}};a.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(e,g){var b=a.ui.ddmanager.droppables[e.options.scope];var f=g?g.type:null;var h=(e.currentItem||e.element).find(":data(droppable)").andSelf();droppablesLoop:for(var d=0;d<b.length;d++){if(b[d].options.disabled||(e&&!b[d].options.accept.call(b[d].element[0],(e.currentItem||e.element)))){continue}for(var c=0;c<h.length;c++){if(h[c]==b[d].element[0]){b[d].proportions.height=0;continue droppablesLoop}}b[d].visible=b[d].element.css("display")!="none";if(!b[d].visible){continue}b[d].offset=b[d].element.offset();b[d].proportions={width:b[d].element[0].offsetWidth,height:b[d].element[0].offsetHeight};if(f=="mousedown"){b[d]._activate.call(b[d],g)}}},drop:function(b,c){var d=false;a.each(a.ui.ddmanager.droppables[b.options.scope],function(){if(!this.options){return}if(!this.options.disabled&&this.visible&&a.ui.intersect(b,this,this.options.tolerance)){d=this._drop.call(this,c)}if(!this.options.disabled&&this.visible&&this.options.accept.call(this.element[0],(b.currentItem||b.element))){this.isout=1;this.isover=0;this._deactivate.call(this,c)}});return d},drag:function(b,c){if(b.options.refreshPositions){a.ui.ddmanager.prepareOffsets(b,c)}a.each(a.ui.ddmanager.droppables[b.options.scope],function(){if(this.options.disabled||this.greedyChild||!this.visible){return}var e=a.ui.intersect(b,this,this.options.tolerance);var g=!e&&this.isover==1?"isout":(e&&this.isover==0?"isover":null);if(!g){return}var f;if(this.options.greedy){var d=this.element.parents(":data(droppable):eq(0)");if(d.length){f=a.data(d[0],"droppable");f.greedyChild=(g=="isover"?1:0)}}if(f&&g=="isover"){f.isover=0;f.isout=1;f._out.call(f,c)}this[g]=1;this[g=="isout"?"isover":"isout"]=0;this[g=="isover"?"_over":"_out"].call(this,c);if(f&&g=="isout"){f.isout=0;f.isover=1;f._over.call(f,c)}})}}})(jQuery);(function(c){c.widget("ui.resizable",c.extend({},c.ui.mouse,{_init:function(){var e=this,j=this.options;this.element.addClass("ui-resizable");c.extend(this,{_aspectRatio:!!(j.aspectRatio),aspectRatio:j.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:j.helper||j.ghost||j.animate?j.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){if(/relative/.test(this.element.css("position"))&&c.browser.opera){this.element.css({position:"relative",top:"auto",left:"auto"})}this.element.wrap(c('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=j.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var k=this.handles.split(",");this.handles={};for(var f=0;f<k.length;f++){var h=c.trim(k[f]),d="ui-resizable-"+h;var g=c('<div class="ui-resizable-handle '+d+'"></div>');if(/sw|se|ne|nw/.test(h)){g.css({zIndex:++j.zIndex})}if("se"==h){g.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[h]=".ui-resizable-"+h;this.element.append(g)}}this._renderAxis=function(p){p=p||this.element;for(var m in this.handles){if(this.handles[m].constructor==String){this.handles[m]=c(this.handles[m],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var n=c(this.handles[m],this.element),o=0;o=/sw|ne|nw|se|n|s/.test(m)?n.outerHeight():n.outerWidth();var l=["padding",/ne|nw|n/.test(m)?"Top":/se|sw|s/.test(m)?"Bottom":/^e$/.test(m)?"Right":"Left"].join("");p.css(l,o);this._proportionallyResize()}if(!c(this.handles[m]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!e.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}e.axis=i&&i[1]?i[1]:"se"}});if(j.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){c(this).removeClass("ui-resizable-autohide");e._handles.show()},function(){if(!e.resizing){c(this).addClass("ui-resizable-autohide");e._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var d=function(f){c(f).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){d(this.element);var e=this.element;e.parent().append(this.originalElement.css({position:e.css("position"),width:e.outerWidth(),height:e.outerHeight(),top:e.css("top"),left:e.css("left")})).end().remove()}this.originalElement.css("resize",this.originalResizeStyle);d(this.originalElement)},_mouseCapture:function(e){var f=false;for(var d in this.handles){if(c(this.handles[d])[0]==e.target){f=true}}return this.options.disabled||!!f},_mouseStart:function(f){var i=this.options,e=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(d.is(".ui-draggable")||(/absolute/).test(d.css("position"))){d.css({position:"absolute",top:e.top,left:e.left})}if(c.browser.opera&&(/relative/).test(d.css("position"))){d.css({position:"relative",top:"auto",left:"auto"})}this._renderProxy();var j=b(this.helper.css("left")),g=b(this.helper.css("top"));if(i.containment){j+=c(i.containment).scrollLeft()||0;g+=c(i.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:j,top:g};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:j,top:g};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:f.pageX,top:f.pageY};this.aspectRatio=(typeof i.aspectRatio=="number")?i.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var h=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",h=="auto"?this.axis+"-resize":h);d.addClass("ui-resizable-resizing");this._propagate("start",f);return true},_mouseDrag:function(d){var g=this.helper,f=this.options,l={},p=this,i=this.originalMousePosition,m=this.axis;var q=(d.pageX-i.left)||0,n=(d.pageY-i.top)||0;var h=this._change[m];if(!h){return false}var k=h.apply(this,[d,q,n]),j=c.browser.msie&&c.browser.version<7,e=this.sizeDiff;if(this._aspectRatio||d.shiftKey){k=this._updateRatio(k,d)}k=this._respectSize(k,d);this._propagate("resize",d);g.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(k);this._trigger("resize",d,this.ui());return false},_mouseStop:function(g){this.resizing=false;var h=this.options,l=this;if(this._helper){var f=this._proportionallyResizeElements,d=f.length&&(/textarea/i).test(f[0].nodeName),e=d&&c.ui.hasScroll(f[0],"left")?0:l.sizeDiff.height,j=d?0:l.sizeDiff.width;var m={width:(l.size.width-j),height:(l.size.height-e)},i=(parseInt(l.element.css("left"),10)+(l.position.left-l.originalPosition.left))||null,k=(parseInt(l.element.css("top"),10)+(l.position.top-l.originalPosition.top))||null;if(!h.animate){this.element.css(c.extend(m,{top:k,left:i}))}l.helper.height(l.size.height);l.helper.width(l.size.width);if(this._helper&&!h.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",g);if(this._helper){this.helper.remove()}return false},_updateCache:function(d){var e=this.options;this.offset=this.helper.offset();if(a(d.left)){this.position.left=d.left}if(a(d.top)){this.position.top=d.top}if(a(d.height)){this.size.height=d.height}if(a(d.width)){this.size.width=d.width}},_updateRatio:function(g,f){var h=this.options,i=this.position,e=this.size,d=this.axis;if(g.height){g.width=(e.height*this.aspectRatio)}else{if(g.width){g.height=(e.width/this.aspectRatio)}}if(d=="sw"){g.left=i.left+(e.width-g.width);g.top=null}if(d=="nw"){g.top=i.top+(e.height-g.height);g.left=i.left+(e.width-g.width)}return g},_respectSize:function(k,f){var i=this.helper,h=this.options,q=this._aspectRatio||f.shiftKey,p=this.axis,s=a(k.width)&&h.maxWidth&&(h.maxWidth<k.width),l=a(k.height)&&h.maxHeight&&(h.maxHeight<k.height),g=a(k.width)&&h.minWidth&&(h.minWidth>k.width),r=a(k.height)&&h.minHeight&&(h.minHeight>k.height);if(g){k.width=h.minWidth}if(r){k.height=h.minHeight}if(s){k.width=h.maxWidth}if(l){k.height=h.maxHeight}var e=this.originalPosition.left+this.originalSize.width,n=this.position.top+this.size.height;var j=/sw|nw|w/.test(p),d=/nw|ne|n/.test(p);if(g&&j){k.left=e-h.minWidth}if(s&&j){k.left=e-h.maxWidth}if(r&&d){k.top=n-h.minHeight}if(l&&d){k.top=n-h.maxHeight}var m=!k.width&&!k.height;if(m&&!k.left&&k.top){k.top=null}else{if(m&&!k.top&&k.left){k.left=null}}return k},_proportionallyResize:function(){var j=this.options;if(!this._proportionallyResizeElements.length){return}var f=this.helper||this.element;for(var e=0;e<this._proportionallyResizeElements.length;e++){var g=this._proportionallyResizeElements[e];if(!this.borderDif){var d=[g.css("borderTopWidth"),g.css("borderRightWidth"),g.css("borderBottomWidth"),g.css("borderLeftWidth")],h=[g.css("paddingTop"),g.css("paddingRight"),g.css("paddingBottom"),g.css("paddingLeft")];this.borderDif=c.map(d,function(k,m){var l=parseInt(k,10)||0,n=parseInt(h[m],10)||0;return l+n})}if(c.browser.msie&&!(!(c(f).is(":hidden")||c(f).parents(":hidden").length))){continue}g.css({height:(f.height()-this.borderDif[0]-this.borderDif[2])||0,width:(f.width()-this.borderDif[1]-this.borderDif[3])||0})}},_renderProxy:function(){var e=this.element,h=this.options;this.elementOffset=e.offset();if(this._helper){this.helper=this.helper||c('<div style="overflow:hidden;"></div>');var d=c.browser.msie&&c.browser.version<7,f=(d?1:0),g=(d?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+g,height:this.element.outerHeight()+g,position:"absolute",left:this.elementOffset.left-f+"px",top:this.elementOffset.top-f+"px",zIndex:++h.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(f,e,d){return{width:this.originalSize.width+e}},w:function(g,e,d){var i=this.options,f=this.originalSize,h=this.originalPosition;return{left:h.left+e,width:f.width-e}},n:function(g,e,d){var i=this.options,f=this.originalSize,h=this.originalPosition;return{top:h.top+d,height:f.height-d}},s:function(f,e,d){return{height:this.originalSize.height+d}},se:function(f,e,d){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[f,e,d]))},sw:function(f,e,d){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[f,e,d]))},ne:function(f,e,d){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[f,e,d]))},nw:function(f,e,d){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[f,e,d]))}},_propagate:function(e,d){c.ui.plugin.call(this,e,[d,this.ui()]);(e!="resize"&&this._trigger(e,d,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}));c.extend(c.ui.resizable,{version:"1.7.2",eventPrefix:"resize",defaults:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,cancel:":input,option",containment:false,delay:0,distance:1,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000}});c.ui.plugin.add("resizable","alsoResize",{start:function(e,f){var d=c(this).data("resizable"),g=d.options;_store=function(h){c(h).each(function(){c(this).data("resizable-alsoresize",{width:parseInt(c(this).width(),10),height:parseInt(c(this).height(),10),left:parseInt(c(this).css("left"),10),top:parseInt(c(this).css("top"),10)})})};if(typeof(g.alsoResize)=="object"&&!g.alsoResize.parentNode){if(g.alsoResize.length){g.alsoResize=g.alsoResize[0];_store(g.alsoResize)}else{c.each(g.alsoResize,function(h,i){_store(h)})}}else{_store(g.alsoResize)}},resize:function(f,h){var e=c(this).data("resizable"),i=e.options,g=e.originalSize,k=e.originalPosition;var j={height:(e.size.height-g.height)||0,width:(e.size.width-g.width)||0,top:(e.position.top-k.top)||0,left:(e.position.left-k.left)||0},d=function(l,m){c(l).each(function(){var p=c(this),q=c(this).data("resizable-alsoresize"),o={},n=m&&m.length?m:["width","height","top","left"];c.each(n||["width","height","top","left"],function(r,u){var s=(q[u]||0)+(j[u]||0);if(s&&s>=0){o[u]=s||null}});if(/relative/.test(p.css("position"))&&c.browser.opera){e._revertToRelativePosition=true;p.css({position:"absolute",top:"auto",left:"auto"})}p.css(o)})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.nodeType){c.each(i.alsoResize,function(l,m){d(l,m)})}else{d(i.alsoResize)}},stop:function(e,f){var d=c(this).data("resizable");if(d._revertToRelativePosition&&c.browser.opera){d._revertToRelativePosition=false;el.css({position:"relative"})}c(this).removeData("resizable-alsoresize-start")}});c.ui.plugin.add("resizable","animate",{stop:function(h,m){var n=c(this).data("resizable"),i=n.options;var g=n._proportionallyResizeElements,d=g.length&&(/textarea/i).test(g[0].nodeName),e=d&&c.ui.hasScroll(g[0],"left")?0:n.sizeDiff.height,k=d?0:n.sizeDiff.width;var f={width:(n.size.width-k),height:(n.size.height-e)},j=(parseInt(n.element.css("left"),10)+(n.position.left-n.originalPosition.left))||null,l=(parseInt(n.element.css("top"),10)+(n.position.top-n.originalPosition.top))||null;n.element.animate(c.extend(f,l&&j?{top:l,left:j}:{}),{duration:i.animateDuration,easing:i.animateEasing,step:function(){var o={width:parseInt(n.element.css("width"),10),height:parseInt(n.element.css("height"),10),top:parseInt(n.element.css("top"),10),left:parseInt(n.element.css("left"),10)};if(g&&g.length){c(g[0]).css({width:o.width,height:o.height})}n._updateCache(o);n._propagate("resize",h)}})}});c.ui.plugin.add("resizable","containment",{start:function(e,q){var s=c(this).data("resizable"),i=s.options,k=s.element;var f=i.containment,j=(f instanceof c)?f.get(0):(/parent/.test(f))?k.parent().get(0):f;if(!j){return}s.containerElement=c(j);if(/document/.test(f)||f==document){s.containerOffset={left:0,top:0};s.containerPosition={left:0,top:0};s.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var m=c(j),h=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){h[p]=b(m.css("padding"+o))});s.containerOffset=m.offset();s.containerPosition=m.position();s.containerSize={height:(m.innerHeight()-h[3]),width:(m.innerWidth()-h[1])};var n=s.containerOffset,d=s.containerSize.height,l=s.containerSize.width,g=(c.ui.hasScroll(j,"left")?j.scrollWidth:l),r=(c.ui.hasScroll(j)?j.scrollHeight:d);s.parentData={element:j,left:n.left,top:n.top,width:g,height:r}}},resize:function(f,p){var s=c(this).data("resizable"),h=s.options,e=s.containerSize,n=s.containerOffset,l=s.size,m=s.position,q=s._aspectRatio||f.shiftKey,d={top:0,left:0},g=s.containerElement;if(g[0]!=document&&(/static/).test(g.css("position"))){d=n}if(m.left<(s._helper?n.left:0)){s.size.width=s.size.width+(s._helper?(s.position.left-n.left):(s.position.left-d.left));if(q){s.size.height=s.size.width/h.aspectRatio}s.position.left=h.helper?n.left:0}if(m.top<(s._helper?n.top:0)){s.size.height=s.size.height+(s._helper?(s.position.top-n.top):s.position.top);if(q){s.size.width=s.size.height*h.aspectRatio}s.position.top=s._helper?n.top:0}s.offset.left=s.parentData.left+s.position.left;s.offset.top=s.parentData.top+s.position.top;var k=Math.abs((s._helper?s.offset.left-d.left:(s.offset.left-d.left))+s.sizeDiff.width),r=Math.abs((s._helper?s.offset.top-d.top:(s.offset.top-n.top))+s.sizeDiff.height);var j=s.containerElement.get(0)==s.element.parent().get(0),i=/relative|absolute/.test(s.containerElement.css("position"));if(j&&i){k-=s.parentData.left}if(k+s.size.width>=s.parentData.width){s.size.width=s.parentData.width-k;if(q){s.size.height=s.size.width/s.aspectRatio}}if(r+s.size.height>=s.parentData.height){s.size.height=s.parentData.height-r;if(q){s.size.width=s.size.height*s.aspectRatio}}},stop:function(e,m){var p=c(this).data("resizable"),f=p.options,k=p.position,l=p.containerOffset,d=p.containerPosition,g=p.containerElement;var i=c(p.helper),q=i.offset(),n=i.outerWidth()-p.sizeDiff.width,j=i.outerHeight()-p.sizeDiff.height;if(p._helper&&!f.animate&&(/relative/).test(g.css("position"))){c(this).css({left:q.left-d.left-l.left,width:n,height:j})}if(p._helper&&!f.animate&&(/static/).test(g.css("position"))){c(this).css({left:q.left-d.left-l.left,width:n,height:j})}}});c.ui.plugin.add("resizable","ghost",{start:function(f,g){var d=c(this).data("resizable"),h=d.options,e=d.size;d.ghost=d.originalElement.clone();d.ghost.css({opacity:0.25,display:"block",position:"relative",height:e.height,width:e.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof h.ghost=="string"?h.ghost:"");d.ghost.appendTo(d.helper)},resize:function(e,f){var d=c(this).data("resizable"),g=d.options;if(d.ghost){d.ghost.css({position:"relative",height:d.size.height,width:d.size.width})}},stop:function(e,f){var d=c(this).data("resizable"),g=d.options;if(d.ghost&&d.helper){d.helper.get(0).removeChild(d.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(d,l){var n=c(this).data("resizable"),g=n.options,j=n.size,h=n.originalSize,i=n.originalPosition,m=n.axis,k=g._aspectRatio||d.shiftKey;g.grid=typeof g.grid=="number"?[g.grid,g.grid]:g.grid;var f=Math.round((j.width-h.width)/(g.grid[0]||1))*(g.grid[0]||1),e=Math.round((j.height-h.height)/(g.grid[1]||1))*(g.grid[1]||1);if(/^(se|s|e)$/.test(m)){n.size.width=h.width+f;n.size.height=h.height+e}else{if(/^(ne)$/.test(m)){n.size.width=h.width+f;n.size.height=h.height+e;n.position.top=i.top-e}else{if(/^(sw)$/.test(m)){n.size.width=h.width+f;n.size.height=h.height+e;n.position.left=i.left-f}else{n.size.width=h.width+f;n.size.height=h.height+e;n.position.top=i.top-e;n.position.left=i.left-f}}}}});var b=function(d){return parseInt(d,10)||0};var a=function(d){return !isNaN(parseInt(d,10))}})(jQuery);(function(a){a.widget("ui.selectable",a.extend({},a.ui.mouse,{_init:function(){var b=this;this.element.addClass("ui-selectable");this.dragged=false;var c;this.refresh=function(){c=a(b.options.filter,b.element[0]);c.each(function(){var d=a(this);var e=d.offset();a.data(this,"selectable-item",{element:this,$element:d,left:e.left,top:e.top,right:e.left+d.outerWidth(),bottom:e.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=c.addClass("ui-selectee");this._mouseInit();this.helper=a(document.createElement("div")).css({border:"1px dotted black"}).addClass("ui-selectable-helper")},destroy:function(){this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy()},_mouseStart:function(d){var b=this;this.opos=[d.pageX,d.pageY];if(this.options.disabled){return}var c=this.options;this.selectees=a(c.filter,this.element[0]);this._trigger("start",d);a(c.appendTo).append(this.helper);this.helper.css({"z-index":100,position:"absolute",left:d.clientX,top:d.clientY,width:0,height:0});if(c.autoRefresh){this.refresh()}this.selectees.filter(".ui-selected").each(function(){var e=a.data(this,"selectable-item");e.startselected=true;if(!d.metaKey){e.$element.removeClass("ui-selected");e.selected=false;e.$element.addClass("ui-unselecting");e.unselecting=true;b._trigger("unselecting",d,{unselecting:e.element})}});a(d.target).parents().andSelf().each(function(){var e=a.data(this,"selectable-item");if(e){e.$element.removeClass("ui-unselecting").addClass("ui-selecting");e.unselecting=false;e.selecting=true;e.selected=true;b._trigger("selecting",d,{selecting:e.element});return false}})},_mouseDrag:function(i){var c=this;this.dragged=true;if(this.options.disabled){return}var e=this.options;var d=this.opos[0],h=this.opos[1],b=i.pageX,g=i.pageY;if(d>b){var f=b;b=d;d=f}if(h>g){var f=g;g=h;h=f}this.helper.css({left:d,top:h,width:b-d,height:g-h});this.selectees.each(function(){var j=a.data(this,"selectable-item");if(!j||j.element==c.element[0]){return}var k=false;if(e.tolerance=="touch"){k=(!(j.left>b||j.right<d||j.top>g||j.bottom<h))}else{if(e.tolerance=="fit"){k=(j.left>d&&j.right<b&&j.top>h&&j.bottom<g)}}if(k){if(j.selected){j.$element.removeClass("ui-selected");j.selected=false}if(j.unselecting){j.$element.removeClass("ui-unselecting");j.unselecting=false}if(!j.selecting){j.$element.addClass("ui-selecting");j.selecting=true;c._trigger("selecting",i,{selecting:j.element})}}else{if(j.selecting){if(i.metaKey&&j.startselected){j.$element.removeClass("ui-selecting");j.selecting=false;j.$element.addClass("ui-selected");j.selected=true}else{j.$element.removeClass("ui-selecting");j.selecting=false;if(j.startselected){j.$element.addClass("ui-unselecting");j.unselecting=true}c._trigger("unselecting",i,{unselecting:j.element})}}if(j.selected){if(!i.metaKey&&!j.startselected){j.$element.removeClass("ui-selected");j.selected=false;j.$element.addClass("ui-unselecting");j.unselecting=true;c._trigger("unselecting",i,{unselecting:j.element})}}}});return false},_mouseStop:function(d){var b=this;this.dragged=false;var c=this.options;a(".ui-unselecting",this.element[0]).each(function(){var e=a.data(this,"selectable-item");e.$element.removeClass("ui-unselecting");e.unselecting=false;e.startselected=false;b._trigger("unselected",d,{unselected:e.element})});a(".ui-selecting",this.element[0]).each(function(){var e=a.data(this,"selectable-item");e.$element.removeClass("ui-selecting").addClass("ui-selected");e.selecting=false;e.selected=true;e.startselected=true;b._trigger("selected",d,{selected:e.element})});this._trigger("stop",d);this.helper.remove();return false}}));a.extend(a.ui.selectable,{version:"1.7.2",defaults:{appendTo:"body",autoRefresh:true,cancel:":input,option",delay:0,distance:0,filter:"*",tolerance:"touch"}})})(jQuery);(function(a){a.widget("ui.sortable",a.extend({},a.ui.mouse,{_init:function(){var b=this.options;this.containerCache={};this.element.addClass("ui-sortable");this.refresh();this.floating=this.items.length?(/left|right/).test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var b=this.items.length-1;b>=0;b--){this.items[b].item.removeData("sortable-item")}},_mouseCapture:function(e,f){if(this.reverting){return false}if(this.options.disabled||this.options.type=="static"){return false}this._refreshItems(e);var d=null,c=this,b=a(e.target).parents().each(function(){if(a.data(this,"sortable-item")==c){d=a(this);return false}});if(a.data(e.target,"sortable-item")==c){d=a(e.target)}if(!d){return false}if(this.options.handle&&!f){var g=false;a(this.options.handle,d).find("*").andSelf().each(function(){if(this==e.target){g=true}});if(!g){return false}}this.currentItem=d;this._removeCurrentsFromItems();return true},_mouseStart:function(e,f,b){var g=this.options,c=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(e);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");a.extend(this.offset,{click:{left:e.pageX-this.offset.left,top:e.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(e);this.originalPageX=e.pageX;this.originalPageY=e.pageY;if(g.cursorAt){this._adjustOffsetFromHelper(g.cursorAt)}this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};if(this.helper[0]!=this.currentItem[0]){this.currentItem.hide()}this._createPlaceholder();if(g.containment){this._setContainment()}if(g.cursor){if(a("body").css("cursor")){this._storedCursor=a("body").css("cursor")}a("body").css("cursor",g.cursor)}if(g.opacity){if(this.helper.css("opacity")){this._storedOpacity=this.helper.css("opacity")}this.helper.css("opacity",g.opacity)}if(g.zIndex){if(this.helper.css("zIndex")){this._storedZIndex=this.helper.css("zIndex")}this.helper.css("zIndex",g.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){this.overflowOffset=this.scrollParent.offset()}this._trigger("start",e,this._uiHash());if(!this._preserveHelperProportions){this._cacheHelperProportions()}if(!b){for(var d=this.containers.length-1;d>=0;d--){this.containers[d]._trigger("activate",e,c._uiHash(this))}}if(a.ui.ddmanager){a.ui.ddmanager.current=this}if(a.ui.ddmanager&&!g.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,e)}this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(e);return true},_mouseDrag:function(f){this.position=this._generatePosition(f);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs){this.lastPositionAbs=this.positionAbs}if(this.options.scroll){var g=this.options,b=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if((this.overflowOffset.top+this.scrollParent[0].offsetHeight)-f.pageY<g.scrollSensitivity){this.scrollParent[0].scrollTop=b=this.scrollParent[0].scrollTop+g.scrollSpeed}else{if(f.pageY-this.overflowOffset.top<g.scrollSensitivity){this.scrollParent[0].scrollTop=b=this.scrollParent[0].scrollTop-g.scrollSpeed}}if((this.overflowOffset.left+this.scrollParent[0].offsetWidth)-f.pageX<g.scrollSensitivity){this.scrollParent[0].scrollLeft=b=this.scrollParent[0].scrollLeft+g.scrollSpeed}else{if(f.pageX-this.overflowOffset.left<g.scrollSensitivity){this.scrollParent[0].scrollLeft=b=this.scrollParent[0].scrollLeft-g.scrollSpeed}}}else{if(f.pageY-a(document).scrollTop()<g.scrollSensitivity){b=a(document).scrollTop(a(document).scrollTop()-g.scrollSpeed)}else{if(a(window).height()-(f.pageY-a(document).scrollTop())<g.scrollSensitivity){b=a(document).scrollTop(a(document).scrollTop()+g.scrollSpeed)}}if(f.pageX-a(document).scrollLeft()<g.scrollSensitivity){b=a(document).scrollLeft(a(document).scrollLeft()-g.scrollSpeed)}else{if(a(window).width()-(f.pageX-a(document).scrollLeft())<g.scrollSensitivity){b=a(document).scrollLeft(a(document).scrollLeft()+g.scrollSpeed)}}}if(b!==false&&a.ui.ddmanager&&!g.dropBehaviour){a.ui.ddmanager.prepareOffsets(this,f)}}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y"){this.helper[0].style.left=this.position.left+"px"}if(!this.options.axis||this.options.axis!="x"){this.helper[0].style.top=this.position.top+"px"}for(var d=this.items.length-1;d>=0;d--){var e=this.items[d],c=e.item[0],h=this._intersectsWithPointer(e);if(!h){continue}if(c!=this.currentItem[0]&&this.placeholder[h==1?"next":"prev"]()[0]!=c&&!a.ui.contains(this.placeholder[0],c)&&(this.options.type=="semi-dynamic"?!a.ui.contains(this.element[0],c):true)){this.direction=h==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(e)){this._rearrange(f,e)}else{break}this._trigger("change",f,this._uiHash());break}}this._contactContainers(f);if(a.ui.ddmanager){a.ui.ddmanager.drag(this,f)}this._trigger("sort",f,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(c,d){if(!c){return}if(a.ui.ddmanager&&!this.options.dropBehaviour){a.ui.ddmanager.drop(this,c)}if(this.options.revert){var b=this;var e=b.placeholder.offset();b.reverting=true;a(this.helper).animate({left:e.left-this.offset.parent.left-b.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:e.top-this.offset.parent.top-b.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){b._clear(c)})}else{this._clear(c,d)}return false},cancel:function(){var b=this;if(this.dragging){this._mouseUp();if(this.options.helper=="original"){this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else{this.currentItem.show()}for(var c=this.containers.length-1;c>=0;c--){this.containers[c]._trigger("deactivate",null,b._uiHash(this));if(this.containers[c].containerCache.over){this.containers[c]._trigger("out",null,b._uiHash(this));this.containers[c].containerCache.over=0}}}if(this.placeholder[0].parentNode){this.placeholder[0].parentNode.removeChild(this.placeholder[0])}if(this.options.helper!="original"&&this.helper&&this.helper[0].parentNode){this.helper.remove()}a.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});if(this.domPosition.prev){a(this.domPosition.prev).after(this.currentItem)}else{a(this.domPosition.parent).prepend(this.currentItem)}return true},serialize:function(d){var b=this._getItemsAsjQuery(d&&d.connected);var c=[];d=d||{};a(b).each(function(){var e=(a(d.item||this).attr(d.attribute||"id")||"").match(d.expression||(/(.+)[-=_](.+)/));if(e){c.push((d.key||e[1]+"[]")+"="+(d.key&&d.expression?e[1]:e[2]))}});return c.join("&")},toArray:function(d){var b=this._getItemsAsjQuery(d&&d.connected);var c=[];d=d||{};b.each(function(){c.push(a(d.item||this).attr(d.attribute||"id")||"")});return c},_intersectsWith:function(m){var e=this.positionAbs.left,d=e+this.helperProportions.width,k=this.positionAbs.top,j=k+this.helperProportions.height;var f=m.left,c=f+m.width,n=m.top,i=n+m.height;var o=this.offset.click.top,h=this.offset.click.left;var g=(k+o)>n&&(k+o)<i&&(e+h)>f&&(e+h)<c;if(this.options.tolerance=="pointer"||this.options.forcePointerForContainers||(this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>m[this.floating?"width":"height"])){return g}else{return(f<e+(this.helperProportions.width/2)&&d-(this.helperProportions.width/2)<c&&n<k+(this.helperProportions.height/2)&&j-(this.helperProportions.height/2)<i)}},_intersectsWithPointer:function(d){var e=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,d.top,d.height),c=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,d.left,d.width),g=e&&c,b=this._getDragVerticalDirection(),f=this._getDragHorizontalDirection();if(!g){return false}return this.floating?(((f&&f=="right")||b=="down")?2:1):(b&&(b=="down"?2:1))},_intersectsWithSides:function(e){var c=a.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,e.top+(e.height/2),e.height),d=a.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,e.left+(e.width/2),e.width),b=this._getDragVerticalDirection(),f=this._getDragHorizontalDirection();if(this.floating&&f){return((f=="right"&&d)||(f=="left"&&!d))}else{return b&&((b=="down"&&c)||(b=="up"&&!c))}},_getDragVerticalDirection:function(){var b=this.positionAbs.top-this.lastPositionAbs.top;return b!=0&&(b>0?"down":"up")},_getDragHorizontalDirection:function(){var b=this.positionAbs.left-this.lastPositionAbs.left;return b!=0&&(b>0?"right":"left")},refresh:function(b){this._refreshItems(b);this.refreshPositions()},_connectWith:function(){var b=this.options;return b.connectWith.constructor==String?[b.connectWith]:b.connectWith},_getItemsAsjQuery:function(b){var l=this;var g=[];var e=[];var h=this._connectWith();if(h&&b){for(var d=h.length-1;d>=0;d--){var k=a(h[d]);for(var c=k.length-1;c>=0;c--){var f=a.data(k[c],"sortable");if(f&&f!=this&&!f.options.disabled){e.push([a.isFunction(f.options.items)?f.options.items.call(f.element):a(f.options.items,f.element).not(".ui-sortable-helper"),f])}}}}e.push([a.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):a(this.options.items,this.element).not(".ui-sortable-helper"),this]);for(var d=e.length-1;d>=0;d--){e[d][0].each(function(){g.push(this)})}return a(g)},_removeCurrentsFromItems:function(){var d=this.currentItem.find(":data(sortable-item)");for(var c=0;c<this.items.length;c++){for(var b=0;b<d.length;b++){if(d[b]==this.items[c].item[0]){this.items.splice(c,1)}}}},_refreshItems:function(b){this.items=[];this.containers=[this];var h=this.items;var p=this;var f=[[a.isFunction(this.options.items)?this.options.items.call(this.element[0],b,{item:this.currentItem}):a(this.options.items,this.element),this]];var l=this._connectWith();if(l){for(var e=l.length-1;e>=0;e--){var m=a(l[e]);for(var d=m.length-1;d>=0;d--){var g=a.data(m[d],"sortable");if(g&&g!=this&&!g.options.disabled){f.push([a.isFunction(g.options.items)?g.options.items.call(g.element[0],b,{item:this.currentItem}):a(g.options.items,g.element),g]);this.containers.push(g)}}}}for(var e=f.length-1;e>=0;e--){var k=f[e][1];var c=f[e][0];for(var d=0,n=c.length;d<n;d++){var o=a(c[d]);o.data("sortable-item",k);h.push({item:o,instance:k,width:0,height:0,left:0,top:0})}}},refreshPositions:function(b){if(this.offsetParent&&this.helper){this.offset.parent=this._getParentOffset()}for(var d=this.items.length-1;d>=0;d--){var e=this.items[d];if(e.instance!=this.currentContainer&&this.currentContainer&&e.item[0]!=this.currentItem[0]){continue}var c=this.options.toleranceElement?a(this.options.toleranceElement,e.item):e.item;if(!b){e.width=c.outerWidth();e.height=c.outerHeight()}var f=c.offset();e.left=f.left;e.top=f.top}if(this.options.custom&&this.options.custom.refreshContainers){this.options.custom.refreshContainers.call(this)}else{for(var d=this.containers.length-1;d>=0;d--){var f=this.containers[d].element.offset();this.containers[d].containerCache.left=f.left;this.containers[d].containerCache.top=f.top;this.containers[d].containerCache.width=this.containers[d].element.outerWidth();this.containers[d].containerCache.height=this.containers[d].element.outerHeight()}}},_createPlaceholder:function(d){var b=d||this,e=b.options;if(!e.placeholder||e.placeholder.constructor==String){var c=e.placeholder;e.placeholder={element:function(){var f=a(document.createElement(b.currentItem[0].nodeName)).addClass(c||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!c){f.style.visibility="hidden"}return f},update:function(f,g){if(c&&!e.forcePlaceholderSize){return}if(!g.height()){g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10))}if(!g.width()){g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=a(e.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);e.placeholder.update(b,b.placeholder)},_contactContainers:function(d){for(var c=this.containers.length-1;c>=0;c--){if(this._intersectsWith(this.containers[c].containerCache)){if(!this.containers[c].containerCache.over){if(this.currentContainer!=this.containers[c]){var h=10000;var g=null;var e=this.positionAbs[this.containers[c].floating?"left":"top"];for(var b=this.items.length-1;b>=0;b--){if(!a.ui.contains(this.containers[c].element[0],this.items[b].item[0])){continue}var f=this.items[b][this.containers[c].floating?"left":"top"];if(Math.abs(f-e)<h){h=Math.abs(f-e);g=this.items[b]}}if(!g&&!this.options.dropOnEmpty){continue}this.currentContainer=this.containers[c];g?this._rearrange(d,g,null,true):this._rearrange(d,null,this.containers[c].element,true);this._trigger("change",d,this._uiHash());this.containers[c]._trigger("change",d,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder)}this.containers[c]._trigger("over",d,this._uiHash(this));this.containers[c].containerCache.over=1}}else{if(this.containers[c].containerCache.over){this.containers[c]._trigger("out",d,this._uiHash(this));this.containers[c].containerCache.over=0}}}},_createHelper:function(c){var d=this.options;var b=a.isFunction(d.helper)?a(d.helper.apply(this.element[0],[c,this.currentItem])):(d.helper=="clone"?this.currentItem.clone():this.currentItem);if(!b.parents("body").length){a(d.appendTo!="parent"?d.appendTo:this.currentItem[0].parentNode)[0].appendChild(b[0])}if(b[0]==this.currentItem[0]){this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}}if(b[0].style.width==""||d.forceHelperSize){b.width(this.currentItem.width())}if(b[0].style.height==""||d.forceHelperSize){b.height(this.currentItem.height())}return b},_adjustOffsetFromHelper:function(b){if(b.left!=undefined){this.offset.click.left=b.left+this.margins.left}if(b.right!=undefined){this.offset.click.left=this.helperProportions.width-b.right+this.margins.left}if(b.top!=undefined){this.offset.click.top=b.top+this.margins.top}if(b.bottom!=undefined){this.offset.click.top=this.helperProportions.height-b.bottom+this.margins.top}},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var b=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0])){b.left+=this.scrollParent.scrollLeft();b.top+=this.scrollParent.scrollTop()}if((this.offsetParent[0]==document.body)||(this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&a.browser.msie)){b={top:0,left:0}}return{top:b.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:b.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var b=this.currentItem.position();return{top:b.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:b.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else{return{top:0,left:0}}},_cacheMargins:function(){this.margins={left:(parseInt(this.currentItem.css("marginLeft"),10)||0),top:(parseInt(this.currentItem.css("marginTop"),10)||0)}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var e=this.options;if(e.containment=="parent"){e.containment=this.helper[0].parentNode}if(e.containment=="document"||e.containment=="window"){this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,a(e.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a(e.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]}if(!(/^(document|window|parent)$/).test(e.containment)){var c=a(e.containment)[0];var d=a(e.containment).offset();var b=(a(c).css("overflow")!="hidden");this.containment=[d.left+(parseInt(a(c).css("borderLeftWidth"),10)||0)+(parseInt(a(c).css("paddingLeft"),10)||0)-this.margins.left,d.top+(parseInt(a(c).css("borderTopWidth"),10)||0)+(parseInt(a(c).css("paddingTop"),10)||0)-this.margins.top,d.left+(b?Math.max(c.scrollWidth,c.offsetWidth):c.offsetWidth)-(parseInt(a(c).css("borderLeftWidth"),10)||0)-(parseInt(a(c).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,d.top+(b?Math.max(c.scrollHeight,c.offsetHeight):c.offsetHeight)-(parseInt(a(c).css("borderTopWidth"),10)||0)-(parseInt(a(c).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(f,h){if(!h){h=this.position}var c=f=="absolute"?1:-1;var e=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,g=(/(html|body)/i).test(b[0].tagName);return{top:(h.top+this.offset.relative.top*c+this.offset.parent.top*c-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(g?0:b.scrollTop()))*c)),left:(h.left+this.offset.relative.left*c+this.offset.parent.left*c-(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():g?0:b.scrollLeft())*c))}},_generatePosition:function(e){var h=this.options,b=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&a.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,i=(/(html|body)/i).test(b[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0])){this.offset.relative=this._getRelativeOffset()}var d=e.pageX;var c=e.pageY;if(this.originalPosition){if(this.containment){if(e.pageX-this.offset.click.left<this.containment[0]){d=this.containment[0]+this.offset.click.left}if(e.pageY-this.offset.click.top<this.containment[1]){c=this.containment[1]+this.offset.click.top}if(e.pageX-this.offset.click.left>this.containment[2]){d=this.containment[2]+this.offset.click.left}if(e.pageY-this.offset.click.top>this.containment[3]){c=this.containment[3]+this.offset.click.top}}if(h.grid){var g=this.originalPageY+Math.round((c-this.originalPageY)/h.grid[1])*h.grid[1];c=this.containment?(!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:(!(g-this.offset.click.top<this.containment[1])?g-h.grid[1]:g+h.grid[1])):g;var f=this.originalPageX+Math.round((d-this.originalPageX)/h.grid[0])*h.grid[0];d=this.containment?(!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:(!(f-this.offset.click.left<this.containment[0])?f-h.grid[0]:f+h.grid[0])):f}}return{top:(c-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():(i?0:b.scrollTop())))),left:(d-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(a.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():i?0:b.scrollLeft())))}},_rearrange:function(g,f,c,e){c?c[0].appendChild(this.placeholder[0]):f.item[0].parentNode.insertBefore(this.placeholder[0],(this.direction=="down"?f.item[0]:f.item[0].nextSibling));this.counter=this.counter?++this.counter:1;var d=this,b=this.counter;window.setTimeout(function(){if(b==d.counter){d.refreshPositions(!e)}},0)},_clear:function(d,e){this.reverting=false;var f=[],b=this;if(!this._noFinalSort&&this.currentItem[0].parentNode){this.placeholder.before(this.currentItem)}this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var c in this._storedCSS){if(this._storedCSS[c]=="auto"||this._storedCSS[c]=="static"){this._storedCSS[c]=""}}this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else{this.currentItem.show()}if(this.fromOutside&&!e){f.push(function(g){this._trigger("receive",g,this._uiHash(this.fromOutside))})}if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!e){f.push(function(g){this._trigger("update",g,this._uiHash())})}if(!a.ui.contains(this.element[0],this.currentItem[0])){if(!e){f.push(function(g){this._trigger("remove",g,this._uiHash())})}for(var c=this.containers.length-1;c>=0;c--){if(a.ui.contains(this.containers[c].element[0],this.currentItem[0])&&!e){f.push((function(g){return function(h){g._trigger("receive",h,this._uiHash(this))}}).call(this,this.containers[c]));f.push((function(g){return function(h){g._trigger("update",h,this._uiHash(this))}}).call(this,this.containers[c]))}}}for(var c=this.containers.length-1;c>=0;c--){if(!e){f.push((function(g){return function(h){g._trigger("deactivate",h,this._uiHash(this))}}).call(this,this.containers[c]))}if(this.containers[c].containerCache.over){f.push((function(g){return function(h){g._trigger("out",h,this._uiHash(this))}}).call(this,this.containers[c]));this.containers[c].containerCache.over=0}}if(this._storedCursor){a("body").css("cursor",this._storedCursor)}if(this._storedOpacity){this.helper.css("opacity",this._storedOpacity)}if(this._storedZIndex){this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex)}this.dragging=false;if(this.cancelHelperRemoval){if(!e){this._trigger("beforeStop",d,this._uiHash());for(var c=0;c<f.length;c++){f[c].call(this,d)}this._trigger("stop",d,this._uiHash())}return false}if(!e){this._trigger("beforeStop",d,this._uiHash())}this.placeholder[0].parentNode.removeChild(this.placeholder[0]);if(this.helper[0]!=this.currentItem[0]){this.helper.remove()}this.helper=null;if(!e){for(var c=0;c<f.length;c++){f[c].call(this,d)}this._trigger("stop",d,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){if(a.widget.prototype._trigger.apply(this,arguments)===false){this.cancel()}},_uiHash:function(c){var b=c||this;return{helper:b.helper,placeholder:b.placeholder||a([]),position:b.position,absolutePosition:b.positionAbs,offset:b.positionAbs,item:b.currentItem,sender:c?c.element:null}}}));a.extend(a.ui.sortable,{getter:"serialize toArray",version:"1.7.2",eventPrefix:"sort",defaults:{appendTo:"parent",axis:false,cancel:":input,option",connectWith:false,containment:false,cursor:"auto",cursorAt:false,delay:0,distance:1,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1000}})})(jQuery);jQuery.effects||(function(d){d.effects={version:"1.7.2",save:function(g,h){for(var f=0;f<h.length;f++){if(h[f]!==null){g.data("ec.storage."+h[f],g[0].style[h[f]])}}},restore:function(g,h){for(var f=0;f<h.length;f++){if(h[f]!==null){g.css(h[f],g.data("ec.storage."+h[f]))}}},setMode:function(f,g){if(g=="toggle"){g=f.is(":hidden")?"show":"hide"}return g},getBaseline:function(g,h){var i,f;switch(g[0]){case"top":i=0;break;case"middle":i=0.5;break;case"bottom":i=1;break;default:i=g[0]/h.height}switch(g[1]){case"left":f=0;break;case"center":f=0.5;break;case"right":f=1;break;default:f=g[1]/h.width}return{x:f,y:i}},createWrapper:function(f){if(f.parent().is(".ui-effects-wrapper")){return f.parent()}var g={width:f.outerWidth(true),height:f.outerHeight(true),"float":f.css("float")};f.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');var j=f.parent();if(f.css("position")=="static"){j.css({position:"relative"});f.css({position:"relative"})}else{var i=f.css("top");if(isNaN(parseInt(i,10))){i="auto"}var h=f.css("left");if(isNaN(parseInt(h,10))){h="auto"}j.css({position:f.css("position"),top:i,left:h,zIndex:f.css("z-index")}).show();f.css({position:"relative",top:0,left:0})}j.css(g);return j},removeWrapper:function(f){if(f.parent().is(".ui-effects-wrapper")){return f.parent().replaceWith(f)}return f},setTransition:function(g,i,f,h){h=h||{};d.each(i,function(k,j){unit=g.cssUnit(j);if(unit[0]>0){h[j]=unit[0]*f+unit[1]}});return h},animateClass:function(h,i,k,j){var f=(typeof k=="function"?k:(j?j:null));var g=(typeof k=="string"?k:null);return this.each(function(){var q={};var o=d(this);var p=o.attr("style")||"";if(typeof p=="object"){p=p.cssText}if(h.toggle){o.hasClass(h.toggle)?h.remove=h.toggle:h.add=h.toggle}var l=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.addClass(h.add)}if(h.remove){o.removeClass(h.remove)}var m=d.extend({},(document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle));if(h.add){o.removeClass(h.add)}if(h.remove){o.addClass(h.remove)}for(var r in m){if(typeof m[r]!="function"&&m[r]&&r.indexOf("Moz")==-1&&r.indexOf("length")==-1&&m[r]!=l[r]&&(r.match(/color/i)||(!r.match(/color/i)&&!isNaN(parseInt(m[r],10))))&&(l.position!="static"||(l.position=="static"&&!r.match(/left|top|bottom|right/)))){q[r]=m[r]}}o.animate(q,i,g,function(){if(typeof d(this).attr("style")=="object"){d(this).attr("style")["cssText"]="";d(this).attr("style")["cssText"]=p}else{d(this).attr("style",p)}if(h.add){d(this).addClass(h.add)}if(h.remove){d(this).removeClass(h.remove)}if(f){f.apply(this,arguments)}})})}};function c(g,f){var i=g[1]&&g[1].constructor==Object?g[1]:{};if(f){i.mode=f}var h=g[1]&&g[1].constructor!=Object?g[1]:(i.duration?i.duration:g[2]);h=d.fx.off?0:typeof h==="number"?h:d.fx.speeds[h]||d.fx.speeds._default;var j=i.callback||(d.isFunction(g[1])&&g[1])||(d.isFunction(g[2])&&g[2])||(d.isFunction(g[3])&&g[3]);return[g[0],i,h,j]}d.fn.extend({_show:d.fn.show,_hide:d.fn.hide,__toggle:d.fn.toggle,_addClass:d.fn.addClass,_removeClass:d.fn.removeClass,_toggleClass:d.fn.toggleClass,effect:function(g,f,h,i){return d.effects[g]?d.effects[g].call(this,{method:g,options:f||{},duration:h,callback:i}):null},show:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._show.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"show"))}},hide:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))){return this._hide.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"hide"))}},toggle:function(){if(!arguments[0]||(arguments[0].constructor==Number||(/(slow|normal|fast)/).test(arguments[0]))||(d.isFunction(arguments[0])||typeof arguments[0]=="boolean")){return this.__toggle.apply(this,arguments)}else{return this.effect.apply(this,c(arguments,"toggle"))}},addClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{add:g},f,i,h]):this._addClass(g)},removeClass:function(g,f,i,h){return f?d.effects.animateClass.apply(this,[{remove:g},f,i,h]):this._removeClass(g)},toggleClass:function(g,f,i,h){return((typeof f!=="boolean")&&f)?d.effects.animateClass.apply(this,[{toggle:g},f,i,h]):this._toggleClass(g,f)},morph:function(f,h,g,j,i){return d.effects.animateClass.apply(this,[{add:h,remove:f},g,j,i])},switchClass:function(){return this.morph.apply(this,arguments)},cssUnit:function(f){var g=this.css(f),h=[];d.each(["em","px","%","pt"],function(j,k){if(g.indexOf(k)>0){h=[parseFloat(g),k]}});return h}});d.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","color","outlineColor"],function(g,f){d.fx.step[f]=function(h){if(h.state==0){h.start=e(h.elem,f);h.end=b(h.end)}h.elem.style[f]="rgb("+[Math.max(Math.min(parseInt((h.pos*(h.end[0]-h.start[0]))+h.start[0],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[1]-h.start[1]))+h.start[1],10),255),0),Math.max(Math.min(parseInt((h.pos*(h.end[2]-h.start[2]))+h.start[2],10),255),0)].join(",")+")"}});function b(g){var f;if(g&&g.constructor==Array&&g.length==3){return g}if(f=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(g)){return[parseInt(f[1],10),parseInt(f[2],10),parseInt(f[3],10)]}if(f=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(g)){return[parseFloat(f[1])*2.55,parseFloat(f[2])*2.55,parseFloat(f[3])*2.55]}if(f=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(g)){return[parseInt(f[1],16),parseInt(f[2],16),parseInt(f[3],16)]}if(f=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(g)){return[parseInt(f[1]+f[1],16),parseInt(f[2]+f[2],16),parseInt(f[3]+f[3],16)]}if(f=/rgba\(0, 0, 0, 0\)/.exec(g)){return a.transparent}return a[d.trim(g).toLowerCase()]}function e(h,f){var g;do{g=d.curCSS(h,f);if(g!=""&&g!="transparent"||d.nodeName(h,"body")){break}f="backgroundColor"}while(h=h.parentNode);return b(g)}var a={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]};d.easing.jswing=d.easing.swing;d.extend(d.easing,{def:"easeOutQuad",swing:function(g,h,f,j,i){return d.easing[d.easing.def](g,h,f,j,i)},easeInQuad:function(g,h,f,j,i){return j*(h/=i)*h+f},easeOutQuad:function(g,h,f,j,i){return -j*(h/=i)*(h-2)+f},easeInOutQuad:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h+f}return -j/2*((--h)*(h-2)-1)+f},easeInCubic:function(g,h,f,j,i){return j*(h/=i)*h*h+f},easeOutCubic:function(g,h,f,j,i){return j*((h=h/i-1)*h*h+1)+f},easeInOutCubic:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h+f}return j/2*((h-=2)*h*h+2)+f},easeInQuart:function(g,h,f,j,i){return j*(h/=i)*h*h*h+f},easeOutQuart:function(g,h,f,j,i){return -j*((h=h/i-1)*h*h*h-1)+f},easeInOutQuart:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h+f}return -j/2*((h-=2)*h*h*h-2)+f},easeInQuint:function(g,h,f,j,i){return j*(h/=i)*h*h*h*h+f},easeOutQuint:function(g,h,f,j,i){return j*((h=h/i-1)*h*h*h*h+1)+f},easeInOutQuint:function(g,h,f,j,i){if((h/=i/2)<1){return j/2*h*h*h*h*h+f}return j/2*((h-=2)*h*h*h*h+2)+f},easeInSine:function(g,h,f,j,i){return -j*Math.cos(h/i*(Math.PI/2))+j+f},easeOutSine:function(g,h,f,j,i){return j*Math.sin(h/i*(Math.PI/2))+f},easeInOutSine:function(g,h,f,j,i){return -j/2*(Math.cos(Math.PI*h/i)-1)+f},easeInExpo:function(g,h,f,j,i){return(h==0)?f:j*Math.pow(2,10*(h/i-1))+f},easeOutExpo:function(g,h,f,j,i){return(h==i)?f+j:j*(-Math.pow(2,-10*h/i)+1)+f},easeInOutExpo:function(g,h,f,j,i){if(h==0){return f}if(h==i){return f+j}if((h/=i/2)<1){return j/2*Math.pow(2,10*(h-1))+f}return j/2*(-Math.pow(2,-10*--h)+2)+f},easeInCirc:function(g,h,f,j,i){return -j*(Math.sqrt(1-(h/=i)*h)-1)+f},easeOutCirc:function(g,h,f,j,i){return j*Math.sqrt(1-(h=h/i-1)*h)+f},easeInOutCirc:function(g,h,f,j,i){if((h/=i/2)<1){return -j/2*(Math.sqrt(1-h*h)-1)+f}return j/2*(Math.sqrt(1-(h-=2)*h)+1)+f},easeInElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l)==1){return f+m}if(!k){k=l*0.3}if(h<Math.abs(m)){h=m;var j=k/4}else{var j=k/(2*Math.PI)*Math.asin(m/h)}return -(h*Math.pow(2,10*(i-=1))*Math.sin((i*l-j)*(2*Math.PI)/k))+f},easeOutElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l)==1){return f+m}if(!k){k=l*0.3}if(h<Math.abs(m)){h=m;var j=k/4}else{var j=k/(2*Math.PI)*Math.asin(m/h)}return h*Math.pow(2,-10*i)*Math.sin((i*l-j)*(2*Math.PI)/k)+m+f},easeInOutElastic:function(g,i,f,m,l){var j=1.70158;var k=0;var h=m;if(i==0){return f}if((i/=l/2)==2){return f+m}if(!k){k=l*(0.3*1.5)}if(h<Math.abs(m)){h=m;var j=k/4}else{var j=k/(2*Math.PI)*Math.asin(m/h)}if(i<1){return -0.5*(h*Math.pow(2,10*(i-=1))*Math.sin((i*l-j)*(2*Math.PI)/k))+f}return h*Math.pow(2,-10*(i-=1))*Math.sin((i*l-j)*(2*Math.PI)/k)*0.5+m+f},easeInBack:function(g,h,f,k,j,i){if(i==undefined){i=1.70158}return k*(h/=j)*h*((i+1)*h-i)+f},easeOutBack:function(g,h,f,k,j,i){if(i==undefined){i=1.70158}return k*((h=h/j-1)*h*((i+1)*h+i)+1)+f},easeInOutBack:function(g,h,f,k,j,i){if(i==undefined){i=1.70158}if((h/=j/2)<1){return k/2*(h*h*(((i*=(1.525))+1)*h-i))+f}return k/2*((h-=2)*h*(((i*=(1.525))+1)*h+i)+2)+f},easeInBounce:function(g,h,f,j,i){return j-d.easing.easeOutBounce(g,i-h,0,j,i)+f},easeOutBounce:function(g,h,f,j,i){if((h/=i)<(1/2.75)){return j*(7.5625*h*h)+f}else{if(h<(2/2.75)){return j*(7.5625*(h-=(1.5/2.75))*h+0.75)+f}else{if(h<(2.5/2.75)){return j*(7.5625*(h-=(2.25/2.75))*h+0.9375)+f}else{return j*(7.5625*(h-=(2.625/2.75))*h+0.984375)+f}}}},easeInOutBounce:function(g,h,f,j,i){if(h<i/2){return d.easing.easeInBounce(g,h*2,0,j,i)*0.5+f}return d.easing.easeOutBounce(g,h*2-i,0,j,i)*0.5+j*0.5+f}})})(jQuery);(function(a){a.effects.blind=function(b){return this.queue(function(){var d=a(this),c=["position","top","left"];var h=a.effects.setMode(d,b.options.mode||"hide");var g=b.options.direction||"vertical";a.effects.save(d,c);d.show();var j=a.effects.createWrapper(d).css({overflow:"hidden"});var e=(g=="vertical")?"height":"width";var i=(g=="vertical")?j.height():j.width();if(h=="show"){j.css(e,0)}var f={};f[e]=h=="show"?i:0;j.animate(f,b.duration,b.options.easing,function(){if(h=="hide"){d.hide()}a.effects.restore(d,c);a.effects.removeWrapper(d);if(b.callback){b.callback.apply(d[0],arguments)}d.dequeue()})})}})(jQuery);(function(a){a.effects.bounce=function(b){return this.queue(function(){var e=a(this),l=["position","top","left"];var k=a.effects.setMode(e,b.options.mode||"effect");var n=b.options.direction||"up";var c=b.options.distance||20;var d=b.options.times||5;var g=b.duration||250;if(/show|hide/.test(k)){l.push("opacity")}a.effects.save(e,l);e.show();a.effects.createWrapper(e);var f=(n=="up"||n=="down")?"top":"left";var p=(n=="up"||n=="left")?"pos":"neg";var c=b.options.distance||(f=="top"?e.outerHeight({margin:true})/3:e.outerWidth({margin:true})/3);if(k=="show"){e.css("opacity",0).css(f,p=="pos"?-c:c)}if(k=="hide"){c=c/(d*2)}if(k!="hide"){d--}if(k=="show"){var h={opacity:1};h[f]=(p=="pos"?"+=":"-=")+c;e.animate(h,g/2,b.options.easing);c=c/2;d--}for(var j=0;j<d;j++){var o={},m={};o[f]=(p=="pos"?"-=":"+=")+c;m[f]=(p=="pos"?"+=":"-=")+c;e.animate(o,g/2,b.options.easing).animate(m,g/2,b.options.easing);c=(k=="hide")?c*2:c/2}if(k=="hide"){var h={opacity:0};h[f]=(p=="pos"?"-=":"+=")+c;e.animate(h,g/2,b.options.easing,function(){e.hide();a.effects.restore(e,l);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}})}else{var o={},m={};o[f]=(p=="pos"?"-=":"+=")+c;m[f]=(p=="pos"?"+=":"-=")+c;e.animate(o,g/2,b.options.easing).animate(m,g/2,b.options.easing,function(){a.effects.restore(e,l);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}})}e.queue("fx",function(){e.dequeue()});e.dequeue()})}})(jQuery);(function(a){a.effects.clip=function(b){return this.queue(function(){var f=a(this),j=["position","top","left","height","width"];var i=a.effects.setMode(f,b.options.mode||"hide");var k=b.options.direction||"vertical";a.effects.save(f,j);f.show();var c=a.effects.createWrapper(f).css({overflow:"hidden"});var e=f[0].tagName=="IMG"?c:f;var g={size:(k=="vertical")?"height":"width",position:(k=="vertical")?"top":"left"};var d=(k=="vertical")?e.height():e.width();if(i=="show"){e.css(g.size,0);e.css(g.position,d/2)}var h={};h[g.size]=i=="show"?d:0;h[g.position]=i=="show"?0:d/2;e.animate(h,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){f.hide()}a.effects.restore(f,j);a.effects.removeWrapper(f);if(b.callback){b.callback.apply(f[0],arguments)}f.dequeue()}})})}})(jQuery);(function(a){a.effects.drop=function(b){return this.queue(function(){var e=a(this),d=["position","top","left","opacity"];var i=a.effects.setMode(e,b.options.mode||"hide");var h=b.options.direction||"left";a.effects.save(e,d);e.show();a.effects.createWrapper(e);var f=(h=="up"||h=="down")?"top":"left";var c=(h=="up"||h=="left")?"pos":"neg";var j=b.options.distance||(f=="top"?e.outerHeight({margin:true})/2:e.outerWidth({margin:true})/2);if(i=="show"){e.css("opacity",0).css(f,c=="pos"?-j:j)}var g={opacity:i=="show"?1:0};g[f]=(i=="show"?(c=="pos"?"+=":"-="):(c=="pos"?"-=":"+="))+j;e.animate(g,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){e.hide()}a.effects.restore(e,d);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);(function(a){a.effects.explode=function(b){return this.queue(function(){var k=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3;var e=b.options.pieces?Math.round(Math.sqrt(b.options.pieces)):3;b.options.mode=b.options.mode=="toggle"?(a(this).is(":visible")?"hide":"show"):b.options.mode;var h=a(this).show().css("visibility","hidden");var l=h.offset();l.top-=parseInt(h.css("marginTop"),10)||0;l.left-=parseInt(h.css("marginLeft"),10)||0;var g=h.outerWidth(true);var c=h.outerHeight(true);for(var f=0;f<k;f++){for(var d=0;d<e;d++){h.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-d*(g/e),top:-f*(c/k)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:g/e,height:c/k,left:l.left+d*(g/e)+(b.options.mode=="show"?(d-Math.floor(e/2))*(g/e):0),top:l.top+f*(c/k)+(b.options.mode=="show"?(f-Math.floor(k/2))*(c/k):0),opacity:b.options.mode=="show"?0:1}).animate({left:l.left+d*(g/e)+(b.options.mode=="show"?0:(d-Math.floor(e/2))*(g/e)),top:l.top+f*(c/k)+(b.options.mode=="show"?0:(f-Math.floor(k/2))*(c/k)),opacity:b.options.mode=="show"?1:0},b.duration||500)}}setTimeout(function(){b.options.mode=="show"?h.css({visibility:"visible"}):h.css({visibility:"visible"}).hide();if(b.callback){b.callback.apply(h[0])}h.dequeue();a("div.ui-effects-explode").remove()},b.duration||500)})}})(jQuery);(function(a){a.effects.fold=function(b){return this.queue(function(){var e=a(this),k=["position","top","left"];var h=a.effects.setMode(e,b.options.mode||"hide");var o=b.options.size||15;var n=!(!b.options.horizFirst);var g=b.duration?b.duration/2:a.fx.speeds._default/2;a.effects.save(e,k);e.show();var d=a.effects.createWrapper(e).css({overflow:"hidden"});var i=((h=="show")!=n);var f=i?["width","height"]:["height","width"];var c=i?[d.width(),d.height()]:[d.height(),d.width()];var j=/([0-9]+)%/.exec(o);if(j){o=parseInt(j[1],10)/100*c[h=="hide"?0:1]}if(h=="show"){d.css(n?{height:0,width:o}:{height:o,width:0})}var m={},l={};m[f[0]]=h=="show"?c[0]:o;l[f[1]]=h=="show"?c[1]:0;d.animate(m,g,b.options.easing).animate(l,g,b.options.easing,function(){if(h=="hide"){e.hide()}a.effects.restore(e,k);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(e[0],arguments)}e.dequeue()})})}})(jQuery);(function(a){a.effects.highlight=function(b){return this.queue(function(){var e=a(this),d=["backgroundImage","backgroundColor","opacity"];var h=a.effects.setMode(e,b.options.mode||"show");var c=b.options.color||"#ffff99";var g=e.css("backgroundColor");a.effects.save(e,d);e.show();e.css({backgroundImage:"none",backgroundColor:c});var f={backgroundColor:g};if(h=="hide"){f.opacity=0}e.animate(f,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(h=="hide"){e.hide()}a.effects.restore(e,d);if(h=="show"&&a.browser.msie){this.style.removeAttribute("filter")}if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);(function(a){a.effects.pulsate=function(b){return this.queue(function(){var d=a(this);var g=a.effects.setMode(d,b.options.mode||"show");var f=b.options.times||5;var e=b.duration?b.duration/2:a.fx.speeds._default/2;if(g=="hide"){f--}if(d.is(":hidden")){d.css("opacity",0);d.show();d.animate({opacity:1},e,b.options.easing);f=f-2}for(var c=0;c<f;c++){d.animate({opacity:0},e,b.options.easing).animate({opacity:1},e,b.options.easing)}if(g=="hide"){d.animate({opacity:0},e,b.options.easing,function(){d.hide();if(b.callback){b.callback.apply(this,arguments)}})}else{d.animate({opacity:0},e,b.options.easing).animate({opacity:1},e,b.options.easing,function(){if(b.callback){b.callback.apply(this,arguments)}})}d.queue("fx",function(){d.dequeue()});d.dequeue()})}})(jQuery);(function(a){a.effects.puff=function(b){return this.queue(function(){var f=a(this);var c=a.extend(true,{},b.options);var h=a.effects.setMode(f,b.options.mode||"hide");var g=parseInt(b.options.percent,10)||150;c.fade=true;var e={height:f.height(),width:f.width()};var d=g/100;f.from=(h=="hide")?e:{height:e.height*d,width:e.width*d};c.from=f.from;c.percent=(h=="hide")?g:100;c.mode=h;f.effect("scale",c,b.duration,b.callback);f.dequeue()})};a.effects.scale=function(b){return this.queue(function(){var g=a(this);var d=a.extend(true,{},b.options);var j=a.effects.setMode(g,b.options.mode||"effect");var h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:(j=="hide"?0:100));var i=b.options.direction||"both";var c=b.options.origin;if(j!="effect"){d.origin=c||["middle","center"];d.restore=true}var f={height:g.height(),width:g.width()};g.from=b.options.from||(j=="show"?{height:0,width:0}:f);var e={y:i!="horizontal"?(h/100):1,x:i!="vertical"?(h/100):1};g.to={height:f.height*e.y,width:f.width*e.x};if(b.options.fade){if(j=="show"){g.from.opacity=0;g.to.opacity=1}if(j=="hide"){g.from.opacity=1;g.to.opacity=0}}d.from=g.from;d.to=g.to;d.mode=j;g.effect("size",d,b.duration,b.callback);g.dequeue()})};a.effects.size=function(b){return this.queue(function(){var c=a(this),n=["position","top","left","width","height","overflow","opacity"];var m=["position","top","left","overflow","opacity"];var j=["width","height","overflow"];var p=["fontSize"];var k=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"];var f=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"];var g=a.effects.setMode(c,b.options.mode||"effect");var i=b.options.restore||false;var e=b.options.scale||"both";var o=b.options.origin;var d={height:c.height(),width:c.width()};c.from=b.options.from||d;c.to=b.options.to||d;if(o){var h=a.effects.getBaseline(o,d);c.from.top=(d.height-c.from.height)*h.y;c.from.left=(d.width-c.from.width)*h.x;c.to.top=(d.height-c.to.height)*h.y;c.to.left=(d.width-c.to.width)*h.x}var l={from:{y:c.from.height/d.height,x:c.from.width/d.width},to:{y:c.to.height/d.height,x:c.to.width/d.width}};if(e=="box"||e=="both"){if(l.from.y!=l.to.y){n=n.concat(k);c.from=a.effects.setTransition(c,k,l.from.y,c.from);c.to=a.effects.setTransition(c,k,l.to.y,c.to)}if(l.from.x!=l.to.x){n=n.concat(f);c.from=a.effects.setTransition(c,f,l.from.x,c.from);c.to=a.effects.setTransition(c,f,l.to.x,c.to)}}if(e=="content"||e=="both"){if(l.from.y!=l.to.y){n=n.concat(p);c.from=a.effects.setTransition(c,p,l.from.y,c.from);c.to=a.effects.setTransition(c,p,l.to.y,c.to)}}a.effects.save(c,i?n:m);c.show();a.effects.createWrapper(c);c.css("overflow","hidden").css(c.from);if(e=="content"||e=="both"){k=k.concat(["marginTop","marginBottom"]).concat(p);f=f.concat(["marginLeft","marginRight"]);j=n.concat(k).concat(f);c.find("*[width]").each(function(){child=a(this);if(i){a.effects.save(child,j)}var q={height:child.height(),width:child.width()};child.from={height:q.height*l.from.y,width:q.width*l.from.x};child.to={height:q.height*l.to.y,width:q.width*l.to.x};if(l.from.y!=l.to.y){child.from=a.effects.setTransition(child,k,l.from.y,child.from);child.to=a.effects.setTransition(child,k,l.to.y,child.to)}if(l.from.x!=l.to.x){child.from=a.effects.setTransition(child,f,l.from.x,child.from);child.to=a.effects.setTransition(child,f,l.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){if(i){a.effects.restore(child,j)}})})}c.animate(c.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(g=="hide"){c.hide()}a.effects.restore(c,i?n:m);a.effects.removeWrapper(c);if(b.callback){b.callback.apply(this,arguments)}c.dequeue()}})})}})(jQuery);(function(a){a.effects.shake=function(b){return this.queue(function(){var e=a(this),l=["position","top","left"];var k=a.effects.setMode(e,b.options.mode||"effect");var n=b.options.direction||"left";var c=b.options.distance||20;var d=b.options.times||3;var g=b.duration||b.options.duration||140;a.effects.save(e,l);e.show();a.effects.createWrapper(e);var f=(n=="up"||n=="down")?"top":"left";var p=(n=="up"||n=="left")?"pos":"neg";var h={},o={},m={};h[f]=(p=="pos"?"-=":"+=")+c;o[f]=(p=="pos"?"+=":"-=")+c*2;m[f]=(p=="pos"?"-=":"+=")+c*2;e.animate(h,g,b.options.easing);for(var j=1;j<d;j++){e.animate(o,g,b.options.easing).animate(m,g,b.options.easing)}e.animate(o,g,b.options.easing).animate(h,g/2,b.options.easing,function(){a.effects.restore(e,l);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}});e.queue("fx",function(){e.dequeue()});e.dequeue()})}})(jQuery);(function(a){a.effects.slide=function(b){return this.queue(function(){var e=a(this),d=["position","top","left"];var i=a.effects.setMode(e,b.options.mode||"show");var h=b.options.direction||"left";a.effects.save(e,d);e.show();a.effects.createWrapper(e).css({overflow:"hidden"});var f=(h=="up"||h=="down")?"top":"left";var c=(h=="up"||h=="left")?"pos":"neg";var j=b.options.distance||(f=="top"?e.outerHeight({margin:true}):e.outerWidth({margin:true}));if(i=="show"){e.css(f,c=="pos"?-j:j)}var g={};g[f]=(i=="show"?(c=="pos"?"+=":"-="):(c=="pos"?"-=":"+="))+j;e.animate(g,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){if(i=="hide"){e.hide()}a.effects.restore(e,d);a.effects.removeWrapper(e);if(b.callback){b.callback.apply(this,arguments)}e.dequeue()}})})}})(jQuery);(function(a){a.effects.transfer=function(b){return this.queue(function(){var f=a(this),h=a(b.options.to),e=h.offset(),g={top:e.top,left:e.left,height:h.innerHeight(),width:h.innerWidth()},d=f.offset(),c=a('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(b.options.className).css({top:d.top,left:d.left,height:f.innerHeight(),width:f.innerWidth(),position:"absolute"}).animate(g,b.duration,b.options.easing,function(){c.remove();(b.callback&&b.callback.apply(f[0],arguments));f.dequeue()})})}})(jQuery);(function(a){a.widget("ui.accordion",{_init:function(){var d=this.options,b=this;this.running=0;if(d.collapsible==a.ui.accordion.defaults.collapsible&&d.alwaysOpen!=a.ui.accordion.defaults.alwaysOpen){d.collapsible=!d.alwaysOpen}if(d.navigation){var c=this.element.find("a").filter(d.navigationFilter);if(c.length){if(c.filter(d.header).length){this.active=c}else{this.active=c.parent().parent().prev();c.addClass("ui-accordion-content-active")}}}this.element.addClass("ui-accordion ui-widget ui-helper-reset");if(this.element[0].nodeName=="UL"){this.element.children("li").addClass("ui-accordion-li-fix")}this.headers=this.element.find(d.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){a(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){a(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){a(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){a(this).removeClass("ui-state-focus")});this.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");this.active=this._findActive(this.active||d.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");this.active.next().addClass("ui-accordion-content-active");a("<span/>").addClass("ui-icon "+d.icons.header).prependTo(this.headers);this.active.find(".ui-icon").toggleClass(d.icons.header).toggleClass(d.icons.headerSelected);if(a.browser.msie){this.element.find("a").css("zoom","1")}this.resize();this.element.attr("role","tablist");this.headers.attr("role","tab").bind("keydown",function(e){return b._keydown(e)}).next().attr("role","tabpanel");this.headers.not(this.active||"").attr("aria-expanded","false").attr("tabIndex","-1").next().hide();if(!this.active.length){this.headers.eq(0).attr("tabIndex","0")}else{this.active.attr("aria-expanded","true").attr("tabIndex","0")}if(!a.browser.safari){this.headers.find("a").attr("tabIndex","-1")}if(d.event){this.headers.bind((d.event)+".accordion",function(e){return b._clickHandler.call(b,e,this)})}},destroy:function(){var c=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role").unbind(".accordion").removeData("accordion");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");this.headers.find("a").removeAttr("tabindex");this.headers.children(".ui-icon").remove();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");if(c.autoHeight||c.fillHeight){b.css("height","")}},_setData:function(b,c){if(b=="alwaysOpen"){b="collapsible";c=!c}a.widget.prototype._setData.apply(this,arguments)},_keydown:function(e){var g=this.options,f=a.ui.keyCode;if(g.disabled||e.altKey||e.ctrlKey){return}var d=this.headers.length;var b=this.headers.index(e.target);var c=false;switch(e.keyCode){case f.RIGHT:case f.DOWN:c=this.headers[(b+1)%d];break;case f.LEFT:case f.UP:c=this.headers[(b-1+d)%d];break;case f.SPACE:case f.ENTER:return this._clickHandler({target:e.target},e.target)}if(c){a(e.target).attr("tabIndex","-1");a(c).attr("tabIndex","0");c.focus();return false}return true},resize:function(){var e=this.options,d;if(e.fillSpace){if(a.browser.msie){var b=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}d=this.element.parent().height();if(a.browser.msie){this.element.parent().css("overflow",b)}this.headers.each(function(){d-=a(this).outerHeight()});var c=0;this.headers.next().each(function(){c=Math.max(c,a(this).innerHeight()-a(this).height())}).height(Math.max(0,d-c)).css("overflow","auto")}else{if(e.autoHeight){d=0;this.headers.next().each(function(){d=Math.max(d,a(this).outerHeight())}).height(d)}}},activate:function(b){var c=this._findActive(b)[0];this._clickHandler({target:c},c)},_findActive:function(b){return b?typeof b=="number"?this.headers.filter(":eq("+b+")"):this.headers.not(this.headers.not(b)):b===false?a([]):this.headers.filter(":eq(0)")},_clickHandler:function(b,f){var d=this.options;if(d.disabled){return false}if(!b.target&&d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var h=this.active.next(),e={options:d,newHeader:a([]),oldHeader:d.active,newContent:a([]),oldContent:h},c=(this.active=a([]));this._toggle(c,h,e);return false}var g=a(b.currentTarget||f);var i=g[0]==this.active[0];if(this.running||(!d.collapsible&&i)){return false}this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");if(!i){g.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").find(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);g.next().addClass("ui-accordion-content-active")}var c=g.next(),h=this.active.next(),e={options:d,newHeader:i&&d.collapsible?a([]):g,oldHeader:this.active,newContent:i&&d.collapsible?a([]):c.find("> *"),oldContent:h.find("> *")},j=this.headers.index(this.active[0])>this.headers.index(g[0]);this.active=i?a([]):g;this._toggle(c,h,e,i,j);return false},_toggle:function(b,i,g,j,k){var d=this.options,m=this;this.toShow=b;this.toHide=i;this.data=g;var c=function(){if(!m){return}return m._completed.apply(m,arguments)};this._trigger("changestart",null,this.data);this.running=i.size()===0?b.size():i.size();if(d.animated){var f={};if(d.collapsible&&j){f={toShow:a([]),toHide:i,complete:c,down:k,autoHeight:d.autoHeight||d.fillSpace}}else{f={toShow:b,toHide:i,complete:c,down:k,autoHeight:d.autoHeight||d.fillSpace}}if(!d.proxied){d.proxied=d.animated}if(!d.proxiedDuration){d.proxiedDuration=d.duration}d.animated=a.isFunction(d.proxied)?d.proxied(f):d.proxied;d.duration=a.isFunction(d.proxiedDuration)?d.proxiedDuration(f):d.proxiedDuration;var l=a.ui.accordion.animations,e=d.duration,h=d.animated;if(!l[h]){l[h]=function(n){this.slide(n,{easing:h,duration:e||700})}}l[h](f)}else{if(d.collapsible&&j){b.toggle()}else{i.hide();b.show()}c(true)}i.prev().attr("aria-expanded","false").attr("tabIndex","-1").blur();b.prev().attr("aria-expanded","true").attr("tabIndex","0").focus()},_completed:function(b){var c=this.options;this.running=b?0:--this.running;if(this.running){return}if(c.clearStyle){this.toShow.add(this.toHide).css({height:"",overflow:""})}this._trigger("change",null,this.data)}});a.extend(a.ui.accordion,{version:"1.7.2",defaults:{active:null,alwaysOpen:true,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()==location.href.toLowerCase()}},animations:{slide:function(j,h){j=a.extend({easing:"swing",duration:300},j,h);if(!j.toHide.size()){j.toShow.animate({height:"show"},j);return}if(!j.toShow.size()){j.toHide.animate({height:"hide"},j);return}var c=j.toShow.css("overflow"),g,d={},f={},e=["height","paddingTop","paddingBottom"],b;var i=j.toShow;b=i[0].style.width;i.width(parseInt(i.parent().width(),10)-parseInt(i.css("paddingLeft"),10)-parseInt(i.css("paddingRight"),10)-(parseInt(i.css("borderLeftWidth"),10)||0)-(parseInt(i.css("borderRightWidth"),10)||0));a.each(e,function(k,m){f[m]="hide";var l=(""+a.css(j.toShow[0],m)).match(/^([\d+-.]+)(.*)$/);d[m]={value:l[1],unit:l[2]||"px"}});j.toShow.css({height:0,overflow:"hidden"}).show();j.toHide.filter(":hidden").each(j.complete).end().filter(":visible").animate(f,{step:function(k,l){if(l.prop=="height"){g=(l.now-l.start)/(l.end-l.start)}j.toShow[0].style[l.prop]=(g*d[l.prop].value)+d[l.prop].unit},duration:j.duration,easing:j.easing,complete:function(){if(!j.autoHeight){j.toShow.css("height","")}j.toShow.css("width",b);j.toShow.css({overflow:c});j.complete()}})},bounceslide:function(b){this.slide(b,{easing:b.down?"easeOutBounce":"swing",duration:b.down?1000:200})},easeslide:function(b){this.slide(b,{easing:"easeinout",duration:700})}}})})(jQuery);(function($){$.extend($.ui,{datepicker:{version:"1.7.2"}});var PROP_NAME="datepicker";function Datepicker(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._datepickerShowing=false;this._inDialog=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass="ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su","Mo","Tu","We","Th","Fr","Sa"],dateFormat:"mm/dd/yy",firstDay:0,isRTL:false};this._defaults={showOn:"focus",showAnim:"show",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,showMonthAfterYear:false,yearRange:"-10:+10",showOtherMonths:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",minDate:null,maxDate:null,duration:"normal",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false};$.extend(this._defaults,this.regional[""]);this.dpDiv=$('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>')}$.extend(Datepicker.prototype,{markerClassName:"hasDatepicker",log:function(){if(this.debug){console.log.apply("",arguments)}},setDefaults:function(settings){extendRemove(this._defaults,settings||{});return this},_attachDatepicker:function(target,settings){var inlineSettings=null;for(var attrName in this._defaults){var attrValue=target.getAttribute("date:"+attrName);if(attrValue){inlineSettings=inlineSettings||{};try{inlineSettings[attrName]=eval(attrValue)}catch(err){inlineSettings[attrName]=attrValue}}}var nodeName=target.nodeName.toLowerCase();var inline=(nodeName=="div"||nodeName=="span");if(!target.id){target.id="dp"+(++this.uuid)}var inst=this._newInst($(target),inline);inst.settings=$.extend({},settings||{},inlineSettings||{});if(nodeName=="input"){this._connectDatepicker(target,inst)}else{if(inline){this._inlineDatepicker(target,inst)}}},_newInst:function(target,inline){var id=target[0].id.replace(/([:\[\]\.])/g,"\\\\$1");return{id:id,input:target,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:inline,dpDiv:(!inline?this.dpDiv:$('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}},_connectDatepicker:function(target,inst){var input=$(target);inst.append=$([]);inst.trigger=$([]);if(input.hasClass(this.markerClassName)){return}var appendText=this._get(inst,"appendText");var isRTL=this._get(inst,"isRTL");if(appendText){inst.append=$('<span class="'+this._appendClass+'">'+appendText+"</span>");input[isRTL?"before":"after"](inst.append)}var showOn=this._get(inst,"showOn");if(showOn=="focus"||showOn=="both"){input.focus(this._showDatepicker)}if(showOn=="button"||showOn=="both"){var buttonText=this._get(inst,"buttonText");var buttonImage=this._get(inst,"buttonImage");inst.trigger=$(this._get(inst,"buttonImageOnly")?$("<img/>").addClass(this._triggerClass).attr({src:buttonImage,alt:buttonText,title:buttonText}):$('<button type="button"></button>').addClass(this._triggerClass).html(buttonImage==""?buttonText:$("<img/>").attr({src:buttonImage,alt:buttonText,title:buttonText})));input[isRTL?"before":"after"](inst.trigger);inst.trigger.click(function(){if($.datepicker._datepickerShowing&&$.datepicker._lastInput==target){$.datepicker._hideDatepicker()}else{$.datepicker._showDatepicker(target)}return false})}input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});$.data(target,PROP_NAME,inst)},_inlineDatepicker:function(target,inst){var divSpan=$(target);if(divSpan.hasClass(this.markerClassName)){return}divSpan.addClass(this.markerClassName).append(inst.dpDiv).bind("setData.datepicker",function(event,key,value){inst.settings[key]=value}).bind("getData.datepicker",function(event,key){return this._get(inst,key)});$.data(target,PROP_NAME,inst);this._setDate(inst,this._getDefaultDate(inst));this._updateDatepicker(inst);this._updateAlternate(inst)},_dialogDatepicker:function(input,dateText,onSelect,settings,pos){var inst=this._dialogInst;if(!inst){var id="dp"+(++this.uuid);this._dialogInput=$('<input type="text" id="'+id+'" size="1" style="position: absolute; top: -100px;"/>');this._dialogInput.keydown(this._doKeyDown);$("body").append(this._dialogInput);inst=this._dialogInst=this._newInst(this._dialogInput,false);inst.settings={};$.data(this._dialogInput[0],PROP_NAME,inst)}extendRemove(inst.settings,settings||{});this._dialogInput.val(dateText);this._pos=(pos?(pos.length?pos:[pos.pageX,pos.pageY]):null);if(!this._pos){var browserWidth=window.innerWidth||document.documentElement.clientWidth||document.body.clientWidth;var browserHeight=window.innerHeight||document.documentElement.clientHeight||document.body.clientHeight;var scrollX=document.documentElement.scrollLeft||document.body.scrollLeft;var scrollY=document.documentElement.scrollTop||document.body.scrollTop;this._pos=[(browserWidth/2)-100+scrollX,(browserHeight/2)-150+scrollY]}this._dialogInput.css("left",this._pos[0]+"px").css("top",this._pos[1]+"px");inst.settings.onSelect=onSelect;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);if($.blockUI){$.blockUI(this.dpDiv)}$.data(this._dialogInput[0],PROP_NAME,inst);return this},_destroyDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();$.removeData(target,PROP_NAME);if(nodeName=="input"){inst.append.remove();inst.trigger.remove();$target.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress)}else{if(nodeName=="div"||nodeName=="span"){$target.removeClass(this.markerClassName).empty()}}},_enableDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=false;inst.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else{if(nodeName=="div"||nodeName=="span"){var inline=$target.children("."+this._inlineClass);inline.children().removeClass("ui-state-disabled")}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)})},_disableDatepicker:function(target){var $target=$(target);var inst=$.data(target,PROP_NAME);if(!$target.hasClass(this.markerClassName)){return}var nodeName=target.nodeName.toLowerCase();if(nodeName=="input"){target.disabled=true;inst.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else{if(nodeName=="div"||nodeName=="span"){var inline=$target.children("."+this._inlineClass);inline.children().addClass("ui-state-disabled")}}this._disabledInputs=$.map(this._disabledInputs,function(value){return(value==target?null:value)});this._disabledInputs[this._disabledInputs.length]=target},_isDisabledDatepicker:function(target){if(!target){return false}for(var i=0;i<this._disabledInputs.length;i++){if(this._disabledInputs[i]==target){return true}}return false},_getInst:function(target){try{return $.data(target,PROP_NAME)}catch(err){throw"Missing instance data for this datepicker"}},_optionDatepicker:function(target,name,value){var inst=this._getInst(target);if(arguments.length==2&&typeof name=="string"){return(name=="defaults"?$.extend({},$.datepicker._defaults):(inst?(name=="all"?$.extend({},inst.settings):this._get(inst,name)):null))}var settings=name||{};if(typeof name=="string"){settings={};settings[name]=value}if(inst){if(this._curInst==inst){this._hideDatepicker(null)}var date=this._getDateDatepicker(target);extendRemove(inst.settings,settings);this._setDateDatepicker(target,date);this._updateDatepicker(inst)}},_changeDatepicker:function(target,name,value){this._optionDatepicker(target,name,value)},_refreshDatepicker:function(target){var inst=this._getInst(target);if(inst){this._updateDatepicker(inst)}},_setDateDatepicker:function(target,date,endDate){var inst=this._getInst(target);if(inst){this._setDate(inst,date,endDate);this._updateDatepicker(inst);this._updateAlternate(inst)}},_getDateDatepicker:function(target){var inst=this._getInst(target);if(inst&&!inst.inline){this._setDateFromField(inst)}return(inst?this._getDate(inst):null)},_doKeyDown:function(event){var inst=$.datepicker._getInst(event.target);var handled=true;var isRTL=inst.dpDiv.is(".ui-datepicker-rtl");inst._keyEvent=true;if($.datepicker._datepickerShowing){switch(event.keyCode){case 9:$.datepicker._hideDatepicker(null,"");break;case 13:var sel=$("td."+$.datepicker._dayOverClass+", td."+$.datepicker._currentClass,inst.dpDiv);if(sel[0]){$.datepicker._selectDay(event.target,inst.selectedMonth,inst.selectedYear,sel[0])}else{$.datepicker._hideDatepicker(null,$.datepicker._get(inst,"duration"))}return false;break;case 27:$.datepicker._hideDatepicker(null,$.datepicker._get(inst,"duration"));break;case 33:$.datepicker._adjustDate(event.target,(event.ctrlKey?-$.datepicker._get(inst,"stepBigMonths"):-$.datepicker._get(inst,"stepMonths")),"M");break;case 34:$.datepicker._adjustDate(event.target,(event.ctrlKey?+$.datepicker._get(inst,"stepBigMonths"):+$.datepicker._get(inst,"stepMonths")),"M");break;case 35:if(event.ctrlKey||event.metaKey){$.datepicker._clearDate(event.target)}handled=event.ctrlKey||event.metaKey;break;case 36:if(event.ctrlKey||event.metaKey){$.datepicker._gotoToday(event.target)}handled=event.ctrlKey||event.metaKey;break;case 37:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,(isRTL?+1:-1),"D")}handled=event.ctrlKey||event.metaKey;if(event.originalEvent.altKey){$.datepicker._adjustDate(event.target,(event.ctrlKey?-$.datepicker._get(inst,"stepBigMonths"):-$.datepicker._get(inst,"stepMonths")),"M")}break;case 38:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,-7,"D")}handled=event.ctrlKey||event.metaKey;break;case 39:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,(isRTL?-1:+1),"D")}handled=event.ctrlKey||event.metaKey;if(event.originalEvent.altKey){$.datepicker._adjustDate(event.target,(event.ctrlKey?+$.datepicker._get(inst,"stepBigMonths"):+$.datepicker._get(inst,"stepMonths")),"M")}break;case 40:if(event.ctrlKey||event.metaKey){$.datepicker._adjustDate(event.target,+7,"D")}handled=event.ctrlKey||event.metaKey;break;default:handled=false}}else{if(event.keyCode==36&&event.ctrlKey){$.datepicker._showDatepicker(this)}else{handled=false}}if(handled){event.preventDefault();event.stopPropagation()}},_doKeyPress:function(event){var inst=$.datepicker._getInst(event.target);if($.datepicker._get(inst,"constrainInput")){var chars=$.datepicker._possibleChars($.datepicker._get(inst,"dateFormat"));var chr=String.fromCharCode(event.charCode==undefined?event.keyCode:event.charCode);return event.ctrlKey||(chr<" "||!chars||chars.indexOf(chr)>-1)}},_showDatepicker:function(input){input=input.target||input;if(input.nodeName.toLowerCase()!="input"){input=$("input",input.parentNode)[0]}if($.datepicker._isDisabledDatepicker(input)||$.datepicker._lastInput==input){return}var inst=$.datepicker._getInst(input);var beforeShow=$.datepicker._get(inst,"beforeShow");extendRemove(inst.settings,(beforeShow?beforeShow.apply(input,[input,inst]):{}));$.datepicker._hideDatepicker(null,"");$.datepicker._lastInput=input;$.datepicker._setDateFromField(inst);if($.datepicker._inDialog){input.value=""}if(!$.datepicker._pos){$.datepicker._pos=$.datepicker._findPos(input);$.datepicker._pos[1]+=input.offsetHeight}var isFixed=false;$(input).parents().each(function(){isFixed|=$(this).css("position")=="fixed";return !isFixed});if(isFixed&&$.browser.opera){$.datepicker._pos[0]-=document.documentElement.scrollLeft;$.datepicker._pos[1]-=document.documentElement.scrollTop}var offset={left:$.datepicker._pos[0],top:$.datepicker._pos[1]};$.datepicker._pos=null;inst.rangeStart=null;inst.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});$.datepicker._updateDatepicker(inst);offset=$.datepicker._checkOffset(inst,offset,isFixed);inst.dpDiv.css({position:($.datepicker._inDialog&&$.blockUI?"static":(isFixed?"fixed":"absolute")),display:"none",left:offset.left+"px",top:offset.top+"px"});if(!inst.inline){var showAnim=$.datepicker._get(inst,"showAnim")||"show";var duration=$.datepicker._get(inst,"duration");var postProcess=function(){$.datepicker._datepickerShowing=true;if($.browser.msie&&parseInt($.browser.version,10)<7){$("iframe.ui-datepicker-cover").css({width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4})}};if($.effects&&$.effects[showAnim]){inst.dpDiv.show(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[showAnim](duration,postProcess)}if(duration==""){postProcess()}if(inst.input[0].type!="hidden"){inst.input[0].focus()}$.datepicker._curInst=inst}},_updateDatepicker:function(inst){var dims={width:inst.dpDiv.width()+4,height:inst.dpDiv.height()+4};var self=this;inst.dpDiv.empty().append(this._generateHTML(inst)).find("iframe.ui-datepicker-cover").css({width:dims.width,height:dims.height}).end().find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){$(this).removeClass("ui-state-hover");if(this.className.indexOf("ui-datepicker-prev")!=-1){$(this).removeClass("ui-datepicker-prev-hover")}if(this.className.indexOf("ui-datepicker-next")!=-1){$(this).removeClass("ui-datepicker-next-hover")}}).bind("mouseover",function(){if(!self._isDisabledDatepicker(inst.inline?inst.dpDiv.parent()[0]:inst.input[0])){$(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");$(this).addClass("ui-state-hover");if(this.className.indexOf("ui-datepicker-prev")!=-1){$(this).addClass("ui-datepicker-prev-hover")}if(this.className.indexOf("ui-datepicker-next")!=-1){$(this).addClass("ui-datepicker-next-hover")}}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();var numMonths=this._getNumberOfMonths(inst);var cols=numMonths[1];var width=17;if(cols>1){inst.dpDiv.addClass("ui-datepicker-multi-"+cols).css("width",(width*cols)+"em")}else{inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("")}inst.dpDiv[(numMonths[0]!=1||numMonths[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");inst.dpDiv[(this._get(inst,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");if(inst.input&&inst.input[0].type!="hidden"&&inst==$.datepicker._curInst){$(inst.input[0]).focus()}},_checkOffset:function(inst,offset,isFixed){var dpWidth=inst.dpDiv.outerWidth();var dpHeight=inst.dpDiv.outerHeight();var inputWidth=inst.input?inst.input.outerWidth():0;var inputHeight=inst.input?inst.input.outerHeight():0;var viewWidth=(window.innerWidth||document.documentElement.clientWidth||document.body.clientWidth)+$(document).scrollLeft();var viewHeight=(window.innerHeight||document.documentElement.clientHeight||document.body.clientHeight)+$(document).scrollTop();offset.left-=(this._get(inst,"isRTL")?(dpWidth-inputWidth):0);offset.left-=(isFixed&&offset.left==inst.input.offset().left)?$(document).scrollLeft():0;offset.top-=(isFixed&&offset.top==(inst.input.offset().top+inputHeight))?$(document).scrollTop():0;offset.left-=(offset.left+dpWidth>viewWidth&&viewWidth>dpWidth)?Math.abs(offset.left+dpWidth-viewWidth):0;offset.top-=(offset.top+dpHeight>viewHeight&&viewHeight>dpHeight)?Math.abs(offset.top+dpHeight+inputHeight*2-viewHeight):0;return offset},_findPos:function(obj){while(obj&&(obj.type=="hidden"||obj.nodeType!=1)){obj=obj.nextSibling}var position=$(obj).offset();return[position.left,position.top]},_hideDatepicker:function(input,duration){var inst=this._curInst;if(!inst||(input&&inst!=$.data(input,PROP_NAME))){return}if(inst.stayOpen){this._selectDate("#"+inst.id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear))}inst.stayOpen=false;if(this._datepickerShowing){duration=(duration!=null?duration:this._get(inst,"duration"));var showAnim=this._get(inst,"showAnim");var postProcess=function(){$.datepicker._tidyDialog(inst)};if(duration!=""&&$.effects&&$.effects[showAnim]){inst.dpDiv.hide(showAnim,$.datepicker._get(inst,"showOptions"),duration,postProcess)}else{inst.dpDiv[(duration==""?"hide":(showAnim=="slideDown"?"slideUp":(showAnim=="fadeIn"?"fadeOut":"hide")))](duration,postProcess)}if(duration==""){this._tidyDialog(inst)}var onClose=this._get(inst,"onClose");if(onClose){onClose.apply((inst.input?inst.input[0]:null),[(inst.input?inst.input.val():""),inst])}this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if($.blockUI){$.unblockUI();$("body").append(this.dpDiv)}}this._inDialog=false}this._curInst=null},_tidyDialog:function(inst){inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(event){if(!$.datepicker._curInst){return}var $target=$(event.target);if(($target.parents("#"+$.datepicker._mainDivId).length==0)&&!$target.hasClass($.datepicker.markerClassName)&&!$target.hasClass($.datepicker._triggerClass)&&$.datepicker._datepickerShowing&&!($.datepicker._inDialog&&$.blockUI)){$.datepicker._hideDatepicker(null,"")}},_adjustDate:function(id,offset,period){var target=$(id);var inst=this._getInst(target[0]);if(this._isDisabledDatepicker(target[0])){return}this._adjustInstDate(inst,offset+(period=="M"?this._get(inst,"showCurrentAtPos"):0),period);this._updateDatepicker(inst)},_gotoToday:function(id){var target=$(id);var inst=this._getInst(target[0]);if(this._get(inst,"gotoCurrent")&&inst.currentDay){inst.selectedDay=inst.currentDay;inst.drawMonth=inst.selectedMonth=inst.currentMonth;inst.drawYear=inst.selectedYear=inst.currentYear}else{var date=new Date();inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear()}this._notifyChange(inst);this._adjustDate(target)},_selectMonthYear:function(id,select,period){var target=$(id);var inst=this._getInst(target[0]);inst._selectingMonthYear=false;inst["selected"+(period=="M"?"Month":"Year")]=inst["draw"+(period=="M"?"Month":"Year")]=parseInt(select.options[select.selectedIndex].value,10);this._notifyChange(inst);this._adjustDate(target)},_clickMonthYear:function(id){var target=$(id);var inst=this._getInst(target[0]);if(inst.input&&inst._selectingMonthYear&&!$.browser.msie){inst.input[0].focus()}inst._selectingMonthYear=!inst._selectingMonthYear},_selectDay:function(id,month,year,td){var target=$(id);if($(td).hasClass(this._unselectableClass)||this._isDisabledDatepicker(target[0])){return}var inst=this._getInst(target[0]);inst.selectedDay=inst.currentDay=$("a",td).html();inst.selectedMonth=inst.currentMonth=month;inst.selectedYear=inst.currentYear=year;if(inst.stayOpen){inst.endDay=inst.endMonth=inst.endYear=null}this._selectDate(id,this._formatDate(inst,inst.currentDay,inst.currentMonth,inst.currentYear));if(inst.stayOpen){inst.rangeStart=this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay));this._updateDatepicker(inst)}},_clearDate:function(id){var target=$(id);var inst=this._getInst(target[0]);inst.stayOpen=false;inst.endDay=inst.endMonth=inst.endYear=inst.rangeStart=null;this._selectDate(target,"")},_selectDate:function(id,dateStr){var target=$(id);var inst=this._getInst(target[0]);dateStr=(dateStr!=null?dateStr:this._formatDate(inst));if(inst.input){inst.input.val(dateStr)}this._updateAlternate(inst);var onSelect=this._get(inst,"onSelect");if(onSelect){onSelect.apply((inst.input?inst.input[0]:null),[dateStr,inst])}else{if(inst.input){inst.input.trigger("change")}}if(inst.inline){this._updateDatepicker(inst)}else{if(!inst.stayOpen){this._hideDatepicker(null,this._get(inst,"duration"));this._lastInput=inst.input[0];if(typeof(inst.input[0])!="object"){inst.input[0].focus()}this._lastInput=null}}},_updateAlternate:function(inst){var altField=this._get(inst,"altField");if(altField){var altFormat=this._get(inst,"altFormat")||this._get(inst,"dateFormat");var date=this._getDate(inst);dateStr=this.formatDate(altFormat,date,this._getFormatConfig(inst));$(altField).each(function(){$(this).val(dateStr)})}},noWeekends:function(date){var day=date.getDay();return[(day>0&&day<6),""]},iso8601Week:function(date){var checkDate=new Date(date.getFullYear(),date.getMonth(),date.getDate());var firstMon=new Date(checkDate.getFullYear(),1-1,4);var firstDay=firstMon.getDay()||7;firstMon.setDate(firstMon.getDate()+1-firstDay);if(firstDay<4&&checkDate<firstMon){checkDate.setDate(checkDate.getDate()-3);return $.datepicker.iso8601Week(checkDate)}else{if(checkDate>new Date(checkDate.getFullYear(),12-1,28)){firstDay=new Date(checkDate.getFullYear()+1,1-1,4).getDay()||7;if(firstDay>4&&(checkDate.getDay()||7)<firstDay-3){return 1}}}return Math.floor(((checkDate-firstMon)/86400000)/7)+1},parseDate:function(format,value,settings){if(format==null||value==null){throw"Invalid arguments"}value=(typeof value=="object"?value.toString():value+"");if(value==""){return null}var shortYearCutoff=(settings?settings.shortYearCutoff:null)||this._defaults.shortYearCutoff;var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var year=-1;var month=-1;var day=-1;var doy=-1;var literal=false;var lookAhead=function(match){var matches=(iFormat+1<format.length&&format.charAt(iFormat+1)==match);if(matches){iFormat++}return matches};var getNumber=function(match){lookAhead(match);var origSize=(match=="@"?14:(match=="y"?4:(match=="o"?3:2)));var size=origSize;var num=0;while(size>0&&iValue<value.length&&value.charAt(iValue)>="0"&&value.charAt(iValue)<="9"){num=num*10+parseInt(value.charAt(iValue++),10);size--}if(size==origSize){throw"Missing number at position "+iValue}return num};var getName=function(match,shortNames,longNames){var names=(lookAhead(match)?longNames:shortNames);var size=0;for(var j=0;j<names.length;j++){size=Math.max(size,names[j].length)}var name="";var iInit=iValue;while(size>0&&iValue<value.length){name+=value.charAt(iValue++);for(var i=0;i<names.length;i++){if(name==names[i]){return i+1}}size--}throw"Unknown name at position "+iInit};var checkLiteral=function(){if(value.charAt(iValue)!=format.charAt(iFormat)){throw"Unexpected literal at position "+iValue}iValue++};var iValue=0;for(var iFormat=0;iFormat<format.length;iFormat++){if(literal){if(format.charAt(iFormat)=="'"&&!lookAhead("'")){literal=false}else{checkLiteral()}}else{switch(format.charAt(iFormat)){case"d":day=getNumber("d");break;case"D":getName("D",dayNamesShort,dayNames);break;case"o":doy=getNumber("o");break;case"m":month=getNumber("m");break;case"M":month=getName("M",monthNamesShort,monthNames);break;case"y":year=getNumber("y");break;case"@":var date=new Date(getNumber("@"));year=date.getFullYear();month=date.getMonth()+1;day=date.getDate();break;case"'":if(lookAhead("'")){checkLiteral()}else{literal=true}break;default:checkLiteral()}}}if(year==-1){year=new Date().getFullYear()}else{if(year<100){year+=new Date().getFullYear()-new Date().getFullYear()%100+(year<=shortYearCutoff?0:-100)}}if(doy>-1){month=1;day=doy;do{var dim=this._getDaysInMonth(year,month-1);if(day<=dim){break}month++;day-=dim}while(true)}var date=this._daylightSavingAdjust(new Date(year,month-1,day));if(date.getFullYear()!=year||date.getMonth()+1!=month||date.getDate()!=day){throw"Invalid date"}return date},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TIMESTAMP:"@",W3C:"yy-mm-dd",formatDate:function(format,date,settings){if(!date){return""}var dayNamesShort=(settings?settings.dayNamesShort:null)||this._defaults.dayNamesShort;var dayNames=(settings?settings.dayNames:null)||this._defaults.dayNames;var monthNamesShort=(settings?settings.monthNamesShort:null)||this._defaults.monthNamesShort;var monthNames=(settings?settings.monthNames:null)||this._defaults.monthNames;var lookAhead=function(match){var matches=(iFormat+1<format.length&&format.charAt(iFormat+1)==match);if(matches){iFormat++}return matches};var formatNumber=function(match,value,len){var num=""+value;if(lookAhead(match)){while(num.length<len){num="0"+num}}return num};var formatName=function(match,value,shortNames,longNames){return(lookAhead(match)?longNames[value]:shortNames[value])};var output="";var literal=false;if(date){for(var iFormat=0;iFormat<format.length;iFormat++){if(literal){if(format.charAt(iFormat)=="'"&&!lookAhead("'")){literal=false}else{output+=format.charAt(iFormat)}}else{switch(format.charAt(iFormat)){case"d":output+=formatNumber("d",date.getDate(),2);break;case"D":output+=formatName("D",date.getDay(),dayNamesShort,dayNames);break;case"o":var doy=date.getDate();for(var m=date.getMonth()-1;m>=0;m--){doy+=this._getDaysInMonth(date.getFullYear(),m)}output+=formatNumber("o",doy,3);break;case"m":output+=formatNumber("m",date.getMonth()+1,2);break;case"M":output+=formatName("M",date.getMonth(),monthNamesShort,monthNames);break;case"y":output+=(lookAhead("y")?date.getFullYear():(date.getYear()%100<10?"0":"")+date.getYear()%100);break;case"@":output+=date.getTime();break;case"'":if(lookAhead("'")){output+="'"}else{literal=true}break;default:output+=format.charAt(iFormat)}}}}return output},_possibleChars:function(format){var chars="";var literal=false;for(var iFormat=0;iFormat<format.length;iFormat++){if(literal){if(format.charAt(iFormat)=="'"&&!lookAhead("'")){literal=false}else{chars+=format.charAt(iFormat)}}else{switch(format.charAt(iFormat)){case"d":case"m":case"y":case"@":chars+="0123456789";break;case"D":case"M":return null;case"'":if(lookAhead("'")){chars+="'"}else{literal=true}break;default:chars+=format.charAt(iFormat)}}}return chars},_get:function(inst,name){return inst.settings[name]!==undefined?inst.settings[name]:this._defaults[name]},_setDateFromField:function(inst){var dateFormat=this._get(inst,"dateFormat");var dates=inst.input?inst.input.val():null;inst.endDay=inst.endMonth=inst.endYear=null;var date=defaultDate=this._getDefaultDate(inst);var settings=this._getFormatConfig(inst);try{date=this.parseDate(dateFormat,dates,settings)||defaultDate}catch(event){this.log(event);date=defaultDate}inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();inst.currentDay=(dates?date.getDate():0);inst.currentMonth=(dates?date.getMonth():0);inst.currentYear=(dates?date.getFullYear():0);this._adjustInstDate(inst)},_getDefaultDate:function(inst){var date=this._determineDate(this._get(inst,"defaultDate"),new Date());var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");date=(minDate&&date<minDate?minDate:date);date=(maxDate&&date>maxDate?maxDate:date);return date},_determineDate:function(date,defaultDate){var offsetNumeric=function(offset){var date=new Date();date.setDate(date.getDate()+offset);return date};var offsetString=function(offset,getDaysInMonth){var date=new Date();var year=date.getFullYear();var month=date.getMonth();var day=date.getDate();var pattern=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;var matches=pattern.exec(offset);while(matches){switch(matches[2]||"d"){case"d":case"D":day+=parseInt(matches[1],10);break;case"w":case"W":day+=parseInt(matches[1],10)*7;break;case"m":case"M":month+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break;case"y":case"Y":year+=parseInt(matches[1],10);day=Math.min(day,getDaysInMonth(year,month));break}matches=pattern.exec(offset)}return new Date(year,month,day)};date=(date==null?defaultDate:(typeof date=="string"?offsetString(date,this._getDaysInMonth):(typeof date=="number"?(isNaN(date)?defaultDate:offsetNumeric(date)):date)));date=(date&&date.toString()=="Invalid Date"?defaultDate:date);if(date){date.setHours(0);date.setMinutes(0);date.setSeconds(0);date.setMilliseconds(0)}return this._daylightSavingAdjust(date)},_daylightSavingAdjust:function(date){if(!date){return null}date.setHours(date.getHours()>12?date.getHours()+2:0);return date},_setDate:function(inst,date,endDate){var clear=!(date);var origMonth=inst.selectedMonth;var origYear=inst.selectedYear;date=this._determineDate(date,new Date());inst.selectedDay=inst.currentDay=date.getDate();inst.drawMonth=inst.selectedMonth=inst.currentMonth=date.getMonth();inst.drawYear=inst.selectedYear=inst.currentYear=date.getFullYear();if(origMonth!=inst.selectedMonth||origYear!=inst.selectedYear){this._notifyChange(inst)}this._adjustInstDate(inst);if(inst.input){inst.input.val(clear?"":this._formatDate(inst))}},_getDate:function(inst){var startDate=(!inst.currentYear||(inst.input&&inst.input.val()=="")?null:this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return startDate},_generateHTML:function(inst){var today=new Date();today=this._daylightSavingAdjust(new Date(today.getFullYear(),today.getMonth(),today.getDate()));var isRTL=this._get(inst,"isRTL");var showButtonPanel=this._get(inst,"showButtonPanel");var hideIfNoPrevNext=this._get(inst,"hideIfNoPrevNext");var navigationAsDateFormat=this._get(inst,"navigationAsDateFormat");var numMonths=this._getNumberOfMonths(inst);var showCurrentAtPos=this._get(inst,"showCurrentAtPos");var stepMonths=this._get(inst,"stepMonths");var stepBigMonths=this._get(inst,"stepBigMonths");var isMultiMonth=(numMonths[0]!=1||numMonths[1]!=1);var currentDate=this._daylightSavingAdjust((!inst.currentDay?new Date(9999,9,9):new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");var drawMonth=inst.drawMonth-showCurrentAtPos;var drawYear=inst.drawYear;if(drawMonth<0){drawMonth+=12;drawYear--}if(maxDate){var maxDraw=this._daylightSavingAdjust(new Date(maxDate.getFullYear(),maxDate.getMonth()-numMonths[1]+1,maxDate.getDate()));maxDraw=(minDate&&maxDraw<minDate?minDate:maxDraw);while(this._daylightSavingAdjust(new Date(drawYear,drawMonth,1))>maxDraw){drawMonth--;if(drawMonth<0){drawMonth=11;drawYear--}}}inst.drawMonth=drawMonth;inst.drawYear=drawYear;var prevText=this._get(inst,"prevText");prevText=(!navigationAsDateFormat?prevText:this.formatDate(prevText,this._daylightSavingAdjust(new Date(drawYear,drawMonth-stepMonths,1)),this._getFormatConfig(inst)));var prev=(this._canAdjustMonth(inst,-1,drawYear,drawMonth)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#'+inst.id+"', -"+stepMonths+", 'M');\" title=\""+prevText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"e":"w")+'">'+prevText+"</span></a>":(hideIfNoPrevNext?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+prevText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"e":"w")+'">'+prevText+"</span></a>"));var nextText=this._get(inst,"nextText");nextText=(!navigationAsDateFormat?nextText:this.formatDate(nextText,this._daylightSavingAdjust(new Date(drawYear,drawMonth+stepMonths,1)),this._getFormatConfig(inst)));var next=(this._canAdjustMonth(inst,+1,drawYear,drawMonth)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#'+inst.id+"', +"+stepMonths+", 'M');\" title=\""+nextText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"w":"e")+'">'+nextText+"</span></a>":(hideIfNoPrevNext?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+nextText+'"><span class="ui-icon ui-icon-circle-triangle-'+(isRTL?"w":"e")+'">'+nextText+"</span></a>"));var currentText=this._get(inst,"currentText");var gotoDate=(this._get(inst,"gotoCurrent")&&inst.currentDay?currentDate:today);currentText=(!navigationAsDateFormat?currentText:this.formatDate(currentText,gotoDate,this._getFormatConfig(inst)));var controls=(!inst.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery.datepicker._hideDatepicker();">'+this._get(inst,"closeText")+"</button>":"");var buttonPanel=(showButtonPanel)?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(isRTL?controls:"")+(this._isInRange(inst,gotoDate)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery.datepicker._gotoToday(\'#'+inst.id+"');\">"+currentText+"</button>":"")+(isRTL?"":controls)+"</div>":"";var firstDay=parseInt(this._get(inst,"firstDay"),10);firstDay=(isNaN(firstDay)?0:firstDay);var dayNames=this._get(inst,"dayNames");var dayNamesShort=this._get(inst,"dayNamesShort");var dayNamesMin=this._get(inst,"dayNamesMin");var monthNames=this._get(inst,"monthNames");var monthNamesShort=this._get(inst,"monthNamesShort");var beforeShowDay=this._get(inst,"beforeShowDay");var showOtherMonths=this._get(inst,"showOtherMonths");var calculateWeek=this._get(inst,"calculateWeek")||this.iso8601Week;var endDate=inst.endDay?this._daylightSavingAdjust(new Date(inst.endYear,inst.endMonth,inst.endDay)):currentDate;var defaultDate=this._getDefaultDate(inst);var html="";for(var row=0;row<numMonths[0];row++){var group="";for(var col=0;col<numMonths[1];col++){var selectedDate=this._daylightSavingAdjust(new Date(drawYear,drawMonth,inst.selectedDay));var cornerClass=" ui-corner-all";var calender="";if(isMultiMonth){calender+='<div class="ui-datepicker-group ui-datepicker-group-';switch(col){case 0:calender+="first";cornerClass=" ui-corner-"+(isRTL?"right":"left");break;case numMonths[1]-1:calender+="last";cornerClass=" ui-corner-"+(isRTL?"left":"right");break;default:calender+="middle";cornerClass="";break}calender+='">'}calender+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+cornerClass+'">'+(/all|left/.test(cornerClass)&&row==0?(isRTL?next:prev):"")+(/all|right/.test(cornerClass)&&row==0?(isRTL?prev:next):"")+this._generateMonthYearHeader(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,row>0||col>0,monthNames,monthNamesShort)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var thead="";for(var dow=0;dow<7;dow++){var day=(dow+firstDay)%7;thead+="<th"+((dow+firstDay+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+dayNames[day]+'">'+dayNamesMin[day]+"</span></th>"}calender+=thead+"</tr></thead><tbody>";var daysInMonth=this._getDaysInMonth(drawYear,drawMonth);if(drawYear==inst.selectedYear&&drawMonth==inst.selectedMonth){inst.selectedDay=Math.min(inst.selectedDay,daysInMonth)}var leadDays=(this._getFirstDayOfMonth(drawYear,drawMonth)-firstDay+7)%7;var numRows=(isMultiMonth?6:Math.ceil((leadDays+daysInMonth)/7));var printDate=this._daylightSavingAdjust(new Date(drawYear,drawMonth,1-leadDays));for(var dRow=0;dRow<numRows;dRow++){calender+="<tr>";var tbody="";for(var dow=0;dow<7;dow++){var daySettings=(beforeShowDay?beforeShowDay.apply((inst.input?inst.input[0]:null),[printDate]):[true,""]);var otherMonth=(printDate.getMonth()!=drawMonth);var unselectable=otherMonth||!daySettings[0]||(minDate&&printDate<minDate)||(maxDate&&printDate>maxDate);tbody+='<td class="'+((dow+firstDay+6)%7>=5?" ui-datepicker-week-end":"")+(otherMonth?" ui-datepicker-other-month":"")+((printDate.getTime()==selectedDate.getTime()&&drawMonth==inst.selectedMonth&&inst._keyEvent)||(defaultDate.getTime()==printDate.getTime()&&defaultDate.getTime()==selectedDate.getTime())?" "+this._dayOverClass:"")+(unselectable?" "+this._unselectableClass+" ui-state-disabled":"")+(otherMonth&&!showOtherMonths?"":" "+daySettings[1]+(printDate.getTime()>=currentDate.getTime()&&printDate.getTime()<=endDate.getTime()?" "+this._currentClass:"")+(printDate.getTime()==today.getTime()?" ui-datepicker-today":""))+'"'+((!otherMonth||showOtherMonths)&&daySettings[2]?' title="'+daySettings[2]+'"':"")+(unselectable?"":" onclick=\"DP_jQuery.datepicker._selectDay('#"+inst.id+"',"+drawMonth+","+drawYear+', this);return false;"')+">"+(otherMonth?(showOtherMonths?printDate.getDate():" "):(unselectable?'<span class="ui-state-default">'+printDate.getDate()+"</span>":'<a class="ui-state-default'+(printDate.getTime()==today.getTime()?" ui-state-highlight":"")+(printDate.getTime()>=currentDate.getTime()&&printDate.getTime()<=endDate.getTime()?" ui-state-active":"")+'" href="#">'+printDate.getDate()+"</a>"))+"</td>";printDate.setDate(printDate.getDate()+1);printDate=this._daylightSavingAdjust(printDate)}calender+=tbody+"</tr>"}drawMonth++;if(drawMonth>11){drawMonth=0;drawYear++}calender+="</tbody></table>"+(isMultiMonth?"</div>"+((numMonths[0]>0&&col==numMonths[1]-1)?'<div class="ui-datepicker-row-break"></div>':""):"");group+=calender}html+=group}html+=buttonPanel+($.browser.msie&&parseInt($.browser.version,10)<7&&!inst.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");inst._keyEvent=false;return html},_generateMonthYearHeader:function(inst,drawMonth,drawYear,minDate,maxDate,selectedDate,secondary,monthNames,monthNamesShort){minDate=(inst.rangeStart&&minDate&&selectedDate<minDate?selectedDate:minDate);var changeMonth=this._get(inst,"changeMonth");var changeYear=this._get(inst,"changeYear");var showMonthAfterYear=this._get(inst,"showMonthAfterYear");var html='<div class="ui-datepicker-title">';var monthHtml="";if(secondary||!changeMonth){monthHtml+='<span class="ui-datepicker-month">'+monthNames[drawMonth]+"</span> "}else{var inMinYear=(minDate&&minDate.getFullYear()==drawYear);var inMaxYear=(maxDate&&maxDate.getFullYear()==drawYear);monthHtml+='<select class="ui-datepicker-month" onchange="DP_jQuery.datepicker._selectMonthYear(\'#'+inst.id+"', this, 'M');\" onclick=\"DP_jQuery.datepicker._clickMonthYear('#"+inst.id+"');\">";for(var month=0;month<12;month++){if((!inMinYear||month>=minDate.getMonth())&&(!inMaxYear||month<=maxDate.getMonth())){monthHtml+='<option value="'+month+'"'+(month==drawMonth?' selected="selected"':"")+">"+monthNamesShort[month]+"</option>"}}monthHtml+="</select>"}if(!showMonthAfterYear){html+=monthHtml+((secondary||changeMonth||changeYear)&&(!(changeMonth&&changeYear))?" ":"")}if(secondary||!changeYear){html+='<span class="ui-datepicker-year">'+drawYear+"</span>"}else{var years=this._get(inst,"yearRange").split(":");var year=0;var endYear=0;if(years.length!=2){year=drawYear-10;endYear=drawYear+10}else{if(years[0].charAt(0)=="+"||years[0].charAt(0)=="-"){year=drawYear+parseInt(years[0],10);endYear=drawYear+parseInt(years[1],10)}else{year=parseInt(years[0],10);endYear=parseInt(years[1],10)}}year=(minDate?Math.max(year,minDate.getFullYear()):year);endYear=(maxDate?Math.min(endYear,maxDate.getFullYear()):endYear);html+='<select class="ui-datepicker-year" onchange="DP_jQuery.datepicker._selectMonthYear(\'#'+inst.id+"', this, 'Y');\" onclick=\"DP_jQuery.datepicker._clickMonthYear('#"+inst.id+"');\">";for(;year<=endYear;year++){html+='<option value="'+year+'"'+(year==drawYear?' selected="selected"':"")+">"+year+"</option>"}html+="</select>"}if(showMonthAfterYear){html+=(secondary||changeMonth||changeYear?" ":"")+monthHtml}html+="</div>";return html},_adjustInstDate:function(inst,offset,period){var year=inst.drawYear+(period=="Y"?offset:0);var month=inst.drawMonth+(period=="M"?offset:0);var day=Math.min(inst.selectedDay,this._getDaysInMonth(year,month))+(period=="D"?offset:0);var date=this._daylightSavingAdjust(new Date(year,month,day));var minDate=this._getMinMaxDate(inst,"min",true);var maxDate=this._getMinMaxDate(inst,"max");date=(minDate&&date<minDate?minDate:date);date=(maxDate&&date>maxDate?maxDate:date);inst.selectedDay=date.getDate();inst.drawMonth=inst.selectedMonth=date.getMonth();inst.drawYear=inst.selectedYear=date.getFullYear();if(period=="M"||period=="Y"){this._notifyChange(inst)}},_notifyChange:function(inst){var onChange=this._get(inst,"onChangeMonthYear");if(onChange){onChange.apply((inst.input?inst.input[0]:null),[inst.selectedYear,inst.selectedMonth+1,inst])}},_getNumberOfMonths:function(inst){var numMonths=this._get(inst,"numberOfMonths");return(numMonths==null?[1,1]:(typeof numMonths=="number"?[1,numMonths]:numMonths))},_getMinMaxDate:function(inst,minMax,checkRange){var date=this._determineDate(this._get(inst,minMax+"Date"),null);return(!checkRange||!inst.rangeStart?date:(!date||inst.rangeStart>date?inst.rangeStart:date))},_getDaysInMonth:function(year,month){return 32-new Date(year,month,32).getDate()},_getFirstDayOfMonth:function(year,month){return new Date(year,month,1).getDay()},_canAdjustMonth:function(inst,offset,curYear,curMonth){var numMonths=this._getNumberOfMonths(inst);var date=this._daylightSavingAdjust(new Date(curYear,curMonth+(offset<0?offset:numMonths[1]),1));if(offset<0){date.setDate(this._getDaysInMonth(date.getFullYear(),date.getMonth()))}return this._isInRange(inst,date)},_isInRange:function(inst,date){var newMinDate=(!inst.rangeStart?null:this._daylightSavingAdjust(new Date(inst.selectedYear,inst.selectedMonth,inst.selectedDay)));newMinDate=(newMinDate&&inst.rangeStart<newMinDate?inst.rangeStart:newMinDate);var minDate=newMinDate||this._getMinMaxDate(inst,"min");var maxDate=this._getMinMaxDate(inst,"max");return((!minDate||date>=minDate)&&(!maxDate||date<=maxDate))},_getFormatConfig:function(inst){var shortYearCutoff=this._get(inst,"shortYearCutoff");shortYearCutoff=(typeof shortYearCutoff!="string"?shortYearCutoff:new Date().getFullYear()%100+parseInt(shortYearCutoff,10));return{shortYearCutoff:shortYearCutoff,dayNamesShort:this._get(inst,"dayNamesShort"),dayNames:this._get(inst,"dayNames"),monthNamesShort:this._get(inst,"monthNamesShort"),monthNames:this._get(inst,"monthNames")}},_formatDate:function(inst,day,month,year){if(!day){inst.currentDay=inst.selectedDay;inst.currentMonth=inst.selectedMonth;inst.currentYear=inst.selectedYear}var date=(day?(typeof day=="object"?day:this._daylightSavingAdjust(new Date(year,month,day))):this._daylightSavingAdjust(new Date(inst.currentYear,inst.currentMonth,inst.currentDay)));return this.formatDate(this._get(inst,"dateFormat"),date,this._getFormatConfig(inst))}});function extendRemove(target,props){$.extend(target,props);for(var name in props){if(props[name]==null||props[name]==undefined){target[name]=props[name]}}return target}function isArray(a){return(a&&(($.browser.safari&&typeof a=="object"&&a.length)||(a.constructor&&a.constructor.toString().match(/\Array\(\)/))))}$.fn.datepicker=function(options){if(!$.datepicker.initialized){$(document).mousedown($.datepicker._checkExternalClick).find("body").append($.datepicker.dpDiv);$.datepicker.initialized=true}var otherArgs=Array.prototype.slice.call(arguments,1);if(typeof options=="string"&&(options=="isDisabled"||options=="getDate")){return $.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this[0]].concat(otherArgs))}if(options=="option"&&arguments.length==2&&typeof arguments[1]=="string"){return $.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this[0]].concat(otherArgs))}return this.each(function(){typeof options=="string"?$.datepicker["_"+options+"Datepicker"].apply($.datepicker,[this].concat(otherArgs)):$.datepicker._attachDatepicker(this,options)})};$.datepicker=new Datepicker();$.datepicker.initialized=false;$.datepicker.uuid=new Date().getTime();$.datepicker.version="1.7.2";window.DP_jQuery=$})(jQuery);(function(c){var b={dragStart:"start.draggable",drag:"drag.draggable",dragStop:"stop.draggable",maxHeight:"maxHeight.resizable",minHeight:"minHeight.resizable",maxWidth:"maxWidth.resizable",minWidth:"minWidth.resizable",resizeStart:"start.resizable",resize:"drag.resizable",resizeStop:"stop.resizable"},a="ui-dialog ui-widget ui-widget-content ui-corner-all ";c.widget("ui.dialog",{_init:function(){this.originalTitle=this.element.attr("title");var l=this,m=this.options,j=m.title||this.originalTitle||" ",e=c.ui.dialog.getTitleId(this.element),k=(this.uiDialog=c("<div/>")).appendTo(document.body).hide().addClass(a+m.dialogClass).css({position:"absolute",overflow:"hidden",zIndex:m.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(n){(m.closeOnEscape&&n.keyCode&&n.keyCode==c.ui.keyCode.ESCAPE&&l.close(n))}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(n){l.moveToTop(false,n)}),g=this.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(k),f=(this.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(k),i=c('<a href="#"/>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){i.addClass("ui-state-hover")},function(){i.removeClass("ui-state-hover")}).focus(function(){i.addClass("ui-state-focus")}).blur(function(){i.removeClass("ui-state-focus")}).mousedown(function(n){n.stopPropagation()}).click(function(n){l.close(n);return false}).appendTo(f),h=(this.uiDialogTitlebarCloseText=c("<span/>")).addClass("ui-icon ui-icon-closethick").text(m.closeText).appendTo(i),d=c("<span/>").addClass("ui-dialog-title").attr("id",e).html(j).prependTo(f);f.find("*").add(f).disableSelection();(m.draggable&&c.fn.draggable&&this._makeDraggable());(m.resizable&&c.fn.resizable&&this._makeResizable());this._createButtons(m.buttons);this._isOpen=false;(m.bgiframe&&c.fn.bgiframe&&k.bgiframe());(m.autoOpen&&this.open())},destroy:function(){(this.overlay&&this.overlay.destroy());this.uiDialog.hide();this.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");this.uiDialog.remove();(this.originalTitle&&this.element.attr("title",this.originalTitle))},close:function(f){var d=this;if(false===d._trigger("beforeclose",f)){return}(d.overlay&&d.overlay.destroy());d.uiDialog.unbind("keypress.ui-dialog");(d.options.hide?d.uiDialog.hide(d.options.hide,function(){d._trigger("close",f)}):d.uiDialog.hide()&&d._trigger("close",f));c.ui.dialog.overlay.resize();d._isOpen=false;if(d.options.modal){var e=0;c(".ui-dialog").each(function(){if(this!=d.uiDialog[0]){e=Math.max(e,c(this).css("z-index"))}});c.ui.dialog.maxZ=e}},isOpen:function(){return this._isOpen},moveToTop:function(f,e){if((this.options.modal&&!f)||(!this.options.stack&&!this.options.modal)){return this._trigger("focus",e)}if(this.options.zIndex>c.ui.dialog.maxZ){c.ui.dialog.maxZ=this.options.zIndex}(this.overlay&&this.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=++c.ui.dialog.maxZ));var d={scrollTop:this.element.attr("scrollTop"),scrollLeft:this.element.attr("scrollLeft")};this.uiDialog.css("z-index",++c.ui.dialog.maxZ);this.element.attr(d);this._trigger("focus",e)},open:function(){if(this._isOpen){return}var e=this.options,d=this.uiDialog;this.overlay=e.modal?new c.ui.dialog.overlay(this):null;(d.next().length&&d.appendTo("body"));this._size();this._position(e.position);d.show(e.show);this.moveToTop(true);(e.modal&&d.bind("keypress.ui-dialog",function(h){if(h.keyCode!=c.ui.keyCode.TAB){return}var g=c(":tabbable",this),i=g.filter(":first")[0],f=g.filter(":last")[0];if(h.target==f&&!h.shiftKey){setTimeout(function(){i.focus()},1)}else{if(h.target==i&&h.shiftKey){setTimeout(function(){f.focus()},1)}}}));c([]).add(d.find(".ui-dialog-content :tabbable:first")).add(d.find(".ui-dialog-buttonpane :tabbable:first")).add(d).filter(":first").focus();this._trigger("open");this._isOpen=true},_createButtons:function(g){var f=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix");this.uiDialog.find(".ui-dialog-buttonpane").remove();(typeof g=="object"&&g!==null&&c.each(g,function(){return !(d=true)}));if(d){c.each(g,function(h,i){c('<button type="button"></button>').addClass("ui-state-default ui-corner-all").text(h).click(function(){i.apply(f.element[0],arguments)}).hover(function(){c(this).addClass("ui-state-hover")},function(){c(this).removeClass("ui-state-hover")}).focus(function(){c(this).addClass("ui-state-focus")}).blur(function(){c(this).removeClass("ui-state-focus")}).appendTo(e)});e.appendTo(this.uiDialog)}},_makeDraggable:function(){var d=this,f=this.options,e;this.uiDialog.draggable({cancel:".ui-dialog-content",handle:".ui-dialog-titlebar",containment:"document",start:function(){e=f.height;c(this).height(c(this).height()).addClass("ui-dialog-dragging");(f.dragStart&&f.dragStart.apply(d.element[0],arguments))},drag:function(){(f.drag&&f.drag.apply(d.element[0],arguments))},stop:function(){c(this).removeClass("ui-dialog-dragging").height(e);(f.dragStop&&f.dragStop.apply(d.element[0],arguments));c.ui.dialog.overlay.resize()}})},_makeResizable:function(g){g=(g===undefined?this.options.resizable:g);var d=this,f=this.options,e=typeof g=="string"?g:"n,e,s,w,se,sw,ne,nw";this.uiDialog.resizable({cancel:".ui-dialog-content",alsoResize:this.element,maxWidth:f.maxWidth,maxHeight:f.maxHeight,minWidth:f.minWidth,minHeight:f.minHeight,start:function(){c(this).addClass("ui-dialog-resizing");(f.resizeStart&&f.resizeStart.apply(d.element[0],arguments))},resize:function(){(f.resize&&f.resize.apply(d.element[0],arguments))},handles:e,stop:function(){c(this).removeClass("ui-dialog-resizing");f.height=c(this).height();f.width=c(this).width();(f.resizeStop&&f.resizeStop.apply(d.element[0],arguments));c.ui.dialog.overlay.resize()}}).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_position:function(i){var e=c(window),f=c(document),g=f.scrollTop(),d=f.scrollLeft(),h=g;if(c.inArray(i,["center","top","right","bottom","left"])>=0){i=[i=="right"||i=="left"?i:"center",i=="top"||i=="bottom"?i:"middle"]}if(i.constructor!=Array){i=["center","middle"]}if(i[0].constructor==Number){d+=i[0]}else{switch(i[0]){case"left":d+=0;break;case"right":d+=e.width()-this.uiDialog.outerWidth();break;default:case"center":d+=(e.width()-this.uiDialog.outerWidth())/2}}if(i[1].constructor==Number){g+=i[1]}else{switch(i[1]){case"top":g+=0;break;case"bottom":g+=e.height()-this.uiDialog.outerHeight();break;default:case"middle":g+=(e.height()-this.uiDialog.outerHeight())/2}}g=Math.max(g,h);this.uiDialog.css({top:g,left:d})},_setData:function(e,f){(b[e]&&this.uiDialog.data(b[e],f));switch(e){case"buttons":this._createButtons(f);break;case"closeText":this.uiDialogTitlebarCloseText.text(f);break;case"dialogClass":this.uiDialog.removeClass(this.options.dialogClass).addClass(a+f);break;case"draggable":(f?this._makeDraggable():this.uiDialog.draggable("destroy"));break;case"height":this.uiDialog.height(f);break;case"position":this._position(f);break;case"resizable":var d=this.uiDialog,g=this.uiDialog.is(":data(resizable)");(g&&!f&&d.resizable("destroy"));(g&&typeof f=="string"&&d.resizable("option","handles",f));(g||this._makeResizable(f));break;case"title":c(".ui-dialog-title",this.uiDialogTitlebar).html(f||" ");break;case"width":this.uiDialog.width(f);break}c.widget.prototype._setData.apply(this,arguments)},_size:function(){var e=this.options;this.element.css({height:0,minHeight:0,width:"auto"});var d=this.uiDialog.css({height:"auto",width:e.width}).height();this.element.css({minHeight:Math.max(e.minHeight-d,0),height:e.height=="auto"?"auto":Math.max(e.height-d,0)})}});c.extend(c.ui.dialog,{version:"1.7.2",defaults:{autoOpen:true,bgiframe:false,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:"center",resizable:true,show:null,stack:true,title:"",width:300,zIndex:1000},getter:"isOpen",uuid:0,maxZ:0,getTitleId:function(d){return"ui-dialog-title-"+(d.attr("id")||++this.uuid)},overlay:function(d){this.$el=c.ui.dialog.overlay.create(d)}});c.extend(c.ui.dialog.overlay,{instances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(d){return d+".dialog-overlay"}).join(" "),create:function(e){if(this.instances.length===0){setTimeout(function(){if(c.ui.dialog.overlay.instances.length){c(document).bind(c.ui.dialog.overlay.events,function(f){var g=c(f.target).parents(".ui-dialog").css("zIndex")||0;return(g>c.ui.dialog.overlay.maxZ)})}},1);c(document).bind("keydown.dialog-overlay",function(f){(e.options.closeOnEscape&&f.keyCode&&f.keyCode==c.ui.keyCode.ESCAPE&&e.close(f))});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var d=c("<div></div>").appendTo(document.body).addClass("ui-widget-overlay").css({width:this.width(),height:this.height()});(e.options.bgiframe&&c.fn.bgiframe&&d.bgiframe());this.instances.push(d);return d},destroy:function(d){this.instances.splice(c.inArray(this.instances,d),1);if(this.instances.length===0){c([document,window]).unbind(".dialog-overlay")}d.remove();var e=0;c.each(this.instances,function(){e=Math.max(e,this.css("z-index"))});this.maxZ=e},height:function(){if(c.browser.msie&&c.browser.version<7){var e=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);var d=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);if(e<d){return c(window).height()+"px"}else{return e+"px"}}else{return c(document).height()+"px"}},width:function(){if(c.browser.msie&&c.browser.version<7){var d=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);var e=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);if(d<e){return c(window).width()+"px"}else{return d+"px"}}else{return c(document).width()+"px"}},resize:function(){var d=c([]);c.each(c.ui.dialog.overlay.instances,function(){d=d.add(this)});d.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);(function(a){a.widget("ui.progressbar",{_init:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this._valueMin(),"aria-valuemax":this._valueMax(),"aria-valuenow":this._value()});this.valueDiv=a('<div class="ui-progressbar-value ui-widget-header ui-corner-left"></div>').appendTo(this.element);this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow").removeData("progressbar").unbind(".progressbar");this.valueDiv.remove();a.widget.prototype.destroy.apply(this,arguments)},value:function(b){if(b===undefined){return this._value()}this._setData("value",b);return this},_setData:function(b,c){switch(b){case"value":this.options.value=c;this._refreshValue();this._trigger("change",null,{});break}a.widget.prototype._setData.apply(this,arguments)},_value:function(){var b=this.options.value;if(b<this._valueMin()){b=this._valueMin()}if(b>this._valueMax()){b=this._valueMax()}return b},_valueMin:function(){var b=0;return b},_valueMax:function(){var b=100;return b},_refreshValue:function(){var b=this.value();this.valueDiv[b==this._valueMax()?"addClass":"removeClass"]("ui-corner-right");this.valueDiv.width(b+"%");this.element.attr("aria-valuenow",b)}});a.extend(a.ui.progressbar,{version:"1.7.2",defaults:{value:0}})})(jQuery);(function(a){a.widget("ui.slider",a.extend({},a.ui.mouse,{_init:function(){var b=this,c=this.options;this._keySliding=false;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");this.range=a([]);if(c.range){if(c.range===true){this.range=a("<div></div>");if(!c.values){c.values=[this._valueMin(),this._valueMin()]}if(c.values.length&&c.values.length!=2){c.values=[c.values[0],c.values[0]]}}else{this.range=a("<div></div>")}this.range.appendTo(this.element).addClass("ui-slider-range");if(c.range=="min"||c.range=="max"){this.range.addClass("ui-slider-range-"+c.range)}this.range.addClass("ui-widget-header")}if(a(".ui-slider-handle",this.element).length==0){a('<a href="#"></a>').appendTo(this.element).addClass("ui-slider-handle")}if(c.values&&c.values.length){while(a(".ui-slider-handle",this.element).length<c.values.length){a('<a href="#"></a>').appendTo(this.element).addClass("ui-slider-handle")}}this.handles=a(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(d){d.preventDefault()}).hover(function(){if(!c.disabled){a(this).addClass("ui-state-hover")}},function(){a(this).removeClass("ui-state-hover")}).focus(function(){if(!c.disabled){a(".ui-slider .ui-state-focus").removeClass("ui-state-focus");a(this).addClass("ui-state-focus")}else{a(this).blur()}}).blur(function(){a(this).removeClass("ui-state-focus")});this.handles.each(function(d){a(this).data("index.ui-slider-handle",d)});this.handles.keydown(function(i){var f=true;var e=a(this).data("index.ui-slider-handle");if(b.options.disabled){return}switch(i.keyCode){case a.ui.keyCode.HOME:case a.ui.keyCode.END:case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:f=false;if(!b._keySliding){b._keySliding=true;a(this).addClass("ui-state-active");b._start(i,e)}break}var g,d,h=b._step();if(b.options.values&&b.options.values.length){g=d=b.values(e)}else{g=d=b.value()}switch(i.keyCode){case a.ui.keyCode.HOME:d=b._valueMin();break;case a.ui.keyCode.END:d=b._valueMax();break;case a.ui.keyCode.UP:case a.ui.keyCode.RIGHT:if(g==b._valueMax()){return}d=g+h;break;case a.ui.keyCode.DOWN:case a.ui.keyCode.LEFT:if(g==b._valueMin()){return}d=g-h;break}b._slide(i,e,d);return f}).keyup(function(e){var d=a(this).data("index.ui-slider-handle");if(b._keySliding){b._stop(e,d);b._change(e,d);b._keySliding=false;a(this).removeClass("ui-state-active")}});this._refreshValue()},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy()},_mouseCapture:function(d){var e=this.options;if(e.disabled){return false}this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();var h={x:d.pageX,y:d.pageY};var j=this._normValueFromMouse(h);var c=this._valueMax()-this._valueMin()+1,f;var k=this,i;this.handles.each(function(l){var m=Math.abs(j-k.values(l));if(c>m){c=m;f=a(this);i=l}});if(e.range==true&&this.values(1)==e.min){f=a(this.handles[++i])}this._start(d,i);k._handleIndex=i;f.addClass("ui-state-active").focus();var g=f.offset();var b=!a(d.target).parents().andSelf().is(".ui-slider-handle");this._clickOffset=b?{left:0,top:0}:{left:d.pageX-g.left-(f.width()/2),top:d.pageY-g.top-(f.height()/2)-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};j=this._normValueFromMouse(h);this._slide(d,i,j);return true},_mouseStart:function(b){return true},_mouseDrag:function(d){var b={x:d.pageX,y:d.pageY};var c=this._normValueFromMouse(b);this._slide(d,this._handleIndex,c);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._handleIndex=null;this._clickOffset=null;return false},_detectOrientation:function(){this.orientation=this.options.orientation=="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(d){var c,h;if("horizontal"==this.orientation){c=this.elementSize.width;h=d.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{c=this.elementSize.height;h=d.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}var f=(h/c);if(f>1){f=1}if(f<0){f=0}if("vertical"==this.orientation){f=1-f}var e=this._valueMax()-this._valueMin(),i=f*e,b=i%this.options.step,g=this._valueMin()+i-b;if(b>(this.options.step/2)){g+=this.options.step}return parseFloat(g.toFixed(5))},_start:function(d,c){var b={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){b.value=this.values(c);b.values=this.values()}this._trigger("start",d,b)},_slide:function(f,e,d){var g=this.handles[e];if(this.options.values&&this.options.values.length){var b=this.values(e?0:1);if((this.options.values.length==2&&this.options.range===true)&&((e==0&&d>b)||(e==1&&d<b))){d=b}if(d!=this.values(e)){var c=this.values();c[e]=d;var h=this._trigger("slide",f,{handle:this.handles[e],value:d,values:c});var b=this.values(e?0:1);if(h!==false){this.values(e,d,(f.type=="mousedown"&&this.options.animate),true)}}}else{if(d!=this.value()){var h=this._trigger("slide",f,{handle:this.handles[e],value:d});if(h!==false){this._setData("value",d,(f.type=="mousedown"&&this.options.animate))}}}},_stop:function(d,c){var b={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){b.value=this.values(c);b.values=this.values()}this._trigger("stop",d,b)},_change:function(d,c){var b={handle:this.handles[c],value:this.value()};if(this.options.values&&this.options.values.length){b.value=this.values(c);b.values=this.values()}this._trigger("change",d,b)},value:function(b){if(arguments.length){this._setData("value",b);this._change(null,0)}return this._value()},values:function(b,e,c,d){if(arguments.length>1){this.options.values[b]=e;this._refreshValue(c);if(!d){this._change(null,b)}}if(arguments.length){if(this.options.values&&this.options.values.length){return this._values(b)}else{return this.value()}}else{return this._values()}},_setData:function(b,d,c){a.widget.prototype._setData.apply(this,arguments);switch(b){case"disabled":if(d){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled")}else{this.handles.removeAttr("disabled")}case"orientation":this._detectOrientation();this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue(c);break;case"value":this._refreshValue(c);break}},_step:function(){var b=this.options.step;return b},_value:function(){var b=this.options.value;if(b<this._valueMin()){b=this._valueMin()}if(b>this._valueMax()){b=this._valueMax()}return b},_values:function(b){if(arguments.length){var c=this.options.values[b];if(c<this._valueMin()){c=this._valueMin()}if(c>this._valueMax()){c=this._valueMax()}return c}else{return this.options.values}},_valueMin:function(){var b=this.options.min;return b},_valueMax:function(){var b=this.options.max;return b},_refreshValue:function(c){var f=this.options.range,d=this.options,l=this;if(this.options.values&&this.options.values.length){var i,h;this.handles.each(function(p,n){var o=(l.values(p)-l._valueMin())/(l._valueMax()-l._valueMin())*100;var m={};m[l.orientation=="horizontal"?"left":"bottom"]=o+"%";a(this).stop(1,1)[c?"animate":"css"](m,d.animate);if(l.options.range===true){if(l.orientation=="horizontal"){(p==0)&&l.range.stop(1,1)[c?"animate":"css"]({left:o+"%"},d.animate);(p==1)&&l.range[c?"animate":"css"]({width:(o-lastValPercent)+"%"},{queue:false,duration:d.animate})}else{(p==0)&&l.range.stop(1,1)[c?"animate":"css"]({bottom:(o)+"%"},d.animate);(p==1)&&l.range[c?"animate":"css"]({height:(o-lastValPercent)+"%"},{queue:false,duration:d.animate})}}lastValPercent=o})}else{var j=this.value(),g=this._valueMin(),k=this._valueMax(),e=k!=g?(j-g)/(k-g)*100:0;var b={};b[l.orientation=="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[c?"animate":"css"](b,d.animate);(f=="min")&&(this.orientation=="horizontal")&&this.range.stop(1,1)[c?"animate":"css"]({width:e+"%"},d.animate);(f=="max")&&(this.orientation=="horizontal")&&this.range[c?"animate":"css"]({width:(100-e)+"%"},{queue:false,duration:d.animate});(f=="min")&&(this.orientation=="vertical")&&this.range.stop(1,1)[c?"animate":"css"]({height:e+"%"},d.animate);(f=="max")&&(this.orientation=="vertical")&&this.range[c?"animate":"css"]({height:(100-e)+"%"},{queue:false,duration:d.animate})}}}));a.extend(a.ui.slider,{getter:"value values",version:"1.7.2",eventPrefix:"slide",defaults:{animate:false,delay:0,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null}})})(jQuery);(function(a){a.widget("ui.tabs",{_init:function(){if(this.options.deselectable!==undefined){this.options.collapsible=this.options.deselectable}this._tabify(true)},_setData:function(b,c){if(b=="selected"){if(this.options.collapsible&&c==this.options.selected){return}this.select(c)}else{this.options[b]=c;if(b=="deselectable"){this.options.collapsible=c}this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^A-Za-z0-9\-_:\.]/g,"")||this.options.idPrefix+a.data(b)},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+a.data(this.list[0]));return a.cookie.apply(null,[b].concat(a.makeArray(arguments)))},_ui:function(c,b){return{tab:c,panel:b,index:this.anchors.index(c)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=a(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(n){this.list=this.element.children("ul:first");this.lis=a("li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return a("a",this)[0]});this.panels=a([]);var p=this,d=this.options;var c=/^#.+/;this.anchors.each(function(r,o){var q=a(o).attr("href");var s=q.split("#")[0],u;if(s&&(s===location.toString().split("#")[0]||(u=a("base")[0])&&s===u.href)){q=o.hash;o.href=q}if(c.test(q)){p.panels=p.panels.add(p._sanitizeSelector(q))}else{if(q!="#"){a.data(o,"href.tabs",q);a.data(o,"load.tabs",q.replace(/#.*$/,""));var w=p._tabId(o);o.href="#"+w;var v=a("#"+w);if(!v.length){v=a(d.panelTemplate).attr("id",w).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(p.panels[r-1]||p.list);v.data("destroy.tabs",true)}p.panels=p.panels.add(v)}else{d.disabled.push(r)}}});if(n){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(d.selected===undefined){if(location.hash){this.anchors.each(function(q,o){if(o.hash==location.hash){d.selected=q;return false}})}if(typeof d.selected!="number"&&d.cookie){d.selected=parseInt(p._cookie(),10)}if(typeof d.selected!="number"&&this.lis.filter(".ui-tabs-selected").length){d.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))}d.selected=d.selected||0}else{if(d.selected===null){d.selected=-1}}d.selected=((d.selected>=0&&this.anchors[d.selected])||d.selected<0)?d.selected:0;d.disabled=a.unique(d.disabled.concat(a.map(this.lis.filter(".ui-state-disabled"),function(q,o){return p.lis.index(q)}))).sort();if(a.inArray(d.selected,d.disabled)!=-1){d.disabled.splice(a.inArray(d.selected,d.disabled),1)}this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");if(d.selected>=0&&this.anchors.length){this.panels.eq(d.selected).removeClass("ui-tabs-hide");this.lis.eq(d.selected).addClass("ui-tabs-selected ui-state-active");p.element.queue("tabs",function(){p._trigger("show",null,p._ui(p.anchors[d.selected],p.panels[d.selected]))});this.load(d.selected)}a(window).bind("unload",function(){p.lis.add(p.anchors).unbind(".tabs");p.lis=p.anchors=p.panels=null})}else{d.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"))}this.element[d.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");if(d.cookie){this._cookie(d.selected,d.cookie)}for(var g=0,m;(m=this.lis[g]);g++){a(m)[a.inArray(g,d.disabled)!=-1&&!a(m).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled")}if(d.cache===false){this.anchors.removeData("cache.tabs")}this.lis.add(this.anchors).unbind(".tabs");if(d.event!="mouseover"){var f=function(o,i){if(i.is(":not(.ui-state-disabled)")){i.addClass("ui-state-"+o)}};var j=function(o,i){i.removeClass("ui-state-"+o)};this.lis.bind("mouseover.tabs",function(){f("hover",a(this))});this.lis.bind("mouseout.tabs",function(){j("hover",a(this))});this.anchors.bind("focus.tabs",function(){f("focus",a(this).closest("li"))});this.anchors.bind("blur.tabs",function(){j("focus",a(this).closest("li"))})}var b,h;if(d.fx){if(a.isArray(d.fx)){b=d.fx[0];h=d.fx[1]}else{b=h=d.fx}}function e(i,o){i.css({display:""});if(a.browser.msie&&o.opacity){i[0].style.removeAttribute("filter")}}var k=h?function(i,o){a(i).closest("li").removeClass("ui-state-default").addClass("ui-tabs-selected ui-state-active");o.hide().removeClass("ui-tabs-hide").animate(h,h.duration||"normal",function(){e(o,h);p._trigger("show",null,p._ui(i,o[0]))})}:function(i,o){a(i).closest("li").removeClass("ui-state-default").addClass("ui-tabs-selected ui-state-active");o.removeClass("ui-tabs-hide");p._trigger("show",null,p._ui(i,o[0]))};var l=b?function(o,i){i.animate(b,b.duration||"normal",function(){p.lis.removeClass("ui-tabs-selected ui-state-active").addClass("ui-state-default");i.addClass("ui-tabs-hide");e(i,b);p.element.dequeue("tabs")})}:function(o,i,q){p.lis.removeClass("ui-tabs-selected ui-state-active").addClass("ui-state-default");i.addClass("ui-tabs-hide");p.element.dequeue("tabs")};this.anchors.bind(d.event+".tabs",function(){var o=this,r=a(this).closest("li"),i=p.panels.filter(":not(.ui-tabs-hide)"),q=a(p._sanitizeSelector(this.hash));if((r.hasClass("ui-tabs-selected")&&!d.collapsible)||r.hasClass("ui-state-disabled")||r.hasClass("ui-state-processing")||p._trigger("select",null,p._ui(this,q[0]))===false){this.blur();return false}d.selected=p.anchors.index(this);p.abort();if(d.collapsible){if(r.hasClass("ui-tabs-selected")){d.selected=-1;if(d.cookie){p._cookie(d.selected,d.cookie)}p.element.queue("tabs",function(){l(o,i)}).dequeue("tabs");this.blur();return false}else{if(!i.length){if(d.cookie){p._cookie(d.selected,d.cookie)}p.element.queue("tabs",function(){k(o,q)});p.load(p.anchors.index(this));this.blur();return false}}}if(d.cookie){p._cookie(d.selected,d.cookie)}if(q.length){if(i.length){p.element.queue("tabs",function(){l(o,i)})}p.element.queue("tabs",function(){k(o,q)});p.load(p.anchors.index(this))}else{throw"jQuery UI Tabs: Mismatching fragment identifier."}if(a.browser.msie){this.blur()}});this.anchors.bind("click.tabs",function(){return false})},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var c=a.data(this,"href.tabs");if(c){this.href=c}var d=a(this).unbind(".tabs");a.each(["href","load","cache"],function(e,f){d.removeData(f+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){if(a.data(this,"destroy.tabs")){a(this).remove()}else{a(this).removeClass(["ui-state-default","ui-corner-top","ui-tabs-selected","ui-state-active","ui-state-hover","ui-state-focus","ui-state-disabled","ui-tabs-panel","ui-widget-content","ui-corner-bottom","ui-tabs-hide"].join(" "))}});if(b.cookie){this._cookie(null,b.cookie)}},add:function(e,d,c){if(c===undefined){c=this.anchors.length}var b=this,g=this.options,i=a(g.tabTemplate.replace(/#\{href\}/g,e).replace(/#\{label\}/g,d)),h=!e.indexOf("#")?e.replace("#",""):this._tabId(a("a",i)[0]);i.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var f=a("#"+h);if(!f.length){f=a(g.panelTemplate).attr("id",h).data("destroy.tabs",true)}f.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(c>=this.lis.length){i.appendTo(this.list);f.appendTo(this.list[0].parentNode)}else{i.insertBefore(this.lis[c]);f.insertBefore(this.panels[c])}g.disabled=a.map(g.disabled,function(k,j){return k>=c?++k:k});this._tabify();if(this.anchors.length==1){i.addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){b._trigger("show",null,b._ui(b.anchors[0],b.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[c],this.panels[c]))},remove:function(b){var d=this.options,e=this.lis.eq(b).remove(),c=this.panels.eq(b).remove();if(e.hasClass("ui-tabs-selected")&&this.anchors.length>1){this.select(b+(b+1<this.anchors.length?1:-1))}d.disabled=a.map(a.grep(d.disabled,function(g,f){return g!=b}),function(g,f){return g>=b?--g:g});this._tabify();this._trigger("remove",null,this._ui(e.find("a")[0],c[0]))},enable:function(b){var c=this.options;if(a.inArray(b,c.disabled)==-1){return}this.lis.eq(b).removeClass("ui-state-disabled");c.disabled=a.grep(c.disabled,function(e,d){return e!=b});this._trigger("enable",null,this._ui(this.anchors[b],this.panels[b]))},disable:function(c){var b=this,d=this.options;if(c!=d.selected){this.lis.eq(c).addClass("ui-state-disabled");d.disabled.push(c);d.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[c],this.panels[c]))}},select:function(b){if(typeof b=="string"){b=this.anchors.index(this.anchors.filter("[href$="+b+"]"))}else{if(b===null){b=-1}}if(b==-1&&this.options.collapsible){b=this.options.selected}this.anchors.eq(b).trigger(this.options.event+".tabs")},load:function(e){var c=this,g=this.options,b=this.anchors.eq(e)[0],d=a.data(b,"load.tabs");this.abort();if(!d||this.element.queue("tabs").length!==0&&a.data(b,"cache.tabs")){this.element.dequeue("tabs");return}this.lis.eq(e).addClass("ui-state-processing");if(g.spinner){var f=a("span",b);f.data("label.tabs",f.html()).html(g.spinner)}this.xhr=a.ajax(a.extend({},g.ajaxOptions,{url:d,success:function(i,h){a(c._sanitizeSelector(b.hash)).html(i);c._cleanup();if(g.cache){a.data(b,"cache.tabs",true)}c._trigger("load",null,c._ui(c.anchors[e],c.panels[e]));try{g.ajaxOptions.success(i,h)}catch(j){}c.element.dequeue("tabs")}}))},abort:function(){this.element.queue([]);this.panels.stop(false,true);if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup()},url:function(c,b){this.anchors.eq(c).removeData("cache.tabs").data("load.tabs",b)},length:function(){return this.anchors.length}});a.extend(a.ui.tabs,{version:"1.7.2",getter:"length",defaults:{ajaxOptions:null,cache:false,cookie:null,collapsible:false,disabled:[],event:"click",fx:null,idPrefix:"ui-tabs-",panelTemplate:"<div></div>",spinner:"<em>Loading…</em>",tabTemplate:'<li><a href="#{href}"><span>#{label}</span></a></li>'}});a.extend(a.ui.tabs.prototype,{rotation:null,rotate:function(d,f){var b=this,g=this.options;var c=b._rotate||(b._rotate=function(h){clearTimeout(b.rotation);b.rotation=setTimeout(function(){var i=g.selected;b.select(++i<b.anchors.length?i:0)},d);if(h){h.stopPropagation()}});var e=b._unrotate||(b._unrotate=!f?function(h){if(h.clientX){b.rotate(null)}}:function(h){t=g.selected;c()});if(d){this.element.bind("tabsshow",c);this.anchors.bind(g.event+".tabs",e);c()}else{clearTimeout(b.rotation);this.element.unbind("tabsshow",c);this.anchors.unbind(g.event+".tabs",e);delete this._rotate;delete this._unrotate}}})})(jQuery);
+jQuery.ui||function(c){c.ui={version:"1.8.1",plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")=="hidden")return false;
+b=b&&b=="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,f,g){return c.ui.isOverAxis(a,d,f)&&c.ui.isOverAxis(b,e,g)},keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,
+PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38}};c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},enableSelection:function(){return this.attr("unselectable","off").css("MozUserSelect","")},disableSelection:function(){return this.attr("unselectable","on").css("MozUserSelect","none")},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||
+/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==
+undefined)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b=="absolute"||b=="relative"||b=="fixed"){b=parseInt(a.css("zIndex"));if(!isNaN(b)&&b!=0)return b}a=a.parent()}}return 0}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b||"area"==b?a.href||!isNaN(d):!isNaN(d))&&
+!c(a)["area"==b?"parents":"closest"](":hidden").length},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}})}(jQuery);
+;/*!
+ * jQuery UI Widget 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b){var j=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add(this).each(function(){b(this).triggerHandler("remove")});return j.call(b(this),a,c)})};b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend({},c.options);b[e][a].prototype=
+b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.substring(0,1)==="_")return h;e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==undefined){h=i;return false}}):this.each(function(){var g=
+b.data(this,a);if(g){d&&g.option(d);g._init()}else b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){this.element=b(c).data(this.widgetName,this);this.options=b.extend(true,{},this.options,b.metadata&&b.metadata.get(c)[this.widgetName],a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();
+this._init()},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(a,c){var d=a,e=this;if(arguments.length===0)return b.extend({},e.options);if(typeof a==="string"){if(c===undefined)return this.options[a];d={};d[a]=c}b.each(d,function(f,
+h){e._setOption(f,h)});return e},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=
+b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
+;/*!
+ * jQuery UI Mouse 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ */
+(function(c){c.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(b){return a._mouseDown(b)}).bind("click."+this.widgetName,function(b){if(a._preventClickEvent){a._preventClickEvent=false;b.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(a){a.originalEvent=a.originalEvent||{};if(!a.originalEvent.mouseHandled){this._mouseStarted&&
+this._mouseUp(a);this._mouseDownEvent=a;var b=this,e=a.which==1,f=typeof this.options.cancel=="string"?c(a.target).parents().add(a.target).filter(this.options.cancel).length:false;if(!e||f||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){b.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();
+return true}}this._mouseMoveDelegate=function(d){return b._mouseMove(d)};this._mouseUpDelegate=function(d){return b._mouseUp(d)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);c.browser.safari||a.preventDefault();return a.originalEvent.mouseHandled=true}},_mouseMove:function(a){if(c.browser.msie&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&
+this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._preventClickEvent=a.target==this._mouseDownEvent.target;this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-
+a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
+;/*
+ * jQuery UI Position 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var m=/left|center|right/,n=/top|center|bottom/,p=c.fn.position,q=c.fn.offset;c.fn.position=function(a){if(!a||!a.of)return p.apply(this,arguments);a=c.extend({},a);var b=c(a.of),d=(a.collision||"flip").split(" "),e=a.offset?a.offset.split(" "):[0,0],g,h,i;if(a.of.nodeType===9){g=b.width();h=b.height();i={top:0,left:0}}else if(a.of.scrollTo&&a.of.document){g=b.width();h=b.height();i={top:b.scrollTop(),left:b.scrollLeft()}}else if(a.of.preventDefault){a.at="left top";g=h=
+0;i={top:a.of.pageY,left:a.of.pageX}}else{g=b.outerWidth();h=b.outerHeight();i=b.offset()}c.each(["my","at"],function(){var f=(a[this]||"").split(" ");if(f.length===1)f=m.test(f[0])?f.concat(["center"]):n.test(f[0])?["center"].concat(f):["center","center"];f[0]=m.test(f[0])?f[0]:"center";f[1]=n.test(f[1])?f[1]:"center";a[this]=f});if(d.length===1)d[1]=d[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(a.at[0]==="right")i.left+=g;else if(a.at[0]==="center")i.left+=
+g/2;if(a.at[1]==="bottom")i.top+=h;else if(a.at[1]==="center")i.top+=h/2;i.left+=e[0];i.top+=e[1];return this.each(function(){var f=c(this),k=f.outerWidth(),l=f.outerHeight(),j=c.extend({},i);if(a.my[0]==="right")j.left-=k;else if(a.my[0]==="center")j.left-=k/2;if(a.my[1]==="bottom")j.top-=l;else if(a.my[1]==="center")j.top-=l/2;j.left=parseInt(j.left);j.top=parseInt(j.top);c.each(["left","top"],function(o,r){c.ui.position[d[o]]&&c.ui.position[d[o]][r](j,{targetWidth:g,targetHeight:h,elemWidth:k,
+elemHeight:l,offset:e,my:a.my,at:a.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(j,{using:a.using}))})};c.ui.position={fit:{left:function(a,b){var d=c(window);b=a.left+b.elemWidth-d.width()-d.scrollLeft();a.left=b>0?a.left-b:Math.max(0,a.left)},top:function(a,b){var d=c(window);b=a.top+b.elemHeight-d.height()-d.scrollTop();a.top=b>0?a.top-b:Math.max(0,a.top)}},flip:{left:function(a,b){if(b.at[0]!=="center"){var d=c(window);d=a.left+b.elemWidth-d.width()-d.scrollLeft();var e=b.my[0]==="left"?
+-b.elemWidth:b.my[0]==="right"?b.elemWidth:0,g=-2*b.offset[0];a.left+=a.left<0?e+b.targetWidth+g:d>0?e-b.targetWidth+g:0}},top:function(a,b){if(b.at[1]!=="center"){var d=c(window);d=a.top+b.elemHeight-d.height()-d.scrollTop();var e=b.my[1]==="top"?-b.elemHeight:b.my[1]==="bottom"?b.elemHeight:0,g=b.at[1]==="top"?b.targetHeight:-b.targetHeight,h=-2*b.offset[1];a.top+=a.top<0?e+b.targetHeight+h:d>0?e+g+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(a,b){if(/static/.test(c.curCSS(a,"position")))a.style.position=
+"relative";var d=c(a),e=d.offset(),g=parseInt(c.curCSS(a,"top",true),10)||0,h=parseInt(c.curCSS(a,"left",true),10)||0;e={top:b.top-e.top+g,left:b.left-e.left+h};"using"in b?b.using.call(a,e):d.css(e)};c.fn.offset=function(a){var b=this[0];if(!b||!b.ownerDocument)return null;if(a)return this.each(function(){c.offset.setOffset(this,a)});return q.call(this)}}})(jQuery);
+;/*
+ * jQuery UI Draggable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
+this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-
+this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();
+d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||
+this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if(!this.element[0]||!this.element[0].parentNode)return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,
+b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
+a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||
+0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-
+(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment==
+"parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&
+a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),
+10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():
+f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])e=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+
+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;e=this.originalPageX+
+Math.round((e-this.originalPageX)/b.grid[0])*b.grid[0];e=this.containment?!(e-this.offset.click.left<this.containment[0]||e-this.offset.click.left>this.containment[2])?e:!(e-this.offset.click.left<this.containment[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-
+this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=
+this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.1"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var g=d.data(this,"sortable");
+if(g&&!g.options.disabled){c.sortables.push({instance:g,shouldRevert:g.options.revert});g._refreshItems();g._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;
+c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=
+1;this.instance.currentItem=d(f).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;
+this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=
+this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","iframeFix",{start:function(){var a=
+d(this).data("draggable").options;d(a.iframeFix===true?"iframe":a.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;
+if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!=
+"HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-
+b.overflowOffset.left<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-
+c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,
+width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,g=b.offset.left,n=g+c.helperProportions.width,m=b.offset.top,o=m+c.helperProportions.height,h=c.snapElements.length-1;h>=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e<g&&g<k+e&&j-e<m&&m<l+e||i-e<g&&g<k+e&&j-e<o&&o<l+e||i-e<n&&n<k+e&&j-e<m&&m<l+e||i-e<n&&n<k+e&&j-e<o&&
+o<l+e){if(f.snapMode!="inner"){var p=Math.abs(j-o)<=e,q=Math.abs(l-m)<=e,r=Math.abs(i-n)<=e,s=Math.abs(k-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k}).left-c.margins.left}var t=
+p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(j-m)<=e;q=Math.abs(l-o)<=e;r=Math.abs(i-g)<=e;s=Math.abs(k-n)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[h].snapping&&
+(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=p||q||r||s||t}else{c.snapElements[h].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),
+10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
+;/*
+ * jQuery UI Droppable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.mouse.js
+ * jquery.ui.draggable.js
+ */
+(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this);
+a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
+this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
+this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
+d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
+a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.1"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
+switch(c){case "fit":return i<e&&g<k&&j<f&&h<l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>=i&&
+e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
+"none";if(c[f].visible){c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight};e=="mousedown"&&c[f]._activate.call(c[f],b)}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem||
+a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=
+d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})}}})(jQuery);
+;/*
+ * jQuery UI Resizable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.resizable",d.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");d.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
+_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&d.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(d('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
+this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!d(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var e=0;e<c.length;e++){var g=d.trim(c[e]),f=d('<div class="ui-resizable-handle '+("ui-resizable-"+g)+'"></div>');/sw|se|ne|nw/.test(g)&&f.css({zIndex:++a.zIndex});"se"==g&&f.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[g]=".ui-resizable-"+g;this.element.append(f)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
+String)this.handles[i]=d(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=d(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}d(this.handles[i])}};this._renderAxis(this.element);this._handles=d(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();d(this.element).addClass("ui-resizable-autohide").hover(function(){d(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){d(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){d(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};
+if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(d(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),
+e=this.element;this.resizing=true;this.documentScroll={top:d(document).scrollTop(),left:d(document).scrollLeft()};if(e.is(".ui-draggable")||/absolute/.test(e.css("position")))e.css({position:"absolute",top:c.top,left:c.left});d.browser.opera&&/relative/.test(e.css("position"))&&e.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var g=m(this.helper.css("top"));if(a.containment){c+=d(a.containment).scrollLeft()||0;g+=d(a.containment).scrollTop()||0}this.offset=
+this.helper.offset();this.position={left:c,top:g};this.size=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalSize=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalPosition={left:c,top:g};this.sizeDiff={width:e.outerWidth()-e.width(),height:e.outerHeight()-e.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:
+this.originalSize.width/this.originalSize.height||1;a=d(".ui-resizable-"+this.axis).css("cursor");d("body").css("cursor",a=="auto"?this.axis+"-resize":a);e.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,e=this._change[this.axis];if(!e)return false;c=e.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",
+b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var e=this._proportionallyResizeElements,g=e.length&&/textarea/i.test(e[0].nodeName);e=g&&d.ui.hasScroll(e[0],"left")?0:c.sizeDiff.height;
+g={width:c.size.width-(g?0:c.sizeDiff.width),height:c.size.height-e};e=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var f=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(d.extend(g,{top:f,left:e}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}d("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",
+b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(k(b.left))this.position.left=b.left;if(k(b.top))this.position.top=b.top;if(k(b.height))this.size.height=b.height;if(k(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,e=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(e=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(e=="nw"){b.top=
+a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,e=k(b.width)&&a.maxWidth&&a.maxWidth<b.width,g=k(b.height)&&a.maxHeight&&a.maxHeight<b.height,f=k(b.width)&&a.minWidth&&a.minWidth>b.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(f)b.width=a.minWidth;if(h)b.height=a.minHeight;if(e)b.width=a.maxWidth;if(g)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,
+l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(f&&l)b.left=i-a.minWidth;if(e&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(g&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var e=[c.css("borderTopWidth"),
+c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],g=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=d.map(e,function(f,h){f=parseInt(f,10)||0;h=parseInt(g[h],10)||0;return f+h})}d.browser.msie&&(d(b).is(":hidden")||d(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=
+this.element.offset();if(this._helper){this.helper=this.helper||d('<div style="overflow:hidden;"></div>');var a=d.browser.msie&&d.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+
+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return d.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return d.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return d.extend(this._change.n.apply(this,
+arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return d.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){d.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});d.extend(d.ui.resizable,
+{version:"1.8.1"});d.ui.plugin.add("resizable","alsoResize",{start:function(){var b=d(this).data("resizable").options,a=function(c){d(c).each(function(){d(this).data("resizable-alsoresize",{width:parseInt(d(this).width(),10),height:parseInt(d(this).height(),10),left:parseInt(d(this).css("left"),10),top:parseInt(d(this).css("top"),10)})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else d.each(b.alsoResize,function(c){a(c)});
+else a(b.alsoResize)},resize:function(){var b=d(this).data("resizable"),a=b.options,c=b.originalSize,e=b.originalPosition,g={height:b.size.height-c.height||0,width:b.size.width-c.width||0,top:b.position.top-e.top||0,left:b.position.left-e.left||0},f=function(h,i){d(h).each(function(){var j=d(this),l=d(this).data("resizable-alsoresize"),p={};d.each((i&&i.length?i:["width","height","top","left"])||["width","height","top","left"],function(n,o){if((n=(l[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(/relative/.test(j.css("position"))&&
+d.browser.opera){b._revertToRelativePosition=true;j.css({position:"absolute",top:"auto",left:"auto"})}j.css(p)})};typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?d.each(a.alsoResize,function(h,i){f(h,i)}):f(a.alsoResize)},stop:function(){var b=d(this).data("resizable");if(b._revertToRelativePosition&&d.browser.opera){b._revertToRelativePosition=false;el.css({position:"relative"})}d(this).removeData("resizable-alsoresize-start")}});d.ui.plugin.add("resizable","animate",{stop:function(b){var a=
+d(this).data("resizable"),c=a.options,e=a._proportionallyResizeElements,g=e.length&&/textarea/i.test(e[0].nodeName),f=g&&d.ui.hasScroll(e[0],"left")?0:a.sizeDiff.height;g={width:a.size.width-(g?0:a.sizeDiff.width),height:a.size.height-f};f=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(d.extend(g,h&&f?{top:h,left:f}:{}),{duration:c.animateDuration,easing:c.animateEasing,
+step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};e&&e.length&&d(e[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});d.ui.plugin.add("resizable","containment",{start:function(){var b=d(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof d?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=
+d(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:d(document),left:0,top:0,width:d(document).width(),height:d(document).height()||document.body.parentNode.scrollHeight}}else{var e=d(a),g=[];d(["Top","Right","Left","Bottom"]).each(function(i,j){g[i]=m(e.css("padding"+j))});b.containerOffset=e.offset();b.containerPosition=e.position();b.containerSize={height:e.innerHeight()-g[3],width:e.innerWidth()-g[1]};c=b.containerOffset;
+var f=b.containerSize.height,h=b.containerSize.width;h=d.ui.hasScroll(a,"left")?a.scrollWidth:h;f=d.ui.hasScroll(a)?a.scrollHeight:f;b.parentData={element:a,left:c.left,top:c.top,width:h,height:f}}}},resize:function(b){var a=d(this).data("resizable"),c=a.options,e=a.containerOffset,g=a.position;b=a._aspectRatio||b.shiftKey;var f={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))f=e;if(g.left<(a._helper?e.left:0)){a.size.width+=a._helper?a.position.left-e.left:
+a.position.left-f.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?e.left:0}if(g.top<(a._helper?e.top:0)){a.size.height+=a._helper?a.position.top-e.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?e.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-f.left:a.offset.left-f.left)+a.sizeDiff.width);e=Math.abs((a._helper?a.offset.top-f.top:a.offset.top-
+e.top)+a.sizeDiff.height);g=a.containerElement.get(0)==a.element.parent().get(0);f=/relative|absolute/.test(a.containerElement.css("position"));if(g&&f)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(e+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-e;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=d(this).data("resizable"),a=b.options,c=b.containerOffset,e=b.containerPosition,
+g=b.containerElement,f=d(b.helper),h=f.offset(),i=f.outerWidth()-b.sizeDiff.width;f=f.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(g.css("position"))&&d(this).css({left:h.left-e.left-c.left,width:i,height:f});b._helper&&!a.animate&&/static/.test(g.css("position"))&&d(this).css({left:h.left-e.left-c.left,width:i,height:f})}});d.ui.plugin.add("resizable","ghost",{start:function(){var b=d(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,
+display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=d(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=d(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});d.ui.plugin.add("resizable","grid",{resize:function(){var b=
+d(this).data("resizable"),a=b.options,c=b.size,e=b.originalSize,g=b.originalPosition,f=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-e.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-e.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(f)){b.size.width=e.width+h;b.size.height=e.height+a}else if(/^(ne)$/.test(f)){b.size.width=e.width+h;b.size.height=e.height+a;b.position.top=g.top-a}else{if(/^(sw)$/.test(f)){b.size.width=e.width+h;b.size.height=
+e.height+a}else{b.size.width=e.width+h;b.size.height=e.height+a;b.position.top=g.top-a}b.position.left=g.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
+;/*
+ * jQuery UI Selectable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var d=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(d.options.filter,d.element[0]);f.each(function(){var c=e(this),b=c.offset();e.data(this,"selectable-item",{element:this,$element:c,left:b.left,top:b.top,right:b.left+c.outerWidth(),bottom:b.top+c.outerHeight(),startselected:false,selected:c.hasClass("ui-selected"),
+selecting:c.hasClass("ui-selecting"),unselecting:c.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e(document.createElement("div")).css({border:"1px dotted black"}).addClass("ui-selectable-helper")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},
+_mouseStart:function(d){var f=this;this.opos=[d.pageX,d.pageY];if(!this.options.disabled){var c=this.options;this.selectees=e(c.filter,this.element[0]);this._trigger("start",d);e(c.appendTo).append(this.helper);this.helper.css({"z-index":100,position:"absolute",left:d.clientX,top:d.clientY,width:0,height:0});c.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!d.metaKey){b.$element.removeClass("ui-selected");
+b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",d,{unselecting:b.element})}});e(d.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){b.$element.removeClass("ui-unselecting").addClass("ui-selecting");b.unselecting=false;b.selecting=true;b.selected=true;f._trigger("selecting",d,{selecting:b.element});return false}})}},_mouseDrag:function(d){var f=this;this.dragged=true;if(!this.options.disabled){var c=this.options,
+b=this.opos[0],g=this.opos[1],h=d.pageX,i=d.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(c.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(c.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting");
+a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",d,{selecting:a.element})}}else{if(a.selecting)if(d.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",d,{unselecting:a.element})}if(a.selected)if(!d.metaKey&&
+!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",d,{unselecting:a.element})}}}});return false}},_mouseStop:function(d){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var c=e.data(this,"selectable-item");c.$element.removeClass("ui-unselecting");c.unselecting=false;c.startselected=false;f._trigger("unselected",d,{unselected:c.element})});e(".ui-selecting",this.element[0]).each(function(){var c=
+e.data(this,"selectable-item");c.$element.removeClass("ui-selecting").addClass("ui-selected");c.selecting=false;c.selected=true;c.startselected=true;f._trigger("selected",d,{selected:c.element})});this._trigger("stop",d);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.1"})})(jQuery);
+;/*
+ * jQuery UI Sortable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable");
+this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(self,
+arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=
+c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,
+{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();
+if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",
+a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");
+if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+
+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+
+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+
+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,
+c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==
+document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp();this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",
+null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):
+d(this.domPosition.parent).prepend(this.currentItem);return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});return c.join("&")},toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},
+_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/
+2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=
+d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)},_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=
+this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?
+h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),
+b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?
+i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,
+c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=
+this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-
+parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],
+this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=
+1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",
+a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==
+this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||
+0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-
+(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;
+if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=
+d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-
+this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+
+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;
+if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-
+this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+
+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&
+this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||
+this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",
+g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",
+this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=
+0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.1"})})(jQuery);
+;/*
+ * jQuery UI Accordion 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()==location.href.toLowerCase()}},_create:function(){var a=this.options,b=this;this.running=0;this.element.addClass("ui-accordion ui-widget ui-helper-reset");
+this.element[0].nodeName=="UL"&&this.element.children("li").addClass("ui-accordion-li-fix");this.headers=this.element.find(a.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){c(this).removeClass("ui-state-focus")});
+this.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");if(a.navigation){var d=this.element.find("a").filter(a.navigationFilter);if(d.length){var f=d.closest(".ui-accordion-header");this.active=f.length?f:d.closest(".ui-accordion-content").prev()}}this.active=this._findActive(this.active||a.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");this.active.next().addClass("ui-accordion-content-active");
+this._createIcons();this.resize();this.element.attr("role","tablist");this.headers.attr("role","tab").bind("keydown",function(g){return b._keydown(g)}).next().attr("role","tabpanel");this.headers.not(this.active||"").attr("aria-expanded","false").attr("tabIndex","-1").next().hide();this.active.length?this.active.attr("aria-expanded","true").attr("tabIndex","0"):this.headers.eq(0).attr("tabIndex","0");c.browser.safari||this.headers.find("a").attr("tabIndex","-1");a.event&&this.headers.bind(a.event+
+".accordion",function(g){b._clickHandler.call(b,g,this);g.preventDefault()})},_createIcons:function(){var a=this.options;if(a.icons){c("<span/>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.find(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role").unbind(".accordion").removeData("accordion");
+this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex");this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");if(a.autoHeight||a.fillHeight)b.css("height",
+"");return this},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();b&&this._createIcons()}},_keydown:function(a){var b=c.ui.keyCode;if(!(this.options.disabled||a.altKey||a.ctrlKey)){var d=this.headers.length,f=this.headers.index(a.target),g=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:g=this.headers[(f+1)%d];break;case b.LEFT:case b.UP:g=this.headers[(f-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},
+a.target);a.preventDefault()}if(g){c(a.target).attr("tabIndex","-1");c(g).attr("tabIndex","0");g.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,
+b-c(this).innerHeight()+c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a=="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=
+this.options;if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]==this.active[0];d.active=d.collapsible&&b?false:c(".ui-accordion-header",this.element).index(a);if(!(this.running||!d.collapsible&&b)){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").find(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);
+a.next().addClass("ui-accordion-content-active")}e=a.next();f=this.active.next();g={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):e,oldContent:f};d=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(e,f,g,b,d)}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
+this.active.next().addClass("ui-accordion-content-active");var f=this.active.next(),g={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:f},e=this.active=c([]);this._toggle(e,f,g)}},_toggle:function(a,b,d,f,g){var e=this.options,k=this;this.toShow=a;this.toHide=b;this.data=d;var i=function(){if(k)return k._completed.apply(k,arguments)};this._trigger("changestart",null,this.data);this.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&f?{toShow:c([]),
+toHide:b,complete:i,down:g,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:i,down:g,autoHeight:e.autoHeight||e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;f=c.ui.accordion.animations;var h=e.duration,j=e.animated;if(j&&!f[j]&&!c.easing[j])j="slide";f[j]||(f[j]=function(l){this.slide(l,{easing:j,
+duration:h||700})});f[j](d)}else{if(e.collapsible&&f)a.toggle();else{b.hide();a.show()}i(true)}b.prev().attr("aria-expanded","false").attr("tabIndex","-1").blur();a.prev().attr("aria-expanded","true").attr("tabIndex","0").focus()},_completed:function(a){var b=this.options;this.running=a?0:--this.running;if(!this.running){b.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,
+{version:"1.8.1",animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),f=0,g={},e={},k;b=a.toShow;k=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(i,h){e[h]="hide";i=(""+c.css(a.toShow[0],
+h)).match(/^([\d+-.]+)(.*)$/);g[h]={value:i[1],unit:i[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(e,{step:function(i,h){if(h.prop=="height")f=h.end-h.start===0?0:(h.now-h.start)/(h.end-h.start);a.toShow[0].style[h.prop]=f*g[h.prop].value+g[h.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css("width",k);a.toShow.css({overflow:d});a.complete()}})}else a.toHide.animate({height:"hide"},
+a);else a.toShow.animate({height:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
+;/*
+ * jQuery UI Autocomplete 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function(e){e.widget("ui.autocomplete",{options:{minLength:1,delay:300},_create:function(){var a=this,b=this.element[0].ownerDocument;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){var d=e.ui.keyCode;switch(c.keyCode){case d.PAGE_UP:a._move("previousPage",c);break;case d.PAGE_DOWN:a._move("nextPage",c);break;case d.UP:a._move("previous",c);c.preventDefault();
+break;case d.DOWN:a._move("next",c);c.preventDefault();break;case d.ENTER:a.menu.active&&c.preventDefault();case d.TAB:if(!a.menu.active)return;a.menu.select(c);break;case d.ESCAPE:a.element.val(a.term);a.close(c);break;case d.LEFT:case d.RIGHT:case d.SHIFT:case d.CONTROL:case d.ALT:break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){a.search(null,c)},a.options.delay);break}}).bind("focus.autocomplete",function(){a.selectedItem=null;a.previous=a.element.val()}).bind("blur.autocomplete",
+function(c){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)});this._initSource();this.response=function(){return a._response.apply(a,arguments)};this.menu=e("<ul></ul>").addClass("ui-autocomplete").appendTo("body",b).menu({focus:function(c,d){d=d.item.data("item.autocomplete");false!==a._trigger("focus",null,{item:d})&&/^key/.test(c.originalEvent.type)&&a.element.val(d.value)},selected:function(c,d){d=d.item.data("item.autocomplete");false!==a._trigger("select",
+c,{item:d})&&a.element.val(d.value);a.close(c);c=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=c}a.selectedItem=d},blur:function(){a.menu.element.is(":visible")&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");e.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");
+this.menu.element.remove();e.Widget.prototype.destroy.call(this)},_setOption:function(a){e.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource()},_initSource:function(){var a,b;if(e.isArray(this.options.source)){a=this.options.source;this.source=function(c,d){d(e.ui.autocomplete.filter(a,c.term))}}else if(typeof this.options.source==="string"){b=this.options.source;this.source=function(c,d){e.getJSON(b,c,d)}}else this.source=this.options.source},search:function(a,b){a=
+a!=null?a:this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search")!==false)return this._search(a)},_search:function(a){this.term=this.element.addClass("ui-autocomplete-loading").val();this.source({term:a},this.response)},_response:function(a){if(a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);
+if(this.menu.element.is(":visible")){this._trigger("close",a);this.menu.element.hide();this.menu.deactivate()}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return e.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return e.extend({label:b.label||b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+
+1),c;this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();this.menu.element.show().position({my:"left top",at:"left bottom",of:this.element,collision:"none"});a=b.width("").width();c=this.element.width();b.width(Math.max(a,c))},_renderMenu:function(a,b){var c=this;e.each(b,function(d,f){c._renderItem(a,f)})},_renderItem:function(a,b){return e("<li></li>").data("item.autocomplete",b).append("<a>"+b.label+"</a>").appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&
+/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});e.extend(e.ui.autocomplete,{escapeRegex:function(a){return a.replace(/([\^\$\(\)\[\]\{\}\*\.\+\?\|\\])/gi,"\\$1")},filter:function(a,b){var c=new RegExp(e.ui.autocomplete.escapeRegex(b),"i");return e.grep(a,function(d){return c.test(d.label||d.value||d)})}})})(jQuery);
+(function(e){e.widget("ui.menu",{_create:function(){var a=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(b){if(e(b.target).closest(".ui-menu-item a").length){b.preventDefault();a.select(b)}});this.refresh()},refresh:function(){var a=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(b){a.activate(b,e(this).parent())}).mouseleave(function(){a.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var c=b.offset().top-this.element.offset().top,d=this.element.attr("scrollTop"),f=this.element.height();if(c<0)this.element.attr("scrollTop",d+c);else c>f&&this.element.attr("scrollTop",d+c-f+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",a,{item:b})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");
+this._trigger("blur");this.active=null}},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prev().length},last:function(){return this.active&&!this.active.next().length},move:function(a,b,c){if(this.active){a=this.active[a+"All"](".ui-menu-item").eq(0);a.length?this.activate(c,a):this.activate(c,this.element.children(b))}else this.activate(c,this.element.children(b))},nextPage:function(a){if(this.hasScroll())if(!this.active||
+this.last())this.activate(a,this.element.children(":first"));else{var b=this.active.offset().top,c=this.element.height(),d=this.element.children("li").filter(function(){var f=e(this).offset().top-b-c+e(this).height();return f<10&&f>-10});d.length||(d=this.element.children(":last"));this.activate(a,d)}else this.activate(a,this.element.children(!this.active||this.last()?":first":":last"))},previousPage:function(a){if(this.hasScroll())if(!this.active||this.first())this.activate(a,this.element.children(":last"));
+else{var b=this.active.offset().top,c=this.element.height();result=this.element.children("li").filter(function(){var d=e(this).offset().top-b+c-e(this).height();return d<10&&d>-10});result.length||(result=this.element.children(":first"));this.activate(a,result)}else this.activate(a,this.element.children(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(a){this._trigger("selected",a,{item:this.active})}})})(jQuery);
+;/*
+ * jQuery UI Button 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(a){var g,i=function(b){a(":ui-button",b.target.form).each(function(){var c=a(this).data("button");setTimeout(function(){c.refresh()},1)})},h=function(b){var c=b.name,d=b.form,e=a([]);if(c)e=d?a(d).find("[name='"+c+"']"):a("[name='"+c+"']",b.ownerDocument).filter(function(){return!this.form});return e};a.widget("ui.button",{options:{text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",i);this._determineButtonType();
+this.hasTitle=!!this.buttonElement.attr("title");var b=this,c=this.options,d=this.type==="checkbox"||this.type==="radio",e="ui-state-hover"+(!d?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",function(){if(!c.disabled){a(this).addClass("ui-state-hover");this===g&&a(this).addClass("ui-state-active")}}).bind("mouseleave.button",
+function(){c.disabled||a(this).removeClass(e)}).bind("focus.button",function(){a(this).addClass("ui-state-focus")}).bind("blur.button",function(){a(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){b.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).toggleClass("ui-state-active");b.buttonElement.attr("aria-pressed",b.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",
+function(){if(c.disabled)return false;a(this).addClass("ui-state-active");b.buttonElement.attr("aria-pressed",true);var f=b.element[0];h(f).not(f).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");g=this;a(document).one("mouseup",function(){g=null})}).bind("mouseup.button",function(){if(c.disabled)return false;a(this).removeClass("ui-state-active")}).bind("keydown.button",
+function(f){if(c.disabled)return false;if(f.keyCode==a.ui.keyCode.SPACE||f.keyCode==a.ui.keyCode.ENTER)a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(f){f.keyCode===a.ui.keyCode.SPACE&&a(this).click()})}this._setOption("disabled",c.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?
+"input":"button";if(this.type==="checkbox"||this.type==="radio"){this.buttonElement=this.element.parents().last().find("[for="+this.element.attr("id")+"]");this.element.addClass("ui-helper-hidden-accessible");var b=this.element.is(":checked");b&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",b)}else this.buttonElement=this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());
+this.hasTitle||this.buttonElement.removeAttr("title");a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b);if(this.type==="radio")h(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed",
+true):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var b=this.buttonElement,c=a("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),
+d=this.options.icons,e=d.primary&&d.secondary;if(d.primary||d.secondary){b.addClass("ui-button-text-icon"+(e?"s":""));d.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){b.addClass(e?"ui-button-icons-only":"ui-button-icon-only").removeClass("ui-button-text-icons ui-button-text-icon");this.hasTitle||b.attr("title",c)}}else b.addClass("ui-button-text-only")}}});
+a.widget("ui.buttonset",{_create:function(){this.element.addClass("ui-buttonset");this._init()},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(":button, :submit, :reset, :checkbox, :radio, a, :data(button)").filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},
+destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery);
+;/*
+ * jQuery UI Dialog 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
+ */
+(function(c){c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:"center",resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");var a=this,b=a.options,d=b.title||a.originalTitle||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+
+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),
+h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",
+e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");
+a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==
+b.uiDialog[0])d=Math.max(d,c(this).css("z-index"))});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",
+c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;d.next().length&&d.appendTo("body");a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===
+f[0]&&e.shiftKey){g.focus(1);return false}}});c([]).add(d.find(".ui-dialog-content :tabbable:first")).add(d.find(".ui-dialog-buttonpane :tabbable:first")).add(d).filter(":first").focus();a._trigger("open");a._isOpen=true;return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix");b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,
+function(g,f){g=c('<button type="button"></button>').text(g).click(function(){f.apply(b.element[0],arguments)}).appendTo(e);c.fn.button&&g.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");
+b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,originalSize:f.originalSize,position:f.position,size:f.size}}a=a===undefined?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");
+a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",
+f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0];a=a||c.ui.dialog.prototype.options.position;if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(e,g){if(+b[e]===b[e]){d[e]=b[e];b[e]=
+g}})}else if(typeof a==="object"){if("left"in a){b[0]="left";d[0]=a.left}else if("right"in a){b[0]="right";d[0]=-a.right}if("top"in a){b[1]="top";d[1]=a.top}else if("bottom"in a){b[1]="bottom";d[1]=-a.bottom}}(a=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position({my:b.join(" "),at:b.join(" "),offset:d.join(" "),of:window,collision:"fit",using:function(e){var g=c(this).css(e).offset().top;g<0&&c(this).css("top",e.top-g)}});a||this.uiDialog.hide()},_setOption:function(a,
+b){var d=this,e=d.uiDialog,g=e.is(":data(resizable)"),f=false;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):e.removeClass("ui-dialog-disabled");break;case "draggable":b?d._makeDraggable():e.draggable("destroy");break;
+case "height":f=true;break;case "maxHeight":g&&e.resizable("option","maxHeight",b);f=true;break;case "maxWidth":g&&e.resizable("option","maxWidth",b);f=true;break;case "minHeight":g&&e.resizable("option","minHeight",b);f=true;break;case "minWidth":g&&e.resizable("option","minWidth",b);f=true;break;case "position":d._position(b);break;case "resizable":g&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",
+d.uiDialogTitlebar).html(""+(b||" "));break;case "width":f=true;break}c.Widget.prototype._setOption.apply(d,arguments);f&&d._size()},_size:function(){var a=this.options,b;this.element.css({width:"auto",minHeight:0,height:0});b=this.uiDialog.css({height:"auto",width:a.width}).height();this.element.css(a.height==="auto"?{minHeight:Math.max(a.minHeight-b,0),height:"auto"}:{minHeight:0,height:Math.max(a.height-b,0)}).show();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",
+this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.1",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&
+c(document).bind(c.ui.dialog.overlay.events,function(d){return c(d.target).zIndex()>=c.ui.dialog.overlay.maxZ})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});c.fn.bgiframe&&
+b.bgiframe();this.instances.push(b);return b},destroy:function(a){this.oldInstances.push(this.instances.splice(c.inArray(a,this.instances),1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var b=0;c.each(this.instances,function(){b=Math.max(b,this.css("z-index"))});this.maxZ=b},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);b=Math.max(document.documentElement.offsetHeight,
+document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a=a.add(this)});a.css({width:0,
+height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
+;/*
+ * jQuery UI Slider 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var b=this,a=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");a.disabled&&this.element.addClass("ui-slider-disabled ui-disabled");
+this.range=d([]);if(a.range){if(a.range===true){this.range=d("<div></div>");if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}else this.range=d("<div></div>");this.range.appendTo(this.element).addClass("ui-slider-range");if(a.range==="min"||a.range==="max")this.range.addClass("ui-slider-range-"+a.range);this.range.addClass("ui-widget-header")}d(".ui-slider-handle",this.element).length===0&&d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");
+if(a.values&&a.values.length)for(;d(".ui-slider-handle",this.element).length<a.values.length;)d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");this.handles=d(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(c){c.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();
+else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(c){d(this).data("index.ui-slider-handle",c)});this.handles.keydown(function(c){var e=true,f=d(this).data("index.ui-slider-handle"),g,h,i;if(!b.options.disabled){switch(c.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:e=
+false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");g=b._start(c,f);if(g===false)return}break}i=b.options.step;g=b.options.values&&b.options.values.length?(h=b.values(f)):(h=b.value());switch(c.keyCode){case d.ui.keyCode.HOME:h=b._valueMin();break;case d.ui.keyCode.END:h=b._valueMax();break;case d.ui.keyCode.PAGE_UP:h=g+(b._valueMax()-b._valueMin())/5;break;case d.ui.keyCode.PAGE_DOWN:h=g-(b._valueMax()-b._valueMin())/5;break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(g===
+b._valueMax())return;h=g+i;break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(g===b._valueMin())return;h=g-i;break}b._slide(c,f,h);return e}}).keyup(function(c){var e=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(c,e);b._change(c,e);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");
+this._mouseDestroy();return this},_mouseCapture:function(b){var a=this.options,c,e,f,g,h,i;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c={x:b.pageX,y:b.pageY};e=this._normValueFromMouse(c);f=this._valueMax()-this._valueMin()+1;h=this;this.handles.each(function(j){var k=Math.abs(e-h.values(j));if(f>k){f=k;g=d(this);i=j}});if(a.range===true&&this.values(1)===a.min){i+=1;g=d(this.handles[i])}if(this._start(b,
+i)===false)return false;this._mouseSliding=true;h._handleIndex=i;g.addClass("ui-state-active").focus();a=g.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-g.width()/2,top:b.pageY-a.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)};e=this._normValueFromMouse(c);this._slide(b,i,e);return this._animateOff=true},_mouseStart:function(){return true},
+_mouseDrag:function(b){var a=this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;
+if(this.orientation==="horizontal"){a=this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=
+this.values(a);c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var e;if(this.options.values&&this.options.values.length){e=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>e||a===1&&c<e))c=e;if(c!==this.values(a)){e=this.values();e[a]=c;b=this._trigger("slide",b,{handle:this.handles[a],value:c,values:e});this.values(a?0:1);b!==false&&this.values(a,c,true)}}else if(c!==this.value()){b=this._trigger("slide",b,{handle:this.handles[a],
+value:c});b!==false&&this.value(c)}},_stop:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("stop",b,c)},_change:function(b,a){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("change",b,c)}},value:function(b){if(arguments.length){this.options.value=
+this._trimAlignValue(b);this._refreshValue();this._change(null,0)}return this._value()},values:function(b,a){var c,e,f;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;e=arguments[0];for(f=0;f<c.length;f+=1){c[f]=this._trimAlignValue(e[f]);this._change(null,f)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(b):this.value();
+else return this._values()},_setOption:function(b,a){var c,e=0;if(d.isArray(this.options.values))e=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(b){case "disabled":if(a){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
+this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<e;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var b=this.options.value;return b=this._trimAlignValue(b)},_values:function(b){var a,c;if(arguments.length){a=this.options.values[b];
+return a=this._trimAlignValue(a)}else{a=this.options.values.slice();for(c=0;c<a.length;c+=1)a[c]=this._trimAlignValue(a[c]);return a}},_trimAlignValue:function(b){if(b<this._valueMin())return this._valueMin();if(b>this._valueMax())return this._valueMax();var a=this.options.step,c=b%a;b=b-c;if(c>=a/2)b+=a;return parseFloat(b.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var b=this.options.range,a=this.options,c=this,
+e=!this._animateOff?a.animate:false,f,g={},h,i,j,k;if(this.options.values&&this.options.values.length)this.handles.each(function(l){f=(c.values(l)-c._valueMin())/(c._valueMax()-c._valueMin())*100;g[c.orientation==="horizontal"?"left":"bottom"]=f+"%";d(this).stop(1,1)[e?"animate":"css"](g,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(l===0)c.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},a.animate);if(l===1)c.range[e?"animate":"css"]({width:f-h+"%"},{queue:false,duration:a.animate})}else{if(l===
+0)c.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},a.animate);if(l===1)c.range[e?"animate":"css"]({height:f-h+"%"},{queue:false,duration:a.animate})}h=f});else{i=this.value();j=this._valueMin();k=this._valueMax();f=k!==j?(i-j)/(k-j)*100:0;g[c.orientation==="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](g,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[e?"animate":"css"]({width:f+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[e?
+"animate":"css"]({width:100-f+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-f+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.1"})})(jQuery);
+;/*
+ * jQuery UI Tabs 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(d){var s=0,u=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:'<li><a href="#{href}"><span>#{label}</span></a></li>'},_create:function(){this._tabify(true)},_setOption:function(c,e){if(c=="selected")this.options.collapsible&&e==this.options.selected||
+this.select(e);else{this.options[c]=e;this._tabify()}},_tabId:function(c){return c.title&&c.title.replace(/\s/g,"_").replace(/[^A-Za-z0-9\-_:\.]/g,"")||this.options.idPrefix+ ++s},_sanitizeSelector:function(c){return c.replace(/:/g,"\\:")},_cookie:function(){var c=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+ ++u);return d.cookie.apply(null,[c].concat(d.makeArray(arguments)))},_ui:function(c,e){return{tab:c,panel:e,index:this.anchors.index(c)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var c=
+d(this);c.html(c.data("label.tabs")).removeData("label.tabs")})},_tabify:function(c){function e(g,f){g.css({display:""});!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}this.list=this.element.find("ol,ul").eq(0);this.lis=d("li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);var a=this,b=this.options,h=/^#.+/;this.anchors.each(function(g,f){var j=d(f).attr("href"),l=j.split("#")[0],p;if(l&&(l===location.toString().split("#")[0]||
+(p=d("base")[0])&&l===p.href)){j=f.hash;f.href=j}if(h.test(j))a.panels=a.panels.add(a._sanitizeSelector(j));else if(j!="#"){d.data(f,"href.tabs",j);d.data(f,"load.tabs",j.replace(/#.*$/,""));j=a._tabId(f);f.href="#"+j;f=d("#"+j);if(!f.length){f=d(b.panelTemplate).attr("id",j).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else b.disabled.push(g)});if(c){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
+this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(b.selected===undefined){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){b.selected=g;return false}});if(typeof b.selected!="number"&&b.cookie)b.selected=parseInt(a._cookie(),10);if(typeof b.selected!="number"&&this.lis.filter(".ui-tabs-selected").length)b.selected=
+this.lis.index(this.lis.filter(".ui-tabs-selected"));b.selected=b.selected||(this.lis.length?0:-1)}else if(b.selected===null)b.selected=-1;b.selected=b.selected>=0&&this.anchors[b.selected]||b.selected<0?b.selected:0;b.disabled=d.unique(b.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(b.selected,b.disabled)!=-1&&b.disabled.splice(d.inArray(b.selected,b.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
+if(b.selected>=0&&this.anchors.length){this.panels.eq(b.selected).removeClass("ui-tabs-hide");this.lis.eq(b.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[b.selected],a.panels[b.selected]))});this.load(b.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else b.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));this.element[b.collapsible?"addClass":
+"removeClass"]("ui-tabs-collapsible");b.cookie&&this._cookie(b.selected,b.cookie);c=0;for(var i;i=this.lis[c];c++)d(i)[d.inArray(c,b.disabled)!=-1&&!d(i).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");b.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(b.event!="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+g)};this.lis.bind("mouseover.tabs",
+function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(b.fx)if(d.isArray(b.fx)){m=b.fx[0];o=b.fx[1]}else m=o=b.fx;var q=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal",function(){e(f,o);a._trigger("show",
+null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},r=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")};this.anchors.bind(b.event+".tabs",
+function(){var g=this,f=d(this).closest("li"),j=a.panels.filter(":not(.ui-tabs-hide)"),l=d(a._sanitizeSelector(this.hash));if(f.hasClass("ui-tabs-selected")&&!b.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}b.selected=a.anchors.index(this);a.abort();if(b.collapsible)if(f.hasClass("ui-tabs-selected")){b.selected=-1;b.cookie&&a._cookie(b.selected,b.cookie);a.element.queue("tabs",function(){r(g,
+j)}).dequeue("tabs");this.blur();return false}else if(!j.length){b.cookie&&a._cookie(b.selected,b.cookie);a.element.queue("tabs",function(){q(g,l)});a.load(a.anchors.index(this));this.blur();return false}b.cookie&&a._cookie(b.selected,b.cookie);if(l.length){j.length&&a.element.queue("tabs",function(){r(g,j)});a.element.queue("tabs",function(){q(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",
+function(){return false})},destroy:function(){var c=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e=d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(b,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,
+"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});c.cookie&&this._cookie(null,c.cookie);return this},add:function(c,e,a){if(a===undefined)a=this.anchors.length;var b=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,c).replace(/#\{label\}/g,e));c=!c.indexOf("#")?c.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",
+true);var i=d("#"+c);i.length||(i=d(h.panelTemplate).attr("id",c).data("destroy.tabs",true));i.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);i.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]);i.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");i.removeClass("ui-tabs-hide");
+this.element.queue("tabs",function(){b._trigger("show",null,b._ui(b.anchors[0],b.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(c){var e=this.options,a=this.lis.eq(c).remove(),b=this.panels.eq(c).remove();if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(c+(c+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=c}),function(h){return h>=c?--h:h});this._tabify();this._trigger("remove",
+null,this._ui(a.find("a")[0],b[0]));return this},enable:function(c){var e=this.options;if(d.inArray(c,e.disabled)!=-1){this.lis.eq(c).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=c});this._trigger("enable",null,this._ui(this.anchors[c],this.panels[c]));return this}},disable:function(c){var e=this.options;if(c!=e.selected){this.lis.eq(c).addClass("ui-state-disabled");e.disabled.push(c);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[c],this.panels[c]))}return this},
+select:function(c){if(typeof c=="string")c=this.anchors.index(this.anchors.filter("[href$="+c+"]"));else if(c===null)c=-1;if(c==-1&&this.options.collapsible)c=this.options.selected;this.anchors.eq(c).trigger(this.options.event+".tabs");return this},load:function(c){var e=this,a=this.options,b=this.anchors.eq(c)[0],h=d.data(b,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(b,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(c).addClass("ui-state-processing");
+if(a.spinner){var i=d("span",b);i.data("label.tabs",i.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){d(e._sanitizeSelector(b.hash)).html(k);e._cleanup();a.cache&&d.data(b,"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[c],e.panels[c]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[c],e.panels[c]));try{a.ajaxOptions.error(k,n,c,b)}catch(m){}}}));e.element.dequeue("tabs");return this}},
+abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},url:function(c,e){this.anchors.eq(c).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.1"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(c,e){var a=this,b=this.options,h=a._rotate||(a._rotate=
+function(i){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=b.selected;a.select(++k<a.anchors.length?k:0)},c);i&&i.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(i){i.clientX&&a.rotate(null)}:function(){t=b.selected;h()});if(c){this.element.bind("tabsshow",h);this.anchors.bind(b.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(b.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
+;/*
+ * jQuery UI Datepicker 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * jquery.ui.core.js
+ */
+(function(d){function J(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass=
+"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su",
+"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"show",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",
+minDate:null,maxDate:null,duration:"_default",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>')}function E(a,b){d.extend(a,
+b);for(var c in b)if(b[c]==null||b[c]==undefined)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.1"}});var y=(new Date).getTime();d.extend(J.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){E(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=
+f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id)a.id="dp"+ ++this.uuid;var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}},
+_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&
+b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==
+""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,
+c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),
+true);this._updateDatepicker(b);this._updateAlternate(b)}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){a="dp"+ ++this.uuid;this._dialogInput=d('<input type="text" id="'+a+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}E(a.settings,e||{});b=b&&b.constructor==Date?
+this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);
+d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},
+_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=
+d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;
+for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({},e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&
+this._hideDatepicker();var h=this._getDateDatepicker(a,true);E(e.settings,f);this._attachments(d(a),e);this._autoSize(e);this._setDateDatepicker(a,h);this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&
+!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass,b.dpDiv).add(d("td."+d.datepicker._currentClass,b.dpDiv));c[0]?d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();
+return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);c=a.ctrlKey||a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||
+a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,
+a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));
+var c=String.fromCharCode(a.charCode==undefined?a.keyCode:a.charCode);return a.ctrlKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||
+a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");E(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);
+d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&
+d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=d.datepicker._getBorders(b.dpDiv);b.dpDiv.find("iframe.ui-datepicker-cover").css({left:-i[0],top:-i[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,
+h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a)).find("iframe.ui-datepicker-cover").css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}).end().find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){d(this).removeClass("ui-state-hover");
+this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).addClass("ui-datepicker-prev-hover");
+this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);var e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1||c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");
+a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input.focus()},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),
+k=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>k&&k>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1);)a=a[b?"previousSibling":"nextSibling"];
+a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():
+"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&
+!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;
+b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){a=this._getInst(d(a)[0]);
+a.input&&a._selectingMonthYear&&!d.browser.msie&&a.input.focus();a._selectingMonthYear=!a._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,
+"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||
+this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;
+for(var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff,f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,k=c=-1,l=-1,u=-1,j=false,o=function(p){(p=z+1<a.length&&a.charAt(z+1)==p)&&z++;return p},m=function(p){o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"?4:p=="o"?3:2)+"}");p=b.substring(s).match(p);if(!p)throw"Missing number at position "+
+s;s+=p[0].length;return parseInt(p[0],10)},n=function(p,w,G){p=o(p)?G:w;for(w=0;w<p.length;w++)if(b.substr(s,p[w].length)==p[w]){s+=p[w].length;return w+1}throw"Unknown name at position "+s;},r=function(){if(b.charAt(s)!=a.charAt(z))throw"Unexpected literal at position "+s;s++},s=0,z=0;z<a.length;z++)if(j)if(a.charAt(z)=="'"&&!o("'"))j=false;else r();else switch(a.charAt(z)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":k=m("m");break;case "M":k=n("M",i,g);break;
+case "y":c=m("y");break;case "@":var v=new Date(m("@"));c=v.getFullYear();k=v.getMonth()+1;l=v.getDate();break;case "!":v=new Date((m("!")-this._ticksTo1970)/1E4);c=v.getFullYear();k=v.getMonth()+1;l=v.getDate();break;case "'":if(o("'"))r();else j=true;break;default:r()}if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){k=1;l=u;do{e=this._getDaysInMonth(c,k-1);if(l<=e)break;k++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,
+k-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=k||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?
+c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=j+1<a.length&&a.charAt(j+1)==o)&&j++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<n;)m="0"+m;return m},k=function(o,m,n,r){return i(o)?r[m]:n[m]},l="",u=false;if(b)for(var j=0;j<a.length;j++)if(u)if(a.charAt(j)=="'"&&!i("'"))u=false;else l+=a.charAt(j);else switch(a.charAt(j)){case "d":l+=g("d",b.getDate(),2);break;
+case "D":l+=k("D",b.getDay(),e,f);break;case "o":l+=g("o",(b.getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=k("M",b.getMonth(),h,c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(j)}return l},_possibleChars:function(a){for(var b="",c=false,
+e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+="0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==undefined?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),
+e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth=f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},
+_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g=(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,k=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,j=u.exec(h);j;){switch(j[2]||"d"){case "d":case "D":g+=parseInt(j[1],10);break;case "w":case "W":g+=parseInt(j[1],
+10)*7;break;case "m":case "M":l+=parseInt(j[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(k,l));break;case "y":case "Y":k+=parseInt(j[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(k,l));break}j=u.exec(h)}return new Date(k,l,g)};if(b=(b=b==null?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):b)&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;
+a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||
+a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),k=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?
+new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),j=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=j&&n<j?j:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-k,1)),this._getFormatConfig(a));
+n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', -"+k+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,
+g+k,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', +"+k+", 'M');\" title=\""+r+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+r+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+r+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+r+"</span></a>";k=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&
+a.currentDay?u:b;k=!h?k:this.formatDate(k,r,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+y+'.datepicker._hideDatepicker();">'+this._get(a,"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,r)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+
+y+".datepicker._gotoToday('#"+a.id+"');\">"+k+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;k=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),w=this._get(a,"showOtherMonths"),G=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var K=this._getDefaultDate(a),H="",C=0;C<i[0];C++){for(var L=
+"",D=0;D<i[1];D++){var M=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",x="";if(l){x+='<div class="ui-datepicker-group';if(i[1]>1)switch(D){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&C==0?c?
+f:n:"")+(/all|right/.test(t)&&C==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,j,o,C>0||D>0,z,v)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var A=k?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(t=0;t<7;t++){var q=(t+h)%7;A+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+r[q]+'">'+s[q]+"</span></th>"}x+=A+"</tr></thead><tbody>";A=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,
+A);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;A=l?6:Math.ceil((t+A)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var N=0;N<A;N++){x+="<tr>";var O=!k?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(q)+"</td>";for(t=0;t<7;t++){var F=p?p.apply(a.input?a.input[0]:null,[q]):[true,""],B=q.getMonth()!=g,I=B&&!G||!F[0]||j&&q<j||o&&q>o;O+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(B?" ui-datepicker-other-month":"")+(q.getTime()==M.getTime()&&g==a.selectedMonth&&
+a._keyEvent||K.getTime()==q.getTime()&&K.getTime()==M.getTime()?" "+this._dayOverClass:"")+(I?" "+this._unselectableClass+" ui-state-disabled":"")+(B&&!w?"":" "+F[1]+(q.getTime()==u.getTime()?" "+this._currentClass:"")+(q.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!B||w)&&F[2]?' title="'+F[2]+'"':"")+(I?"":' onclick="DP_jQuery_'+y+".datepicker._selectDay('#"+a.id+"',"+q.getMonth()+","+q.getFullYear()+', this);return false;"')+">"+(B&&!w?" ":I?'<span class="ui-state-default">'+q.getDate()+
+"</span>":'<a class="ui-state-default'+(q.getTime()==b.getTime()?" ui-state-highlight":"")+(q.getTime()==u.getTime()?" ui-state-active":"")+(B?" ui-priority-secondary":"")+'" href="#">'+q.getDate()+"</a>")+"</td>";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+=O+"</tr>"}g++;if(g>11){g=0;m++}x+="</tbody></table>"+(l?"</div>"+(i[0]>0&&D==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");L+=x}H+=L}H+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':
+"");a._keyEvent=false;return H},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var k=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),j='<div class="ui-datepicker-title">',o="";if(h||!k)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+
+a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(j+=o+(h||!(k&&l)?" ":""));if(h||!l)j+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,
+i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(j+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)j+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";j+="</select>"}j+=this._get(a,"yearSuffix");if(u)j+=(h||!(k&&l)?" ":"")+o;j+="</div>";return j},_adjustInstDate:function(a,b,c){var e=
+a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,
+"onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);
+c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,
+"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=
+function(a){if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));
+return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new J;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.1";window["DP_jQuery_"+y]=d})(jQuery);
+;/*
+ * jQuery UI Progressbar 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(b){b.widget("ui.progressbar",{options:{value:0},_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this._valueMin(),"aria-valuemax":this._valueMax(),"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
+this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===undefined)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){switch(a){case "value":this.options.value=c;this._refreshValue();this._trigger("change");break}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;if(a<this._valueMin())a=this._valueMin();if(a>this._valueMax())a=this._valueMax();return a},
+_valueMin:function(){return 0},_valueMax:function(){return 100},_refreshValue:function(){var a=this.value();this.valueDiv[a===this._valueMax()?"addClass":"removeClass"]("ui-corner-right").width(a+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.1"})})(jQuery);
+;/*
+ * jQuery UI Effects 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+jQuery.effects||function(f){function k(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1],
+16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return l.transparent;return l[f.trim(c).toLowerCase()]}function q(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return k(b)}function m(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,
+a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function n(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in r||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function s(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function j(c,a,b,d){if(typeof c=="object"){d=
+a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(f.isFunction(b)){d=b;b=null}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:f.fx.speeds[b]||f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=q(b.elem,a);b.end=k(b.end);b.colorInit=
+true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var l={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,
+183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,
+165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},o=["add","remove","toggle"],r={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b,d){if(f.isFunction(b)){d=b;b=null}return this.each(function(){var e=f(this),g=e.attr("style")||" ",h=n(m.call(this)),p,t=e.attr("className");f.each(o,function(u,
+i){c[i]&&e[i+"Class"](c[i])});p=n(m.call(this));e.attr("className",t);e.animate(s(h,p),a,b,function(){f.each(o,function(u,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments)})})};f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?
+f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===undefined?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this,[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.1",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==
+null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,a){var b;switch(c[0]){case "top":b=0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();
+var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});
+c.css({position:"relative",top:0,left:0})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=j.apply(this,arguments);a={options:a[1],duration:a[2],callback:a[3]};var b=f.effects[c];return b&&!f.fx.off?b.call(this,a):this},_show:f.fn.show,show:function(c){if(!c||
+typeof c=="number"||f.fx.speeds[c])return this._show.apply(this,arguments);else{var a=j.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(!c||typeof c=="number"||f.fx.speeds[c])return this._hide.apply(this,arguments);else{var a=j.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(!c||typeof c=="number"||f.fx.speeds[c]||typeof c=="boolean"||f.isFunction(c))return this.__toggle.apply(this,
+arguments);else{var a=j.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,
+a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+
+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,
+10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*
+a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,
+a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);if(a<1)return-0.5*h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==undefined)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==undefined)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,
+a,b,d,e,g){if(g==undefined)g=1.70158;if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,a,b,d,e){return d-f.easing.easeOutBounce(c,e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,
+d,e)*0.5+b;return f.easing.easeOutBounce(c,a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery);
+;/*
+ * jQuery UI Effects Blind 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","left"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a,g);b.effects.removeWrapper(a);
+c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery);
+;/*
+ * jQuery UI Effects Bounce 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","left"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/
+3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a);
+b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Clip 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","left","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position,c/2)}var h={};h[g.size]=
+f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Drop 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","left","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e=="show"?1:
+0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Explode 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f=
+0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+
+e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery);
+;/*
+ * jQuery UI Effects Fold 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","left"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1],10)/100*
+f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery);
+;/*
+ * jQuery UI Effects Highlight 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&&
+this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Pulsate 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration,
+a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Scale 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a,
+b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity=
+1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","left","width","height","overflow","opacity"],g=["position","top","left","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],p=c.effects.setMode(a,
+b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}};if(m=="box"||m=="both"){if(d.from.y!=
+d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a);a.css("overflow","hidden").css(a.from);
+if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from);child.to=c.effects.setTransition(child,
+f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a,n?e:g);c.effects.removeWrapper(a);b.callback&&
+b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Shake 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","left"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]=(h=="pos"?"-=":"+=")+
+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery);
+;/*
+ * jQuery UI Effects Slide 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","left"],e=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(e=="show")a.css(f,b=="pos"?-g:g);var i={};i[f]=(e=="show"?b=="pos"?
+"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
+;/*
+ * jQuery UI Effects Transfer 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments);
+b.dequeue()})})}})(jQuery);
+;
\ No newline at end of file
diff --git a/libs/jquery/jquery.js b/libs/jquery/jquery.js
index b1ae21d8b2..7c24308023 100644
--- a/libs/jquery/jquery.js
+++ b/libs/jquery/jquery.js
@@ -1,19 +1,154 @@
-/*
- * jQuery JavaScript Library v1.3.2
+/*!
+ * jQuery JavaScript Library v1.4.2
* http://jquery.com/
*
- * Copyright (c) 2009 John Resig
- * Dual licensed under the MIT and GPL licenses.
- * http://docs.jquery.com/License
+ * Copyright 2010, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
*
- * Date: 2009-02-19 17:34:21 -0500 (Thu, 19 Feb 2009)
- * Revision: 6246
- */
-(function(){var l=this,g,y=l.jQuery,p=l.$,o=l.jQuery=l.$=function(E,F){return new o.fn.init(E,F)},D=/^[^<]*(<(.|\s)+>)[^>]*$|^#([\w-]+)$/,f=/^.[^:#\[\.,]*$/;o.fn=o.prototype={init:function(E,H){E=E||document;if(E.nodeType){this[0]=E;this.length=1;this.context=E;return this}if(typeof E==="string"){var G=D.exec(E);if(G&&(G[1]||!H)){if(G[1]){E=o.clean([G[1]],H)}else{var I=document.getElementById(G[3]);if(I&&I.id!=G[3]){return o().find(E)}var F=o(I||[]);F.context=document;F.selector=E;return F}}else{return o(H).find(E)}}else{if(o.isFunction(E)){return o(document).ready(E)}}if(E.selector&&E.context){this.selector=E.selector;this.context=E.context}return this.setArray(o.isArray(E)?E:o.makeArray(E))},selector:"",jquery:"1.3.2",size:function(){return this.length},get:function(E){return E===g?Array.prototype.slice.call(this):this[E]},pushStack:function(F,H,E){var G=o(F);G.prevObject=this;G.context=this.context;if(H==="find"){G.selector=this.selector+(this.selector?" ":"")+E}else{if(H){G.selector=this.selector+"."+H+"("+E+")"}}return G},setArray:function(E){this.length=0;Array.prototype.push.apply(this,E);return this},each:function(F,E){return o.each(this,F,E)},index:function(E){return o.inArray(E&&E.jquery?E[0]:E,this)},attr:function(F,H,G){var E=F;if(typeof F==="string"){if(H===g){return this[0]&&o[G||"attr"](this[0],F)}else{E={};E[F]=H}}return this.each(function(I){for(F in E){o.attr(G?this.style:this,F,o.prop(this,E[F],G,I,F))}})},css:function(E,F){if((E=="width"||E=="height")&&parseFloat(F)<0){F=g}return this.attr(E,F,"curCSS")},text:function(F){if(typeof F!=="object"&&F!=null){return this.empty().append((this[0]&&this[0].ownerDocument||document).createTextNode(F))}var E="";o.each(F||this,function(){o.each(this.childNodes,function(){if(this.nodeType!=8){E+=this.nodeType!=1?this.nodeValue:o.fn.text([this])}})});return E},wrapAll:function(E){if(this[0]){var F=o(E,this[0].ownerDocument).clone();if(this[0].parentNode){F.insertBefore(this[0])}F.map(function(){var G=this;while(G.firstChild){G=G.firstChild}return G}).append(this)}return this},wrapInner:function(E){return this.each(function(){o(this).contents().wrapAll(E)})},wrap:function(E){return this.each(function(){o(this).wrapAll(E)})},append:function(){return this.domManip(arguments,true,function(E){if(this.nodeType==1){this.appendChild(E)}})},prepend:function(){return this.domManip(arguments,true,function(E){if(this.nodeType==1){this.insertBefore(E,this.firstChild)}})},before:function(){return this.domManip(arguments,false,function(E){this.parentNode.insertBefore(E,this)})},after:function(){return this.domManip(arguments,false,function(E){this.parentNode.insertBefore(E,this.nextSibling)})},end:function(){return this.prevObject||o([])},push:[].push,sort:[].sort,splice:[].splice,find:function(E){if(this.length===1){var F=this.pushStack([],"find",E);F.length=0;o.find(E,this[0],F);return F}else{return this.pushStack(o.unique(o.map(this,function(G){return o.find(E,G)})),"find",E)}},clone:function(G){var E=this.map(function(){if(!o.support.noCloneEvent&&!o.isXMLDoc(this)){var I=this.outerHTML;if(!I){var J=this.ownerDocument.createElement("div");J.appendChild(this.cloneNode(true));I=J.innerHTML}return o.clean([I.replace(/ jQuery\d+="(?:\d+|null)"/g,"").replace(/^\s*/,"")])[0]}else{return this.cloneNode(true)}});if(G===true){var H=this.find("*").andSelf(),F=0;E.find("*").andSelf().each(function(){if(this.nodeName!==H[F].nodeName){return}var I=o.data(H[F],"events");for(var K in I){for(var J in I[K]){o.event.add(this,K,I[K][J],I[K][J].data)}}F++})}return E},filter:function(E){return this.pushStack(o.isFunction(E)&&o.grep(this,function(G,F){return E.call(G,F)})||o.multiFilter(E,o.grep(this,function(F){return F.nodeType===1})),"filter",E)},closest:function(E){var G=o.expr.match.POS.test(E)?o(E):null,F=0;return this.map(function(){var H=this;while(H&&H.ownerDocument){if(G?G.index(H)>-1:o(H).is(E)){o.data(H,"closest",F);return H}H=H.parentNode;F++}})},not:function(E){if(typeof E==="string"){if(f.test(E)){return this.pushStack(o.multiFilter(E,this,true),"not",E)}else{E=o.multiFilter(E,this)}}var F=E.length&&E[E.length-1]!==g&&!E.nodeType;return this.filter(function(){return F?o.inArray(this,E)<0:this!=E})},add:function(E){return this.pushStack(o.unique(o.merge(this.get(),typeof E==="string"?o(E):o.makeArray(E))))},is:function(E){return !!E&&o.multiFilter(E,this).length>0},hasClass:function(E){return !!E&&this.is("."+E)},val:function(K){if(K===g){var E=this[0];if(E){if(o.nodeName(E,"option")){return(E.attributes.value||{}).specified?E.value:E.text}if(o.nodeName(E,"select")){var I=E.selectedIndex,L=[],M=E.options,H=E.type=="select-one";if(I<0){return null}for(var F=H?I:0,J=H?I+1:M.length;F<J;F++){var G=M[F];if(G.selected){K=o(G).val();if(H){return K}L.push(K)}}return L}return(E.value||"").replace(/\r/g,"")}return g}if(typeof K==="number"){K+=""}return this.each(function(){if(this.nodeType!=1){return}if(o.isArray(K)&&/radio|checkbox/.test(this.type)){this.checked=(o.inArray(this.value,K)>=0||o.inArray(this.name,K)>=0)}else{if(o.nodeName(this,"select")){var N=o.makeArray(K);o("option",this).each(function(){this.selected=(o.inArray(this.value,N)>=0||o.inArray(this.text,N)>=0)});if(!N.length){this.selectedIndex=-1}}else{this.value=K}}})},html:function(E){return E===g?(this[0]?this[0].innerHTML.replace(/ jQuery\d+="(?:\d+|null)"/g,""):null):this.empty().append(E)},replaceWith:function(E){return this.after(E).remove()},eq:function(E){return this.slice(E,+E+1)},slice:function(){return this.pushStack(Array.prototype.slice.apply(this,arguments),"slice",Array.prototype.slice.call(arguments).join(","))},map:function(E){return this.pushStack(o.map(this,function(G,F){return E.call(G,F,G)}))},andSelf:function(){return this.add(this.prevObject)},domManip:function(J,M,L){if(this[0]){var I=(this[0].ownerDocument||this[0]).createDocumentFragment(),F=o.clean(J,(this[0].ownerDocument||this[0]),I),H=I.firstChild;if(H){for(var G=0,E=this.length;G<E;G++){L.call(K(this[G],H),this.length>1||G>0?I.cloneNode(true):I)}}if(F){o.each(F,z)}}return this;function K(N,O){return M&&o.nodeName(N,"table")&&o.nodeName(O,"tr")?(N.getElementsByTagName("tbody")[0]||N.appendChild(N.ownerDocument.createElement("tbody"))):N}}};o.fn.init.prototype=o.fn;function z(E,F){if(F.src){o.ajax({url:F.src,async:false,dataType:"script"})}else{o.globalEval(F.text||F.textContent||F.innerHTML||"")}if(F.parentNode){F.parentNode.removeChild(F)}}function e(){return +new Date}o.extend=o.fn.extend=function(){var J=arguments[0]||{},H=1,I=arguments.length,E=false,G;if(typeof J==="boolean"){E=J;J=arguments[1]||{};H=2}if(typeof J!=="object"&&!o.isFunction(J)){J={}}if(I==H){J=this;--H}for(;H<I;H++){if((G=arguments[H])!=null){for(var F in G){var K=J[F],L=G[F];if(J===L){continue}if(E&&L&&typeof L==="object"&&!L.nodeType){J[F]=o.extend(E,K||(L.length!=null?[]:{}),L)}else{if(L!==g){J[F]=L}}}}}return J};var b=/z-?index|font-?weight|opacity|zoom|line-?height/i,q=document.defaultView||{},s=Object.prototype.toString;o.extend({noConflict:function(E){l.$=p;if(E){l.jQuery=y}return o},isFunction:function(E){return s.call(E)==="[object Function]"},isArray:function(E){return s.call(E)==="[object Array]"},isXMLDoc:function(E){return E.nodeType===9&&E.documentElement.nodeName!=="HTML"||!!E.ownerDocument&&o.isXMLDoc(E.ownerDocument)},globalEval:function(G){if(G&&/\S/.test(G)){var F=document.getElementsByTagName("head")[0]||document.documentElement,E=document.createElement("script");E.type="text/javascript";if(o.support.scriptEval){E.appendChild(document.createTextNode(G))}else{E.text=G}F.insertBefore(E,F.firstChild);F.removeChild(E)}},nodeName:function(F,E){return F.nodeName&&F.nodeName.toUpperCase()==E.toUpperCase()},each:function(G,K,F){var E,H=0,I=G.length;if(F){if(I===g){for(E in G){if(K.apply(G[E],F)===false){break}}}else{for(;H<I;){if(K.apply(G[H++],F)===false){break}}}}else{if(I===g){for(E in G){if(K.call(G[E],E,G[E])===false){break}}}else{for(var J=G[0];H<I&&K.call(J,H,J)!==false;J=G[++H]){}}}return G},prop:function(H,I,G,F,E){if(o.isFunction(I)){I=I.call(H,F)}return typeof I==="number"&&G=="curCSS"&&!b.test(E)?I+"px":I},className:{add:function(E,F){o.each((F||"").split(/\s+/),function(G,H){if(E.nodeType==1&&!o.className.has(E.className,H)){E.className+=(E.className?" ":"")+H}})},remove:function(E,F){if(E.nodeType==1){E.className=F!==g?o.grep(E.className.split(/\s+/),function(G){return !o.className.has(F,G)}).join(" "):""}},has:function(F,E){return F&&o.inArray(E,(F.className||F).toString().split(/\s+/))>-1}},swap:function(H,G,I){var E={};for(var F in G){E[F]=H.style[F];H.style[F]=G[F]}I.call(H);for(var F in G){H.style[F]=E[F]}},css:function(H,F,J,E){if(F=="width"||F=="height"){var L,G={position:"absolute",visibility:"hidden",display:"block"},K=F=="width"?["Left","Right"]:["Top","Bottom"];function I(){L=F=="width"?H.offsetWidth:H.offsetHeight;if(E==="border"){return}o.each(K,function(){if(!E){L-=parseFloat(o.curCSS(H,"padding"+this,true))||0}if(E==="margin"){L+=parseFloat(o.curCSS(H,"margin"+this,true))||0}else{L-=parseFloat(o.curCSS(H,"border"+this+"Width",true))||0}})}if(H.offsetWidth!==0){I()}else{o.swap(H,G,I)}return Math.max(0,Math.round(L))}return o.curCSS(H,F,J)},curCSS:function(I,F,G){var L,E=I.style;if(F=="opacity"&&!o.support.opacity){L=o.attr(E,"opacity");return L==""?"1":L}if(F.match(/float/i)){F=w}if(!G&&E&&E[F]){L=E[F]}else{if(q.getComputedStyle){if(F.match(/float/i)){F="float"}F=F.replace(/([A-Z])/g,"-$1").toLowerCase();var M=q.getComputedStyle(I,null);if(M){L=M.getPropertyValue(F)}if(F=="opacity"&&L==""){L="1"}}else{if(I.currentStyle){var J=F.replace(/\-(\w)/g,function(N,O){return O.toUpperCase()});L=I.currentStyle[F]||I.currentStyle[J];if(!/^\d+(px)?$/i.test(L)&&/^\d/.test(L)){var H=E.left,K=I.runtimeStyle.left;I.runtimeStyle.left=I.currentStyle.left;E.left=L||0;L=E.pixelLeft+"px";E.left=H;I.runtimeStyle.left=K}}}}return L},clean:function(F,K,I){K=K||document;if(typeof K.createElement==="undefined"){K=K.ownerDocument||K[0]&&K[0].ownerDocument||document}if(!I&&F.length===1&&typeof F[0]==="string"){var H=/^<(\w+)\s*\/?>$/.exec(F[0]);if(H){return[K.createElement(H[1])]}}var G=[],E=[],L=K.createElement("div");o.each(F,function(P,S){if(typeof S==="number"){S+=""}if(!S){return}if(typeof S==="string"){S=S.replace(/(<(\w+)[^>]*?)\/>/g,function(U,V,T){return T.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i)?U:V+"></"+T+">"});var O=S.replace(/^\s+/,"").substring(0,10).toLowerCase();var Q=!O.indexOf("<opt")&&[1,"<select multiple='multiple'>","</select>"]||!O.indexOf("<leg")&&[1,"<fieldset>","</fieldset>"]||O.match(/^<(thead|tbody|tfoot|colg|cap)/)&&[1,"<table>","</table>"]||!O.indexOf("<tr")&&[2,"<table><tbody>","</tbody></table>"]||(!O.indexOf("<td")||!O.indexOf("<th"))&&[3,"<table><tbody><tr>","</tr></tbody></table>"]||!O.indexOf("<col")&&[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"]||!o.support.htmlSerialize&&[1,"div<div>","</div>"]||[0,"",""];L.innerHTML=Q[1]+S+Q[2];while(Q[0]--){L=L.lastChild}if(!o.support.tbody){var R=/<tbody/i.test(S),N=!O.indexOf("<table")&&!R?L.firstChild&&L.firstChild.childNodes:Q[1]=="<table>"&&!R?L.childNodes:[];for(var M=N.length-1;M>=0;--M){if(o.nodeName(N[M],"tbody")&&!N[M].childNodes.length){N[M].parentNode.removeChild(N[M])}}}if(!o.support.leadingWhitespace&&/^\s/.test(S)){L.insertBefore(K.createTextNode(S.match(/^\s*/)[0]),L.firstChild)}S=o.makeArray(L.childNodes)}if(S.nodeType){G.push(S)}else{G=o.merge(G,S)}});if(I){for(var J=0;G[J];J++){if(o.nodeName(G[J],"script")&&(!G[J].type||G[J].type.toLowerCase()==="text/javascript")){E.push(G[J].parentNode?G[J].parentNode.removeChild(G[J]):G[J])}else{if(G[J].nodeType===1){G.splice.apply(G,[J+1,0].concat(o.makeArray(G[J].getElementsByTagName("script"))))}I.appendChild(G[J])}}return E}return G},attr:function(J,G,K){if(!J||J.nodeType==3||J.nodeType==8){return g}var H=!o.isXMLDoc(J),L=K!==g;G=H&&o.props[G]||G;if(J.tagName){var F=/href|src|style/.test(G);if(G=="selected"&&J.parentNode){J.parentNode.selectedIndex}if(G in J&&H&&!F){if(L){if(G=="type"&&o.nodeName(J,"input")&&J.parentNode){throw"type property can't be changed"}J[G]=K}if(o.nodeName(J,"form")&&J.getAttributeNode(G)){return J.getAttributeNode(G).nodeValue}if(G=="tabIndex"){var I=J.getAttributeNode("tabIndex");return I&&I.specified?I.value:J.nodeName.match(/(button|input|object|select|textarea)/i)?0:J.nodeName.match(/^(a|area)$/i)&&J.href?0:g}return J[G]}if(!o.support.style&&H&&G=="style"){return o.attr(J.style,"cssText",K)}if(L){J.setAttribute(G,""+K)}var E=!o.support.hrefNormalized&&H&&F?J.getAttribute(G,2):J.getAttribute(G);return E===null?g:E}if(!o.support.opacity&&G=="opacity"){if(L){J.zoom=1;J.filter=(J.filter||"").replace(/alpha\([^)]*\)/,"")+(parseInt(K)+""=="NaN"?"":"alpha(opacity="+K*100+")")}return J.filter&&J.filter.indexOf("opacity=")>=0?(parseFloat(J.filter.match(/opacity=([^)]*)/)[1])/100)+"":""}G=G.replace(/-([a-z])/ig,function(M,N){return N.toUpperCase()});if(L){J[G]=K}return J[G]},trim:function(E){return(E||"").replace(/^\s+|\s+$/g,"")},makeArray:function(G){var E=[];if(G!=null){var F=G.length;if(F==null||typeof G==="string"||o.isFunction(G)||G.setInterval){E[0]=G}else{while(F){E[--F]=G[F]}}}return E},inArray:function(G,H){for(var E=0,F=H.length;E<F;E++){if(H[E]===G){return E}}return -1},merge:function(H,E){var F=0,G,I=H.length;if(!o.support.getAll){while((G=E[F++])!=null){if(G.nodeType!=8){H[I++]=G}}}else{while((G=E[F++])!=null){H[I++]=G}}return H},unique:function(K){var F=[],E={};try{for(var G=0,H=K.length;G<H;G++){var J=o.data(K[G]);if(!E[J]){E[J]=true;F.push(K[G])}}}catch(I){F=K}return F},grep:function(F,J,E){var G=[];for(var H=0,I=F.length;H<I;H++){if(!E!=!J(F[H],H)){G.push(F[H])}}return G},map:function(E,J){var F=[];for(var G=0,H=E.length;G<H;G++){var I=J(E[G],G);if(I!=null){F[F.length]=I}}return F.concat.apply([],F)}});var C=navigator.userAgent.toLowerCase();o.browser={version:(C.match(/.+(?:rv|it|ra|ie)[\/: ]([\d.]+)/)||[0,"0"])[1],safari:/webkit/.test(C),opera:/opera/.test(C),msie:/msie/.test(C)&&!/opera/.test(C),mozilla:/mozilla/.test(C)&&!/(compatible|webkit)/.test(C)};o.each({parent:function(E){return E.parentNode},parents:function(E){return o.dir(E,"parentNode")},next:function(E){return o.nth(E,2,"nextSibling")},prev:function(E){return o.nth(E,2,"previousSibling")},nextAll:function(E){return o.dir(E,"nextSibling")},prevAll:function(E){return o.dir(E,"previousSibling")},siblings:function(E){return o.sibling(E.parentNode.firstChild,E)},children:function(E){return o.sibling(E.firstChild)},contents:function(E){return o.nodeName(E,"iframe")?E.contentDocument||E.contentWindow.document:o.makeArray(E.childNodes)}},function(E,F){o.fn[E]=function(G){var H=o.map(this,F);if(G&&typeof G=="string"){H=o.multiFilter(G,H)}return this.pushStack(o.unique(H),E,G)}});o.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(E,F){o.fn[E]=function(G){var J=[],L=o(G);for(var K=0,H=L.length;K<H;K++){var I=(K>0?this.clone(true):this).get();o.fn[F].apply(o(L[K]),I);J=J.concat(I)}return this.pushStack(J,E,G)}});o.each({removeAttr:function(E){o.attr(this,E,"");if(this.nodeType==1){this.removeAttribute(E)}},addClass:function(E){o.className.add(this,E)},removeClass:function(E){o.className.remove(this,E)},toggleClass:function(F,E){if(typeof E!=="boolean"){E=!o.className.has(this,F)}o.className[E?"add":"remove"](this,F)},remove:function(E){if(!E||o.filter(E,[this]).length){o("*",this).add([this]).each(function(){o.event.remove(this);o.removeData(this)});if(this.parentNode){this.parentNode.removeChild(this)}}},empty:function(){o(this).children().remove();while(this.firstChild){this.removeChild(this.firstChild)}}},function(E,F){o.fn[E]=function(){return this.each(F,arguments)}});function j(E,F){return E[0]&&parseInt(o.curCSS(E[0],F,true),10)||0}var h="jQuery"+e(),v=0,A={};o.extend({cache:{},data:function(F,E,G){F=F==l?A:F;var H=F[h];if(!H){H=F[h]=++v}if(E&&!o.cache[H]){o.cache[H]={}}if(G!==g){o.cache[H][E]=G}return E?o.cache[H][E]:H},removeData:function(F,E){F=F==l?A:F;var H=F[h];if(E){if(o.cache[H]){delete o.cache[H][E];E="";for(E in o.cache[H]){break}if(!E){o.removeData(F)}}}else{try{delete F[h]}catch(G){if(F.removeAttribute){F.removeAttribute(h)}}delete o.cache[H]}},queue:function(F,E,H){if(F){E=(E||"fx")+"queue";var G=o.data(F,E);if(!G||o.isArray(H)){G=o.data(F,E,o.makeArray(H))}else{if(H){G.push(H)}}}return G},dequeue:function(H,G){var E=o.queue(H,G),F=E.shift();if(!G||G==="fx"){F=E[0]}if(F!==g){F.call(H)}}});o.fn.extend({data:function(E,G){var H=E.split(".");H[1]=H[1]?"."+H[1]:"";if(G===g){var F=this.triggerHandler("getData"+H[1]+"!",[H[0]]);if(F===g&&this.length){F=o.data(this[0],E)}return F===g&&H[1]?this.data(H[0]):F}else{return this.trigger("setData"+H[1]+"!",[H[0],G]).each(function(){o.data(this,E,G)})}},removeData:function(E){return this.each(function(){o.removeData(this,E)})},queue:function(E,F){if(typeof E!=="string"){F=E;E="fx"}if(F===g){return o.queue(this[0],E)}return this.each(function(){var G=o.queue(this,E,F);if(E=="fx"&&G.length==1){G[0].call(this)}})},dequeue:function(E){return this.each(function(){o.dequeue(this,E)})}});
-/*
- * Sizzle CSS Selector Engine - v0.9.3
- * Copyright 2009, The Dojo Foundation
- * Released under the MIT, BSD, and GPL Licenses.
- * More information: http://sizzlejs.com/
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ * Copyright 2010, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ *
+ * Date: Sat Feb 13 22:33:48 2010 -0500
*/
-(function(){var R=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?/g,L=0,H=Object.prototype.toString;var F=function(Y,U,ab,ac){ab=ab||[];U=U||document;if(U.nodeType!==1&&U.nodeType!==9){return[]}if(!Y||typeof Y!=="string"){return ab}var Z=[],W,af,ai,T,ad,V,X=true;R.lastIndex=0;while((W=R.exec(Y))!==null){Z.push(W[1]);if(W[2]){V=RegExp.rightContext;break}}if(Z.length>1&&M.exec(Y)){if(Z.length===2&&I.relative[Z[0]]){af=J(Z[0]+Z[1],U)}else{af=I.relative[Z[0]]?[U]:F(Z.shift(),U);while(Z.length){Y=Z.shift();if(I.relative[Y]){Y+=Z.shift()}af=J(Y,af)}}}else{var ae=ac?{expr:Z.pop(),set:E(ac)}:F.find(Z.pop(),Z.length===1&&U.parentNode?U.parentNode:U,Q(U));af=F.filter(ae.expr,ae.set);if(Z.length>0){ai=E(af)}else{X=false}while(Z.length){var ah=Z.pop(),ag=ah;if(!I.relative[ah]){ah=""}else{ag=Z.pop()}if(ag==null){ag=U}I.relative[ah](ai,ag,Q(U))}}if(!ai){ai=af}if(!ai){throw"Syntax error, unrecognized expression: "+(ah||Y)}if(H.call(ai)==="[object Array]"){if(!X){ab.push.apply(ab,ai)}else{if(U.nodeType===1){for(var aa=0;ai[aa]!=null;aa++){if(ai[aa]&&(ai[aa]===true||ai[aa].nodeType===1&&K(U,ai[aa]))){ab.push(af[aa])}}}else{for(var aa=0;ai[aa]!=null;aa++){if(ai[aa]&&ai[aa].nodeType===1){ab.push(af[aa])}}}}}else{E(ai,ab)}if(V){F(V,U,ab,ac);if(G){hasDuplicate=false;ab.sort(G);if(hasDuplicate){for(var aa=1;aa<ab.length;aa++){if(ab[aa]===ab[aa-1]){ab.splice(aa--,1)}}}}}return ab};F.matches=function(T,U){return F(T,null,null,U)};F.find=function(aa,T,ab){var Z,X;if(!aa){return[]}for(var W=0,V=I.order.length;W<V;W++){var Y=I.order[W],X;if((X=I.match[Y].exec(aa))){var U=RegExp.leftContext;if(U.substr(U.length-1)!=="\\"){X[1]=(X[1]||"").replace(/\\/g,"");Z=I.find[Y](X,T,ab);if(Z!=null){aa=aa.replace(I.match[Y],"");break}}}}if(!Z){Z=T.getElementsByTagName("*")}return{set:Z,expr:aa}};F.filter=function(ad,ac,ag,W){var V=ad,ai=[],aa=ac,Y,T,Z=ac&&ac[0]&&Q(ac[0]);while(ad&&ac.length){for(var ab in I.filter){if((Y=I.match[ab].exec(ad))!=null){var U=I.filter[ab],ah,af;T=false;if(aa==ai){ai=[]}if(I.preFilter[ab]){Y=I.preFilter[ab](Y,aa,ag,ai,W,Z);if(!Y){T=ah=true}else{if(Y===true){continue}}}if(Y){for(var X=0;(af=aa[X])!=null;X++){if(af){ah=U(af,Y,X,aa);var ae=W^!!ah;if(ag&&ah!=null){if(ae){T=true}else{aa[X]=false}}else{if(ae){ai.push(af);T=true}}}}}if(ah!==g){if(!ag){aa=ai}ad=ad.replace(I.match[ab],"");if(!T){return[]}break}}}if(ad==V){if(T==null){throw"Syntax error, unrecognized expression: "+ad}else{break}}V=ad}return aa};var I=F.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF_-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF_-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*_-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF_-]|\\.)+)(?:\((['"]*)((?:\([^\)]+\)|[^\2\(\)]*)+)\2\))?/},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(T){return T.getAttribute("href")}},relative:{"+":function(aa,T,Z){var X=typeof T==="string",ab=X&&!/\W/.test(T),Y=X&&!ab;if(ab&&!Z){T=T.toUpperCase()}for(var W=0,V=aa.length,U;W<V;W++){if((U=aa[W])){while((U=U.previousSibling)&&U.nodeType!==1){}aa[W]=Y||U&&U.nodeName===T?U||false:U===T}}if(Y){F.filter(T,aa,true)}},">":function(Z,U,aa){var X=typeof U==="string";if(X&&!/\W/.test(U)){U=aa?U:U.toUpperCase();for(var V=0,T=Z.length;V<T;V++){var Y=Z[V];if(Y){var W=Y.parentNode;Z[V]=W.nodeName===U?W:false}}}else{for(var V=0,T=Z.length;V<T;V++){var Y=Z[V];if(Y){Z[V]=X?Y.parentNode:Y.parentNode===U}}if(X){F.filter(U,Z,true)}}},"":function(W,U,Y){var V=L++,T=S;if(!U.match(/\W/)){var X=U=Y?U:U.toUpperCase();T=P}T("parentNode",U,V,W,X,Y)},"~":function(W,U,Y){var V=L++,T=S;if(typeof U==="string"&&!U.match(/\W/)){var X=U=Y?U:U.toUpperCase();T=P}T("previousSibling",U,V,W,X,Y)}},find:{ID:function(U,V,W){if(typeof V.getElementById!=="undefined"&&!W){var T=V.getElementById(U[1]);return T?[T]:[]}},NAME:function(V,Y,Z){if(typeof Y.getElementsByName!=="undefined"){var U=[],X=Y.getElementsByName(V[1]);for(var W=0,T=X.length;W<T;W++){if(X[W].getAttribute("name")===V[1]){U.push(X[W])}}return U.length===0?null:U}},TAG:function(T,U){return U.getElementsByTagName(T[1])}},preFilter:{CLASS:function(W,U,V,T,Z,aa){W=" "+W[1].replace(/\\/g,"")+" ";if(aa){return W}for(var X=0,Y;(Y=U[X])!=null;X++){if(Y){if(Z^(Y.className&&(" "+Y.className+" ").indexOf(W)>=0)){if(!V){T.push(Y)}}else{if(V){U[X]=false}}}}return false},ID:function(T){return T[1].replace(/\\/g,"")},TAG:function(U,T){for(var V=0;T[V]===false;V++){}return T[V]&&Q(T[V])?U[1]:U[1].toUpperCase()},CHILD:function(T){if(T[1]=="nth"){var U=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(T[2]=="even"&&"2n"||T[2]=="odd"&&"2n+1"||!/\D/.test(T[2])&&"0n+"+T[2]||T[2]);T[2]=(U[1]+(U[2]||1))-0;T[3]=U[3]-0}T[0]=L++;return T},ATTR:function(X,U,V,T,Y,Z){var W=X[1].replace(/\\/g,"");if(!Z&&I.attrMap[W]){X[1]=I.attrMap[W]}if(X[2]==="~="){X[4]=" "+X[4]+" "}return X},PSEUDO:function(X,U,V,T,Y){if(X[1]==="not"){if(X[3].match(R).length>1||/^\w/.test(X[3])){X[3]=F(X[3],null,null,U)}else{var W=F.filter(X[3],U,V,true^Y);if(!V){T.push.apply(T,W)}return false}}else{if(I.match.POS.test(X[0])||I.match.CHILD.test(X[0])){return true}}return X},POS:function(T){T.unshift(true);return T}},filters:{enabled:function(T){return T.disabled===false&&T.type!=="hidden"},disabled:function(T){return T.disabled===true},checked:function(T){return T.checked===true},selected:function(T){T.parentNode.selectedIndex;return T.selected===true},parent:function(T){return !!T.firstChild},empty:function(T){return !T.firstChild},has:function(V,U,T){return !!F(T[3],V).length},header:function(T){return/h\d/i.test(T.nodeName)},text:function(T){return"text"===T.type},radio:function(T){return"radio"===T.type},checkbox:function(T){return"checkbox"===T.type},file:function(T){return"file"===T.type},password:function(T){return"password"===T.type},submit:function(T){return"submit"===T.type},image:function(T){return"image"===T.type},reset:function(T){return"reset"===T.type},button:function(T){return"button"===T.type||T.nodeName.toUpperCase()==="BUTTON"},input:function(T){return/input|select|textarea|button/i.test(T.nodeName)}},setFilters:{first:function(U,T){return T===0},last:function(V,U,T,W){return U===W.length-1},even:function(U,T){return T%2===0},odd:function(U,T){return T%2===1},lt:function(V,U,T){return U<T[3]-0},gt:function(V,U,T){return U>T[3]-0},nth:function(V,U,T){return T[3]-0==U},eq:function(V,U,T){return T[3]-0==U}},filter:{PSEUDO:function(Z,V,W,aa){var U=V[1],X=I.filters[U];if(X){return X(Z,W,V,aa)}else{if(U==="contains"){return(Z.textContent||Z.innerText||"").indexOf(V[3])>=0}else{if(U==="not"){var Y=V[3];for(var W=0,T=Y.length;W<T;W++){if(Y[W]===Z){return false}}return true}}}},CHILD:function(T,W){var Z=W[1],U=T;switch(Z){case"only":case"first":while(U=U.previousSibling){if(U.nodeType===1){return false}}if(Z=="first"){return true}U=T;case"last":while(U=U.nextSibling){if(U.nodeType===1){return false}}return true;case"nth":var V=W[2],ac=W[3];if(V==1&&ac==0){return true}var Y=W[0],ab=T.parentNode;if(ab&&(ab.sizcache!==Y||!T.nodeIndex)){var X=0;for(U=ab.firstChild;U;U=U.nextSibling){if(U.nodeType===1){U.nodeIndex=++X}}ab.sizcache=Y}var aa=T.nodeIndex-ac;if(V==0){return aa==0}else{return(aa%V==0&&aa/V>=0)}}},ID:function(U,T){return U.nodeType===1&&U.getAttribute("id")===T},TAG:function(U,T){return(T==="*"&&U.nodeType===1)||U.nodeName===T},CLASS:function(U,T){return(" "+(U.className||U.getAttribute("class"))+" ").indexOf(T)>-1},ATTR:function(Y,W){var V=W[1],T=I.attrHandle[V]?I.attrHandle[V](Y):Y[V]!=null?Y[V]:Y.getAttribute(V),Z=T+"",X=W[2],U=W[4];return T==null?X==="!=":X==="="?Z===U:X==="*="?Z.indexOf(U)>=0:X==="~="?(" "+Z+" ").indexOf(U)>=0:!U?Z&&T!==false:X==="!="?Z!=U:X==="^="?Z.indexOf(U)===0:X==="$="?Z.substr(Z.length-U.length)===U:X==="|="?Z===U||Z.substr(0,U.length+1)===U+"-":false},POS:function(X,U,V,Y){var T=U[2],W=I.setFilters[T];if(W){return W(X,V,U,Y)}}}};var M=I.match.POS;for(var O in I.match){I.match[O]=RegExp(I.match[O].source+/(?![^\[]*\])(?![^\(]*\))/.source)}var E=function(U,T){U=Array.prototype.slice.call(U);if(T){T.push.apply(T,U);return T}return U};try{Array.prototype.slice.call(document.documentElement.childNodes)}catch(N){E=function(X,W){var U=W||[];if(H.call(X)==="[object Array]"){Array.prototype.push.apply(U,X)}else{if(typeof X.length==="number"){for(var V=0,T=X.length;V<T;V++){U.push(X[V])}}else{for(var V=0;X[V];V++){U.push(X[V])}}}return U}}var G;if(document.documentElement.compareDocumentPosition){G=function(U,T){var V=U.compareDocumentPosition(T)&4?-1:U===T?0:1;if(V===0){hasDuplicate=true}return V}}else{if("sourceIndex" in document.documentElement){G=function(U,T){var V=U.sourceIndex-T.sourceIndex;if(V===0){hasDuplicate=true}return V}}else{if(document.createRange){G=function(W,U){var V=W.ownerDocument.createRange(),T=U.ownerDocument.createRange();V.selectNode(W);V.collapse(true);T.selectNode(U);T.collapse(true);var X=V.compareBoundaryPoints(Range.START_TO_END,T);if(X===0){hasDuplicate=true}return X}}}}(function(){var U=document.createElement("form"),V="script"+(new Date).getTime();U.innerHTML="<input name='"+V+"'/>";var T=document.documentElement;T.insertBefore(U,T.firstChild);if(!!document.getElementById(V)){I.find.ID=function(X,Y,Z){if(typeof Y.getElementById!=="undefined"&&!Z){var W=Y.getElementById(X[1]);return W?W.id===X[1]||typeof W.getAttributeNode!=="undefined"&&W.getAttributeNode("id").nodeValue===X[1]?[W]:g:[]}};I.filter.ID=function(Y,W){var X=typeof Y.getAttributeNode!=="undefined"&&Y.getAttributeNode("id");return Y.nodeType===1&&X&&X.nodeValue===W}}T.removeChild(U)})();(function(){var T=document.createElement("div");T.appendChild(document.createComment(""));if(T.getElementsByTagName("*").length>0){I.find.TAG=function(U,Y){var X=Y.getElementsByTagName(U[1]);if(U[1]==="*"){var W=[];for(var V=0;X[V];V++){if(X[V].nodeType===1){W.push(X[V])}}X=W}return X}}T.innerHTML="<a href='#'></a>";if(T.firstChild&&typeof T.firstChild.getAttribute!=="undefined"&&T.firstChild.getAttribute("href")!=="#"){I.attrHandle.href=function(U){return U.getAttribute("href",2)}}})();if(document.querySelectorAll){(function(){var T=F,U=document.createElement("div");U.innerHTML="<p class='TEST'></p>";if(U.querySelectorAll&&U.querySelectorAll(".TEST").length===0){return}F=function(Y,X,V,W){X=X||document;if(!W&&X.nodeType===9&&!Q(X)){try{return E(X.querySelectorAll(Y),V)}catch(Z){}}return T(Y,X,V,W)};F.find=T.find;F.filter=T.filter;F.selectors=T.selectors;F.matches=T.matches})()}if(document.getElementsByClassName&&document.documentElement.getElementsByClassName){(function(){var T=document.createElement("div");T.innerHTML="<div class='test e'></div><div class='test'></div>";if(T.getElementsByClassName("e").length===0){return}T.lastChild.className="e";if(T.getElementsByClassName("e").length===1){return}I.order.splice(1,0,"CLASS");I.find.CLASS=function(U,V,W){if(typeof V.getElementsByClassName!=="undefined"&&!W){return V.getElementsByClassName(U[1])}}})()}function P(U,Z,Y,ad,aa,ac){var ab=U=="previousSibling"&&!ac;for(var W=0,V=ad.length;W<V;W++){var T=ad[W];if(T){if(ab&&T.nodeType===1){T.sizcache=Y;T.sizset=W}T=T[U];var X=false;while(T){if(T.sizcache===Y){X=ad[T.sizset];break}if(T.nodeType===1&&!ac){T.sizcache=Y;T.sizset=W}if(T.nodeName===Z){X=T;break}T=T[U]}ad[W]=X}}}function S(U,Z,Y,ad,aa,ac){var ab=U=="previousSibling"&&!ac;for(var W=0,V=ad.length;W<V;W++){var T=ad[W];if(T){if(ab&&T.nodeType===1){T.sizcache=Y;T.sizset=W}T=T[U];var X=false;while(T){if(T.sizcache===Y){X=ad[T.sizset];break}if(T.nodeType===1){if(!ac){T.sizcache=Y;T.sizset=W}if(typeof Z!=="string"){if(T===Z){X=true;break}}else{if(F.filter(Z,[T]).length>0){X=T;break}}}T=T[U]}ad[W]=X}}}var K=document.compareDocumentPosition?function(U,T){return U.compareDocumentPosition(T)&16}:function(U,T){return U!==T&&(U.contains?U.contains(T):true)};var Q=function(T){return T.nodeType===9&&T.documentElement.nodeName!=="HTML"||!!T.ownerDocument&&Q(T.ownerDocument)};var J=function(T,aa){var W=[],X="",Y,V=aa.nodeType?[aa]:aa;while((Y=I.match.PSEUDO.exec(T))){X+=Y[0];T=T.replace(I.match.PSEUDO,"")}T=I.relative[T]?T+"*":T;for(var Z=0,U=V.length;Z<U;Z++){F(T,V[Z],W)}return F.filter(X,W)};o.find=F;o.filter=F.filter;o.expr=F.selectors;o.expr[":"]=o.expr.filters;F.selectors.filters.hidden=function(T){return T.offsetWidth===0||T.offsetHeight===0};F.selectors.filters.visible=function(T){return T.offsetWidth>0||T.offsetHeight>0};F.selectors.filters.animated=function(T){return o.grep(o.timers,function(U){return T===U.elem}).length};o.multiFilter=function(V,T,U){if(U){V=":not("+V+")"}return F.matches(V,T)};o.dir=function(V,U){var T=[],W=V[U];while(W&&W!=document){if(W.nodeType==1){T.push(W)}W=W[U]}return T};o.nth=function(X,T,V,W){T=T||1;var U=0;for(;X;X=X[V]){if(X.nodeType==1&&++U==T){break}}return X};o.sibling=function(V,U){var T=[];for(;V;V=V.nextSibling){if(V.nodeType==1&&V!=U){T.push(V)}}return T};return;l.Sizzle=F})();o.event={add:function(I,F,H,K){if(I.nodeType==3||I.nodeType==8){return}if(I.setInterval&&I!=l){I=l}if(!H.guid){H.guid=this.guid++}if(K!==g){var G=H;H=this.proxy(G);H.data=K}var E=o.data(I,"events")||o.data(I,"events",{}),J=o.data(I,"handle")||o.data(I,"handle",function(){return typeof o!=="undefined"&&!o.event.triggered?o.event.handle.apply(arguments.callee.elem,arguments):g});J.elem=I;o.each(F.split(/\s+/),function(M,N){var O=N.split(".");N=O.shift();H.type=O.slice().sort().join(".");var L=E[N];if(o.event.specialAll[N]){o.event.specialAll[N].setup.call(I,K,O)}if(!L){L=E[N]={};if(!o.event.special[N]||o.event.special[N].setup.call(I,K,O)===false){if(I.addEventListener){I.addEventListener(N,J,false)}else{if(I.attachEvent){I.attachEvent("on"+N,J)}}}}L[H.guid]=H;o.event.global[N]=true});I=null},guid:1,global:{},remove:function(K,H,J){if(K.nodeType==3||K.nodeType==8){return}var G=o.data(K,"events"),F,E;if(G){if(H===g||(typeof H==="string"&&H.charAt(0)==".")){for(var I in G){this.remove(K,I+(H||""))}}else{if(H.type){J=H.handler;H=H.type}o.each(H.split(/\s+/),function(M,O){var Q=O.split(".");O=Q.shift();var N=RegExp("(^|\\.)"+Q.slice().sort().join(".*\\.")+"(\\.|$)");if(G[O]){if(J){delete G[O][J.guid]}else{for(var P in G[O]){if(N.test(G[O][P].type)){delete G[O][P]}}}if(o.event.specialAll[O]){o.event.specialAll[O].teardown.call(K,Q)}for(F in G[O]){break}if(!F){if(!o.event.special[O]||o.event.special[O].teardown.call(K,Q)===false){if(K.removeEventListener){K.removeEventListener(O,o.data(K,"handle"),false)}else{if(K.detachEvent){K.detachEvent("on"+O,o.data(K,"handle"))}}}F=null;delete G[O]}}})}for(F in G){break}if(!F){var L=o.data(K,"handle");if(L){L.elem=null}o.removeData(K,"events");o.removeData(K,"handle")}}},trigger:function(I,K,H,E){var G=I.type||I;if(!E){I=typeof I==="object"?I[h]?I:o.extend(o.Event(G),I):o.Event(G);if(G.indexOf("!")>=0){I.type=G=G.slice(0,-1);I.exclusive=true}if(!H){I.stopPropagation();if(this.global[G]){o.each(o.cache,function(){if(this.events&&this.events[G]){o.event.trigger(I,K,this.handle.elem)}})}}if(!H||H.nodeType==3||H.nodeType==8){return g}I.result=g;I.target=H;K=o.makeArray(K);K.unshift(I)}I.currentTarget=H;var J=o.data(H,"handle");if(J){J.apply(H,K)}if((!H[G]||(o.nodeName(H,"a")&&G=="click"))&&H["on"+G]&&H["on"+G].apply(H,K)===false){I.result=false}if(!E&&H[G]&&!I.isDefaultPrevented()&&!(o.nodeName(H,"a")&&G=="click")){this.triggered=true;try{H[G]()}catch(L){}}this.triggered=false;if(!I.isPropagationStopped()){var F=H.parentNode||H.ownerDocument;if(F){o.event.trigger(I,K,F,true)}}},handle:function(K){var J,E;K=arguments[0]=o.event.fix(K||l.event);K.currentTarget=this;var L=K.type.split(".");K.type=L.shift();J=!L.length&&!K.exclusive;var I=RegExp("(^|\\.)"+L.slice().sort().join(".*\\.")+"(\\.|$)");E=(o.data(this,"events")||{})[K.type];for(var G in E){var H=E[G];if(J||I.test(H.type)){K.handler=H;K.data=H.data;var F=H.apply(this,arguments);if(F!==g){K.result=F;if(F===false){K.preventDefault();K.stopPropagation()}}if(K.isImmediatePropagationStopped()){break}}}},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode metaKey newValue originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),fix:function(H){if(H[h]){return H}var F=H;H=o.Event(F);for(var G=this.props.length,J;G;){J=this.props[--G];H[J]=F[J]}if(!H.target){H.target=H.srcElement||document}if(H.target.nodeType==3){H.target=H.target.parentNode}if(!H.relatedTarget&&H.fromElement){H.relatedTarget=H.fromElement==H.target?H.toElement:H.fromElement}if(H.pageX==null&&H.clientX!=null){var I=document.documentElement,E=document.body;H.pageX=H.clientX+(I&&I.scrollLeft||E&&E.scrollLeft||0)-(I.clientLeft||0);H.pageY=H.clientY+(I&&I.scrollTop||E&&E.scrollTop||0)-(I.clientTop||0)}if(!H.which&&((H.charCode||H.charCode===0)?H.charCode:H.keyCode)){H.which=H.charCode||H.keyCode}if(!H.metaKey&&H.ctrlKey){H.metaKey=H.ctrlKey}if(!H.which&&H.button){H.which=(H.button&1?1:(H.button&2?3:(H.button&4?2:0)))}return H},proxy:function(F,E){E=E||function(){return F.apply(this,arguments)};E.guid=F.guid=F.guid||E.guid||this.guid++;return E},special:{ready:{setup:B,teardown:function(){}}},specialAll:{live:{setup:function(E,F){o.event.add(this,F[0],c)},teardown:function(G){if(G.length){var E=0,F=RegExp("(^|\\.)"+G[0]+"(\\.|$)");o.each((o.data(this,"events").live||{}),function(){if(F.test(this.type)){E++}});if(E<1){o.event.remove(this,G[0],c)}}}}}};o.Event=function(E){if(!this.preventDefault){return new o.Event(E)}if(E&&E.type){this.originalEvent=E;this.type=E.type}else{this.type=E}this.timeStamp=e();this[h]=true};function k(){return false}function u(){return true}o.Event.prototype={preventDefault:function(){this.isDefaultPrevented=u;var E=this.originalEvent;if(!E){return}if(E.preventDefault){E.preventDefault()}E.returnValue=false},stopPropagation:function(){this.isPropagationStopped=u;var E=this.originalEvent;if(!E){return}if(E.stopPropagation){E.stopPropagation()}E.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=u;this.stopPropagation()},isDefaultPrevented:k,isPropagationStopped:k,isImmediatePropagationStopped:k};var a=function(F){var E=F.relatedTarget;while(E&&E!=this){try{E=E.parentNode}catch(G){E=this}}if(E!=this){F.type=F.data;o.event.handle.apply(this,arguments)}};o.each({mouseover:"mouseenter",mouseout:"mouseleave"},function(F,E){o.event.special[E]={setup:function(){o.event.add(this,F,a,E)},teardown:function(){o.event.remove(this,F,a)}}});o.fn.extend({bind:function(F,G,E){return F=="unload"?this.one(F,G,E):this.each(function(){o.event.add(this,F,E||G,E&&G)})},one:function(G,H,F){var E=o.event.proxy(F||H,function(I){o(this).unbind(I,E);return(F||H).apply(this,arguments)});return this.each(function(){o.event.add(this,G,E,F&&H)})},unbind:function(F,E){return this.each(function(){o.event.remove(this,F,E)})},trigger:function(E,F){return this.each(function(){o.event.trigger(E,F,this)})},triggerHandler:function(E,G){if(this[0]){var F=o.Event(E);F.preventDefault();F.stopPropagation();o.event.trigger(F,G,this[0]);return F.result}},toggle:function(G){var E=arguments,F=1;while(F<E.length){o.event.proxy(G,E[F++])}return this.click(o.event.proxy(G,function(H){this.lastToggle=(this.lastToggle||0)%F;H.preventDefault();return E[this.lastToggle++].apply(this,arguments)||false}))},hover:function(E,F){return this.mouseenter(E).mouseleave(F)},ready:function(E){B();if(o.isReady){E.call(document,o)}else{o.readyList.push(E)}return this},live:function(G,F){var E=o.event.proxy(F);E.guid+=this.selector+G;o(document).bind(i(G,this.selector),this.selector,E);return this},die:function(F,E){o(document).unbind(i(F,this.selector),E?{guid:E.guid+this.selector+F}:null);return this}});function c(H){var E=RegExp("(^|\\.)"+H.type+"(\\.|$)"),G=true,F=[];o.each(o.data(this,"events").live||[],function(I,J){if(E.test(J.type)){var K=o(H.target).closest(J.data)[0];if(K){F.push({elem:K,fn:J})}}});F.sort(function(J,I){return o.data(J.elem,"closest")-o.data(I.elem,"closest")});o.each(F,function(){if(this.fn.call(this.elem,H,this.fn.data)===false){return(G=false)}});return G}function i(F,E){return["live",F,E.replace(/\./g,"`").replace(/ /g,"|")].join(".")}o.extend({isReady:false,readyList:[],ready:function(){if(!o.isReady){o.isReady=true;if(o.readyList){o.each(o.readyList,function(){this.call(document,o)});o.readyList=null}o(document).triggerHandler("ready")}}});var x=false;function B(){if(x){return}x=true;if(document.addEventListener){document.addEventListener("DOMContentLoaded",function(){document.removeEventListener("DOMContentLoaded",arguments.callee,false);o.ready()},false)}else{if(document.attachEvent){document.attachEvent("onreadystatechange",function(){if(document.readyState==="complete"){document.detachEvent("onreadystatechange",arguments.callee);o.ready()}});if(document.documentElement.doScroll&&l==l.top){(function(){if(o.isReady){return}try{document.documentElement.doScroll("left")}catch(E){setTimeout(arguments.callee,0);return}o.ready()})()}}}o.event.add(l,"load",o.ready)}o.each(("blur,focus,load,resize,scroll,unload,click,dblclick,mousedown,mouseup,mousemove,mouseover,mouseout,mouseenter,mouseleave,change,select,submit,keydown,keypress,keyup,error").split(","),function(F,E){o.fn[E]=function(G){return G?this.bind(E,G):this.trigger(E)}});o(l).bind("unload",function(){for(var E in o.cache){if(E!=1&&o.cache[E].handle){o.event.remove(o.cache[E].handle.elem)}}});(function(){o.support={};var F=document.documentElement,G=document.createElement("script"),K=document.createElement("div"),J="script"+(new Date).getTime();K.style.display="none";K.innerHTML=' <link/><table></table><a href="/a" style="color:red;float:left;opacity:.5;">a</a><select><option>text</option></select><object><param/></object>';var H=K.getElementsByTagName("*"),E=K.getElementsByTagName("a")[0];if(!H||!H.length||!E){return}o.support={leadingWhitespace:K.firstChild.nodeType==3,tbody:!K.getElementsByTagName("tbody").length,objectAll:!!K.getElementsByTagName("object")[0].getElementsByTagName("*").length,htmlSerialize:!!K.getElementsByTagName("link").length,style:/red/.test(E.getAttribute("style")),hrefNormalized:E.getAttribute("href")==="/a",opacity:E.style.opacity==="0.5",cssFloat:!!E.style.cssFloat,scriptEval:false,noCloneEvent:true,boxModel:null};G.type="text/javascript";try{G.appendChild(document.createTextNode("window."+J+"=1;"))}catch(I){}F.insertBefore(G,F.firstChild);if(l[J]){o.support.scriptEval=true;delete l[J]}F.removeChild(G);if(K.attachEvent&&K.fireEvent){K.attachEvent("onclick",function(){o.support.noCloneEvent=false;K.detachEvent("onclick",arguments.callee)});K.cloneNode(true).fireEvent("onclick")}o(function(){var L=document.createElement("div");L.style.width=L.style.paddingLeft="1px";document.body.appendChild(L);o.boxModel=o.support.boxModel=L.offsetWidth===2;document.body.removeChild(L).style.display="none"})})();var w=o.support.cssFloat?"cssFloat":"styleFloat";o.props={"for":"htmlFor","class":"className","float":w,cssFloat:w,styleFloat:w,readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan",tabindex:"tabIndex"};o.fn.extend({_load:o.fn.load,load:function(G,J,K){if(typeof G!=="string"){return this._load(G)}var I=G.indexOf(" ");if(I>=0){var E=G.slice(I,G.length);G=G.slice(0,I)}var H="GET";if(J){if(o.isFunction(J)){K=J;J=null}else{if(typeof J==="object"){J=o.param(J);H="POST"}}}var F=this;o.ajax({url:G,type:H,dataType:"html",data:J,complete:function(M,L){if(L=="success"||L=="notmodified"){F.html(E?o("<div/>").append(M.responseText.replace(/<script(.|\s)*?\/script>/g,"")).find(E):M.responseText)}if(K){F.each(K,[M.responseText,L,M])}}});return this},serialize:function(){return o.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?o.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||/select|textarea/i.test(this.nodeName)||/text|hidden|password|search/i.test(this.type))}).map(function(E,F){var G=o(this).val();return G==null?null:o.isArray(G)?o.map(G,function(I,H){return{name:F.name,value:I}}):{name:F.name,value:G}}).get()}});o.each("ajaxStart,ajaxStop,ajaxComplete,ajaxError,ajaxSuccess,ajaxSend".split(","),function(E,F){o.fn[F]=function(G){return this.bind(F,G)}});var r=e();o.extend({get:function(E,G,H,F){if(o.isFunction(G)){H=G;G=null}return o.ajax({type:"GET",url:E,data:G,success:H,dataType:F})},getScript:function(E,F){return o.get(E,null,F,"script")},getJSON:function(E,F,G){return o.get(E,F,G,"json")},post:function(E,G,H,F){if(o.isFunction(G)){H=G;G={}}return o.ajax({type:"POST",url:E,data:G,success:H,dataType:F})},ajaxSetup:function(E){o.extend(o.ajaxSettings,E)},ajaxSettings:{url:location.href,global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:function(){return l.ActiveXObject?new ActiveXObject("Microsoft.XMLHTTP"):new XMLHttpRequest()},accepts:{xml:"application/xml, text/xml",html:"text/html",script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},lastModified:{},ajax:function(M){M=o.extend(true,M,o.extend(true,{},o.ajaxSettings,M));var W,F=/=\?(&|$)/g,R,V,G=M.type.toUpperCase();if(M.data&&M.processData&&typeof M.data!=="string"){M.data=o.param(M.data)}if(M.dataType=="jsonp"){if(G=="GET"){if(!M.url.match(F)){M.url+=(M.url.match(/\?/)?"&":"?")+(M.jsonp||"callback")+"=?"}}else{if(!M.data||!M.data.match(F)){M.data=(M.data?M.data+"&":"")+(M.jsonp||"callback")+"=?"}}M.dataType="json"}if(M.dataType=="json"&&(M.data&&M.data.match(F)||M.url.match(F))){W="jsonp"+r++;if(M.data){M.data=(M.data+"").replace(F,"="+W+"$1")}M.url=M.url.replace(F,"="+W+"$1");M.dataType="script";l[W]=function(X){V=X;I();L();l[W]=g;try{delete l[W]}catch(Y){}if(H){H.removeChild(T)}}}if(M.dataType=="script"&&M.cache==null){M.cache=false}if(M.cache===false&&G=="GET"){var E=e();var U=M.url.replace(/(\?|&)_=.*?(&|$)/,"$1_="+E+"$2");M.url=U+((U==M.url)?(M.url.match(/\?/)?"&":"?")+"_="+E:"")}if(M.data&&G=="GET"){M.url+=(M.url.match(/\?/)?"&":"?")+M.data;M.data=null}if(M.global&&!o.active++){o.event.trigger("ajaxStart")}var Q=/^(\w+:)?\/\/([^\/?#]+)/.exec(M.url);if(M.dataType=="script"&&G=="GET"&&Q&&(Q[1]&&Q[1]!=location.protocol||Q[2]!=location.host)){var H=document.getElementsByTagName("head")[0];var T=document.createElement("script");T.src=M.url;if(M.scriptCharset){T.charset=M.scriptCharset}if(!W){var O=false;T.onload=T.onreadystatechange=function(){if(!O&&(!this.readyState||this.readyState=="loaded"||this.readyState=="complete")){O=true;I();L();T.onload=T.onreadystatechange=null;H.removeChild(T)}}}H.appendChild(T);return g}var K=false;var J=M.xhr();if(M.username){J.open(G,M.url,M.async,M.username,M.password)}else{J.open(G,M.url,M.async)}try{if(M.data){J.setRequestHeader("Content-Type",M.contentType)}if(M.ifModified){J.setRequestHeader("If-Modified-Since",o.lastModified[M.url]||"Thu, 01 Jan 1970 00:00:00 GMT")}J.setRequestHeader("X-Requested-With","XMLHttpRequest");J.setRequestHeader("Accept",M.dataType&&M.accepts[M.dataType]?M.accepts[M.dataType]+", */*":M.accepts._default)}catch(S){}if(M.beforeSend&&M.beforeSend(J,M)===false){if(M.global&&!--o.active){o.event.trigger("ajaxStop")}J.abort();return false}if(M.global){o.event.trigger("ajaxSend",[J,M])}var N=function(X){if(J.readyState==0){if(P){clearInterval(P);P=null;if(M.global&&!--o.active){o.event.trigger("ajaxStop")}}}else{if(!K&&J&&(J.readyState==4||X=="timeout")){K=true;if(P){clearInterval(P);P=null}R=X=="timeout"?"timeout":!o.httpSuccess(J)?"error":M.ifModified&&o.httpNotModified(J,M.url)?"notmodified":"success";if(R=="success"){try{V=o.httpData(J,M.dataType,M)}catch(Z){R="parsererror"}}if(R=="success"){var Y;try{Y=J.getResponseHeader("Last-Modified")}catch(Z){}if(M.ifModified&&Y){o.lastModified[M.url]=Y}if(!W){I()}}else{o.handleError(M,J,R)}L();if(X){J.abort()}if(M.async){J=null}}}};if(M.async){var P=setInterval(N,13);if(M.timeout>0){setTimeout(function(){if(J&&!K){N("timeout")}},M.timeout)}}try{J.send(M.data)}catch(S){o.handleError(M,J,null,S)}if(!M.async){N()}function I(){if(M.success){M.success(V,R)}if(M.global){o.event.trigger("ajaxSuccess",[J,M])}}function L(){if(M.complete){M.complete(J,R)}if(M.global){o.event.trigger("ajaxComplete",[J,M])}if(M.global&&!--o.active){o.event.trigger("ajaxStop")}}return J},handleError:function(F,H,E,G){if(F.error){F.error(H,E,G)}if(F.global){o.event.trigger("ajaxError",[H,F,G])}},active:0,httpSuccess:function(F){try{return !F.status&&location.protocol=="file:"||(F.status>=200&&F.status<300)||F.status==304||F.status==1223}catch(E){}return false},httpNotModified:function(G,E){try{var H=G.getResponseHeader("Last-Modified");return G.status==304||H==o.lastModified[E]}catch(F){}return false},httpData:function(J,H,G){var F=J.getResponseHeader("content-type"),E=H=="xml"||!H&&F&&F.indexOf("xml")>=0,I=E?J.responseXML:J.responseText;if(E&&I.documentElement.tagName=="parsererror"){throw"parsererror"}if(G&&G.dataFilter){I=G.dataFilter(I,H)}if(typeof I==="string"){if(H=="script"){o.globalEval(I)}if(H=="json"){I=l["eval"]("("+I+")")}}return I},param:function(E){var G=[];function H(I,J){G[G.length]=encodeURIComponent(I)+"="+encodeURIComponent(J)}if(o.isArray(E)||E.jquery){o.each(E,function(){H(this.name,this.value)})}else{for(var F in E){if(o.isArray(E[F])){o.each(E[F],function(){H(F,this)})}else{H(F,o.isFunction(E[F])?E[F]():E[F])}}}return G.join("&").replace(/%20/g,"+")}});var m={},n,d=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];function t(F,E){var G={};o.each(d.concat.apply([],d.slice(0,E)),function(){G[this]=F});return G}o.fn.extend({show:function(J,L){if(J){return this.animate(t("show",3),J,L)}else{for(var H=0,F=this.length;H<F;H++){var E=o.data(this[H],"olddisplay");this[H].style.display=E||"";if(o.css(this[H],"display")==="none"){var G=this[H].tagName,K;if(m[G]){K=m[G]}else{var I=o("<"+G+" />").appendTo("body");K=I.css("display");if(K==="none"){K="block"}I.remove();m[G]=K}o.data(this[H],"olddisplay",K)}}for(var H=0,F=this.length;H<F;H++){this[H].style.display=o.data(this[H],"olddisplay")||""}return this}},hide:function(H,I){if(H){return this.animate(t("hide",3),H,I)}else{for(var G=0,F=this.length;G<F;G++){var E=o.data(this[G],"olddisplay");if(!E&&E!=="none"){o.data(this[G],"olddisplay",o.css(this[G],"display"))}}for(var G=0,F=this.length;G<F;G++){this[G].style.display="none"}return this}},_toggle:o.fn.toggle,toggle:function(G,F){var E=typeof G==="boolean";return o.isFunction(G)&&o.isFunction(F)?this._toggle.apply(this,arguments):G==null||E?this.each(function(){var H=E?G:o(this).is(":hidden");o(this)[H?"show":"hide"]()}):this.animate(t("toggle",3),G,F)},fadeTo:function(E,G,F){return this.animate({opacity:G},E,F)},animate:function(I,F,H,G){var E=o.speed(F,H,G);return this[E.queue===false?"each":"queue"](function(){var K=o.extend({},E),M,L=this.nodeType==1&&o(this).is(":hidden"),J=this;for(M in I){if(I[M]=="hide"&&L||I[M]=="show"&&!L){return K.complete.call(this)}if((M=="height"||M=="width")&&this.style){K.display=o.css(this,"display");K.overflow=this.style.overflow}}if(K.overflow!=null){this.style.overflow="hidden"}K.curAnim=o.extend({},I);o.each(I,function(O,S){var R=new o.fx(J,K,O);if(/toggle|show|hide/.test(S)){R[S=="toggle"?L?"show":"hide":S](I)}else{var Q=S.toString().match(/^([+-]=)?([\d+-.]+)(.*)$/),T=R.cur(true)||0;if(Q){var N=parseFloat(Q[2]),P=Q[3]||"px";if(P!="px"){J.style[O]=(N||1)+P;T=((N||1)/R.cur(true))*T;J.style[O]=T+P}if(Q[1]){N=((Q[1]=="-="?-1:1)*N)+T}R.custom(T,N,P)}else{R.custom(T,S,"")}}});return true})},stop:function(F,E){var G=o.timers;if(F){this.queue([])}this.each(function(){for(var H=G.length-1;H>=0;H--){if(G[H].elem==this){if(E){G[H](true)}G.splice(H,1)}}});if(!E){this.dequeue()}return this}});o.each({slideDown:t("show",1),slideUp:t("hide",1),slideToggle:t("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"}},function(E,F){o.fn[E]=function(G,H){return this.animate(F,G,H)}});o.extend({speed:function(G,H,F){var E=typeof G==="object"?G:{complete:F||!F&&H||o.isFunction(G)&&G,duration:G,easing:F&&H||H&&!o.isFunction(H)&&H};E.duration=o.fx.off?0:typeof E.duration==="number"?E.duration:o.fx.speeds[E.duration]||o.fx.speeds._default;E.old=E.complete;E.complete=function(){if(E.queue!==false){o(this).dequeue()}if(o.isFunction(E.old)){E.old.call(this)}};return E},easing:{linear:function(G,H,E,F){return E+F*G},swing:function(G,H,E,F){return((-Math.cos(G*Math.PI)/2)+0.5)*F+E}},timers:[],fx:function(F,E,G){this.options=E;this.elem=F;this.prop=G;if(!E.orig){E.orig={}}}});o.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(o.fx.step[this.prop]||o.fx.step._default)(this);if((this.prop=="height"||this.prop=="width")&&this.elem.style){this.elem.style.display="block"}},cur:function(F){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var E=parseFloat(o.css(this.elem,this.prop,F));return E&&E>-10000?E:parseFloat(o.curCSS(this.elem,this.prop))||0},custom:function(I,H,G){this.startTime=e();this.start=I;this.end=H;this.unit=G||this.unit||"px";this.now=this.start;this.pos=this.state=0;var E=this;function F(J){return E.step(J)}F.elem=this.elem;if(F()&&o.timers.push(F)&&!n){n=setInterval(function(){var K=o.timers;for(var J=0;J<K.length;J++){if(!K[J]()){K.splice(J--,1)}}if(!K.length){clearInterval(n);n=g}},13)}},show:function(){this.options.orig[this.prop]=o.attr(this.elem.style,this.prop);this.options.show=true;this.custom(this.prop=="width"||this.prop=="height"?1:0,this.cur());o(this.elem).show()},hide:function(){this.options.orig[this.prop]=o.attr(this.elem.style,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(H){var G=e();if(H||G>=this.options.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;var E=true;for(var F in this.options.curAnim){if(this.options.curAnim[F]!==true){E=false}}if(E){if(this.options.display!=null){this.elem.style.overflow=this.options.overflow;this.elem.style.display=this.options.display;if(o.css(this.elem,"display")=="none"){this.elem.style.display="block"}}if(this.options.hide){o(this.elem).hide()}if(this.options.hide||this.options.show){for(var I in this.options.curAnim){o.attr(this.elem.style,I,this.options.orig[I])}}this.options.complete.call(this.elem)}return false}else{var J=G-this.startTime;this.state=J/this.options.duration;this.pos=o.easing[this.options.easing||(o.easing.swing?"swing":"linear")](this.state,J,0,1,this.options.duration);this.now=this.start+((this.end-this.start)*this.pos);this.update()}return true}};o.extend(o.fx,{speeds:{slow:600,fast:200,_default:400},step:{opacity:function(E){o.attr(E.elem.style,"opacity",E.now)},_default:function(E){if(E.elem.style&&E.elem.style[E.prop]!=null){E.elem.style[E.prop]=E.now+E.unit}else{E.elem[E.prop]=E.now}}}});if(document.documentElement.getBoundingClientRect){o.fn.offset=function(){if(!this[0]){return{top:0,left:0}}if(this[0]===this[0].ownerDocument.body){return o.offset.bodyOffset(this[0])}var G=this[0].getBoundingClientRect(),J=this[0].ownerDocument,F=J.body,E=J.documentElement,L=E.clientTop||F.clientTop||0,K=E.clientLeft||F.clientLeft||0,I=G.top+(self.pageYOffset||o.boxModel&&E.scrollTop||F.scrollTop)-L,H=G.left+(self.pageXOffset||o.boxModel&&E.scrollLeft||F.scrollLeft)-K;return{top:I,left:H}}}else{o.fn.offset=function(){if(!this[0]){return{top:0,left:0}}if(this[0]===this[0].ownerDocument.body){return o.offset.bodyOffset(this[0])}o.offset.initialized||o.offset.initialize();var J=this[0],G=J.offsetParent,F=J,O=J.ownerDocument,M,H=O.documentElement,K=O.body,L=O.defaultView,E=L.getComputedStyle(J,null),N=J.offsetTop,I=J.offsetLeft;while((J=J.parentNode)&&J!==K&&J!==H){M=L.getComputedStyle(J,null);N-=J.scrollTop,I-=J.scrollLeft;if(J===G){N+=J.offsetTop,I+=J.offsetLeft;if(o.offset.doesNotAddBorder&&!(o.offset.doesAddBorderForTableAndCells&&/^t(able|d|h)$/i.test(J.tagName))){N+=parseInt(M.borderTopWidth,10)||0,I+=parseInt(M.borderLeftWidth,10)||0}F=G,G=J.offsetParent}if(o.offset.subtractsBorderForOverflowNotVisible&&M.overflow!=="visible"){N+=parseInt(M.borderTopWidth,10)||0,I+=parseInt(M.borderLeftWidth,10)||0}E=M}if(E.position==="relative"||E.position==="static"){N+=K.offsetTop,I+=K.offsetLeft}if(E.position==="fixed"){N+=Math.max(H.scrollTop,K.scrollTop),I+=Math.max(H.scrollLeft,K.scrollLeft)}return{top:N,left:I}}}o.offset={initialize:function(){if(this.initialized){return}var L=document.body,F=document.createElement("div"),H,G,N,I,M,E,J=L.style.marginTop,K='<div style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;"><div></div></div><table style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;" cellpadding="0" cellspacing="0"><tr><td></td></tr></table>';M={position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"};for(E in M){F.style[E]=M[E]}F.innerHTML=K;L.insertBefore(F,L.firstChild);H=F.firstChild,G=H.firstChild,I=H.nextSibling.firstChild.firstChild;this.doesNotAddBorder=(G.offsetTop!==5);this.doesAddBorderForTableAndCells=(I.offsetTop===5);H.style.overflow="hidden",H.style.position="relative";this.subtractsBorderForOverflowNotVisible=(G.offsetTop===-5);L.style.marginTop="1px";this.doesNotIncludeMarginInBodyOffset=(L.offsetTop===0);L.style.marginTop=J;L.removeChild(F);this.initialized=true},bodyOffset:function(E){o.offset.initialized||o.offset.initialize();var G=E.offsetTop,F=E.offsetLeft;if(o.offset.doesNotIncludeMarginInBodyOffset){G+=parseInt(o.curCSS(E,"marginTop",true),10)||0,F+=parseInt(o.curCSS(E,"marginLeft",true),10)||0}return{top:G,left:F}}};o.fn.extend({position:function(){var I=0,H=0,F;if(this[0]){var G=this.offsetParent(),J=this.offset(),E=/^body|html$/i.test(G[0].tagName)?{top:0,left:0}:G.offset();J.top-=j(this,"marginTop");J.left-=j(this,"marginLeft");E.top+=j(G,"borderTopWidth");E.left+=j(G,"borderLeftWidth");F={top:J.top-E.top,left:J.left-E.left}}return F},offsetParent:function(){var E=this[0].offsetParent||document.body;while(E&&(!/^body|html$/i.test(E.tagName)&&o.css(E,"position")=="static")){E=E.offsetParent}return o(E)}});o.each(["Left","Top"],function(F,E){var G="scroll"+E;o.fn[G]=function(H){if(!this[0]){return null}return H!==g?this.each(function(){this==l||this==document?l.scrollTo(!F?H:o(l).scrollLeft(),F?H:o(l).scrollTop()):this[G]=H}):this[0]==l||this[0]==document?self[F?"pageYOffset":"pageXOffset"]||o.boxModel&&document.documentElement[G]||document.body[G]:this[0][G]}});o.each(["Height","Width"],function(I,G){var E=I?"Left":"Top",H=I?"Right":"Bottom",F=G.toLowerCase();o.fn["inner"+G]=function(){return this[0]?o.css(this[0],F,false,"padding"):null};o.fn["outer"+G]=function(K){return this[0]?o.css(this[0],F,false,K?"margin":"border"):null};var J=G.toLowerCase();o.fn[J]=function(K){return this[0]==l?document.compatMode=="CSS1Compat"&&document.documentElement["client"+G]||document.body["client"+G]:this[0]==document?Math.max(document.documentElement["client"+G],document.body["scroll"+G],document.documentElement["scroll"+G],document.body["offset"+G],document.documentElement["offset"+G]):K===g?(this.length?o.css(this[0],J):null):this.css(J,typeof K==="string"?K:K+"px")}})})();
\ No newline at end of file
+(function(A,w){function ma(){if(!c.isReady){try{s.documentElement.doScroll("left")}catch(a){setTimeout(ma,1);return}c.ready()}}function Qa(a,b){b.src?c.ajax({url:b.src,async:false,dataType:"script"}):c.globalEval(b.text||b.textContent||b.innerHTML||"");b.parentNode&&b.parentNode.removeChild(b)}function X(a,b,d,f,e,j){var i=a.length;if(typeof b==="object"){for(var o in b)X(a,o,b[o],f,e,d);return a}if(d!==w){f=!j&&f&&c.isFunction(d);for(o=0;o<i;o++)e(a[o],b,f?d.call(a[o],o,e(a[o],b)):d,j);return a}return i?
+e(a[0],b):w}function J(){return(new Date).getTime()}function Y(){return false}function Z(){return true}function na(a,b,d){d[0].type=a;return c.event.handle.apply(b,d)}function oa(a){var b,d=[],f=[],e=arguments,j,i,o,k,n,r;i=c.data(this,"events");if(!(a.liveFired===this||!i||!i.live||a.button&&a.type==="click")){a.liveFired=this;var u=i.live.slice(0);for(k=0;k<u.length;k++){i=u[k];i.origType.replace(O,"")===a.type?f.push(i.selector):u.splice(k--,1)}j=c(a.target).closest(f,a.currentTarget);n=0;for(r=
+j.length;n<r;n++)for(k=0;k<u.length;k++){i=u[k];if(j[n].selector===i.selector){o=j[n].elem;f=null;if(i.preType==="mouseenter"||i.preType==="mouseleave")f=c(a.relatedTarget).closest(i.selector)[0];if(!f||f!==o)d.push({elem:o,handleObj:i})}}n=0;for(r=d.length;n<r;n++){j=d[n];a.currentTarget=j.elem;a.data=j.handleObj.data;a.handleObj=j.handleObj;if(j.handleObj.origHandler.apply(j.elem,e)===false){b=false;break}}return b}}function pa(a,b){return"live."+(a&&a!=="*"?a+".":"")+b.replace(/\./g,"`").replace(/ /g,
+"&")}function qa(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function ra(a,b){var d=0;b.each(function(){if(this.nodeName===(a[d]&&a[d].nodeName)){var f=c.data(a[d++]),e=c.data(this,f);if(f=f&&f.events){delete e.handle;e.events={};for(var j in f)for(var i in f[j])c.event.add(this,j,f[j][i],f[j][i].data)}}})}function sa(a,b,d){var f,e,j;b=b&&b[0]?b[0].ownerDocument||b[0]:s;if(a.length===1&&typeof a[0]==="string"&&a[0].length<512&&b===s&&!ta.test(a[0])&&(c.support.checkClone||!ua.test(a[0]))){e=
+true;if(j=c.fragments[a[0]])if(j!==1)f=j}if(!f){f=b.createDocumentFragment();c.clean(a,b,f,d)}if(e)c.fragments[a[0]]=j?f:1;return{fragment:f,cacheable:e}}function K(a,b){var d={};c.each(va.concat.apply([],va.slice(0,b)),function(){d[this]=a});return d}function wa(a){return"scrollTo"in a&&a.document?a:a.nodeType===9?a.defaultView||a.parentWindow:false}var c=function(a,b){return new c.fn.init(a,b)},Ra=A.jQuery,Sa=A.$,s=A.document,T,Ta=/^[^<]*(<[\w\W]+>)[^>]*$|^#([\w-]+)$/,Ua=/^.[^:#\[\.,]*$/,Va=/\S/,
+Wa=/^(\s|\u00A0)+|(\s|\u00A0)+$/g,Xa=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,P=navigator.userAgent,xa=false,Q=[],L,$=Object.prototype.toString,aa=Object.prototype.hasOwnProperty,ba=Array.prototype.push,R=Array.prototype.slice,ya=Array.prototype.indexOf;c.fn=c.prototype={init:function(a,b){var d,f;if(!a)return this;if(a.nodeType){this.context=this[0]=a;this.length=1;return this}if(a==="body"&&!b){this.context=s;this[0]=s.body;this.selector="body";this.length=1;return this}if(typeof a==="string")if((d=Ta.exec(a))&&
+(d[1]||!b))if(d[1]){f=b?b.ownerDocument||b:s;if(a=Xa.exec(a))if(c.isPlainObject(b)){a=[s.createElement(a[1])];c.fn.attr.call(a,b,true)}else a=[f.createElement(a[1])];else{a=sa([d[1]],[f]);a=(a.cacheable?a.fragment.cloneNode(true):a.fragment).childNodes}return c.merge(this,a)}else{if(b=s.getElementById(d[2])){if(b.id!==d[2])return T.find(a);this.length=1;this[0]=b}this.context=s;this.selector=a;return this}else if(!b&&/^\w+$/.test(a)){this.selector=a;this.context=s;a=s.getElementsByTagName(a);return c.merge(this,
+a)}else return!b||b.jquery?(b||T).find(a):c(b).find(a);else if(c.isFunction(a))return T.ready(a);if(a.selector!==w){this.selector=a.selector;this.context=a.context}return c.makeArray(a,this)},selector:"",jquery:"1.4.2",length:0,size:function(){return this.length},toArray:function(){return R.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this.slice(a)[0]:this[a]},pushStack:function(a,b,d){var f=c();c.isArray(a)?ba.apply(f,a):c.merge(f,a);f.prevObject=this;f.context=this.context;if(b===
+"find")f.selector=this.selector+(this.selector?" ":"")+d;else if(b)f.selector=this.selector+"."+b+"("+d+")";return f},each:function(a,b){return c.each(this,a,b)},ready:function(a){c.bindReady();if(c.isReady)a.call(s,c);else Q&&Q.push(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(R.apply(this,arguments),"slice",R.call(arguments).join(","))},map:function(a){return this.pushStack(c.map(this,
+function(b,d){return a.call(b,d,b)}))},end:function(){return this.prevObject||c(null)},push:ba,sort:[].sort,splice:[].splice};c.fn.init.prototype=c.fn;c.extend=c.fn.extend=function(){var a=arguments[0]||{},b=1,d=arguments.length,f=false,e,j,i,o;if(typeof a==="boolean"){f=a;a=arguments[1]||{};b=2}if(typeof a!=="object"&&!c.isFunction(a))a={};if(d===b){a=this;--b}for(;b<d;b++)if((e=arguments[b])!=null)for(j in e){i=a[j];o=e[j];if(a!==o)if(f&&o&&(c.isPlainObject(o)||c.isArray(o))){i=i&&(c.isPlainObject(i)||
+c.isArray(i))?i:c.isArray(o)?[]:{};a[j]=c.extend(f,i,o)}else if(o!==w)a[j]=o}return a};c.extend({noConflict:function(a){A.$=Sa;if(a)A.jQuery=Ra;return c},isReady:false,ready:function(){if(!c.isReady){if(!s.body)return setTimeout(c.ready,13);c.isReady=true;if(Q){for(var a,b=0;a=Q[b++];)a.call(s,c);Q=null}c.fn.triggerHandler&&c(s).triggerHandler("ready")}},bindReady:function(){if(!xa){xa=true;if(s.readyState==="complete")return c.ready();if(s.addEventListener){s.addEventListener("DOMContentLoaded",
+L,false);A.addEventListener("load",c.ready,false)}else if(s.attachEvent){s.attachEvent("onreadystatechange",L);A.attachEvent("onload",c.ready);var a=false;try{a=A.frameElement==null}catch(b){}s.documentElement.doScroll&&a&&ma()}}},isFunction:function(a){return $.call(a)==="[object Function]"},isArray:function(a){return $.call(a)==="[object Array]"},isPlainObject:function(a){if(!a||$.call(a)!=="[object Object]"||a.nodeType||a.setInterval)return false;if(a.constructor&&!aa.call(a,"constructor")&&!aa.call(a.constructor.prototype,
+"isPrototypeOf"))return false;var b;for(b in a);return b===w||aa.call(a,b)},isEmptyObject:function(a){for(var b in a)return false;return true},error:function(a){throw a;},parseJSON:function(a){if(typeof a!=="string"||!a)return null;a=c.trim(a);if(/^[\],:{}\s]*$/.test(a.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,"@").replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,"]").replace(/(?:^|:|,)(?:\s*\[)+/g,"")))return A.JSON&&A.JSON.parse?A.JSON.parse(a):(new Function("return "+
+a))();else c.error("Invalid JSON: "+a)},noop:function(){},globalEval:function(a){if(a&&Va.test(a)){var b=s.getElementsByTagName("head")[0]||s.documentElement,d=s.createElement("script");d.type="text/javascript";if(c.support.scriptEval)d.appendChild(s.createTextNode(a));else d.text=a;b.insertBefore(d,b.firstChild);b.removeChild(d)}},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,b,d){var f,e=0,j=a.length,i=j===w||c.isFunction(a);if(d)if(i)for(f in a){if(b.apply(a[f],
+d)===false)break}else for(;e<j;){if(b.apply(a[e++],d)===false)break}else if(i)for(f in a){if(b.call(a[f],f,a[f])===false)break}else for(d=a[0];e<j&&b.call(d,e,d)!==false;d=a[++e]);return a},trim:function(a){return(a||"").replace(Wa,"")},makeArray:function(a,b){b=b||[];if(a!=null)a.length==null||typeof a==="string"||c.isFunction(a)||typeof a!=="function"&&a.setInterval?ba.call(b,a):c.merge(b,a);return b},inArray:function(a,b){if(b.indexOf)return b.indexOf(a);for(var d=0,f=b.length;d<f;d++)if(b[d]===
+a)return d;return-1},merge:function(a,b){var d=a.length,f=0;if(typeof b.length==="number")for(var e=b.length;f<e;f++)a[d++]=b[f];else for(;b[f]!==w;)a[d++]=b[f++];a.length=d;return a},grep:function(a,b,d){for(var f=[],e=0,j=a.length;e<j;e++)!d!==!b(a[e],e)&&f.push(a[e]);return f},map:function(a,b,d){for(var f=[],e,j=0,i=a.length;j<i;j++){e=b(a[j],j,d);if(e!=null)f[f.length]=e}return f.concat.apply([],f)},guid:1,proxy:function(a,b,d){if(arguments.length===2)if(typeof b==="string"){d=a;a=d[b];b=w}else if(b&&
+!c.isFunction(b)){d=b;b=w}if(!b&&a)b=function(){return a.apply(d||this,arguments)};if(a)b.guid=a.guid=a.guid||b.guid||c.guid++;return b},uaMatch:function(a){a=a.toLowerCase();a=/(webkit)[ \/]([\w.]+)/.exec(a)||/(opera)(?:.*version)?[ \/]([\w.]+)/.exec(a)||/(msie) ([\w.]+)/.exec(a)||!/compatible/.test(a)&&/(mozilla)(?:.*? rv:([\w.]+))?/.exec(a)||[];return{browser:a[1]||"",version:a[2]||"0"}},browser:{}});P=c.uaMatch(P);if(P.browser){c.browser[P.browser]=true;c.browser.version=P.version}if(c.browser.webkit)c.browser.safari=
+true;if(ya)c.inArray=function(a,b){return ya.call(b,a)};T=c(s);if(s.addEventListener)L=function(){s.removeEventListener("DOMContentLoaded",L,false);c.ready()};else if(s.attachEvent)L=function(){if(s.readyState==="complete"){s.detachEvent("onreadystatechange",L);c.ready()}};(function(){c.support={};var a=s.documentElement,b=s.createElement("script"),d=s.createElement("div"),f="script"+J();d.style.display="none";d.innerHTML=" <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
+var e=d.getElementsByTagName("*"),j=d.getElementsByTagName("a")[0];if(!(!e||!e.length||!j)){c.support={leadingWhitespace:d.firstChild.nodeType===3,tbody:!d.getElementsByTagName("tbody").length,htmlSerialize:!!d.getElementsByTagName("link").length,style:/red/.test(j.getAttribute("style")),hrefNormalized:j.getAttribute("href")==="/a",opacity:/^0.55$/.test(j.style.opacity),cssFloat:!!j.style.cssFloat,checkOn:d.getElementsByTagName("input")[0].value==="on",optSelected:s.createElement("select").appendChild(s.createElement("option")).selected,
+parentNode:d.removeChild(d.appendChild(s.createElement("div"))).parentNode===null,deleteExpando:true,checkClone:false,scriptEval:false,noCloneEvent:true,boxModel:null};b.type="text/javascript";try{b.appendChild(s.createTextNode("window."+f+"=1;"))}catch(i){}a.insertBefore(b,a.firstChild);if(A[f]){c.support.scriptEval=true;delete A[f]}try{delete b.test}catch(o){c.support.deleteExpando=false}a.removeChild(b);if(d.attachEvent&&d.fireEvent){d.attachEvent("onclick",function k(){c.support.noCloneEvent=
+false;d.detachEvent("onclick",k)});d.cloneNode(true).fireEvent("onclick")}d=s.createElement("div");d.innerHTML="<input type='radio' name='radiotest' checked='checked'/>";a=s.createDocumentFragment();a.appendChild(d.firstChild);c.support.checkClone=a.cloneNode(true).cloneNode(true).lastChild.checked;c(function(){var k=s.createElement("div");k.style.width=k.style.paddingLeft="1px";s.body.appendChild(k);c.boxModel=c.support.boxModel=k.offsetWidth===2;s.body.removeChild(k).style.display="none"});a=function(k){var n=
+s.createElement("div");k="on"+k;var r=k in n;if(!r){n.setAttribute(k,"return;");r=typeof n[k]==="function"}return r};c.support.submitBubbles=a("submit");c.support.changeBubbles=a("change");a=b=d=e=j=null}})();c.props={"for":"htmlFor","class":"className",readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan",colspan:"colSpan",tabindex:"tabIndex",usemap:"useMap",frameborder:"frameBorder"};var G="jQuery"+J(),Ya=0,za={};c.extend({cache:{},expando:G,noData:{embed:true,object:true,
+applet:true},data:function(a,b,d){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==A?za:a;var f=a[G],e=c.cache;if(!f&&typeof b==="string"&&d===w)return null;f||(f=++Ya);if(typeof b==="object"){a[G]=f;e[f]=c.extend(true,{},b)}else if(!e[f]){a[G]=f;e[f]={}}a=e[f];if(d!==w)a[b]=d;return typeof b==="string"?a[b]:a}},removeData:function(a,b){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==A?za:a;var d=a[G],f=c.cache,e=f[d];if(b){if(e){delete e[b];c.isEmptyObject(e)&&c.removeData(a)}}else{if(c.support.deleteExpando)delete a[c.expando];
+else a.removeAttribute&&a.removeAttribute(c.expando);delete f[d]}}}});c.fn.extend({data:function(a,b){if(typeof a==="undefined"&&this.length)return c.data(this[0]);else if(typeof a==="object")return this.each(function(){c.data(this,a)});var d=a.split(".");d[1]=d[1]?"."+d[1]:"";if(b===w){var f=this.triggerHandler("getData"+d[1]+"!",[d[0]]);if(f===w&&this.length)f=c.data(this[0],a);return f===w&&d[1]?this.data(d[0]):f}else return this.trigger("setData"+d[1]+"!",[d[0],b]).each(function(){c.data(this,
+a,b)})},removeData:function(a){return this.each(function(){c.removeData(this,a)})}});c.extend({queue:function(a,b,d){if(a){b=(b||"fx")+"queue";var f=c.data(a,b);if(!d)return f||[];if(!f||c.isArray(d))f=c.data(a,b,c.makeArray(d));else f.push(d);return f}},dequeue:function(a,b){b=b||"fx";var d=c.queue(a,b),f=d.shift();if(f==="inprogress")f=d.shift();if(f){b==="fx"&&d.unshift("inprogress");f.call(a,function(){c.dequeue(a,b)})}}});c.fn.extend({queue:function(a,b){if(typeof a!=="string"){b=a;a="fx"}if(b===
+w)return c.queue(this[0],a);return this.each(function(){var d=c.queue(this,a,b);a==="fx"&&d[0]!=="inprogress"&&c.dequeue(this,a)})},dequeue:function(a){return this.each(function(){c.dequeue(this,a)})},delay:function(a,b){a=c.fx?c.fx.speeds[a]||a:a;b=b||"fx";return this.queue(b,function(){var d=this;setTimeout(function(){c.dequeue(d,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])}});var Aa=/[\n\t]/g,ca=/\s+/,Za=/\r/g,$a=/href|src|style/,ab=/(button|input)/i,bb=/(button|input|object|select|textarea)/i,
+cb=/^(a|area)$/i,Ba=/radio|checkbox/;c.fn.extend({attr:function(a,b){return X(this,a,b,true,c.attr)},removeAttr:function(a){return this.each(function(){c.attr(this,a,"");this.nodeType===1&&this.removeAttribute(a)})},addClass:function(a){if(c.isFunction(a))return this.each(function(n){var r=c(this);r.addClass(a.call(this,n,r.attr("class")))});if(a&&typeof a==="string")for(var b=(a||"").split(ca),d=0,f=this.length;d<f;d++){var e=this[d];if(e.nodeType===1)if(e.className){for(var j=" "+e.className+" ",
+i=e.className,o=0,k=b.length;o<k;o++)if(j.indexOf(" "+b[o]+" ")<0)i+=" "+b[o];e.className=c.trim(i)}else e.className=a}return this},removeClass:function(a){if(c.isFunction(a))return this.each(function(k){var n=c(this);n.removeClass(a.call(this,k,n.attr("class")))});if(a&&typeof a==="string"||a===w)for(var b=(a||"").split(ca),d=0,f=this.length;d<f;d++){var e=this[d];if(e.nodeType===1&&e.className)if(a){for(var j=(" "+e.className+" ").replace(Aa," "),i=0,o=b.length;i<o;i++)j=j.replace(" "+b[i]+" ",
+" ");e.className=c.trim(j)}else e.className=""}return this},toggleClass:function(a,b){var d=typeof a,f=typeof b==="boolean";if(c.isFunction(a))return this.each(function(e){var j=c(this);j.toggleClass(a.call(this,e,j.attr("class"),b),b)});return this.each(function(){if(d==="string")for(var e,j=0,i=c(this),o=b,k=a.split(ca);e=k[j++];){o=f?o:!i.hasClass(e);i[o?"addClass":"removeClass"](e)}else if(d==="undefined"||d==="boolean"){this.className&&c.data(this,"__className__",this.className);this.className=
+this.className||a===false?"":c.data(this,"__className__")||""}})},hasClass:function(a){a=" "+a+" ";for(var b=0,d=this.length;b<d;b++)if((" "+this[b].className+" ").replace(Aa," ").indexOf(a)>-1)return true;return false},val:function(a){if(a===w){var b=this[0];if(b){if(c.nodeName(b,"option"))return(b.attributes.value||{}).specified?b.value:b.text;if(c.nodeName(b,"select")){var d=b.selectedIndex,f=[],e=b.options;b=b.type==="select-one";if(d<0)return null;var j=b?d:0;for(d=b?d+1:e.length;j<d;j++){var i=
+e[j];if(i.selected){a=c(i).val();if(b)return a;f.push(a)}}return f}if(Ba.test(b.type)&&!c.support.checkOn)return b.getAttribute("value")===null?"on":b.value;return(b.value||"").replace(Za,"")}return w}var o=c.isFunction(a);return this.each(function(k){var n=c(this),r=a;if(this.nodeType===1){if(o)r=a.call(this,k,n.val());if(typeof r==="number")r+="";if(c.isArray(r)&&Ba.test(this.type))this.checked=c.inArray(n.val(),r)>=0;else if(c.nodeName(this,"select")){var u=c.makeArray(r);c("option",this).each(function(){this.selected=
+c.inArray(c(this).val(),u)>=0});if(!u.length)this.selectedIndex=-1}else this.value=r}})}});c.extend({attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(a,b,d,f){if(!a||a.nodeType===3||a.nodeType===8)return w;if(f&&b in c.attrFn)return c(a)[b](d);f=a.nodeType!==1||!c.isXMLDoc(a);var e=d!==w;b=f&&c.props[b]||b;if(a.nodeType===1){var j=$a.test(b);if(b in a&&f&&!j){if(e){b==="type"&&ab.test(a.nodeName)&&a.parentNode&&c.error("type property can't be changed");
+a[b]=d}if(c.nodeName(a,"form")&&a.getAttributeNode(b))return a.getAttributeNode(b).nodeValue;if(b==="tabIndex")return(b=a.getAttributeNode("tabIndex"))&&b.specified?b.value:bb.test(a.nodeName)||cb.test(a.nodeName)&&a.href?0:w;return a[b]}if(!c.support.style&&f&&b==="style"){if(e)a.style.cssText=""+d;return a.style.cssText}e&&a.setAttribute(b,""+d);a=!c.support.hrefNormalized&&f&&j?a.getAttribute(b,2):a.getAttribute(b);return a===null?w:a}return c.style(a,b,d)}});var O=/\.(.*)$/,db=function(a){return a.replace(/[^\w\s\.\|`]/g,
+function(b){return"\\"+b})};c.event={add:function(a,b,d,f){if(!(a.nodeType===3||a.nodeType===8)){if(a.setInterval&&a!==A&&!a.frameElement)a=A;var e,j;if(d.handler){e=d;d=e.handler}if(!d.guid)d.guid=c.guid++;if(j=c.data(a)){var i=j.events=j.events||{},o=j.handle;if(!o)j.handle=o=function(){return typeof c!=="undefined"&&!c.event.triggered?c.event.handle.apply(o.elem,arguments):w};o.elem=a;b=b.split(" ");for(var k,n=0,r;k=b[n++];){j=e?c.extend({},e):{handler:d,data:f};if(k.indexOf(".")>-1){r=k.split(".");
+k=r.shift();j.namespace=r.slice(0).sort().join(".")}else{r=[];j.namespace=""}j.type=k;j.guid=d.guid;var u=i[k],z=c.event.special[k]||{};if(!u){u=i[k]=[];if(!z.setup||z.setup.call(a,f,r,o)===false)if(a.addEventListener)a.addEventListener(k,o,false);else a.attachEvent&&a.attachEvent("on"+k,o)}if(z.add){z.add.call(a,j);if(!j.handler.guid)j.handler.guid=d.guid}u.push(j);c.event.global[k]=true}a=null}}},global:{},remove:function(a,b,d,f){if(!(a.nodeType===3||a.nodeType===8)){var e,j=0,i,o,k,n,r,u,z=c.data(a),
+C=z&&z.events;if(z&&C){if(b&&b.type){d=b.handler;b=b.type}if(!b||typeof b==="string"&&b.charAt(0)==="."){b=b||"";for(e in C)c.event.remove(a,e+b)}else{for(b=b.split(" ");e=b[j++];){n=e;i=e.indexOf(".")<0;o=[];if(!i){o=e.split(".");e=o.shift();k=new RegExp("(^|\\.)"+c.map(o.slice(0).sort(),db).join("\\.(?:.*\\.)?")+"(\\.|$)")}if(r=C[e])if(d){n=c.event.special[e]||{};for(B=f||0;B<r.length;B++){u=r[B];if(d.guid===u.guid){if(i||k.test(u.namespace)){f==null&&r.splice(B--,1);n.remove&&n.remove.call(a,u)}if(f!=
+null)break}}if(r.length===0||f!=null&&r.length===1){if(!n.teardown||n.teardown.call(a,o)===false)Ca(a,e,z.handle);delete C[e]}}else for(var B=0;B<r.length;B++){u=r[B];if(i||k.test(u.namespace)){c.event.remove(a,n,u.handler,B);r.splice(B--,1)}}}if(c.isEmptyObject(C)){if(b=z.handle)b.elem=null;delete z.events;delete z.handle;c.isEmptyObject(z)&&c.removeData(a)}}}}},trigger:function(a,b,d,f){var e=a.type||a;if(!f){a=typeof a==="object"?a[G]?a:c.extend(c.Event(e),a):c.Event(e);if(e.indexOf("!")>=0){a.type=
+e=e.slice(0,-1);a.exclusive=true}if(!d){a.stopPropagation();c.event.global[e]&&c.each(c.cache,function(){this.events&&this.events[e]&&c.event.trigger(a,b,this.handle.elem)})}if(!d||d.nodeType===3||d.nodeType===8)return w;a.result=w;a.target=d;b=c.makeArray(b);b.unshift(a)}a.currentTarget=d;(f=c.data(d,"handle"))&&f.apply(d,b);f=d.parentNode||d.ownerDocument;try{if(!(d&&d.nodeName&&c.noData[d.nodeName.toLowerCase()]))if(d["on"+e]&&d["on"+e].apply(d,b)===false)a.result=false}catch(j){}if(!a.isPropagationStopped()&&
+f)c.event.trigger(a,b,f,true);else if(!a.isDefaultPrevented()){f=a.target;var i,o=c.nodeName(f,"a")&&e==="click",k=c.event.special[e]||{};if((!k._default||k._default.call(d,a)===false)&&!o&&!(f&&f.nodeName&&c.noData[f.nodeName.toLowerCase()])){try{if(f[e]){if(i=f["on"+e])f["on"+e]=null;c.event.triggered=true;f[e]()}}catch(n){}if(i)f["on"+e]=i;c.event.triggered=false}}},handle:function(a){var b,d,f,e;a=arguments[0]=c.event.fix(a||A.event);a.currentTarget=this;b=a.type.indexOf(".")<0&&!a.exclusive;
+if(!b){d=a.type.split(".");a.type=d.shift();f=new RegExp("(^|\\.)"+d.slice(0).sort().join("\\.(?:.*\\.)?")+"(\\.|$)")}e=c.data(this,"events");d=e[a.type];if(e&&d){d=d.slice(0);e=0;for(var j=d.length;e<j;e++){var i=d[e];if(b||f.test(i.namespace)){a.handler=i.handler;a.data=i.data;a.handleObj=i;i=i.handler.apply(this,arguments);if(i!==w){a.result=i;if(i===false){a.preventDefault();a.stopPropagation()}}if(a.isImmediatePropagationStopped())break}}}return a.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
+fix:function(a){if(a[G])return a;var b=a;a=c.Event(b);for(var d=this.props.length,f;d;){f=this.props[--d];a[f]=b[f]}if(!a.target)a.target=a.srcElement||s;if(a.target.nodeType===3)a.target=a.target.parentNode;if(!a.relatedTarget&&a.fromElement)a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement;if(a.pageX==null&&a.clientX!=null){b=s.documentElement;d=s.body;a.pageX=a.clientX+(b&&b.scrollLeft||d&&d.scrollLeft||0)-(b&&b.clientLeft||d&&d.clientLeft||0);a.pageY=a.clientY+(b&&b.scrollTop||
+d&&d.scrollTop||0)-(b&&b.clientTop||d&&d.clientTop||0)}if(!a.which&&(a.charCode||a.charCode===0?a.charCode:a.keyCode))a.which=a.charCode||a.keyCode;if(!a.metaKey&&a.ctrlKey)a.metaKey=a.ctrlKey;if(!a.which&&a.button!==w)a.which=a.button&1?1:a.button&2?3:a.button&4?2:0;return a},guid:1E8,proxy:c.proxy,special:{ready:{setup:c.bindReady,teardown:c.noop},live:{add:function(a){c.event.add(this,a.origType,c.extend({},a,{handler:oa}))},remove:function(a){var b=true,d=a.origType.replace(O,"");c.each(c.data(this,
+"events").live||[],function(){if(d===this.origType.replace(O,""))return b=false});b&&c.event.remove(this,a.origType,oa)}},beforeunload:{setup:function(a,b,d){if(this.setInterval)this.onbeforeunload=d;return false},teardown:function(a,b){if(this.onbeforeunload===b)this.onbeforeunload=null}}}};var Ca=s.removeEventListener?function(a,b,d){a.removeEventListener(b,d,false)}:function(a,b,d){a.detachEvent("on"+b,d)};c.Event=function(a){if(!this.preventDefault)return new c.Event(a);if(a&&a.type){this.originalEvent=
+a;this.type=a.type}else this.type=a;this.timeStamp=J();this[G]=true};c.Event.prototype={preventDefault:function(){this.isDefaultPrevented=Z;var a=this.originalEvent;if(a){a.preventDefault&&a.preventDefault();a.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=Z;var a=this.originalEvent;if(a){a.stopPropagation&&a.stopPropagation();a.cancelBubble=true}},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=Z;this.stopPropagation()},isDefaultPrevented:Y,isPropagationStopped:Y,
+isImmediatePropagationStopped:Y};var Da=function(a){var b=a.relatedTarget;try{for(;b&&b!==this;)b=b.parentNode;if(b!==this){a.type=a.data;c.event.handle.apply(this,arguments)}}catch(d){}},Ea=function(a){a.type=a.data;c.event.handle.apply(this,arguments)};c.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){c.event.special[a]={setup:function(d){c.event.add(this,b,d&&d.selector?Ea:Da,a)},teardown:function(d){c.event.remove(this,b,d&&d.selector?Ea:Da)}}});if(!c.support.submitBubbles)c.event.special.submit=
+{setup:function(){if(this.nodeName.toLowerCase()!=="form"){c.event.add(this,"click.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="submit"||d==="image")&&c(b).closest("form").length)return na("submit",this,arguments)});c.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="text"||d==="password")&&c(b).closest("form").length&&a.keyCode===13)return na("submit",this,arguments)})}else return false},teardown:function(){c.event.remove(this,".specialSubmit")}};
+if(!c.support.changeBubbles){var da=/textarea|input|select/i,ea,Fa=function(a){var b=a.type,d=a.value;if(b==="radio"||b==="checkbox")d=a.checked;else if(b==="select-multiple")d=a.selectedIndex>-1?c.map(a.options,function(f){return f.selected}).join("-"):"";else if(a.nodeName.toLowerCase()==="select")d=a.selectedIndex;return d},fa=function(a,b){var d=a.target,f,e;if(!(!da.test(d.nodeName)||d.readOnly)){f=c.data(d,"_change_data");e=Fa(d);if(a.type!=="focusout"||d.type!=="radio")c.data(d,"_change_data",
+e);if(!(f===w||e===f))if(f!=null||e){a.type="change";return c.event.trigger(a,b,d)}}};c.event.special.change={filters:{focusout:fa,click:function(a){var b=a.target,d=b.type;if(d==="radio"||d==="checkbox"||b.nodeName.toLowerCase()==="select")return fa.call(this,a)},keydown:function(a){var b=a.target,d=b.type;if(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(d==="checkbox"||d==="radio")||d==="select-multiple")return fa.call(this,a)},beforeactivate:function(a){a=a.target;c.data(a,
+"_change_data",Fa(a))}},setup:function(){if(this.type==="file")return false;for(var a in ea)c.event.add(this,a+".specialChange",ea[a]);return da.test(this.nodeName)},teardown:function(){c.event.remove(this,".specialChange");return da.test(this.nodeName)}};ea=c.event.special.change.filters}s.addEventListener&&c.each({focus:"focusin",blur:"focusout"},function(a,b){function d(f){f=c.event.fix(f);f.type=b;return c.event.handle.call(this,f)}c.event.special[b]={setup:function(){this.addEventListener(a,
+d,true)},teardown:function(){this.removeEventListener(a,d,true)}}});c.each(["bind","one"],function(a,b){c.fn[b]=function(d,f,e){if(typeof d==="object"){for(var j in d)this[b](j,f,d[j],e);return this}if(c.isFunction(f)){e=f;f=w}var i=b==="one"?c.proxy(e,function(k){c(this).unbind(k,i);return e.apply(this,arguments)}):e;if(d==="unload"&&b!=="one")this.one(d,f,e);else{j=0;for(var o=this.length;j<o;j++)c.event.add(this[j],d,i,f)}return this}});c.fn.extend({unbind:function(a,b){if(typeof a==="object"&&
+!a.preventDefault)for(var d in a)this.unbind(d,a[d]);else{d=0;for(var f=this.length;d<f;d++)c.event.remove(this[d],a,b)}return this},delegate:function(a,b,d,f){return this.live(b,d,f,a)},undelegate:function(a,b,d){return arguments.length===0?this.unbind("live"):this.die(b,null,d,a)},trigger:function(a,b){return this.each(function(){c.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0]){a=c.Event(a);a.preventDefault();a.stopPropagation();c.event.trigger(a,b,this[0]);return a.result}},
+toggle:function(a){for(var b=arguments,d=1;d<b.length;)c.proxy(a,b[d++]);return this.click(c.proxy(a,function(f){var e=(c.data(this,"lastToggle"+a.guid)||0)%d;c.data(this,"lastToggle"+a.guid,e+1);f.preventDefault();return b[e].apply(this,arguments)||false}))},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var Ga={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};c.each(["live","die"],function(a,b){c.fn[b]=function(d,f,e,j){var i,o=0,k,n,r=j||this.selector,
+u=j?this:c(this.context);if(c.isFunction(f)){e=f;f=w}for(d=(d||"").split(" ");(i=d[o++])!=null;){j=O.exec(i);k="";if(j){k=j[0];i=i.replace(O,"")}if(i==="hover")d.push("mouseenter"+k,"mouseleave"+k);else{n=i;if(i==="focus"||i==="blur"){d.push(Ga[i]+k);i+=k}else i=(Ga[i]||i)+k;b==="live"?u.each(function(){c.event.add(this,pa(i,r),{data:f,selector:r,handler:e,origType:i,origHandler:e,preType:n})}):u.unbind(pa(i,r),e)}}return this}});c.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),
+function(a,b){c.fn[b]=function(d){return d?this.bind(b,d):this.trigger(b)};if(c.attrFn)c.attrFn[b]=true});A.attachEvent&&!A.addEventListener&&A.attachEvent("onunload",function(){for(var a in c.cache)if(c.cache[a].handle)try{c.event.remove(c.cache[a].handle.elem)}catch(b){}});(function(){function a(g){for(var h="",l,m=0;g[m];m++){l=g[m];if(l.nodeType===3||l.nodeType===4)h+=l.nodeValue;else if(l.nodeType!==8)h+=a(l.childNodes)}return h}function b(g,h,l,m,q,p){q=0;for(var v=m.length;q<v;q++){var t=m[q];
+if(t){t=t[g];for(var y=false;t;){if(t.sizcache===l){y=m[t.sizset];break}if(t.nodeType===1&&!p){t.sizcache=l;t.sizset=q}if(t.nodeName.toLowerCase()===h){y=t;break}t=t[g]}m[q]=y}}}function d(g,h,l,m,q,p){q=0;for(var v=m.length;q<v;q++){var t=m[q];if(t){t=t[g];for(var y=false;t;){if(t.sizcache===l){y=m[t.sizset];break}if(t.nodeType===1){if(!p){t.sizcache=l;t.sizset=q}if(typeof h!=="string"){if(t===h){y=true;break}}else if(k.filter(h,[t]).length>0){y=t;break}}t=t[g]}m[q]=y}}}var f=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
+e=0,j=Object.prototype.toString,i=false,o=true;[0,0].sort(function(){o=false;return 0});var k=function(g,h,l,m){l=l||[];var q=h=h||s;if(h.nodeType!==1&&h.nodeType!==9)return[];if(!g||typeof g!=="string")return l;for(var p=[],v,t,y,S,H=true,M=x(h),I=g;(f.exec(""),v=f.exec(I))!==null;){I=v[3];p.push(v[1]);if(v[2]){S=v[3];break}}if(p.length>1&&r.exec(g))if(p.length===2&&n.relative[p[0]])t=ga(p[0]+p[1],h);else for(t=n.relative[p[0]]?[h]:k(p.shift(),h);p.length;){g=p.shift();if(n.relative[g])g+=p.shift();
+t=ga(g,t)}else{if(!m&&p.length>1&&h.nodeType===9&&!M&&n.match.ID.test(p[0])&&!n.match.ID.test(p[p.length-1])){v=k.find(p.shift(),h,M);h=v.expr?k.filter(v.expr,v.set)[0]:v.set[0]}if(h){v=m?{expr:p.pop(),set:z(m)}:k.find(p.pop(),p.length===1&&(p[0]==="~"||p[0]==="+")&&h.parentNode?h.parentNode:h,M);t=v.expr?k.filter(v.expr,v.set):v.set;if(p.length>0)y=z(t);else H=false;for(;p.length;){var D=p.pop();v=D;if(n.relative[D])v=p.pop();else D="";if(v==null)v=h;n.relative[D](y,v,M)}}else y=[]}y||(y=t);y||k.error(D||
+g);if(j.call(y)==="[object Array]")if(H)if(h&&h.nodeType===1)for(g=0;y[g]!=null;g++){if(y[g]&&(y[g]===true||y[g].nodeType===1&&E(h,y[g])))l.push(t[g])}else for(g=0;y[g]!=null;g++)y[g]&&y[g].nodeType===1&&l.push(t[g]);else l.push.apply(l,y);else z(y,l);if(S){k(S,q,l,m);k.uniqueSort(l)}return l};k.uniqueSort=function(g){if(B){i=o;g.sort(B);if(i)for(var h=1;h<g.length;h++)g[h]===g[h-1]&&g.splice(h--,1)}return g};k.matches=function(g,h){return k(g,null,null,h)};k.find=function(g,h,l){var m,q;if(!g)return[];
+for(var p=0,v=n.order.length;p<v;p++){var t=n.order[p];if(q=n.leftMatch[t].exec(g)){var y=q[1];q.splice(1,1);if(y.substr(y.length-1)!=="\\"){q[1]=(q[1]||"").replace(/\\/g,"");m=n.find[t](q,h,l);if(m!=null){g=g.replace(n.match[t],"");break}}}}m||(m=h.getElementsByTagName("*"));return{set:m,expr:g}};k.filter=function(g,h,l,m){for(var q=g,p=[],v=h,t,y,S=h&&h[0]&&x(h[0]);g&&h.length;){for(var H in n.filter)if((t=n.leftMatch[H].exec(g))!=null&&t[2]){var M=n.filter[H],I,D;D=t[1];y=false;t.splice(1,1);if(D.substr(D.length-
+1)!=="\\"){if(v===p)p=[];if(n.preFilter[H])if(t=n.preFilter[H](t,v,l,p,m,S)){if(t===true)continue}else y=I=true;if(t)for(var U=0;(D=v[U])!=null;U++)if(D){I=M(D,t,U,v);var Ha=m^!!I;if(l&&I!=null)if(Ha)y=true;else v[U]=false;else if(Ha){p.push(D);y=true}}if(I!==w){l||(v=p);g=g.replace(n.match[H],"");if(!y)return[];break}}}if(g===q)if(y==null)k.error(g);else break;q=g}return v};k.error=function(g){throw"Syntax error, unrecognized expression: "+g;};var n=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
+CLASS:/\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(g){return g.getAttribute("href")}},
+relative:{"+":function(g,h){var l=typeof h==="string",m=l&&!/\W/.test(h);l=l&&!m;if(m)h=h.toLowerCase();m=0;for(var q=g.length,p;m<q;m++)if(p=g[m]){for(;(p=p.previousSibling)&&p.nodeType!==1;);g[m]=l||p&&p.nodeName.toLowerCase()===h?p||false:p===h}l&&k.filter(h,g,true)},">":function(g,h){var l=typeof h==="string";if(l&&!/\W/.test(h)){h=h.toLowerCase();for(var m=0,q=g.length;m<q;m++){var p=g[m];if(p){l=p.parentNode;g[m]=l.nodeName.toLowerCase()===h?l:false}}}else{m=0;for(q=g.length;m<q;m++)if(p=g[m])g[m]=
+l?p.parentNode:p.parentNode===h;l&&k.filter(h,g,true)}},"":function(g,h,l){var m=e++,q=d;if(typeof h==="string"&&!/\W/.test(h)){var p=h=h.toLowerCase();q=b}q("parentNode",h,m,g,p,l)},"~":function(g,h,l){var m=e++,q=d;if(typeof h==="string"&&!/\W/.test(h)){var p=h=h.toLowerCase();q=b}q("previousSibling",h,m,g,p,l)}},find:{ID:function(g,h,l){if(typeof h.getElementById!=="undefined"&&!l)return(g=h.getElementById(g[1]))?[g]:[]},NAME:function(g,h){if(typeof h.getElementsByName!=="undefined"){var l=[];
+h=h.getElementsByName(g[1]);for(var m=0,q=h.length;m<q;m++)h[m].getAttribute("name")===g[1]&&l.push(h[m]);return l.length===0?null:l}},TAG:function(g,h){return h.getElementsByTagName(g[1])}},preFilter:{CLASS:function(g,h,l,m,q,p){g=" "+g[1].replace(/\\/g,"")+" ";if(p)return g;p=0;for(var v;(v=h[p])!=null;p++)if(v)if(q^(v.className&&(" "+v.className+" ").replace(/[\t\n]/g," ").indexOf(g)>=0))l||m.push(v);else if(l)h[p]=false;return false},ID:function(g){return g[1].replace(/\\/g,"")},TAG:function(g){return g[1].toLowerCase()},
+CHILD:function(g){if(g[1]==="nth"){var h=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(g[2]==="even"&&"2n"||g[2]==="odd"&&"2n+1"||!/\D/.test(g[2])&&"0n+"+g[2]||g[2]);g[2]=h[1]+(h[2]||1)-0;g[3]=h[3]-0}g[0]=e++;return g},ATTR:function(g,h,l,m,q,p){h=g[1].replace(/\\/g,"");if(!p&&n.attrMap[h])g[1]=n.attrMap[h];if(g[2]==="~=")g[4]=" "+g[4]+" ";return g},PSEUDO:function(g,h,l,m,q){if(g[1]==="not")if((f.exec(g[3])||"").length>1||/^\w/.test(g[3]))g[3]=k(g[3],null,null,h);else{g=k.filter(g[3],h,l,true^q);l||m.push.apply(m,
+g);return false}else if(n.match.POS.test(g[0])||n.match.CHILD.test(g[0]))return true;return g},POS:function(g){g.unshift(true);return g}},filters:{enabled:function(g){return g.disabled===false&&g.type!=="hidden"},disabled:function(g){return g.disabled===true},checked:function(g){return g.checked===true},selected:function(g){return g.selected===true},parent:function(g){return!!g.firstChild},empty:function(g){return!g.firstChild},has:function(g,h,l){return!!k(l[3],g).length},header:function(g){return/h\d/i.test(g.nodeName)},
+text:function(g){return"text"===g.type},radio:function(g){return"radio"===g.type},checkbox:function(g){return"checkbox"===g.type},file:function(g){return"file"===g.type},password:function(g){return"password"===g.type},submit:function(g){return"submit"===g.type},image:function(g){return"image"===g.type},reset:function(g){return"reset"===g.type},button:function(g){return"button"===g.type||g.nodeName.toLowerCase()==="button"},input:function(g){return/input|select|textarea|button/i.test(g.nodeName)}},
+setFilters:{first:function(g,h){return h===0},last:function(g,h,l,m){return h===m.length-1},even:function(g,h){return h%2===0},odd:function(g,h){return h%2===1},lt:function(g,h,l){return h<l[3]-0},gt:function(g,h,l){return h>l[3]-0},nth:function(g,h,l){return l[3]-0===h},eq:function(g,h,l){return l[3]-0===h}},filter:{PSEUDO:function(g,h,l,m){var q=h[1],p=n.filters[q];if(p)return p(g,l,h,m);else if(q==="contains")return(g.textContent||g.innerText||a([g])||"").indexOf(h[3])>=0;else if(q==="not"){h=
+h[3];l=0;for(m=h.length;l<m;l++)if(h[l]===g)return false;return true}else k.error("Syntax error, unrecognized expression: "+q)},CHILD:function(g,h){var l=h[1],m=g;switch(l){case "only":case "first":for(;m=m.previousSibling;)if(m.nodeType===1)return false;if(l==="first")return true;m=g;case "last":for(;m=m.nextSibling;)if(m.nodeType===1)return false;return true;case "nth":l=h[2];var q=h[3];if(l===1&&q===0)return true;h=h[0];var p=g.parentNode;if(p&&(p.sizcache!==h||!g.nodeIndex)){var v=0;for(m=p.firstChild;m;m=
+m.nextSibling)if(m.nodeType===1)m.nodeIndex=++v;p.sizcache=h}g=g.nodeIndex-q;return l===0?g===0:g%l===0&&g/l>=0}},ID:function(g,h){return g.nodeType===1&&g.getAttribute("id")===h},TAG:function(g,h){return h==="*"&&g.nodeType===1||g.nodeName.toLowerCase()===h},CLASS:function(g,h){return(" "+(g.className||g.getAttribute("class"))+" ").indexOf(h)>-1},ATTR:function(g,h){var l=h[1];g=n.attrHandle[l]?n.attrHandle[l](g):g[l]!=null?g[l]:g.getAttribute(l);l=g+"";var m=h[2];h=h[4];return g==null?m==="!=":m===
+"="?l===h:m==="*="?l.indexOf(h)>=0:m==="~="?(" "+l+" ").indexOf(h)>=0:!h?l&&g!==false:m==="!="?l!==h:m==="^="?l.indexOf(h)===0:m==="$="?l.substr(l.length-h.length)===h:m==="|="?l===h||l.substr(0,h.length+1)===h+"-":false},POS:function(g,h,l,m){var q=n.setFilters[h[2]];if(q)return q(g,l,h,m)}}},r=n.match.POS;for(var u in n.match){n.match[u]=new RegExp(n.match[u].source+/(?![^\[]*\])(?![^\(]*\))/.source);n.leftMatch[u]=new RegExp(/(^(?:.|\r|\n)*?)/.source+n.match[u].source.replace(/\\(\d+)/g,function(g,
+h){return"\\"+(h-0+1)}))}var z=function(g,h){g=Array.prototype.slice.call(g,0);if(h){h.push.apply(h,g);return h}return g};try{Array.prototype.slice.call(s.documentElement.childNodes,0)}catch(C){z=function(g,h){h=h||[];if(j.call(g)==="[object Array]")Array.prototype.push.apply(h,g);else if(typeof g.length==="number")for(var l=0,m=g.length;l<m;l++)h.push(g[l]);else for(l=0;g[l];l++)h.push(g[l]);return h}}var B;if(s.documentElement.compareDocumentPosition)B=function(g,h){if(!g.compareDocumentPosition||
+!h.compareDocumentPosition){if(g==h)i=true;return g.compareDocumentPosition?-1:1}g=g.compareDocumentPosition(h)&4?-1:g===h?0:1;if(g===0)i=true;return g};else if("sourceIndex"in s.documentElement)B=function(g,h){if(!g.sourceIndex||!h.sourceIndex){if(g==h)i=true;return g.sourceIndex?-1:1}g=g.sourceIndex-h.sourceIndex;if(g===0)i=true;return g};else if(s.createRange)B=function(g,h){if(!g.ownerDocument||!h.ownerDocument){if(g==h)i=true;return g.ownerDocument?-1:1}var l=g.ownerDocument.createRange(),m=
+h.ownerDocument.createRange();l.setStart(g,0);l.setEnd(g,0);m.setStart(h,0);m.setEnd(h,0);g=l.compareBoundaryPoints(Range.START_TO_END,m);if(g===0)i=true;return g};(function(){var g=s.createElement("div"),h="script"+(new Date).getTime();g.innerHTML="<a name='"+h+"'/>";var l=s.documentElement;l.insertBefore(g,l.firstChild);if(s.getElementById(h)){n.find.ID=function(m,q,p){if(typeof q.getElementById!=="undefined"&&!p)return(q=q.getElementById(m[1]))?q.id===m[1]||typeof q.getAttributeNode!=="undefined"&&
+q.getAttributeNode("id").nodeValue===m[1]?[q]:w:[]};n.filter.ID=function(m,q){var p=typeof m.getAttributeNode!=="undefined"&&m.getAttributeNode("id");return m.nodeType===1&&p&&p.nodeValue===q}}l.removeChild(g);l=g=null})();(function(){var g=s.createElement("div");g.appendChild(s.createComment(""));if(g.getElementsByTagName("*").length>0)n.find.TAG=function(h,l){l=l.getElementsByTagName(h[1]);if(h[1]==="*"){h=[];for(var m=0;l[m];m++)l[m].nodeType===1&&h.push(l[m]);l=h}return l};g.innerHTML="<a href='#'></a>";
+if(g.firstChild&&typeof g.firstChild.getAttribute!=="undefined"&&g.firstChild.getAttribute("href")!=="#")n.attrHandle.href=function(h){return h.getAttribute("href",2)};g=null})();s.querySelectorAll&&function(){var g=k,h=s.createElement("div");h.innerHTML="<p class='TEST'></p>";if(!(h.querySelectorAll&&h.querySelectorAll(".TEST").length===0)){k=function(m,q,p,v){q=q||s;if(!v&&q.nodeType===9&&!x(q))try{return z(q.querySelectorAll(m),p)}catch(t){}return g(m,q,p,v)};for(var l in g)k[l]=g[l];h=null}}();
+(function(){var g=s.createElement("div");g.innerHTML="<div class='test e'></div><div class='test'></div>";if(!(!g.getElementsByClassName||g.getElementsByClassName("e").length===0)){g.lastChild.className="e";if(g.getElementsByClassName("e").length!==1){n.order.splice(1,0,"CLASS");n.find.CLASS=function(h,l,m){if(typeof l.getElementsByClassName!=="undefined"&&!m)return l.getElementsByClassName(h[1])};g=null}}})();var E=s.compareDocumentPosition?function(g,h){return!!(g.compareDocumentPosition(h)&16)}:
+function(g,h){return g!==h&&(g.contains?g.contains(h):true)},x=function(g){return(g=(g?g.ownerDocument||g:0).documentElement)?g.nodeName!=="HTML":false},ga=function(g,h){var l=[],m="",q;for(h=h.nodeType?[h]:h;q=n.match.PSEUDO.exec(g);){m+=q[0];g=g.replace(n.match.PSEUDO,"")}g=n.relative[g]?g+"*":g;q=0;for(var p=h.length;q<p;q++)k(g,h[q],l);return k.filter(m,l)};c.find=k;c.expr=k.selectors;c.expr[":"]=c.expr.filters;c.unique=k.uniqueSort;c.text=a;c.isXMLDoc=x;c.contains=E})();var eb=/Until$/,fb=/^(?:parents|prevUntil|prevAll)/,
+gb=/,/;R=Array.prototype.slice;var Ia=function(a,b,d){if(c.isFunction(b))return c.grep(a,function(e,j){return!!b.call(e,j,e)===d});else if(b.nodeType)return c.grep(a,function(e){return e===b===d});else if(typeof b==="string"){var f=c.grep(a,function(e){return e.nodeType===1});if(Ua.test(b))return c.filter(b,f,!d);else b=c.filter(b,f)}return c.grep(a,function(e){return c.inArray(e,b)>=0===d})};c.fn.extend({find:function(a){for(var b=this.pushStack("","find",a),d=0,f=0,e=this.length;f<e;f++){d=b.length;
+c.find(a,this[f],b);if(f>0)for(var j=d;j<b.length;j++)for(var i=0;i<d;i++)if(b[i]===b[j]){b.splice(j--,1);break}}return b},has:function(a){var b=c(a);return this.filter(function(){for(var d=0,f=b.length;d<f;d++)if(c.contains(this,b[d]))return true})},not:function(a){return this.pushStack(Ia(this,a,false),"not",a)},filter:function(a){return this.pushStack(Ia(this,a,true),"filter",a)},is:function(a){return!!a&&c.filter(a,this).length>0},closest:function(a,b){if(c.isArray(a)){var d=[],f=this[0],e,j=
+{},i;if(f&&a.length){e=0;for(var o=a.length;e<o;e++){i=a[e];j[i]||(j[i]=c.expr.match.POS.test(i)?c(i,b||this.context):i)}for(;f&&f.ownerDocument&&f!==b;){for(i in j){e=j[i];if(e.jquery?e.index(f)>-1:c(f).is(e)){d.push({selector:i,elem:f});delete j[i]}}f=f.parentNode}}return d}var k=c.expr.match.POS.test(a)?c(a,b||this.context):null;return this.map(function(n,r){for(;r&&r.ownerDocument&&r!==b;){if(k?k.index(r)>-1:c(r).is(a))return r;r=r.parentNode}return null})},index:function(a){if(!a||typeof a===
+"string")return c.inArray(this[0],a?c(a):this.parent().children());return c.inArray(a.jquery?a[0]:a,this)},add:function(a,b){a=typeof a==="string"?c(a,b||this.context):c.makeArray(a);b=c.merge(this.get(),a);return this.pushStack(qa(a[0])||qa(b[0])?b:c.unique(b))},andSelf:function(){return this.add(this.prevObject)}});c.each({parent:function(a){return(a=a.parentNode)&&a.nodeType!==11?a:null},parents:function(a){return c.dir(a,"parentNode")},parentsUntil:function(a,b,d){return c.dir(a,"parentNode",
+d)},next:function(a){return c.nth(a,2,"nextSibling")},prev:function(a){return c.nth(a,2,"previousSibling")},nextAll:function(a){return c.dir(a,"nextSibling")},prevAll:function(a){return c.dir(a,"previousSibling")},nextUntil:function(a,b,d){return c.dir(a,"nextSibling",d)},prevUntil:function(a,b,d){return c.dir(a,"previousSibling",d)},siblings:function(a){return c.sibling(a.parentNode.firstChild,a)},children:function(a){return c.sibling(a.firstChild)},contents:function(a){return c.nodeName(a,"iframe")?
+a.contentDocument||a.contentWindow.document:c.makeArray(a.childNodes)}},function(a,b){c.fn[a]=function(d,f){var e=c.map(this,b,d);eb.test(a)||(f=d);if(f&&typeof f==="string")e=c.filter(f,e);e=this.length>1?c.unique(e):e;if((this.length>1||gb.test(f))&&fb.test(a))e=e.reverse();return this.pushStack(e,a,R.call(arguments).join(","))}});c.extend({filter:function(a,b,d){if(d)a=":not("+a+")";return c.find.matches(a,b)},dir:function(a,b,d){var f=[];for(a=a[b];a&&a.nodeType!==9&&(d===w||a.nodeType!==1||!c(a).is(d));){a.nodeType===
+1&&f.push(a);a=a[b]}return f},nth:function(a,b,d){b=b||1;for(var f=0;a;a=a[d])if(a.nodeType===1&&++f===b)break;return a},sibling:function(a,b){for(var d=[];a;a=a.nextSibling)a.nodeType===1&&a!==b&&d.push(a);return d}});var Ja=/ jQuery\d+="(?:\d+|null)"/g,V=/^\s+/,Ka=/(<([\w:]+)[^>]*?)\/>/g,hb=/^(?:area|br|col|embed|hr|img|input|link|meta|param)$/i,La=/<([\w:]+)/,ib=/<tbody/i,jb=/<|&#?\w+;/,ta=/<script|<object|<embed|<option|<style/i,ua=/checked\s*(?:[^=]|=\s*.checked.)/i,Ma=function(a,b,d){return hb.test(d)?
+a:b+"></"+d+">"},F={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};F.optgroup=F.option;F.tbody=F.tfoot=F.colgroup=F.caption=F.thead;F.th=F.td;if(!c.support.htmlSerialize)F._default=[1,"div<div>","</div>"];c.fn.extend({text:function(a){if(c.isFunction(a))return this.each(function(b){var d=
+c(this);d.text(a.call(this,b,d.text()))});if(typeof a!=="object"&&a!==w)return this.empty().append((this[0]&&this[0].ownerDocument||s).createTextNode(a));return c.text(this)},wrapAll:function(a){if(c.isFunction(a))return this.each(function(d){c(this).wrapAll(a.call(this,d))});if(this[0]){var b=c(a,this[0].ownerDocument).eq(0).clone(true);this[0].parentNode&&b.insertBefore(this[0]);b.map(function(){for(var d=this;d.firstChild&&d.firstChild.nodeType===1;)d=d.firstChild;return d}).append(this)}return this},
+wrapInner:function(a){if(c.isFunction(a))return this.each(function(b){c(this).wrapInner(a.call(this,b))});return this.each(function(){var b=c(this),d=b.contents();d.length?d.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){c(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){c.nodeName(this,"body")||c(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.appendChild(a)})},
+prepend:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,this)});else if(arguments.length){var a=c(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,
+this.nextSibling)});else if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,c(arguments[0]).toArray());return a}},remove:function(a,b){for(var d=0,f;(f=this[d])!=null;d++)if(!a||c.filter(a,[f]).length){if(!b&&f.nodeType===1){c.cleanData(f.getElementsByTagName("*"));c.cleanData([f])}f.parentNode&&f.parentNode.removeChild(f)}return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++)for(b.nodeType===1&&c.cleanData(b.getElementsByTagName("*"));b.firstChild;)b.removeChild(b.firstChild);
+return this},clone:function(a){var b=this.map(function(){if(!c.support.noCloneEvent&&!c.isXMLDoc(this)){var d=this.outerHTML,f=this.ownerDocument;if(!d){d=f.createElement("div");d.appendChild(this.cloneNode(true));d=d.innerHTML}return c.clean([d.replace(Ja,"").replace(/=([^="'>\s]+\/)>/g,'="$1">').replace(V,"")],f)[0]}else return this.cloneNode(true)});if(a===true){ra(this,b);ra(this.find("*"),b.find("*"))}return b},html:function(a){if(a===w)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Ja,
+""):null;else if(typeof a==="string"&&!ta.test(a)&&(c.support.leadingWhitespace||!V.test(a))&&!F[(La.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Ka,Ma);try{for(var b=0,d=this.length;b<d;b++)if(this[b].nodeType===1){c.cleanData(this[b].getElementsByTagName("*"));this[b].innerHTML=a}}catch(f){this.empty().append(a)}}else c.isFunction(a)?this.each(function(e){var j=c(this),i=j.html();j.empty().append(function(){return a.call(this,e,i)})}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&
+this[0].parentNode){if(c.isFunction(a))return this.each(function(b){var d=c(this),f=d.html();d.replaceWith(a.call(this,b,f))});if(typeof a!=="string")a=c(a).detach();return this.each(function(){var b=this.nextSibling,d=this.parentNode;c(this).remove();b?c(b).before(a):c(d).append(a)})}else return this.pushStack(c(c.isFunction(a)?a():a),"replaceWith",a)},detach:function(a){return this.remove(a,true)},domManip:function(a,b,d){function f(u){return c.nodeName(u,"table")?u.getElementsByTagName("tbody")[0]||
+u.appendChild(u.ownerDocument.createElement("tbody")):u}var e,j,i=a[0],o=[],k;if(!c.support.checkClone&&arguments.length===3&&typeof i==="string"&&ua.test(i))return this.each(function(){c(this).domManip(a,b,d,true)});if(c.isFunction(i))return this.each(function(u){var z=c(this);a[0]=i.call(this,u,b?z.html():w);z.domManip(a,b,d)});if(this[0]){e=i&&i.parentNode;e=c.support.parentNode&&e&&e.nodeType===11&&e.childNodes.length===this.length?{fragment:e}:sa(a,this,o);k=e.fragment;if(j=k.childNodes.length===
+1?(k=k.firstChild):k.firstChild){b=b&&c.nodeName(j,"tr");for(var n=0,r=this.length;n<r;n++)d.call(b?f(this[n],j):this[n],n>0||e.cacheable||this.length>1?k.cloneNode(true):k)}o.length&&c.each(o,Qa)}return this}});c.fragments={};c.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){c.fn[a]=function(d){var f=[];d=c(d);var e=this.length===1&&this[0].parentNode;if(e&&e.nodeType===11&&e.childNodes.length===1&&d.length===1){d[b](this[0]);
+return this}else{e=0;for(var j=d.length;e<j;e++){var i=(e>0?this.clone(true):this).get();c.fn[b].apply(c(d[e]),i);f=f.concat(i)}return this.pushStack(f,a,d.selector)}}});c.extend({clean:function(a,b,d,f){b=b||s;if(typeof b.createElement==="undefined")b=b.ownerDocument||b[0]&&b[0].ownerDocument||s;for(var e=[],j=0,i;(i=a[j])!=null;j++){if(typeof i==="number")i+="";if(i){if(typeof i==="string"&&!jb.test(i))i=b.createTextNode(i);else if(typeof i==="string"){i=i.replace(Ka,Ma);var o=(La.exec(i)||["",
+""])[1].toLowerCase(),k=F[o]||F._default,n=k[0],r=b.createElement("div");for(r.innerHTML=k[1]+i+k[2];n--;)r=r.lastChild;if(!c.support.tbody){n=ib.test(i);o=o==="table"&&!n?r.firstChild&&r.firstChild.childNodes:k[1]==="<table>"&&!n?r.childNodes:[];for(k=o.length-1;k>=0;--k)c.nodeName(o[k],"tbody")&&!o[k].childNodes.length&&o[k].parentNode.removeChild(o[k])}!c.support.leadingWhitespace&&V.test(i)&&r.insertBefore(b.createTextNode(V.exec(i)[0]),r.firstChild);i=r.childNodes}if(i.nodeType)e.push(i);else e=
+c.merge(e,i)}}if(d)for(j=0;e[j];j++)if(f&&c.nodeName(e[j],"script")&&(!e[j].type||e[j].type.toLowerCase()==="text/javascript"))f.push(e[j].parentNode?e[j].parentNode.removeChild(e[j]):e[j]);else{e[j].nodeType===1&&e.splice.apply(e,[j+1,0].concat(c.makeArray(e[j].getElementsByTagName("script"))));d.appendChild(e[j])}return e},cleanData:function(a){for(var b,d,f=c.cache,e=c.event.special,j=c.support.deleteExpando,i=0,o;(o=a[i])!=null;i++)if(d=o[c.expando]){b=f[d];if(b.events)for(var k in b.events)e[k]?
+c.event.remove(o,k):Ca(o,k,b.handle);if(j)delete o[c.expando];else o.removeAttribute&&o.removeAttribute(c.expando);delete f[d]}}});var kb=/z-?index|font-?weight|opacity|zoom|line-?height/i,Na=/alpha\([^)]*\)/,Oa=/opacity=([^)]*)/,ha=/float/i,ia=/-([a-z])/ig,lb=/([A-Z])/g,mb=/^-?\d+(?:px)?$/i,nb=/^-?\d/,ob={position:"absolute",visibility:"hidden",display:"block"},pb=["Left","Right"],qb=["Top","Bottom"],rb=s.defaultView&&s.defaultView.getComputedStyle,Pa=c.support.cssFloat?"cssFloat":"styleFloat",ja=
+function(a,b){return b.toUpperCase()};c.fn.css=function(a,b){return X(this,a,b,true,function(d,f,e){if(e===w)return c.curCSS(d,f);if(typeof e==="number"&&!kb.test(f))e+="px";c.style(d,f,e)})};c.extend({style:function(a,b,d){if(!a||a.nodeType===3||a.nodeType===8)return w;if((b==="width"||b==="height")&&parseFloat(d)<0)d=w;var f=a.style||a,e=d!==w;if(!c.support.opacity&&b==="opacity"){if(e){f.zoom=1;b=parseInt(d,10)+""==="NaN"?"":"alpha(opacity="+d*100+")";a=f.filter||c.curCSS(a,"filter")||"";f.filter=
+Na.test(a)?a.replace(Na,b):b}return f.filter&&f.filter.indexOf("opacity=")>=0?parseFloat(Oa.exec(f.filter)[1])/100+"":""}if(ha.test(b))b=Pa;b=b.replace(ia,ja);if(e)f[b]=d;return f[b]},css:function(a,b,d,f){if(b==="width"||b==="height"){var e,j=b==="width"?pb:qb;function i(){e=b==="width"?a.offsetWidth:a.offsetHeight;f!=="border"&&c.each(j,function(){f||(e-=parseFloat(c.curCSS(a,"padding"+this,true))||0);if(f==="margin")e+=parseFloat(c.curCSS(a,"margin"+this,true))||0;else e-=parseFloat(c.curCSS(a,
+"border"+this+"Width",true))||0})}a.offsetWidth!==0?i():c.swap(a,ob,i);return Math.max(0,Math.round(e))}return c.curCSS(a,b,d)},curCSS:function(a,b,d){var f,e=a.style;if(!c.support.opacity&&b==="opacity"&&a.currentStyle){f=Oa.test(a.currentStyle.filter||"")?parseFloat(RegExp.$1)/100+"":"";return f===""?"1":f}if(ha.test(b))b=Pa;if(!d&&e&&e[b])f=e[b];else if(rb){if(ha.test(b))b="float";b=b.replace(lb,"-$1").toLowerCase();e=a.ownerDocument.defaultView;if(!e)return null;if(a=e.getComputedStyle(a,null))f=
+a.getPropertyValue(b);if(b==="opacity"&&f==="")f="1"}else if(a.currentStyle){d=b.replace(ia,ja);f=a.currentStyle[b]||a.currentStyle[d];if(!mb.test(f)&&nb.test(f)){b=e.left;var j=a.runtimeStyle.left;a.runtimeStyle.left=a.currentStyle.left;e.left=d==="fontSize"?"1em":f||0;f=e.pixelLeft+"px";e.left=b;a.runtimeStyle.left=j}}return f},swap:function(a,b,d){var f={};for(var e in b){f[e]=a.style[e];a.style[e]=b[e]}d.call(a);for(e in b)a.style[e]=f[e]}});if(c.expr&&c.expr.filters){c.expr.filters.hidden=function(a){var b=
+a.offsetWidth,d=a.offsetHeight,f=a.nodeName.toLowerCase()==="tr";return b===0&&d===0&&!f?true:b>0&&d>0&&!f?false:c.curCSS(a,"display")==="none"};c.expr.filters.visible=function(a){return!c.expr.filters.hidden(a)}}var sb=J(),tb=/<script(.|\s)*?\/script>/gi,ub=/select|textarea/i,vb=/color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week/i,N=/=\?(&|$)/,ka=/\?/,wb=/(\?|&)_=.*?(&|$)/,xb=/^(\w+:)?\/\/([^\/?#]+)/,yb=/%20/g,zb=c.fn.load;c.fn.extend({load:function(a,b,d){if(typeof a!==
+"string")return zb.call(this,a);else if(!this.length)return this;var f=a.indexOf(" ");if(f>=0){var e=a.slice(f,a.length);a=a.slice(0,f)}f="GET";if(b)if(c.isFunction(b)){d=b;b=null}else if(typeof b==="object"){b=c.param(b,c.ajaxSettings.traditional);f="POST"}var j=this;c.ajax({url:a,type:f,dataType:"html",data:b,complete:function(i,o){if(o==="success"||o==="notmodified")j.html(e?c("<div />").append(i.responseText.replace(tb,"")).find(e):i.responseText);d&&j.each(d,[i.responseText,o,i])}});return this},
+serialize:function(){return c.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?c.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||ub.test(this.nodeName)||vb.test(this.type))}).map(function(a,b){a=c(this).val();return a==null?null:c.isArray(a)?c.map(a,function(d){return{name:b.name,value:d}}):{name:b.name,value:a}}).get()}});c.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),
+function(a,b){c.fn[b]=function(d){return this.bind(b,d)}});c.extend({get:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b=null}return c.ajax({type:"GET",url:a,data:b,success:d,dataType:f})},getScript:function(a,b){return c.get(a,null,b,"script")},getJSON:function(a,b,d){return c.get(a,b,d,"json")},post:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b={}}return c.ajax({type:"POST",url:a,data:b,success:d,dataType:f})},ajaxSetup:function(a){c.extend(c.ajaxSettings,a)},ajaxSettings:{url:location.href,
+global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:A.XMLHttpRequest&&(A.location.protocol!=="file:"||!A.ActiveXObject)?function(){return new A.XMLHttpRequest}:function(){try{return new A.ActiveXObject("Microsoft.XMLHTTP")}catch(a){}},accepts:{xml:"application/xml, text/xml",html:"text/html",script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},lastModified:{},etag:{},ajax:function(a){function b(){e.success&&
+e.success.call(k,o,i,x);e.global&&f("ajaxSuccess",[x,e])}function d(){e.complete&&e.complete.call(k,x,i);e.global&&f("ajaxComplete",[x,e]);e.global&&!--c.active&&c.event.trigger("ajaxStop")}function f(q,p){(e.context?c(e.context):c.event).trigger(q,p)}var e=c.extend(true,{},c.ajaxSettings,a),j,i,o,k=a&&a.context||e,n=e.type.toUpperCase();if(e.data&&e.processData&&typeof e.data!=="string")e.data=c.param(e.data,e.traditional);if(e.dataType==="jsonp"){if(n==="GET")N.test(e.url)||(e.url+=(ka.test(e.url)?
+"&":"?")+(e.jsonp||"callback")+"=?");else if(!e.data||!N.test(e.data))e.data=(e.data?e.data+"&":"")+(e.jsonp||"callback")+"=?";e.dataType="json"}if(e.dataType==="json"&&(e.data&&N.test(e.data)||N.test(e.url))){j=e.jsonpCallback||"jsonp"+sb++;if(e.data)e.data=(e.data+"").replace(N,"="+j+"$1");e.url=e.url.replace(N,"="+j+"$1");e.dataType="script";A[j]=A[j]||function(q){o=q;b();d();A[j]=w;try{delete A[j]}catch(p){}z&&z.removeChild(C)}}if(e.dataType==="script"&&e.cache===null)e.cache=false;if(e.cache===
+false&&n==="GET"){var r=J(),u=e.url.replace(wb,"$1_="+r+"$2");e.url=u+(u===e.url?(ka.test(e.url)?"&":"?")+"_="+r:"")}if(e.data&&n==="GET")e.url+=(ka.test(e.url)?"&":"?")+e.data;e.global&&!c.active++&&c.event.trigger("ajaxStart");r=(r=xb.exec(e.url))&&(r[1]&&r[1]!==location.protocol||r[2]!==location.host);if(e.dataType==="script"&&n==="GET"&&r){var z=s.getElementsByTagName("head")[0]||s.documentElement,C=s.createElement("script");C.src=e.url;if(e.scriptCharset)C.charset=e.scriptCharset;if(!j){var B=
+false;C.onload=C.onreadystatechange=function(){if(!B&&(!this.readyState||this.readyState==="loaded"||this.readyState==="complete")){B=true;b();d();C.onload=C.onreadystatechange=null;z&&C.parentNode&&z.removeChild(C)}}}z.insertBefore(C,z.firstChild);return w}var E=false,x=e.xhr();if(x){e.username?x.open(n,e.url,e.async,e.username,e.password):x.open(n,e.url,e.async);try{if(e.data||a&&a.contentType)x.setRequestHeader("Content-Type",e.contentType);if(e.ifModified){c.lastModified[e.url]&&x.setRequestHeader("If-Modified-Since",
+c.lastModified[e.url]);c.etag[e.url]&&x.setRequestHeader("If-None-Match",c.etag[e.url])}r||x.setRequestHeader("X-Requested-With","XMLHttpRequest");x.setRequestHeader("Accept",e.dataType&&e.accepts[e.dataType]?e.accepts[e.dataType]+", */*":e.accepts._default)}catch(ga){}if(e.beforeSend&&e.beforeSend.call(k,x,e)===false){e.global&&!--c.active&&c.event.trigger("ajaxStop");x.abort();return false}e.global&&f("ajaxSend",[x,e]);var g=x.onreadystatechange=function(q){if(!x||x.readyState===0||q==="abort"){E||
+d();E=true;if(x)x.onreadystatechange=c.noop}else if(!E&&x&&(x.readyState===4||q==="timeout")){E=true;x.onreadystatechange=c.noop;i=q==="timeout"?"timeout":!c.httpSuccess(x)?"error":e.ifModified&&c.httpNotModified(x,e.url)?"notmodified":"success";var p;if(i==="success")try{o=c.httpData(x,e.dataType,e)}catch(v){i="parsererror";p=v}if(i==="success"||i==="notmodified")j||b();else c.handleError(e,x,i,p);d();q==="timeout"&&x.abort();if(e.async)x=null}};try{var h=x.abort;x.abort=function(){x&&h.call(x);
+g("abort")}}catch(l){}e.async&&e.timeout>0&&setTimeout(function(){x&&!E&&g("timeout")},e.timeout);try{x.send(n==="POST"||n==="PUT"||n==="DELETE"?e.data:null)}catch(m){c.handleError(e,x,null,m);d()}e.async||g();return x}},handleError:function(a,b,d,f){if(a.error)a.error.call(a.context||a,b,d,f);if(a.global)(a.context?c(a.context):c.event).trigger("ajaxError",[b,a,f])},active:0,httpSuccess:function(a){try{return!a.status&&location.protocol==="file:"||a.status>=200&&a.status<300||a.status===304||a.status===
+1223||a.status===0}catch(b){}return false},httpNotModified:function(a,b){var d=a.getResponseHeader("Last-Modified"),f=a.getResponseHeader("Etag");if(d)c.lastModified[b]=d;if(f)c.etag[b]=f;return a.status===304||a.status===0},httpData:function(a,b,d){var f=a.getResponseHeader("content-type")||"",e=b==="xml"||!b&&f.indexOf("xml")>=0;a=e?a.responseXML:a.responseText;e&&a.documentElement.nodeName==="parsererror"&&c.error("parsererror");if(d&&d.dataFilter)a=d.dataFilter(a,b);if(typeof a==="string")if(b===
+"json"||!b&&f.indexOf("json")>=0)a=c.parseJSON(a);else if(b==="script"||!b&&f.indexOf("javascript")>=0)c.globalEval(a);return a},param:function(a,b){function d(i,o){if(c.isArray(o))c.each(o,function(k,n){b||/\[\]$/.test(i)?f(i,n):d(i+"["+(typeof n==="object"||c.isArray(n)?k:"")+"]",n)});else!b&&o!=null&&typeof o==="object"?c.each(o,function(k,n){d(i+"["+k+"]",n)}):f(i,o)}function f(i,o){o=c.isFunction(o)?o():o;e[e.length]=encodeURIComponent(i)+"="+encodeURIComponent(o)}var e=[];if(b===w)b=c.ajaxSettings.traditional;
+if(c.isArray(a)||a.jquery)c.each(a,function(){f(this.name,this.value)});else for(var j in a)d(j,a[j]);return e.join("&").replace(yb,"+")}});var la={},Ab=/toggle|show|hide/,Bb=/^([+-]=)?([\d+-.]+)(.*)$/,W,va=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];c.fn.extend({show:function(a,b){if(a||a===0)return this.animate(K("show",3),a,b);else{a=0;for(b=this.length;a<b;a++){var d=c.data(this[a],"olddisplay");
+this[a].style.display=d||"";if(c.css(this[a],"display")==="none"){d=this[a].nodeName;var f;if(la[d])f=la[d];else{var e=c("<"+d+" />").appendTo("body");f=e.css("display");if(f==="none")f="block";e.remove();la[d]=f}c.data(this[a],"olddisplay",f)}}a=0;for(b=this.length;a<b;a++)this[a].style.display=c.data(this[a],"olddisplay")||"";return this}},hide:function(a,b){if(a||a===0)return this.animate(K("hide",3),a,b);else{a=0;for(b=this.length;a<b;a++){var d=c.data(this[a],"olddisplay");!d&&d!=="none"&&c.data(this[a],
+"olddisplay",c.css(this[a],"display"))}a=0;for(b=this.length;a<b;a++)this[a].style.display="none";return this}},_toggle:c.fn.toggle,toggle:function(a,b){var d=typeof a==="boolean";if(c.isFunction(a)&&c.isFunction(b))this._toggle.apply(this,arguments);else a==null||d?this.each(function(){var f=d?a:c(this).is(":hidden");c(this)[f?"show":"hide"]()}):this.animate(K("toggle",3),a,b);return this},fadeTo:function(a,b,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,d)},
+animate:function(a,b,d,f){var e=c.speed(b,d,f);if(c.isEmptyObject(a))return this.each(e.complete);return this[e.queue===false?"each":"queue"](function(){var j=c.extend({},e),i,o=this.nodeType===1&&c(this).is(":hidden"),k=this;for(i in a){var n=i.replace(ia,ja);if(i!==n){a[n]=a[i];delete a[i];i=n}if(a[i]==="hide"&&o||a[i]==="show"&&!o)return j.complete.call(this);if((i==="height"||i==="width")&&this.style){j.display=c.css(this,"display");j.overflow=this.style.overflow}if(c.isArray(a[i])){(j.specialEasing=
+j.specialEasing||{})[i]=a[i][1];a[i]=a[i][0]}}if(j.overflow!=null)this.style.overflow="hidden";j.curAnim=c.extend({},a);c.each(a,function(r,u){var z=new c.fx(k,j,r);if(Ab.test(u))z[u==="toggle"?o?"show":"hide":u](a);else{var C=Bb.exec(u),B=z.cur(true)||0;if(C){u=parseFloat(C[2]);var E=C[3]||"px";if(E!=="px"){k.style[r]=(u||1)+E;B=(u||1)/z.cur(true)*B;k.style[r]=B+E}if(C[1])u=(C[1]==="-="?-1:1)*u+B;z.custom(B,u,E)}else z.custom(B,u,"")}});return true})},stop:function(a,b){var d=c.timers;a&&this.queue([]);
+this.each(function(){for(var f=d.length-1;f>=0;f--)if(d[f].elem===this){b&&d[f](true);d.splice(f,1)}});b||this.dequeue();return this}});c.each({slideDown:K("show",1),slideUp:K("hide",1),slideToggle:K("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"}},function(a,b){c.fn[a]=function(d,f){return this.animate(b,d,f)}});c.extend({speed:function(a,b,d){var f=a&&typeof a==="object"?a:{complete:d||!d&&b||c.isFunction(a)&&a,duration:a,easing:d&&b||b&&!c.isFunction(b)&&b};f.duration=c.fx.off?0:typeof f.duration===
+"number"?f.duration:c.fx.speeds[f.duration]||c.fx.speeds._default;f.old=f.complete;f.complete=function(){f.queue!==false&&c(this).dequeue();c.isFunction(f.old)&&f.old.call(this)};return f},easing:{linear:function(a,b,d,f){return d+f*a},swing:function(a,b,d,f){return(-Math.cos(a*Math.PI)/2+0.5)*f+d}},timers:[],fx:function(a,b,d){this.options=b;this.elem=a;this.prop=d;if(!b.orig)b.orig={}}});c.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this);(c.fx.step[this.prop]||
+c.fx.step._default)(this);if((this.prop==="height"||this.prop==="width")&&this.elem.style)this.elem.style.display="block"},cur:function(a){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];return(a=parseFloat(c.css(this.elem,this.prop,a)))&&a>-10000?a:parseFloat(c.curCSS(this.elem,this.prop))||0},custom:function(a,b,d){function f(j){return e.step(j)}this.startTime=J();this.start=a;this.end=b;this.unit=d||this.unit||"px";this.now=this.start;
+this.pos=this.state=0;var e=this;f.elem=this.elem;if(f()&&c.timers.push(f)&&!W)W=setInterval(c.fx.tick,13)},show:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.show=true;this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur());c(this.elem).show()},hide:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(a){var b=J(),d=true;if(a||b>=this.options.duration+this.startTime){this.now=
+this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;for(var f in this.options.curAnim)if(this.options.curAnim[f]!==true)d=false;if(d){if(this.options.display!=null){this.elem.style.overflow=this.options.overflow;a=c.data(this.elem,"olddisplay");this.elem.style.display=a?a:this.options.display;if(c.css(this.elem,"display")==="none")this.elem.style.display="block"}this.options.hide&&c(this.elem).hide();if(this.options.hide||this.options.show)for(var e in this.options.curAnim)c.style(this.elem,
+e,this.options.orig[e]);this.options.complete.call(this.elem)}return false}else{e=b-this.startTime;this.state=e/this.options.duration;a=this.options.easing||(c.easing.swing?"swing":"linear");this.pos=c.easing[this.options.specialEasing&&this.options.specialEasing[this.prop]||a](this.state,e,0,1,this.options.duration);this.now=this.start+(this.end-this.start)*this.pos;this.update()}return true}};c.extend(c.fx,{tick:function(){for(var a=c.timers,b=0;b<a.length;b++)a[b]()||a.splice(b--,1);a.length||
+c.fx.stop()},stop:function(){clearInterval(W);W=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){c.style(a.elem,"opacity",a.now)},_default:function(a){if(a.elem.style&&a.elem.style[a.prop]!=null)a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit;else a.elem[a.prop]=a.now}}});if(c.expr&&c.expr.filters)c.expr.filters.animated=function(a){return c.grep(c.timers,function(b){return a===b.elem}).length};c.fn.offset="getBoundingClientRect"in s.documentElement?
+function(a){var b=this[0];if(a)return this.each(function(e){c.offset.setOffset(this,a,e)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);var d=b.getBoundingClientRect(),f=b.ownerDocument;b=f.body;f=f.documentElement;return{top:d.top+(self.pageYOffset||c.support.boxModel&&f.scrollTop||b.scrollTop)-(f.clientTop||b.clientTop||0),left:d.left+(self.pageXOffset||c.support.boxModel&&f.scrollLeft||b.scrollLeft)-(f.clientLeft||b.clientLeft||0)}}:function(a){var b=
+this[0];if(a)return this.each(function(r){c.offset.setOffset(this,a,r)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);c.offset.initialize();var d=b.offsetParent,f=b,e=b.ownerDocument,j,i=e.documentElement,o=e.body;f=(e=e.defaultView)?e.getComputedStyle(b,null):b.currentStyle;for(var k=b.offsetTop,n=b.offsetLeft;(b=b.parentNode)&&b!==o&&b!==i;){if(c.offset.supportsFixedPosition&&f.position==="fixed")break;j=e?e.getComputedStyle(b,null):b.currentStyle;
+k-=b.scrollTop;n-=b.scrollLeft;if(b===d){k+=b.offsetTop;n+=b.offsetLeft;if(c.offset.doesNotAddBorder&&!(c.offset.doesAddBorderForTableAndCells&&/^t(able|d|h)$/i.test(b.nodeName))){k+=parseFloat(j.borderTopWidth)||0;n+=parseFloat(j.borderLeftWidth)||0}f=d;d=b.offsetParent}if(c.offset.subtractsBorderForOverflowNotVisible&&j.overflow!=="visible"){k+=parseFloat(j.borderTopWidth)||0;n+=parseFloat(j.borderLeftWidth)||0}f=j}if(f.position==="relative"||f.position==="static"){k+=o.offsetTop;n+=o.offsetLeft}if(c.offset.supportsFixedPosition&&
+f.position==="fixed"){k+=Math.max(i.scrollTop,o.scrollTop);n+=Math.max(i.scrollLeft,o.scrollLeft)}return{top:k,left:n}};c.offset={initialize:function(){var a=s.body,b=s.createElement("div"),d,f,e,j=parseFloat(c.curCSS(a,"marginTop",true))||0;c.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"});b.innerHTML="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";
+a.insertBefore(b,a.firstChild);d=b.firstChild;f=d.firstChild;e=d.nextSibling.firstChild.firstChild;this.doesNotAddBorder=f.offsetTop!==5;this.doesAddBorderForTableAndCells=e.offsetTop===5;f.style.position="fixed";f.style.top="20px";this.supportsFixedPosition=f.offsetTop===20||f.offsetTop===15;f.style.position=f.style.top="";d.style.overflow="hidden";d.style.position="relative";this.subtractsBorderForOverflowNotVisible=f.offsetTop===-5;this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==j;a.removeChild(b);
+c.offset.initialize=c.noop},bodyOffset:function(a){var b=a.offsetTop,d=a.offsetLeft;c.offset.initialize();if(c.offset.doesNotIncludeMarginInBodyOffset){b+=parseFloat(c.curCSS(a,"marginTop",true))||0;d+=parseFloat(c.curCSS(a,"marginLeft",true))||0}return{top:b,left:d}},setOffset:function(a,b,d){if(/static/.test(c.curCSS(a,"position")))a.style.position="relative";var f=c(a),e=f.offset(),j=parseInt(c.curCSS(a,"top",true),10)||0,i=parseInt(c.curCSS(a,"left",true),10)||0;if(c.isFunction(b))b=b.call(a,
+d,e);d={top:b.top-e.top+j,left:b.left-e.left+i};"using"in b?b.using.call(a,d):f.css(d)}};c.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),d=this.offset(),f=/^body|html$/i.test(b[0].nodeName)?{top:0,left:0}:b.offset();d.top-=parseFloat(c.curCSS(a,"marginTop",true))||0;d.left-=parseFloat(c.curCSS(a,"marginLeft",true))||0;f.top+=parseFloat(c.curCSS(b[0],"borderTopWidth",true))||0;f.left+=parseFloat(c.curCSS(b[0],"borderLeftWidth",true))||0;return{top:d.top-
+f.top,left:d.left-f.left}},offsetParent:function(){return this.map(function(){for(var a=this.offsetParent||s.body;a&&!/^body|html$/i.test(a.nodeName)&&c.css(a,"position")==="static";)a=a.offsetParent;return a})}});c.each(["Left","Top"],function(a,b){var d="scroll"+b;c.fn[d]=function(f){var e=this[0],j;if(!e)return null;if(f!==w)return this.each(function(){if(j=wa(this))j.scrollTo(!a?f:c(j).scrollLeft(),a?f:c(j).scrollTop());else this[d]=f});else return(j=wa(e))?"pageXOffset"in j?j[a?"pageYOffset":
+"pageXOffset"]:c.support.boxModel&&j.document.documentElement[d]||j.document.body[d]:e[d]}});c.each(["Height","Width"],function(a,b){var d=b.toLowerCase();c.fn["inner"+b]=function(){return this[0]?c.css(this[0],d,false,"padding"):null};c.fn["outer"+b]=function(f){return this[0]?c.css(this[0],d,false,f?"margin":"border"):null};c.fn[d]=function(f){var e=this[0];if(!e)return f==null?null:this;if(c.isFunction(f))return this.each(function(j){var i=c(this);i[d](f.call(this,j,i[d]()))});return"scrollTo"in
+e&&e.document?e.document.compatMode==="CSS1Compat"&&e.document.documentElement["client"+b]||e.document.body["client"+b]:e.nodeType===9?Math.max(e.documentElement["client"+b],e.body["scroll"+b],e.documentElement["scroll"+b],e.body["offset"+b],e.documentElement["offset"+b]):f===w?c.css(e,d):this.css(d,typeof f==="string"?f:f+"px")}});A.jQuery=A.$=c})(window);
diff --git a/libs/jquery/original lib/jquery-ui.js b/libs/jquery/original lib/jquery-ui.js
index fc3a87fabe..748776a8b0 100644
--- a/libs/jquery/original lib/jquery-ui.js
+++ b/libs/jquery/original lib/jquery-ui.js
@@ -1,7 +1,7 @@
-/*
- * jQuery UI 1.7.2
+/*!
+ * jQuery UI 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
@@ -9,12 +9,9 @@
*/
;jQuery.ui || (function($) {
-var _remove = $.fn.remove,
- isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9);
-
//Helper functions and ui object
$.ui = {
- version: "1.7.2",
+ version: "1.8.1",
// $.ui.plugin is deprecated. Use the proxy pattern instead.
plugin: {
@@ -73,6 +70,7 @@ $.ui = {
},
keyCode: {
+ ALT: 18,
BACKSPACE: 8,
CAPS_LOCK: 20,
COMMA: 188,
@@ -102,60 +100,31 @@ $.ui = {
}
};
-// WAI-ARIA normalization
-if (isFF2) {
- var attr = $.attr,
- removeAttr = $.fn.removeAttr,
- ariaNS = "http://www.w3.org/2005/07/aaa",
- ariaState = /^aria-/,
- ariaRole = /^wairole:/;
-
- $.attr = function(elem, name, value) {
- var set = value !== undefined;
-
- return (name == 'role'
- ? (set
- ? attr.call(this, elem, name, "wairole:" + value)
- : (attr.apply(this, arguments) || "").replace(ariaRole, ""))
- : (ariaState.test(name)
- ? (set
- ? elem.setAttributeNS(ariaNS,
- name.replace(ariaState, "aaa:"), value)
- : attr.call(this, elem, name.replace(ariaState, "aaa:")))
- : attr.apply(this, arguments)));
- };
-
- $.fn.removeAttr = function(name) {
- return (ariaState.test(name)
- ? this.each(function() {
- this.removeAttributeNS(ariaNS, name.replace(ariaState, ""));
- }) : removeAttr.call(this, name));
- };
-}
-
//jQuery plugins
$.fn.extend({
- remove: function() {
- // Safari has a native remove event which actually removes DOM elements,
- // so we have to use triggerHandler instead of trigger (#3037).
- $("*", this).add(this).each(function() {
- $(this).triggerHandler("remove");
- });
- return _remove.apply(this, arguments );
+ _focus: $.fn.focus,
+ focus: function(delay, fn) {
+ return typeof delay === 'number'
+ ? this.each(function() {
+ var elem = this;
+ setTimeout(function() {
+ $(elem).focus();
+ (fn && fn.call(elem));
+ }, delay);
+ })
+ : this._focus.apply(this, arguments);
},
-
+
enableSelection: function() {
return this
.attr('unselectable', 'off')
- .css('MozUserSelect', '')
- .unbind('selectstart.ui');
+ .css('MozUserSelect', '');
},
disableSelection: function() {
return this
.attr('unselectable', 'on')
- .css('MozUserSelect', 'none')
- .bind('selectstart.ui', function() { return false; });
+ .css('MozUserSelect', 'none');
},
scrollParent: function() {
@@ -171,6 +140,36 @@ $.fn.extend({
}
return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+ },
+
+ zIndex: function(zIndex) {
+ if (zIndex !== undefined) {
+ return this.css('zIndex', zIndex);
+ }
+
+ if (this.length) {
+ var elem = $(this[0]), position, value;
+ while (elem.length && elem[0] !== document) {
+ // Ignore z-index if position is set to a value where z-index is ignored by the browser
+ // This makes behavior of this function consistent across browsers
+ // WebKit always returns auto if the element is positioned
+ position = elem.css('position');
+ if (position == 'absolute' || position == 'relative' || position == 'fixed')
+ {
+ // IE returns 0 when zIndex is not specified
+ // other browsers return a string
+ // we ignore the case of nested elements with an explicit value of 0
+ // <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+ value = parseInt(elem.css('zIndex'));
+ if (!isNaN(value) && value != 0) {
+ return value;
+ }
+ }
+ elem = elem.parent();
+ }
+ }
+
+ return 0;
}
});
@@ -200,176 +199,263 @@ $.extend($.expr[':'], {
}
});
+})(jQuery);
+/*!
+ * jQuery UI Widget 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function( $ ) {
-// $.widget is a factory to create jQuery plugins
-// taking some boilerplate code out of the plugin code
-function getter(namespace, plugin, method, args) {
- function getMethods(type) {
- var methods = $[namespace][plugin][type] || [];
- return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods);
- }
+var _remove = $.fn.remove;
- var methods = getMethods('getter');
- if (args.length == 1 && typeof args[0] == 'string') {
- methods = methods.concat(getMethods('getterSetter'));
- }
- return ($.inArray(method, methods) != -1);
-}
+$.fn.remove = function( selector, keepData ) {
+ return this.each(function() {
+ if ( !keepData ) {
+ if ( !selector || $.filter( selector, [ this ] ).length ) {
+ $( "*", this ).add( this ).each(function() {
+ $( this ).triggerHandler( "remove" );
+ });
+ }
+ }
+ return _remove.call( $(this), selector, keepData );
+ });
+};
-$.widget = function(name, prototype) {
- var namespace = name.split(".")[0];
- name = name.split(".")[1];
+$.widget = function( name, base, prototype ) {
+ var namespace = name.split( "." )[ 0 ],
+ fullName;
+ name = name.split( "." )[ 1 ];
+ fullName = namespace + "-" + name;
- // create plugin method
- $.fn[name] = function(options) {
- var isMethodCall = (typeof options == 'string'),
- args = Array.prototype.slice.call(arguments, 1);
+ if ( !prototype ) {
+ prototype = base;
+ base = $.Widget;
+ }
- // prevent calls to internal methods
- if (isMethodCall && options.substring(0, 1) == '_') {
- return this;
- }
+ // create selector for plugin
+ $.expr[ ":" ][ fullName ] = function( elem ) {
+ return !!$.data( elem, name );
+ };
- // handle getter methods
- if (isMethodCall && getter(namespace, name, options, args)) {
- var instance = $.data(this[0], name);
- return (instance ? instance[options].apply(instance, args)
- : undefined);
+ $[ namespace ] = $[ namespace ] || {};
+ $[ namespace ][ name ] = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
}
+ };
- // handle initialization and non-getter methods
- return this.each(function() {
- var instance = $.data(this, name);
-
- // constructor
- (!instance && !isMethodCall &&
- $.data(this, name, new $[namespace][name](this, options))._init());
+ var basePrototype = new base();
+ // we need to make the options hash a property directly on the new instance
+ // otherwise we'll modify the options hash on the prototype that we're
+ // inheriting from
+// $.each( basePrototype, function( key, val ) {
+// if ( $.isPlainObject(val) ) {
+// basePrototype[ key ] = $.extend( {}, val );
+// }
+// });
+ basePrototype.options = $.extend( {}, basePrototype.options );
+ $[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+ namespace: namespace,
+ widgetName: name,
+ widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
+ widgetBaseClass: fullName
+ }, prototype );
+
+ $.widget.bridge( name, $[ namespace ][ name ] );
+};
- // method call
- (instance && isMethodCall && $.isFunction(instance[options]) &&
- instance[options].apply(instance, args));
- });
- };
+$.widget.bridge = function( name, object ) {
+ $.fn[ name ] = function( options ) {
+ var isMethodCall = typeof options === "string",
+ args = Array.prototype.slice.call( arguments, 1 ),
+ returnValue = this;
- // create widget constructor
- $[namespace] = $[namespace] || {};
- $[namespace][name] = function(element, options) {
- var self = this;
+ // allow multiple hashes to be passed on init
+ options = !isMethodCall && args.length ?
+ $.extend.apply( null, [ true, options ].concat(args) ) :
+ options;
- this.namespace = namespace;
- this.widgetName = name;
- this.widgetEventPrefix = $[namespace][name].eventPrefix || name;
- this.widgetBaseClass = namespace + '-' + name;
-
- this.options = $.extend({},
- $.widget.defaults,
- $[namespace][name].defaults,
- $.metadata && $.metadata.get(element)[name],
- options);
-
- this.element = $(element)
- .bind('setData.' + name, function(event, key, value) {
- if (event.target == element) {
- return self._setData(key, value);
+ // prevent calls to internal methods
+ if ( isMethodCall && options.substring( 0, 1 ) === "_" ) {
+ return returnValue;
+ }
+
+ if ( isMethodCall ) {
+ this.each(function() {
+ var instance = $.data( this, name ),
+ methodValue = instance && $.isFunction( instance[options] ) ?
+ instance[ options ].apply( instance, args ) :
+ instance;
+ if ( methodValue !== instance && methodValue !== undefined ) {
+ returnValue = methodValue;
+ return false;
}
- })
- .bind('getData.' + name, function(event, key) {
- if (event.target == element) {
- return self._getData(key);
+ });
+ } else {
+ this.each(function() {
+ var instance = $.data( this, name );
+ if ( instance ) {
+ if ( options ) {
+ instance.option( options );
+ }
+ instance._init();
+ } else {
+ $.data( this, name, new object( options, this ) );
}
- })
- .bind('remove', function() {
- return self.destroy();
});
- };
+ }
- // add widget prototype
- $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype);
+ return returnValue;
+ };
+};
- // TODO: merge getter and getterSetter properties from widget prototype
- // and plugin prototype
- $[namespace][name].getterSetter = 'option';
+$.Widget = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
};
-$.widget.prototype = {
+$.Widget.prototype = {
+ widgetName: "widget",
+ widgetEventPrefix: "",
+ options: {
+ disabled: false
+ },
+ _createWidget: function( options, element ) {
+ // $.widget.bridge stores the plugin instance, but we do it anyway
+ // so that it's stored even before the _create function runs
+ this.element = $( element ).data( this.widgetName, this );
+ this.options = $.extend( true, {},
+ this.options,
+ $.metadata && $.metadata.get( element )[ this.widgetName ],
+ options );
+
+ var self = this;
+ this.element.bind( "remove." + this.widgetName, function() {
+ self.destroy();
+ });
+
+ this._create();
+ this._init();
+ },
+ _create: function() {},
_init: function() {},
+
destroy: function() {
- this.element.removeData(this.widgetName)
- .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled')
- .removeAttr('aria-disabled');
+ this.element
+ .unbind( "." + this.widgetName )
+ .removeData( this.widgetName );
+ this.widget()
+ .unbind( "." + this.widgetName )
+ .removeAttr( "aria-disabled" )
+ .removeClass(
+ this.widgetBaseClass + "-disabled " +
+ "ui-state-disabled" );
+ },
+
+ widget: function() {
+ return this.element;
},
- option: function(key, value) {
+ option: function( key, value ) {
var options = key,
self = this;
- if (typeof key == "string") {
- if (value === undefined) {
- return this._getData(key);
+ if ( arguments.length === 0 ) {
+ // don't return a reference to the internal hash
+ return $.extend( {}, self.options );
+ }
+
+ if (typeof key === "string" ) {
+ if ( value === undefined ) {
+ return this.options[ key ];
}
options = {};
- options[key] = value;
+ options[ key ] = value;
}
- $.each(options, function(key, value) {
- self._setData(key, value);
+ $.each( options, function( key, value ) {
+ self._setOption( key, value );
});
+
+ return self;
},
- _getData: function(key) {
- return this.options[key];
- },
- _setData: function(key, value) {
- this.options[key] = value;
+ _setOption: function( key, value ) {
+ this.options[ key ] = value;
- if (key == 'disabled') {
- this.element
- [value ? 'addClass' : 'removeClass'](
- this.widgetBaseClass + '-disabled' + ' ' +
- this.namespace + '-state-disabled')
- .attr("aria-disabled", value);
+ if ( key === "disabled" ) {
+ this.widget()
+ [ value ? "addClass" : "removeClass"](
+ this.widgetBaseClass + "-disabled" + " " +
+ "ui-state-disabled" )
+ .attr( "aria-disabled", value );
}
+
+ return this;
},
enable: function() {
- this._setData('disabled', false);
+ return this._setOption( "disabled", false );
},
disable: function() {
- this._setData('disabled', true);
+ return this._setOption( "disabled", true );
},
- _trigger: function(type, event, data) {
- var callback = this.options[type],
- eventName = (type == this.widgetEventPrefix
- ? type : this.widgetEventPrefix + type);
+ _trigger: function( type, event, data ) {
+ var callback = this.options[ type ];
- event = $.Event(event);
- event.type = eventName;
+ event = $.Event( event );
+ event.type = ( type === this.widgetEventPrefix ?
+ type :
+ this.widgetEventPrefix + type ).toLowerCase();
+ data = data || {};
// copy original event properties over to the new event
// this would happen if we could call $.event.fix instead of $.Event
// but we don't have a way to force an event to be fixed multiple times
- if (event.originalEvent) {
- for (var i = $.event.props.length, prop; i;) {
- prop = $.event.props[--i];
- event[prop] = event.originalEvent[prop];
+ if ( event.originalEvent ) {
+ for ( var i = $.event.props.length, prop; i; ) {
+ prop = $.event.props[ --i ];
+ event[ prop ] = event.originalEvent[ prop ];
}
}
- this.element.trigger(event, data);
+ this.element.trigger( event, data );
- return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false
- || event.isDefaultPrevented());
+ return !( $.isFunction(callback) &&
+ callback.call( this.element[0], event, data ) === false ||
+ event.isDefaultPrevented() );
}
};
-$.widget.defaults = {
- disabled: false
-};
-
-
-/** Mouse Interaction Plugin **/
+})( jQuery );
+/*!
+ * jQuery UI Mouse 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ */
+(function($) {
-$.ui.mouse = {
+$.widget("ui.mouse", {
+ options: {
+ cancel: ':input,option',
+ distance: 1,
+ delay: 0
+ },
_mouseInit: function() {
var self = this;
@@ -385,12 +471,6 @@ $.ui.mouse = {
}
});
- // Prevent text selection in IE
- if ($.browser.msie) {
- this._mouseUnselectable = this.element.attr('unselectable');
- this.element.attr('unselectable', 'on');
- }
-
this.started = false;
},
@@ -398,10 +478,6 @@ $.ui.mouse = {
// other instances of mouse
_mouseDestroy: function() {
this.element.unbind('.'+this.widgetName);
-
- // Restore text selection in IE
- ($.browser.msie
- && this.element.attr('unselectable', this._mouseUnselectable));
},
_mouseDown: function(event) {
@@ -508,32 +584,287 @@ $.ui.mouse = {
_mouseDrag: function(event) {},
_mouseStop: function(event) {},
_mouseCapture: function(event) { return true; }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Position 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function( $ ) {
+
+$.ui = $.ui || {};
+
+var horizontalPositions = /left|center|right/,
+ horizontalDefault = "center",
+ verticalPositions = /top|center|bottom/,
+ verticalDefault = "center",
+ _position = $.fn.position,
+ _offset = $.fn.offset;
+
+$.fn.position = function( options ) {
+ if ( !options || !options.of ) {
+ return _position.apply( this, arguments );
+ }
+
+ // make a copy, we don't want to modify arguments
+ options = $.extend( {}, options );
+
+ var target = $( options.of ),
+ collision = ( options.collision || "flip" ).split( " " ),
+ offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
+ targetWidth,
+ targetHeight,
+ basePosition;
+
+ if ( options.of.nodeType === 9 ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: 0, left: 0 };
+ } else if ( options.of.scrollTo && options.of.document ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
+ } else if ( options.of.preventDefault ) {
+ // force left top to allow flipping
+ options.at = "left top";
+ targetWidth = targetHeight = 0;
+ basePosition = { top: options.of.pageY, left: options.of.pageX };
+ } else {
+ targetWidth = target.outerWidth();
+ targetHeight = target.outerHeight();
+ basePosition = target.offset();
+ }
+
+ // force my and at to have valid horizontal and veritcal positions
+ // if a value is missing or invalid, it will be converted to center
+ $.each( [ "my", "at" ], function() {
+ var pos = ( options[this] || "" ).split( " " );
+ if ( pos.length === 1) {
+ pos = horizontalPositions.test( pos[0] ) ?
+ pos.concat( [verticalDefault] ) :
+ verticalPositions.test( pos[0] ) ?
+ [ horizontalDefault ].concat( pos ) :
+ [ horizontalDefault, verticalDefault ];
+ }
+ pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : horizontalDefault;
+ pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : verticalDefault;
+ options[ this ] = pos;
+ });
+
+ // normalize collision option
+ if ( collision.length === 1 ) {
+ collision[ 1 ] = collision[ 0 ];
+ }
+
+ // normalize offset option
+ offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
+ if ( offset.length === 1 ) {
+ offset[ 1 ] = offset[ 0 ];
+ }
+ offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
+
+ if ( options.at[0] === "right" ) {
+ basePosition.left += targetWidth;
+ } else if (options.at[0] === horizontalDefault ) {
+ basePosition.left += targetWidth / 2;
+ }
+
+ if ( options.at[1] === "bottom" ) {
+ basePosition.top += targetHeight;
+ } else if ( options.at[1] === verticalDefault ) {
+ basePosition.top += targetHeight / 2;
+ }
+
+ basePosition.left += offset[ 0 ];
+ basePosition.top += offset[ 1 ];
+
+ return this.each(function() {
+ var elem = $( this ),
+ elemWidth = elem.outerWidth(),
+ elemHeight = elem.outerHeight(),
+ position = $.extend( {}, basePosition );
+
+ if ( options.my[0] === "right" ) {
+ position.left -= elemWidth;
+ } else if ( options.my[0] === horizontalDefault ) {
+ position.left -= elemWidth / 2;
+ }
+
+ if ( options.my[1] === "bottom" ) {
+ position.top -= elemHeight;
+ } else if ( options.my[1] === verticalDefault ) {
+ position.top -= elemHeight / 2;
+ }
+
+ // prevent fractions (see #5280)
+ position.left = parseInt( position.left );
+ position.top = parseInt( position.top );
+
+ $.each( [ "left", "top" ], function( i, dir ) {
+ if ( $.ui.position[ collision[i] ] ) {
+ $.ui.position[ collision[i] ][ dir ]( position, {
+ targetWidth: targetWidth,
+ targetHeight: targetHeight,
+ elemWidth: elemWidth,
+ elemHeight: elemHeight,
+ offset: offset,
+ my: options.my,
+ at: options.at
+ });
+ }
+ });
+
+ if ( $.fn.bgiframe ) {
+ elem.bgiframe();
+ }
+ elem.offset( $.extend( position, { using: options.using } ) );
+ });
};
-$.ui.mouse.defaults = {
- cancel: null,
- distance: 1,
- delay: 0
+$.ui.position = {
+ fit: {
+ left: function( position, data ) {
+ var win = $( window ),
+ over = position.left + data.elemWidth - win.width() - win.scrollLeft();
+ position.left = over > 0 ? position.left - over : Math.max( 0, position.left );
+ },
+ top: function( position, data ) {
+ var win = $( window ),
+ over = position.top + data.elemHeight - win.height() - win.scrollTop();
+ position.top = over > 0 ? position.top - over : Math.max( 0, position.top );
+ }
+ },
+
+ flip: {
+ left: function( position, data ) {
+ if ( data.at[0] === "center" ) {
+ return;
+ }
+ var win = $( window ),
+ over = position.left + data.elemWidth - win.width() - win.scrollLeft(),
+ myOffset = data.my[ 0 ] === "left" ?
+ -data.elemWidth :
+ data.my[ 0 ] === "right" ?
+ data.elemWidth :
+ 0,
+ offset = -2 * data.offset[ 0 ];
+ position.left += position.left < 0 ?
+ myOffset + data.targetWidth + offset :
+ over > 0 ?
+ myOffset - data.targetWidth + offset :
+ 0;
+ },
+ top: function( position, data ) {
+ if ( data.at[1] === "center" ) {
+ return;
+ }
+ var win = $( window ),
+ over = position.top + data.elemHeight - win.height() - win.scrollTop(),
+ myOffset = data.my[ 1 ] === "top" ?
+ -data.elemHeight :
+ data.my[ 1 ] === "bottom" ?
+ data.elemHeight :
+ 0,
+ atOffset = data.at[ 1 ] === "top" ?
+ data.targetHeight :
+ -data.targetHeight,
+ offset = -2 * data.offset[ 1 ];
+ position.top += position.top < 0 ?
+ myOffset + data.targetHeight + offset :
+ over > 0 ?
+ myOffset + atOffset + offset :
+ 0;
+ }
+ }
};
-})(jQuery);
+// offset setter from jQuery 1.4
+if ( !$.offset.setOffset ) {
+ $.offset.setOffset = function( elem, options ) {
+ // set position first, in-case top/left are set even on static elem
+ if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
+ elem.style.position = "relative";
+ }
+ var curElem = $( elem ),
+ curOffset = curElem.offset(),
+ curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0,
+ curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0,
+ props = {
+ top: (options.top - curOffset.top) + curTop,
+ left: (options.left - curOffset.left) + curLeft
+ };
+
+ if ( 'using' in options ) {
+ options.using.call( elem, props );
+ } else {
+ curElem.css( props );
+ }
+ };
+
+ $.fn.offset = function( options ) {
+ var elem = this[ 0 ];
+ if ( !elem || !elem.ownerDocument ) { return null; }
+ if ( options ) {
+ return this.each(function() {
+ $.offset.setOffset( this, options );
+ });
+ }
+ return _offset.call( this );
+ };
+}
+
+}( jQuery ));
/*
- * jQuery UI Draggable 1.7.2
+ * jQuery UI Draggable 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
* http://docs.jquery.com/UI/Draggables
*
* Depends:
- * ui.core.js
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
*/
(function($) {
-$.widget("ui.draggable", $.extend({}, $.ui.mouse, {
-
- _init: function() {
+$.widget("ui.draggable", $.ui.mouse, {
+ widgetEventPrefix: "drag",
+ options: {
+ addClasses: true,
+ appendTo: "parent",
+ axis: false,
+ connectToSortable: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false
+ },
+ _create: function() {
if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
this.element[0].style.position = 'relative';
@@ -554,12 +885,15 @@ $.widget("ui.draggable", $.extend({}, $.ui.mouse, {
+ " ui-draggable-dragging"
+ " ui-draggable-disabled");
this._mouseDestroy();
+
+ return this;
},
_mouseCapture: function(event) {
var o = this.options;
+ // among others, prevent a drag on a resizable-handle
if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
return false;
@@ -599,7 +933,7 @@ $.widget("ui.draggable", $.extend({}, $.ui.mouse, {
this.scrollParent = this.helper.scrollParent();
//The element's absolute position on the page minus margins
- this.offset = this.element.offset();
+ this.offset = this.positionAbs = this.element.offset();
this.offset = {
top: this.offset.top - this.margins.top,
left: this.offset.left - this.margins.left
@@ -615,20 +949,22 @@ $.widget("ui.draggable", $.extend({}, $.ui.mouse, {
});
//Generate the original position
- this.originalPosition = this._generatePosition(event);
+ this.originalPosition = this.position = this._generatePosition(event);
this.originalPageX = event.pageX;
this.originalPageY = event.pageY;
//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
- if(o.cursorAt)
- this._adjustOffsetFromHelper(o.cursorAt);
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
//Set a containment if given in the options
if(o.containment)
this._setContainment();
- //Call plugins and callbacks
- this._trigger("start", event);
+ //Trigger event + callbacks
+ if(this._trigger("start", event) === false) {
+ this._clear();
+ return false;
+ }
//Recache the helper size
this._cacheHelperProportions();
@@ -651,7 +987,10 @@ $.widget("ui.draggable", $.extend({}, $.ui.mouse, {
//Call plugins and callbacks and use the resulting position if something is returned
if (!noPropagation) {
var ui = this._uiHash();
- this._trigger('drag', event, ui);
+ if(this._trigger('drag', event, ui) === false) {
+ this._mouseUp({});
+ return false;
+ }
this.position = ui.position;
}
@@ -674,20 +1013,38 @@ $.widget("ui.draggable", $.extend({}, $.ui.mouse, {
dropped = this.dropped;
this.dropped = false;
}
+
+ //if the original element is removed, don't bother to continue
+ if(!this.element[0] || !this.element[0].parentNode)
+ return false;
if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
var self = this;
$(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
- self._trigger("stop", event);
- self._clear();
+ if(self._trigger("stop", event) !== false) {
+ self._clear();
+ }
});
} else {
- this._trigger("stop", event);
- this._clear();
+ if(this._trigger("stop", event) !== false) {
+ this._clear();
+ }
}
return false;
},
+
+ cancel: function() {
+
+ if(this.helper.is(".ui-draggable-dragging")) {
+ this._mouseUp({});
+ } else {
+ this._clear();
+ }
+
+ return this;
+
+ },
_getHandle: function(event) {
@@ -719,10 +1076,24 @@ $.widget("ui.draggable", $.extend({}, $.ui.mouse, {
},
_adjustOffsetFromHelper: function(obj) {
- if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
- if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
- if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
- if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
},
_getParentOffset: function() {
@@ -818,13 +1189,13 @@ $.widget("ui.draggable", $.extend({}, $.ui.mouse, {
pos.top // The absolute mouse position
+ this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
),
left: (
pos.left // The absolute mouse position
+ this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
)
};
@@ -833,15 +1204,6 @@ $.widget("ui.draggable", $.extend({}, $.ui.mouse, {
_generatePosition: function(event) {
var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-
- // This is another very weird special case that only happens for relative elements:
- // 1. If the css position is relative
- // 2. and the scroll parent is the document or similar to the offset parent
- // we have to refresh the relative offset during the scroll so there are no jumps
- if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
- this.offset.relative = this._getRelativeOffset();
- }
-
var pageX = event.pageX;
var pageY = event.pageY;
@@ -875,14 +1237,14 @@ $.widget("ui.draggable", $.extend({}, $.ui.mouse, {
- this.offset.click.top // Click offset (relative to the element)
- this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
- this.offset.parent.top // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
),
left: (
pageX // The absolute mouse position
- this.offset.click.left // Click offset (relative to the element)
- this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
- this.offset.parent.left // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
)
};
@@ -902,7 +1264,7 @@ $.widget("ui.draggable", $.extend({}, $.ui.mouse, {
ui = ui || this._uiHash();
$.ui.plugin.call(this, type, [event, ui]);
if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
- return $.widget.prototype._trigger.call(this, type, event, ui);
+ return $.Widget.prototype._trigger.call(this, type, event, ui);
},
plugins: {},
@@ -911,45 +1273,15 @@ $.widget("ui.draggable", $.extend({}, $.ui.mouse, {
return {
helper: this.helper,
position: this.position,
- absolutePosition: this.positionAbs, //deprecated
+ originalPosition: this.originalPosition,
offset: this.positionAbs
};
}
-}));
+});
$.extend($.ui.draggable, {
- version: "1.7.2",
- eventPrefix: "drag",
- defaults: {
- addClasses: true,
- appendTo: "parent",
- axis: false,
- cancel: ":input,option",
- connectToSortable: false,
- containment: false,
- cursor: "auto",
- cursorAt: false,
- delay: 0,
- distance: 1,
- grid: false,
- handle: false,
- helper: "original",
- iframeFix: false,
- opacity: false,
- refreshPositions: false,
- revert: false,
- revertDuration: 500,
- scope: "default",
- scroll: true,
- scrollSensitivity: 20,
- scrollSpeed: 20,
- snap: false,
- snapMode: "both",
- snapTolerance: 20,
- stack: false,
- zIndex: false
- }
+ version: "1.8.1"
});
$.ui.plugin.add("draggable", "connectToSortable", {
@@ -1019,12 +1351,12 @@ $.ui.plugin.add("draggable", "connectToSortable", {
};
$.each(inst.sortables, function(i) {
-
+
//Copy over some variables to allow calling the sortable's native _intersectsWith
this.instance.positionAbs = inst.positionAbs;
this.instance.helperProportions = inst.helperProportions;
this.instance.offset.click = inst.offset.click;
-
+
if(this.instance._intersectsWith(this.instance.containerCache)) {
//If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
@@ -1067,13 +1399,13 @@ $.ui.plugin.add("draggable", "connectToSortable", {
this.instance.isOver = 0;
this.instance.cancelHelperRemoval = true;
-
+
//Prevent reverting on this forced stop
this.instance.options.revert = false;
-
+
// The out event needs to be triggered independently
this.instance._trigger('out', event, this.instance._uiHash(this.instance));
-
+
this.instance._mouseStop(event, true);
this.instance.options.helper = this.instance.options._helper;
@@ -1257,15 +1589,17 @@ $.ui.plugin.add("draggable", "stack", {
var o = $(this).data("draggable").options;
- var group = $.makeArray($(o.stack.group)).sort(function(a,b) {
- return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min);
+ var group = $.makeArray($(o.stack)).sort(function(a,b) {
+ return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
});
-
+ if (!group.length) { return; }
+
+ var min = parseInt(group[0].style.zIndex) || 0;
$(group).each(function(i) {
- this.style.zIndex = o.stack.min + i;
+ this.style.zIndex = min + i;
});
- this[0].style.zIndex = o.stack.min + group.length;
+ this[0].style.zIndex = min + group.length;
}
});
@@ -1284,28 +1618,39 @@ $.ui.plugin.add("draggable", "zIndex", {
})(jQuery);
/*
- * jQuery UI Droppable 1.7.2
+ * jQuery UI Droppable 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
* http://docs.jquery.com/UI/Droppables
*
* Depends:
- * ui.core.js
- * ui.draggable.js
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.mouse.js
+ * jquery.ui.draggable.js
*/
(function($) {
$.widget("ui.droppable", {
-
- _init: function() {
+ widgetEventPrefix: "drop",
+ options: {
+ accept: '*',
+ activeClass: false,
+ addClasses: true,
+ greedy: false,
+ hoverClass: false,
+ scope: 'default',
+ tolerance: 'intersect'
+ },
+ _create: function() {
var o = this.options, accept = o.accept;
this.isover = 0; this.isout = 1;
- this.options.accept = this.options.accept && $.isFunction(this.options.accept) ? this.options.accept : function(d) {
+ this.accept = $.isFunction(accept) ? accept : function(d) {
return d.is(accept);
};
@@ -1313,10 +1658,10 @@ $.widget("ui.droppable", {
this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
// Add the reference and positions to the manager
- $.ui.ddmanager.droppables[this.options.scope] = $.ui.ddmanager.droppables[this.options.scope] || [];
- $.ui.ddmanager.droppables[this.options.scope].push(this);
+ $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
+ $.ui.ddmanager.droppables[o.scope].push(this);
- (this.options.addClasses && this.element.addClass("ui-droppable"));
+ (o.addClasses && this.element.addClass("ui-droppable"));
},
@@ -1330,18 +1675,18 @@ $.widget("ui.droppable", {
.removeClass("ui-droppable ui-droppable-disabled")
.removeData("droppable")
.unbind(".droppable");
+
+ return this;
},
- _setData: function(key, value) {
+ _setOption: function(key, value) {
if(key == 'accept') {
- this.options.accept = value && $.isFunction(value) ? value : function(d) {
+ this.accept = $.isFunction(value) ? value : function(d) {
return d.is(value);
};
- } else {
- $.widget.prototype._setData.apply(this, arguments);
}
-
+ $.Widget.prototype._setOption.apply(this, arguments);
},
_activate: function(event) {
@@ -1361,7 +1706,7 @@ $.widget("ui.droppable", {
var draggable = $.ui.ddmanager.current;
if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
- if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
this._trigger('over', event, this.ui(draggable));
}
@@ -1373,7 +1718,7 @@ $.widget("ui.droppable", {
var draggable = $.ui.ddmanager.current;
if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
- if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
this._trigger('out', event, this.ui(draggable));
}
@@ -1388,13 +1733,17 @@ $.widget("ui.droppable", {
var childrenIntersection = false;
this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
var inst = $.data(this, 'droppable');
- if(inst.options.greedy && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)) {
- childrenIntersection = true; return false;
- }
+ if(
+ inst.options.greedy
+ && !inst.options.disabled
+ && inst.options.scope == draggable.options.scope
+ && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
+ && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
+ ) { childrenIntersection = true; return false; }
});
if(childrenIntersection) return false;
- if(this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
this._trigger('drop', event, this.ui(draggable));
@@ -1410,7 +1759,6 @@ $.widget("ui.droppable", {
draggable: (c.currentItem || c.element),
helper: c.helper,
position: c.position,
- absolutePosition: c.positionAbs, //deprecated
offset: c.positionAbs
};
}
@@ -1418,17 +1766,7 @@ $.widget("ui.droppable", {
});
$.extend($.ui.droppable, {
- version: "1.7.2",
- eventPrefix: 'drop',
- defaults: {
- accept: '*',
- activeClass: false,
- addClasses: true,
- greedy: false,
- hoverClass: false,
- scope: 'default',
- tolerance: 'intersect'
- }
+ version: "1.8.1"
});
$.ui.intersect = function(draggable, droppable, toleranceMode) {
@@ -1483,13 +1821,13 @@ $.ui.ddmanager = {
droppables: { 'default': [] },
prepareOffsets: function(t, event) {
- var m = $.ui.ddmanager.droppables[t.options.scope];
+ var m = $.ui.ddmanager.droppables[t.options.scope] || [];
var type = event ? event.type : null; // workaround for #2317
var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
droppablesLoop: for (var i = 0; i < m.length; i++) {
- if(m[i].options.disabled || (t && !m[i].options.accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
+ if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
@@ -1504,13 +1842,13 @@ $.ui.ddmanager = {
drop: function(draggable, event) {
var dropped = false;
- $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
if(!this.options) return;
if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
- dropped = this._drop.call(this, event);
+ dropped = dropped || this._drop.call(this, event);
- if (!this.options.disabled && this.visible && this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
this.isout = 1; this.isover = 0;
this._deactivate.call(this, event);
}
@@ -1525,8 +1863,7 @@ $.ui.ddmanager = {
if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
//Run through all droppables and check their positions based on specific tolerance options
-
- $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
if(this.options.disabled || this.greedyChild || !this.visible) return;
var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
@@ -1566,22 +1903,42 @@ $.ui.ddmanager = {
})(jQuery);
/*
- * jQuery UI Resizable 1.7.2
+ * jQuery UI Resizable 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
* http://docs.jquery.com/UI/Resizables
*
* Depends:
- * ui.core.js
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
*/
(function($) {
-$.widget("ui.resizable", $.extend({}, $.ui.mouse, {
-
- _init: function() {
+$.widget("ui.resizable", $.ui.mouse, {
+ widgetEventPrefix: "resize",
+ options: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ containment: false,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ zIndex: 1000
+ },
+ _create: function() {
var self = this, o = this.options;
this.element.addClass("ui-resizable");
@@ -1752,7 +2109,7 @@ $.widget("ui.resizable", $.extend({}, $.ui.mouse, {
if (this.elementIsWrapper) {
_destroy(this.element);
var wrapper = this.element;
- wrapper.parent().append(
+ wrapper.after(
this.originalElement.css({
position: wrapper.css('position'),
width: wrapper.outerWidth(),
@@ -1760,23 +2117,24 @@ $.widget("ui.resizable", $.extend({}, $.ui.mouse, {
top: wrapper.css('top'),
left: wrapper.css('left')
})
- ).end().remove();
+ ).remove();
}
this.originalElement.css('resize', this.originalResizeStyle);
_destroy(this.originalElement);
+ return this;
},
_mouseCapture: function(event) {
-
var handle = false;
- for(var i in this.handles) {
- if($(this.handles[i])[0] == event.target) handle = true;
+ for (var i in this.handles) {
+ if ($(this.handles[i])[0] == event.target) {
+ handle = true;
+ }
}
- return this.options.disabled || !!handle;
-
+ return !this.options.disabled && handle;
},
_mouseStart: function(event) {
@@ -2062,32 +2420,10 @@ $.widget("ui.resizable", $.extend({}, $.ui.mouse, {
};
}
-}));
+});
$.extend($.ui.resizable, {
- version: "1.7.2",
- eventPrefix: "resize",
- defaults: {
- alsoResize: false,
- animate: false,
- animateDuration: "slow",
- animateEasing: "swing",
- aspectRatio: false,
- autoHide: false,
- cancel: ":input,option",
- containment: false,
- delay: 0,
- distance: 1,
- ghost: false,
- grid: false,
- handles: "e,s,se",
- helper: false,
- maxHeight: null,
- maxWidth: null,
- minHeight: 10,
- minWidth: 10,
- zIndex: 1000
- }
+ version: "1.8.1"
});
/*
@@ -2100,7 +2436,7 @@ $.ui.plugin.add("resizable", "alsoResize", {
var self = $(this).data("resizable"), o = self.options;
- _store = function(exp) {
+ var _store = function(exp) {
$(exp).each(function() {
$(this).data("resizable-alsoresize", {
width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
@@ -2366,22 +2702,30 @@ var isNumber = function(value) {
})(jQuery);
/*
- * jQuery UI Selectable 1.7.2
+ * jQuery UI Selectable 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
* http://docs.jquery.com/UI/Selectables
*
* Depends:
- * ui.core.js
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
*/
(function($) {
-$.widget("ui.selectable", $.extend({}, $.ui.mouse, {
-
- _init: function() {
+$.widget("ui.selectable", $.ui.mouse, {
+ options: {
+ appendTo: 'body',
+ autoRefresh: true,
+ distance: 0,
+ filter: '*',
+ tolerance: 'touch'
+ },
+ _create: function() {
var self = this;
this.element.addClass("ui-selectable");
@@ -2421,11 +2765,16 @@ $.widget("ui.selectable", $.extend({}, $.ui.mouse, {
},
destroy: function() {
+ this.selectees
+ .removeClass("ui-selectee")
+ .removeData("selectable-item");
this.element
.removeClass("ui-selectable ui-selectable-disabled")
.removeData("selectable")
.unbind(".selectable");
this._mouseDestroy();
+
+ return this;
},
_mouseStart: function(event) {
@@ -2606,38 +2955,56 @@ $.widget("ui.selectable", $.extend({}, $.ui.mouse, {
return false;
}
-}));
+});
$.extend($.ui.selectable, {
- version: "1.7.2",
- defaults: {
- appendTo: 'body',
- autoRefresh: true,
- cancel: ":input,option",
- delay: 0,
- distance: 0,
- filter: '*',
- tolerance: 'touch'
- }
+ version: "1.8.1"
});
})(jQuery);
/*
- * jQuery UI Sortable 1.7.2
+ * jQuery UI Sortable 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
* http://docs.jquery.com/UI/Sortables
*
* Depends:
- * ui.core.js
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
*/
(function($) {
-$.widget("ui.sortable", $.extend({}, $.ui.mouse, {
- _init: function() {
+$.widget("ui.sortable", $.ui.mouse, {
+ widgetEventPrefix: "sort",
+ options: {
+ appendTo: "parent",
+ axis: false,
+ connectWith: false,
+ containment: false,
+ cursor: 'auto',
+ cursorAt: false,
+ dropOnEmpty: true,
+ forcePlaceholderSize: false,
+ forceHelperSize: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ items: '> *',
+ opacity: false,
+ placeholder: false,
+ revert: false,
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ scope: "default",
+ tolerance: "intersect",
+ zIndex: 1000
+ },
+ _create: function() {
var o = this.options;
this.containerCache = {};
@@ -2666,6 +3033,20 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
for ( var i = this.items.length - 1; i >= 0; i-- )
this.items[i].item.removeData("sortable-item");
+
+ return this;
+ },
+
+ _setOption: function(key, value){
+ if ( key === "disabled" ) {
+ this.options[ key ] = value;
+
+ this.widget()
+ [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" );
+ } else {
+ // Don't call widget base _setOption for disable as it adds ui-state-disabled class
+ $.Widget.prototype._setOption.apply(self, arguments);
+ }
},
_mouseCapture: function(event, overrideHandle) {
@@ -2754,8 +3135,7 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
this.originalPageY = event.pageY;
//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
- if(o.cursorAt)
- this._adjustOffsetFromHelper(o.cursorAt);
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
//Cache the former DOM position
this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
@@ -2880,6 +3260,7 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
&& this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
&& !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
&& (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+ //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
) {
this.direction = intersection == 1 ? "down" : "up";
@@ -2978,7 +3359,7 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
$(this.domPosition.parent).prepend(this.currentItem);
}
- return true;
+ return this;
},
@@ -3084,6 +3465,7 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
refresh: function(event) {
this._refreshItems(event);
this.refreshPositions();
+ return this;
},
_connectWith: function() {
@@ -3092,7 +3474,7 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
? [options.connectWith]
: options.connectWith;
},
-
+
_getItemsAsjQuery: function(connected) {
var self = this;
@@ -3106,13 +3488,13 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
for (var j = cur.length - 1; j >= 0; j--){
var inst = $.data(cur[j], 'sortable');
if(inst && inst != this && !inst.options.disabled) {
- queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper"), inst]);
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
}
};
};
}
- queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper"), this]);
+ queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
for (var i = queries.length - 1; i >= 0; i--){
queries[i][0].each(function() {
@@ -3191,10 +3573,6 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
for (var i = this.items.length - 1; i >= 0; i--){
var item = this.items[i];
- //We ignore calculating positions of all connected containers when we're not over them
- if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0])
- continue;
-
var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
if (!fast) {
@@ -3219,6 +3597,7 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
};
}
+ return this;
},
_createPlaceholder: function(that) {
@@ -3264,47 +3643,71 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
},
_contactContainers: function(event) {
+
+ // get innermost container that intersects with item
+ var innermostContainer = null, innermostIndex = null;
+
+
for (var i = this.containers.length - 1; i >= 0; i--){
- if(this._intersectsWith(this.containers[i].containerCache)) {
- if(!this.containers[i].containerCache.over) {
-
- if(this.currentContainer != this.containers[i]) {
-
- //When entering a new container, we will find the item with the least distance and append our item near it
- var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[i].floating ? 'left' : 'top'];
- for (var j = this.items.length - 1; j >= 0; j--) {
- if(!$.ui.contains(this.containers[i].element[0], this.items[j].item[0])) continue;
- var cur = this.items[j][this.containers[i].floating ? 'left' : 'top'];
- if(Math.abs(cur - base) < dist) {
- dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
- }
- }
-
- if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
- continue;
-
- this.currentContainer = this.containers[i];
- itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[i].element, true);
- this._trigger("change", event, this._uiHash());
- this.containers[i]._trigger("change", event, this._uiHash(this));
+ // never consider a container that's located within the item itself
+ if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
+ continue;
- //Update the placeholder
- this.options.placeholder.update(this.currentContainer, this.placeholder);
+ if(this._intersectsWith(this.containers[i].containerCache)) {
- }
+ // if we've already found a container and it's more "inner" than this, then continue
+ if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
+ continue;
- this.containers[i]._trigger("over", event, this._uiHash(this));
- this.containers[i].containerCache.over = 1;
- }
+ innermostContainer = this.containers[i];
+ innermostIndex = i;
+
} else {
+ // container doesn't intersect. trigger "out" event if necessary
if(this.containers[i].containerCache.over) {
this.containers[i]._trigger("out", event, this._uiHash(this));
this.containers[i].containerCache.over = 0;
}
}
- };
+ }
+
+ // if no intersecting containers found, return
+ if(!innermostContainer) return;
+
+ // move the item into the container if it's not there already
+ if(this.containers.length === 1) {
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ } else if(this.currentContainer != this.containers[innermostIndex]) {
+
+ //When entering a new container, we will find the item with the least distance and append our item near it
+ var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top'];
+ for (var j = this.items.length - 1; j >= 0; j--) {
+ if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue;
+ var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top'];
+ if(Math.abs(cur - base) < dist) {
+ dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
+ }
+ }
+
+ if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
+ return;
+
+ this.currentContainer = this.containers[innermostIndex];
+ itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
+ this._trigger("change", event, this._uiHash());
+ this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
+
+ //Update the placeholder
+ this.options.placeholder.update(this.currentContainer, this.placeholder);
+
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ }
+
+
},
_createHelper: function(event) {
@@ -3326,10 +3729,24 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
},
_adjustOffsetFromHelper: function(obj) {
- if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
- if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
- if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
- if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
},
_getParentOffset: function() {
@@ -3556,7 +3973,7 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
//Do what was originally in plugins
if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
- if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset cursor
+ if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
this.dragging = false;
@@ -3587,7 +4004,7 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
},
_trigger: function() {
- if ($.widget.prototype._trigger.apply(this, arguments) === false) {
+ if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
this.cancel();
}
},
@@ -3598,4203 +4015,5364 @@ $.widget("ui.sortable", $.extend({}, $.ui.mouse, {
helper: self.helper,
placeholder: self.placeholder || $([]),
position: self.position,
- absolutePosition: self.positionAbs, //deprecated
+ originalPosition: self.originalPosition,
offset: self.positionAbs,
item: self.currentItem,
sender: inst ? inst.element : null
};
}
-}));
+});
$.extend($.ui.sortable, {
- getter: "serialize toArray",
- version: "1.7.2",
- eventPrefix: "sort",
- defaults: {
- appendTo: "parent",
- axis: false,
- cancel: ":input,option",
- connectWith: false,
- containment: false,
- cursor: 'auto',
- cursorAt: false,
- delay: 0,
- distance: 1,
- dropOnEmpty: true,
- forcePlaceholderSize: false,
- forceHelperSize: false,
- grid: false,
- handle: false,
- helper: "original",
- items: '> *',
- opacity: false,
- placeholder: false,
- revert: false,
- scroll: true,
- scrollSensitivity: 20,
- scrollSpeed: 20,
- scope: "default",
- tolerance: "intersect",
- zIndex: 1000
- }
+ version: "1.8.1"
});
})(jQuery);
/*
- * jQuery UI Effects 1.7.2
+ * jQuery UI Accordion 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
- * http://docs.jquery.com/UI/Effects/
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
*/
-;jQuery.effects || (function($) {
-
-$.effects = {
- version: "1.7.2",
+(function($) {
- // Saves a set of properties in a data storage
- save: function(element, set) {
- for(var i=0; i < set.length; i++) {
- if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+$.widget("ui.accordion", {
+ options: {
+ active: 0,
+ animated: 'slide',
+ autoHeight: true,
+ clearStyle: false,
+ collapsible: false,
+ event: "click",
+ fillSpace: false,
+ header: "> li > :first-child,> :not(li):even",
+ icons: {
+ header: "ui-icon-triangle-1-e",
+ headerSelected: "ui-icon-triangle-1-s"
+ },
+ navigation: false,
+ navigationFilter: function() {
+ return this.href.toLowerCase() == location.href.toLowerCase();
}
},
+ _create: function() {
- // Restores a set of previously saved properties from a data storage
- restore: function(element, set) {
- for(var i=0; i < set.length; i++) {
- if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ var o = this.options, self = this;
+ this.running = 0;
+
+ this.element.addClass("ui-accordion ui-widget ui-helper-reset");
+
+ // in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix
+ if (this.element[0].nodeName == "UL") {
+ this.element.children("li").addClass("ui-accordion-li-fix");
}
- },
- setMode: function(el, mode) {
- if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
- return mode;
- },
+ this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all")
+ .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); })
+ .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); })
+ .bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); })
+ .bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); });
- getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
- // this should be a little more flexible in the future to handle a string & hash
- var y, x;
- switch (origin[0]) {
- case 'top': y = 0; break;
- case 'middle': y = 0.5; break;
- case 'bottom': y = 1; break;
- default: y = origin[0] / original.height;
- };
- switch (origin[1]) {
- case 'left': x = 0; break;
- case 'center': x = 0.5; break;
- case 'right': x = 1; break;
- default: x = origin[1] / original.width;
- };
- return {x: x, y: y};
- },
+ this.headers
+ .next()
+ .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
- // Wraps the element around a wrapper that copies position properties
- createWrapper: function(element) {
+ if ( o.navigation ) {
+ var current = this.element.find("a").filter(o.navigationFilter);
+ if ( current.length ) {
+ var header = current.closest(".ui-accordion-header");
+ if ( header.length ) {
+ // anchor within header
+ this.active = header;
+ } else {
+ // anchor within content
+ this.active = current.closest(".ui-accordion-content").prev();
+ }
+ }
+ }
- //if the element is already wrapped, return it
- if (element.parent().is('.ui-effects-wrapper'))
- return element.parent();
+ this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");
+ this.active.next().addClass('ui-accordion-content-active');
- //Cache width,height and float properties of the element, and create a wrapper around it
- var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') };
- element.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');
- var wrapper = element.parent();
+ //Append icon elements
+ this._createIcons();
- //Transfer the positioning of the element to the wrapper
- if (element.css('position') == 'static') {
- wrapper.css({ position: 'relative' });
- element.css({ position: 'relative'} );
- } else {
- var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto';
- var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto';
- wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show();
- element.css({position: 'relative', top: 0, left: 0 });
- }
+ this.resize();
- wrapper.css(props);
- return wrapper;
- },
+ //ARIA
+ this.element.attr('role','tablist');
- removeWrapper: function(element) {
- if (element.parent().is('.ui-effects-wrapper'))
- return element.parent().replaceWith(element);
- return element;
- },
+ this.headers
+ .attr('role','tab')
+ .bind('keydown', function(event) { return self._keydown(event); })
+ .next()
+ .attr('role','tabpanel');
- setTransition: function(element, list, factor, value) {
- value = value || {};
- $.each(list, function(i, x){
- unit = element.cssUnit(x);
- if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
- });
- return value;
- },
+ this.headers
+ .not(this.active || "")
+ .attr('aria-expanded','false')
+ .attr("tabIndex", "-1")
+ .next()
+ .hide();
- //Base function to animate from one class to another in a seamless transition
- animateClass: function(value, duration, easing, callback) {
+ // make sure at least one header is in the tab order
+ if (!this.active.length) {
+ this.headers.eq(0).attr('tabIndex','0');
+ } else {
+ this.active
+ .attr('aria-expanded','true')
+ .attr('tabIndex', '0');
+ }
- var cb = (typeof easing == "function" ? easing : (callback ? callback : null));
- var ea = (typeof easing == "string" ? easing : null);
+ // only need links in taborder for Safari
+ if (!$.browser.safari)
+ this.headers.find('a').attr('tabIndex','-1');
- return this.each(function() {
+ if (o.event) {
+ this.headers.bind((o.event) + ".accordion", function(event) {
+ self._clickHandler.call(self, event, this);
+ event.preventDefault();
+ });
+ }
- var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || '';
- if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */
- if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; }
+ },
+
+ _createIcons: function() {
+ var o = this.options;
+ if (o.icons) {
+ $("<span/>").addClass("ui-icon " + o.icons.header).prependTo(this.headers);
+ this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);
+ this.element.addClass("ui-accordion-icons");
+ }
+ },
+
+ _destroyIcons: function() {
+ this.headers.children(".ui-icon").remove();
+ this.element.removeClass("ui-accordion-icons");
+ },
- //Let's get a style offset
- var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
- if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove);
- var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
- if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove);
+ destroy: function() {
+ var o = this.options;
- // The main function to form the object for animation
- for(var n in newStyle) {
- if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */
- && n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */
- && newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */
- && (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */
- && (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */
- ) offset[n] = newStyle[n];
- }
+ this.element
+ .removeClass("ui-accordion ui-widget ui-helper-reset")
+ .removeAttr("role")
+ .unbind('.accordion')
+ .removeData('accordion');
- that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object
- // Change style attribute back to original. For stupid IE, we need to clear the damn object.
- if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr);
- if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove);
- if(cb) cb.apply(this, arguments);
- });
+ this.headers
+ .unbind(".accordion")
+ .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top")
+ .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex");
- });
- }
-};
+ this.headers.find("a").removeAttr("tabIndex");
+ this._destroyIcons();
+ var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");
+ if (o.autoHeight || o.fillHeight) {
+ contents.css("height", "");
+ }
+ return this;
+ },
+
+ _setOption: function(key, value) {
+ $.Widget.prototype._setOption.apply(this, arguments);
+
+ if (key == "active") {
+ this.activate(value);
+ }
+ if (key == "icons") {
+ this._destroyIcons();
+ if (value) {
+ this._createIcons();
+ }
+ }
+
+ },
-function _normalizeArguments(a, m) {
+ _keydown: function(event) {
- var o = a[1] && a[1].constructor == Object ? a[1] : {}; if(m) o.mode = m;
- var speed = a[1] && a[1].constructor != Object ? a[1] : (o.duration ? o.duration : a[2]); //either comes from options.duration or the secon/third argument
- speed = $.fx.off ? 0 : typeof speed === "number" ? speed : $.fx.speeds[speed] || $.fx.speeds._default;
- var callback = o.callback || ( $.isFunction(a[1]) && a[1] ) || ( $.isFunction(a[2]) && a[2] ) || ( $.isFunction(a[3]) && a[3] );
+ var o = this.options, keyCode = $.ui.keyCode;
- return [a[0], o, speed, callback];
+ if (o.disabled || event.altKey || event.ctrlKey)
+ return;
-}
+ var length = this.headers.length;
+ var currentIndex = this.headers.index(event.target);
+ var toFocus = false;
-//Extend the methods of jQuery
-$.fn.extend({
+ switch(event.keyCode) {
+ case keyCode.RIGHT:
+ case keyCode.DOWN:
+ toFocus = this.headers[(currentIndex + 1) % length];
+ break;
+ case keyCode.LEFT:
+ case keyCode.UP:
+ toFocus = this.headers[(currentIndex - 1 + length) % length];
+ break;
+ case keyCode.SPACE:
+ case keyCode.ENTER:
+ this._clickHandler({ target: event.target }, event.target);
+ event.preventDefault();
+ }
- //Save old methods
- _show: $.fn.show,
- _hide: $.fn.hide,
- __toggle: $.fn.toggle,
- _addClass: $.fn.addClass,
- _removeClass: $.fn.removeClass,
- _toggleClass: $.fn.toggleClass,
+ if (toFocus) {
+ $(event.target).attr('tabIndex','-1');
+ $(toFocus).attr('tabIndex','0');
+ toFocus.focus();
+ return false;
+ }
- // New effect methods
- effect: function(fx, options, speed, callback) {
- return $.effects[fx] ? $.effects[fx].call(this, {method: fx, options: options || {}, duration: speed, callback: callback }) : null;
- },
+ return true;
- show: function() {
- if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
- return this._show.apply(this, arguments);
- else {
- return this.effect.apply(this, _normalizeArguments(arguments, 'show'));
- }
},
- hide: function() {
- if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
- return this._hide.apply(this, arguments);
- else {
- return this.effect.apply(this, _normalizeArguments(arguments, 'hide'));
- }
- },
+ resize: function() {
- toggle: function(){
- if(!arguments[0] ||
- (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])) ||
- ($.isFunction(arguments[0]) || typeof arguments[0] == 'boolean')) {
- return this.__toggle.apply(this, arguments);
- } else {
- return this.effect.apply(this, _normalizeArguments(arguments, 'toggle'));
+ var o = this.options, maxHeight;
+
+ if (o.fillSpace) {
+
+ if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); }
+ maxHeight = this.element.parent().height();
+ if($.browser.msie) { this.element.parent().css('overflow', defOverflow); }
+
+ this.headers.each(function() {
+ maxHeight -= $(this).outerHeight(true);
+ });
+
+ this.headers.next().each(function() {
+ $(this).height(Math.max(0, maxHeight - $(this).innerHeight() + $(this).height()));
+ }).css('overflow', 'auto');
+
+ } else if ( o.autoHeight ) {
+ maxHeight = 0;
+ this.headers.next().each(function() {
+ maxHeight = Math.max(maxHeight, $(this).height());
+ }).height(maxHeight);
}
- },
- addClass: function(classNames, speed, easing, callback) {
- return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
- },
- removeClass: function(classNames,speed,easing,callback) {
- return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
- },
- toggleClass: function(classNames,speed,easing,callback) {
- return ( (typeof speed !== "boolean") && speed ) ? $.effects.animateClass.apply(this, [{ toggle: classNames },speed,easing,callback]) : this._toggleClass(classNames, speed);
+ return this;
},
- morph: function(remove,add,speed,easing,callback) {
- return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+
+ activate: function(index) {
+ // TODO this gets called on init, changing the option without an explicit call for that
+ this.options.active = index;
+ // call clickHandler with custom event
+ var active = this._findActive(index)[0];
+ this._clickHandler({ target: active }, active);
+
+ return this;
},
- switchClass: function() {
- return this.morph.apply(this, arguments);
+
+ _findActive: function(selector) {
+ return selector
+ ? typeof selector == "number"
+ ? this.headers.filter(":eq(" + selector + ")")
+ : this.headers.not(this.headers.not(selector))
+ : selector === false
+ ? $([])
+ : this.headers.filter(":eq(0)");
},
- // helper functions
- cssUnit: function(key) {
- var style = this.css(key), val = [];
- $.each( ['em','px','%','pt'], function(i, unit){
- if(style.indexOf(unit) > 0)
- val = [parseFloat(style), unit];
- });
- return val;
- }
-});
+ // TODO isn't event.target enough? why the seperate target argument?
+ _clickHandler: function(event, target) {
-/*
- * jQuery Color Animations
- * Copyright 2007 John Resig
- * Released under the MIT and GPL licenses.
- */
+ var o = this.options;
+ if (o.disabled)
+ return;
-// We override the animation for all of these color styles
-$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){
- $.fx.step[attr] = function(fx) {
- if ( fx.state == 0 ) {
- fx.start = getColor( fx.elem, attr );
- fx.end = getRGB( fx.end );
- }
+ // called only when using activate(false) to close all parts programmatically
+ if (!event.target) {
+ if (!o.collapsible)
+ return;
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ this.active.next().addClass('ui-accordion-content-active');
+ var toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: $([]),
+ oldHeader: o.active,
+ newContent: $([]),
+ oldContent: toHide
+ },
+ toShow = (this.active = $([]));
+ this._toggle(toShow, toHide, data);
+ return;
+ }
- fx.elem.style[attr] = "rgb(" + [
- Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0],10), 255), 0),
- Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1],10), 255), 0),
- Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2],10), 255), 0)
- ].join(",") + ")";
- };
-});
+ // get the click target
+ var clicked = $(event.currentTarget || target);
+ var clickedIsActive = clicked[0] == this.active[0];
+
+ // TODO the option is changed, is that correct?
+ // TODO if it is correct, shouldn't that happen after determining that the click is valid?
+ o.active = o.collapsible && clickedIsActive ? false : $('.ui-accordion-header', this.element).index(clicked);
-// Color Conversion functions from highlightFade
-// By Blair Mitchelmore
-// http://jquery.offput.ca/highlightFade/
+ // if animations are still active, or the active header is the target, ignore click
+ if (this.running || (!o.collapsible && clickedIsActive)) {
+ return;
+ }
-// Parse strings looking for color tuples [255,255,255]
-function getRGB(color) {
- var result;
+ // switch classes
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ if (!clickedIsActive) {
+ clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top")
+ .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);
+ clicked.next().addClass('ui-accordion-content-active');
+ }
- // Check if we're already dealing with an array of colors
- if ( color && color.constructor == Array && color.length == 3 )
- return color;
+ // find elements to show and hide
+ var toShow = clicked.next(),
+ toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: clickedIsActive && o.collapsible ? $([]) : clicked,
+ oldHeader: this.active,
+ newContent: clickedIsActive && o.collapsible ? $([]) : toShow,
+ oldContent: toHide
+ },
+ down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
- // Look for rgb(num,num,num)
- if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
- return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+ this.active = clickedIsActive ? $([]) : clicked;
+ this._toggle(toShow, toHide, data, clickedIsActive, down);
- // Look for rgb(num%,num%,num%)
- if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
- return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+ return;
- // Look for #a0b1c2
- if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
- return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+ },
- // Look for #fff
- if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
- return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+ _toggle: function(toShow, toHide, data, clickedIsActive, down) {
- // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
- if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
- return colors['transparent'];
+ var o = this.options, self = this;
- // Otherwise, we're most likely dealing with a named color
- return colors[$.trim(color).toLowerCase()];
-}
+ this.toShow = toShow;
+ this.toHide = toHide;
+ this.data = data;
-function getColor(elem, attr) {
- var color;
+ var complete = function() { if(!self) return; return self._completed.apply(self, arguments); };
- do {
- color = $.curCSS(elem, attr);
+ // trigger changestart event
+ this._trigger("changestart", null, this.data);
- // Keep going until we find an element that has color, or we hit the body
- if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
- break;
+ // count elements to animate
+ this.running = toHide.size() === 0 ? toShow.size() : toHide.size();
- attr = "backgroundColor";
- } while ( elem = elem.parentNode );
+ if (o.animated) {
- return getRGB(color);
-};
+ var animOptions = {};
-// Some named colors to work with
-// From Interface by Stefan Petre
-// http://interface.eyecon.ro/
+ if ( o.collapsible && clickedIsActive ) {
+ animOptions = {
+ toShow: $([]),
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ } else {
+ animOptions = {
+ toShow: toShow,
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ }
-var colors = {
- aqua:[0,255,255],
- azure:[240,255,255],
- beige:[245,245,220],
- black:[0,0,0],
- blue:[0,0,255],
- brown:[165,42,42],
- cyan:[0,255,255],
- darkblue:[0,0,139],
- darkcyan:[0,139,139],
- darkgrey:[169,169,169],
- darkgreen:[0,100,0],
- darkkhaki:[189,183,107],
- darkmagenta:[139,0,139],
- darkolivegreen:[85,107,47],
- darkorange:[255,140,0],
- darkorchid:[153,50,204],
- darkred:[139,0,0],
- darksalmon:[233,150,122],
- darkviolet:[148,0,211],
- fuchsia:[255,0,255],
- gold:[255,215,0],
- green:[0,128,0],
- indigo:[75,0,130],
- khaki:[240,230,140],
- lightblue:[173,216,230],
- lightcyan:[224,255,255],
- lightgreen:[144,238,144],
- lightgrey:[211,211,211],
- lightpink:[255,182,193],
- lightyellow:[255,255,224],
- lime:[0,255,0],
- magenta:[255,0,255],
- maroon:[128,0,0],
- navy:[0,0,128],
- olive:[128,128,0],
- orange:[255,165,0],
- pink:[255,192,203],
- purple:[128,0,128],
- violet:[128,0,128],
- red:[255,0,0],
- silver:[192,192,192],
- white:[255,255,255],
- yellow:[255,255,0],
- transparent: [255,255,255]
-};
+ if (!o.proxied) {
+ o.proxied = o.animated;
+ }
+
+ if (!o.proxiedDuration) {
+ o.proxiedDuration = o.duration;
+ }
+
+ o.animated = $.isFunction(o.proxied) ?
+ o.proxied(animOptions) : o.proxied;
+
+ o.duration = $.isFunction(o.proxiedDuration) ?
+ o.proxiedDuration(animOptions) : o.proxiedDuration;
+
+ var animations = $.ui.accordion.animations,
+ duration = o.duration,
+ easing = o.animated;
+
+ if (easing && !animations[easing] && !$.easing[easing]) {
+ easing = 'slide';
+ }
+ if (!animations[easing]) {
+ animations[easing] = function(options) {
+ this.slide(options, {
+ easing: easing,
+ duration: duration || 700
+ });
+ };
+ }
+
+ animations[easing](animOptions);
+
+ } else {
+
+ if (o.collapsible && clickedIsActive) {
+ toShow.toggle();
+ } else {
+ toHide.hide();
+ toShow.show();
+ }
+
+ complete(true);
+
+ }
+
+ // TODO assert that the blur and focus triggers are really necessary, remove otherwise
+ toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur();
+ toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus();
+
+ },
+
+ _completed: function(cancel) {
+
+ var o = this.options;
+
+ this.running = cancel ? 0 : --this.running;
+ if (this.running) return;
+
+ if (o.clearStyle) {
+ this.toShow.add(this.toHide).css({
+ height: "",
+ overflow: ""
+ });
+ }
+
+ // other classes are removed before the animation; this one needs to stay until completed
+ this.toHide.removeClass("ui-accordion-content-active");
+
+ this._trigger('change', null, this.data);
+ }
+
+});
+
+
+$.extend($.ui.accordion, {
+ version: "1.8.1",
+ animations: {
+ slide: function(options, additions) {
+ options = $.extend({
+ easing: "swing",
+ duration: 300
+ }, options, additions);
+ if ( !options.toHide.size() ) {
+ options.toShow.animate({height: "show"}, options);
+ return;
+ }
+ if ( !options.toShow.size() ) {
+ options.toHide.animate({height: "hide"}, options);
+ return;
+ }
+ var overflow = options.toShow.css('overflow'),
+ percentDone = 0,
+ showProps = {},
+ hideProps = {},
+ fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
+ originalWidth;
+ // fix width before calculating height of hidden element
+ var s = options.toShow;
+ originalWidth = s[0].style.width;
+ s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) );
+
+ $.each(fxAttrs, function(i, prop) {
+ hideProps[prop] = 'hide';
+
+ var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/);
+ showProps[prop] = {
+ value: parts[1],
+ unit: parts[2] || 'px'
+ };
+ });
+ options.toShow.css({ height: 0, overflow: 'hidden' }).show();
+ options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{
+ step: function(now, settings) {
+ // only calculate the percent when animating height
+ // IE gets very inconsistent results when animating elements
+ // with small values, which is common for padding
+ if (settings.prop == 'height') {
+ percentDone = ( settings.end - settings.start === 0 ) ? 0 :
+ (settings.now - settings.start) / (settings.end - settings.start);
+ }
+
+ options.toShow[0].style[settings.prop] =
+ (percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit;
+ },
+ duration: options.duration,
+ easing: options.easing,
+ complete: function() {
+ if ( !options.autoHeight ) {
+ options.toShow.css("height", "");
+ }
+ options.toShow.css("width", originalWidth);
+ options.toShow.css({overflow: overflow});
+ options.complete();
+ }
+ });
+ },
+ bounceslide: function(options) {
+ this.slide(options, {
+ easing: options.down ? "easeOutBounce" : "swing",
+ duration: options.down ? 1000 : 200
+ });
+ }
+ }
+});
+})(jQuery);
/*
- * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
- *
- * Uses the built in easing capabilities added In jQuery 1.1
- * to offer multiple easing options
- *
- * TERMS OF USE - jQuery Easing
- *
- * Open source under the BSD License.
- *
- * Copyright 2008 George McGinley Smith
- * All rights reserved.
+ * jQuery UI Autocomplete 1.8.1
*
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
*
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
+ * http://docs.jquery.com/UI/Autocomplete
*
-*/
-
-// t: current time, b: begInnIng value, c: change In value, d: duration
-$.easing.jswing = $.easing.swing;
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function( $ ) {
-$.extend($.easing,
-{
- def: 'easeOutQuad',
- swing: function (x, t, b, c, d) {
- //alert($.easing.default);
- return $.easing[$.easing.def](x, t, b, c, d);
- },
- easeInQuad: function (x, t, b, c, d) {
- return c*(t/=d)*t + b;
- },
- easeOutQuad: function (x, t, b, c, d) {
- return -c *(t/=d)*(t-2) + b;
+$.widget( "ui.autocomplete", {
+ options: {
+ minLength: 1,
+ delay: 300
},
- easeInOutQuad: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t + b;
- return -c/2 * ((--t)*(t-2) - 1) + b;
- },
- easeInCubic: function (x, t, b, c, d) {
- return c*(t/=d)*t*t + b;
- },
- easeOutCubic: function (x, t, b, c, d) {
- return c*((t=t/d-1)*t*t + 1) + b;
- },
- easeInOutCubic: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t + b;
- return c/2*((t-=2)*t*t + 2) + b;
- },
- easeInQuart: function (x, t, b, c, d) {
- return c*(t/=d)*t*t*t + b;
- },
- easeOutQuart: function (x, t, b, c, d) {
- return -c * ((t=t/d-1)*t*t*t - 1) + b;
- },
- easeInOutQuart: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
- return -c/2 * ((t-=2)*t*t*t - 2) + b;
- },
- easeInQuint: function (x, t, b, c, d) {
- return c*(t/=d)*t*t*t*t + b;
- },
- easeOutQuint: function (x, t, b, c, d) {
- return c*((t=t/d-1)*t*t*t*t + 1) + b;
- },
- easeInOutQuint: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
- return c/2*((t-=2)*t*t*t*t + 2) + b;
- },
- easeInSine: function (x, t, b, c, d) {
- return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
- },
- easeOutSine: function (x, t, b, c, d) {
- return c * Math.sin(t/d * (Math.PI/2)) + b;
- },
- easeInOutSine: function (x, t, b, c, d) {
- return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
- },
- easeInExpo: function (x, t, b, c, d) {
- return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+ _create: function() {
+ var self = this,
+ doc = this.element[ 0 ].ownerDocument;
+ this.element
+ .addClass( "ui-autocomplete-input" )
+ .attr( "autocomplete", "off" )
+ // TODO verify these actually work as intended
+ .attr({
+ role: "textbox",
+ "aria-autocomplete": "list",
+ "aria-haspopup": "true"
+ })
+ .bind( "keydown.autocomplete", function( event ) {
+ var keyCode = $.ui.keyCode;
+ switch( event.keyCode ) {
+ case keyCode.PAGE_UP:
+ self._move( "previousPage", event );
+ break;
+ case keyCode.PAGE_DOWN:
+ self._move( "nextPage", event );
+ break;
+ case keyCode.UP:
+ self._move( "previous", event );
+ // prevent moving cursor to beginning of text field in some browsers
+ event.preventDefault();
+ break;
+ case keyCode.DOWN:
+ self._move( "next", event );
+ // prevent moving cursor to end of text field in some browsers
+ event.preventDefault();
+ break;
+ case keyCode.ENTER:
+ // when menu is open or has focus
+ if ( self.menu.active ) {
+ event.preventDefault();
+ }
+ //passthrough - ENTER and TAB both select the current element
+ case keyCode.TAB:
+ if ( !self.menu.active ) {
+ return;
+ }
+ self.menu.select( event );
+ break;
+ case keyCode.ESCAPE:
+ self.element.val( self.term );
+ self.close( event );
+ break;
+ case keyCode.LEFT:
+ case keyCode.RIGHT:
+ case keyCode.SHIFT:
+ case keyCode.CONTROL:
+ case keyCode.ALT:
+ // ignore metakeys (shift, ctrl, alt)
+ break;
+ default:
+ // keypress is triggered before the input value is changed
+ clearTimeout( self.searching );
+ self.searching = setTimeout(function() {
+ self.search( null, event );
+ }, self.options.delay );
+ break;
+ }
+ })
+ .bind( "focus.autocomplete", function() {
+ self.selectedItem = null;
+ self.previous = self.element.val();
+ })
+ .bind( "blur.autocomplete", function( event ) {
+ clearTimeout( self.searching );
+ // clicks on the menu (or a button to trigger a search) will cause a blur event
+ // TODO try to implement this without a timeout, see clearTimeout in search()
+ self.closing = setTimeout(function() {
+ self.close( event );
+ self._change( event );
+ }, 150 );
+ });
+ this._initSource();
+ this.response = function() {
+ return self._response.apply( self, arguments );
+ };
+ this.menu = $( "<ul></ul>" )
+ .addClass( "ui-autocomplete" )
+ .appendTo( "body", doc )
+ .menu({
+ focus: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" );
+ if ( false !== self._trigger( "focus", null, { item: item } ) ) {
+ // use value to match what will end up in the input, if it was a key event
+ if ( /^key/.test(event.originalEvent.type) ) {
+ self.element.val( item.value );
+ }
+ }
+ },
+ selected: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" );
+ if ( false !== self._trigger( "select", event, { item: item } ) ) {
+ self.element.val( item.value );
+ }
+ self.close( event );
+ // only trigger when focus was lost (click on menu)
+ var previous = self.previous;
+ if ( self.element[0] !== doc.activeElement ) {
+ self.element.focus();
+ self.previous = previous;
+ }
+ self.selectedItem = item;
+ },
+ blur: function( event, ui ) {
+ if ( self.menu.element.is(":visible") ) {
+ self.element.val( self.term );
+ }
+ }
+ })
+ .zIndex( this.element.zIndex() + 1 )
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .hide()
+ .data( "menu" );
+ if ( $.fn.bgiframe ) {
+ this.menu.element.bgiframe();
+ }
},
- easeOutExpo: function (x, t, b, c, d) {
- return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-autocomplete-input" )
+ .removeAttr( "autocomplete" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-autocomplete" )
+ .removeAttr( "aria-haspopup" );
+ this.menu.element.remove();
+ $.Widget.prototype.destroy.call( this );
},
- easeInOutExpo: function (x, t, b, c, d) {
- if (t==0) return b;
- if (t==d) return b+c;
- if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
- return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
+
+ _setOption: function( key ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "source" ) {
+ this._initSource();
+ }
},
- easeInCirc: function (x, t, b, c, d) {
- return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
+
+ _initSource: function() {
+ var array,
+ url;
+ if ( $.isArray(this.options.source) ) {
+ array = this.options.source;
+ this.source = function( request, response ) {
+ response( $.ui.autocomplete.filter(array, request.term) );
+ };
+ } else if ( typeof this.options.source === "string" ) {
+ url = this.options.source;
+ this.source = function( request, response ) {
+ $.getJSON( url, request, response );
+ };
+ } else {
+ this.source = this.options.source;
+ }
},
- easeOutCirc: function (x, t, b, c, d) {
- return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
+
+ search: function( value, event ) {
+ value = value != null ? value : this.element.val();
+ if ( value.length < this.options.minLength ) {
+ return this.close( event );
+ }
+
+ clearTimeout( this.closing );
+ if ( this._trigger("search") === false ) {
+ return;
+ }
+
+ return this._search( value );
},
- easeInOutCirc: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
- return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
+
+ _search: function( value ) {
+ this.term = this.element
+ .addClass( "ui-autocomplete-loading" )
+ // always save the actual value, not the one passed as an argument
+ .val();
+
+ this.source( { term: value }, this.response );
},
- easeInElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+
+ _response: function( content ) {
+ if ( content.length ) {
+ content = this._normalize( content );
+ this._suggest( content );
+ this._trigger( "open" );
+ } else {
+ this.close();
+ }
+ this.element.removeClass( "ui-autocomplete-loading" );
},
- easeOutElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+
+ close: function( event ) {
+ clearTimeout( this.closing );
+ if ( this.menu.element.is(":visible") ) {
+ this._trigger( "close", event );
+ this.menu.element.hide();
+ this.menu.deactivate();
+ }
},
- easeInOutElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
- return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
+
+ _change: function( event ) {
+ if ( this.previous !== this.element.val() ) {
+ this._trigger( "change", event, { item: this.selectedItem } );
+ }
},
- easeInBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- return c*(t/=d)*t*((s+1)*t - s) + b;
+
+ _normalize: function( items ) {
+ // assume all items have the right format when the first item is complete
+ if ( items.length && items[0].label && items[0].value ) {
+ return items;
+ }
+ return $.map( items, function(item) {
+ if ( typeof item === "string" ) {
+ return {
+ label: item,
+ value: item
+ };
+ }
+ return $.extend({
+ label: item.label || item.value,
+ value: item.value || item.label
+ }, item );
+ });
},
- easeOutBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
+
+ _suggest: function( items ) {
+ var ul = this.menu.element
+ .empty()
+ .zIndex( this.element.zIndex() + 1 ),
+ menuWidth,
+ textWidth;
+ this._renderMenu( ul, items );
+ // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
+ this.menu.deactivate();
+ this.menu.refresh();
+ this.menu.element.show().position({
+ my: "left top",
+ at: "left bottom",
+ of: this.element,
+ collision: "none"
+ });
+
+ menuWidth = ul.width( "" ).width();
+ textWidth = this.element.width();
+ ul.width( Math.max( menuWidth, textWidth ) );
},
- easeInOutBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
- return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+
+ _renderMenu: function( ul, items ) {
+ var self = this;
+ $.each( items, function( index, item ) {
+ self._renderItem( ul, item );
+ });
},
- easeInBounce: function (x, t, b, c, d) {
- return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+
+ _renderItem: function( ul, item) {
+ return $( "<li></li>" )
+ .data( "item.autocomplete", item )
+ .append( "<a>" + item.label + "</a>" )
+ .appendTo( ul );
},
- easeOutBounce: function (x, t, b, c, d) {
- if ((t/=d) < (1/2.75)) {
- return c*(7.5625*t*t) + b;
- } else if (t < (2/2.75)) {
- return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
- } else if (t < (2.5/2.75)) {
- return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
- } else {
- return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+
+ _move: function( direction, event ) {
+ if ( !this.menu.element.is(":visible") ) {
+ this.search( null, event );
+ return;
+ }
+ if ( this.menu.first() && /^previous/.test(direction) ||
+ this.menu.last() && /^next/.test(direction) ) {
+ this.element.val( this.term );
+ this.menu.deactivate();
+ return;
}
+ this.menu[ direction ]( event );
},
- easeInOutBounce: function (x, t, b, c, d) {
- if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
- return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
+
+ widget: function() {
+ return this.menu.element;
}
});
-/*
- *
- * TERMS OF USE - EASING EQUATIONS
- *
- * Open source under the BSD License.
- *
- * Copyright 2001 Robert Penner
- * All rights reserved.
- *
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
- *
- */
+$.extend( $.ui.autocomplete, {
+ escapeRegex: function( value ) {
+ return value.replace( /([\^\$\(\)\[\]\{\}\*\.\+\?\|\\])/gi, "\\$1" );
+ },
+ filter: function(array, term) {
+ var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
+ return $.grep( array, function(value) {
+ return matcher.test( value.label || value.value || value );
+ });
+ }
+});
+
+}( jQuery ));
-})(jQuery);
/*
- * jQuery UI Effects Blind 1.7.2
+ * jQuery UI Menu (not officially released)
+ *
+ * This widget isn't yet finished and the API is subject to change. We plan to finish
+ * it for the next release. You're welcome to give it a try anyway and give us feedback,
+ * as long as you're okay with migrating your code later on. We can help with that, too.
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
- * http://docs.jquery.com/UI/Effects/Blind
+ * http://docs.jquery.com/UI/Menu
*
* Depends:
- * effects.core.js
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
*/
(function($) {
-$.effects.blind = function(o) {
+$.widget("ui.menu", {
+ _create: function() {
+ var self = this;
+ this.element
+ .addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
+ .attr({
+ role: "listbox",
+ "aria-activedescendant": "ui-active-menuitem"
+ })
+ .click(function( event ) {
+ if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) {
+ return;
+ }
+ // temporary
+ event.preventDefault();
+ self.select( event );
+ });
+ this.refresh();
+ },
+
+ refresh: function() {
+ var self = this;
- return this.queue(function() {
+ // don't refresh list items that are already adapted
+ var items = this.element.children("li:not(.ui-menu-item):has(a)")
+ .addClass("ui-menu-item")
+ .attr("role", "menuitem");
+
+ items.children("a")
+ .addClass("ui-corner-all")
+ .attr("tabindex", -1)
+ // mouseenter doesn't work with event delegation
+ .mouseenter(function( event ) {
+ self.activate( event, $(this).parent() );
+ })
+ .mouseleave(function() {
+ self.deactivate();
+ });
+ },
- // Create element
- var el = $(this), props = ['position','top','left'];
+ activate: function( event, item ) {
+ this.deactivate();
+ if (this.hasScroll()) {
+ var offset = item.offset().top - this.element.offset().top,
+ scroll = this.element.attr("scrollTop"),
+ elementHeight = this.element.height();
+ if (offset < 0) {
+ this.element.attr("scrollTop", scroll + offset);
+ } else if (offset > elementHeight) {
+ this.element.attr("scrollTop", scroll + offset - elementHeight + item.height());
+ }
+ }
+ this.active = item.eq(0)
+ .children("a")
+ .addClass("ui-state-hover")
+ .attr("id", "ui-active-menuitem")
+ .end();
+ this._trigger("focus", event, { item: item });
+ },
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'vertical'; // Default direction
+ deactivate: function() {
+ if (!this.active) { return; }
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var ref = (direction == 'vertical') ? 'height' : 'width';
- var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
- if(mode == 'show') wrapper.css(ref, 0); // Shift
+ this.active.children("a")
+ .removeClass("ui-state-hover")
+ .removeAttr("id");
+ this._trigger("blur");
+ this.active = null;
+ },
- // Animation
- var animation = {};
- animation[ref] = mode == 'show' ? distance : 0;
+ next: function(event) {
+ this.move("next", ".ui-menu-item:first", event);
+ },
- // Animate
- wrapper.animate(animation, o.duration, o.options.easing, function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- });
+ previous: function(event) {
+ this.move("prev", ".ui-menu-item:last", event);
+ },
- });
+ first: function() {
+ return this.active && !this.active.prev().length;
+ },
-};
+ last: function() {
+ return this.active && !this.active.next().length;
+ },
-})(jQuery);
-/*
- * jQuery UI Effects Bounce 1.7.2
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Bounce
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.bounce = function(o) {
+ move: function(direction, edge, event) {
+ if (!this.active) {
+ this.activate(event, this.element.children(edge));
+ return;
+ }
+ var next = this.active[direction + "All"](".ui-menu-item").eq(0);
+ if (next.length) {
+ this.activate(event, next);
+ } else {
+ this.activate(event, this.element.children(edge));
+ }
+ },
- return this.queue(function() {
+ // TODO merge with previousPage
+ nextPage: function(event) {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.last()) {
+ this.activate(event, this.element.children(":first"));
+ return;
+ }
+ var base = this.active.offset().top,
+ height = this.element.height(),
+ result = this.element.children("li").filter(function() {
+ var close = $(this).offset().top - base - height + $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
- // Create element
- var el = $(this), props = ['position','top','left'];
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(":last");
+ }
+ this.activate(event, result);
+ } else {
+ this.activate(event, this.element.children(!this.active || this.last() ? ":first" : ":last"));
+ }
+ },
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var direction = o.options.direction || 'up'; // Default direction
- var distance = o.options.distance || 20; // Default distance
- var times = o.options.times || 5; // Default # of times
- var speed = o.duration || 250; // Default speed per bounce
- if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
+ // TODO merge with nextPage
+ previousPage: function(event) {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.first()) {
+ this.activate(event, this.element.children(":last"));
+ return;
+ }
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
- if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
- if (mode == 'hide') distance = distance / (times * 2);
- if (mode != 'hide') times--;
+ var base = this.active.offset().top,
+ height = this.element.height();
+ result = this.element.children("li").filter(function() {
+ var close = $(this).offset().top - base + height - $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
- // Animate
- if (mode == 'show') { // Show Bounce
- var animation = {opacity: 1};
- animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation, speed / 2, o.options.easing);
- distance = distance / 2;
- times--;
- };
- for (var i = 0; i < times; i++) { // Bounces
- var animation1 = {}, animation2 = {};
- animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
- distance = (mode == 'hide') ? distance * 2 : distance / 2;
- };
- if (mode == 'hide') { // Last Bounce
- var animation = {opacity: 0};
- animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- el.animate(animation, speed / 2, o.options.easing, function(){
- el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(":first");
+ }
+ this.activate(event, result);
} else {
- var animation1 = {}, animation2 = {};
- animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- };
- el.queue('fx', function() { el.dequeue(); });
- el.dequeue();
- });
+ this.activate(event, this.element.children(!this.active || this.first() ? ":last" : ":first"));
+ }
+ },
-};
+ hasScroll: function() {
+ return this.element.height() < this.element.attr("scrollHeight");
+ },
-})(jQuery);
+ select: function( event ) {
+ this._trigger("selected", event, { item: this.active });
+ }
+});
+
+}(jQuery));
/*
- * jQuery UI Effects Clip 1.7.2
+ * jQuery UI Button 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
- * http://docs.jquery.com/UI/Effects/Clip
+ * http://docs.jquery.com/UI/Button
*
* Depends:
- * effects.core.js
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
*/
-(function($) {
-
-$.effects.clip = function(o) {
+(function( $ ) {
+
+var lastActive,
+ baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
+ otherClasses = "ui-state-hover ui-state-active " +
+ "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon ui-button-text-only",
+ formResetHandler = function( event ) {
+ $( ":ui-button", event.target.form ).each(function() {
+ var inst = $( this ).data( "button" );
+ setTimeout(function() {
+ inst.refresh();
+ }, 1 );
+ });
+ },
+ radioGroup = function( radio ) {
+ var name = radio.name,
+ form = radio.form,
+ radios = $( [] );
+ if ( name ) {
+ if ( form ) {
+ radios = $( form ).find( "[name='" + name + "']" );
+ } else {
+ radios = $( "[name='" + name + "']", radio.ownerDocument )
+ .filter(function() {
+ return !this.form;
+ });
+ }
+ }
+ return radios;
+ };
- return this.queue(function() {
+$.widget( "ui.button", {
+ options: {
+ text: true,
+ label: null,
+ icons: {
+ primary: null,
+ secondary: null
+ }
+ },
+ _create: function() {
+ this.element.closest( "form" )
+ .unbind( "reset.button" )
+ .bind( "reset.button", formResetHandler );
- // Create element
- var el = $(this), props = ['position','top','left','height','width'];
+ this._determineButtonType();
+ this.hasTitle = !!this.buttonElement.attr( "title" );
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'vertical'; // Default direction
+ var self = this,
+ options = this.options,
+ toggleButton = this.type === "checkbox" || this.type === "radio",
+ hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
+ focusClass = "ui-state-focus";
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var animate = el[0].tagName == 'IMG' ? wrapper : el;
- var ref = {
- size: (direction == 'vertical') ? 'height' : 'width',
- position: (direction == 'vertical') ? 'top' : 'left'
- };
- var distance = (direction == 'vertical') ? animate.height() : animate.width();
- if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
+ if ( options.label === null ) {
+ options.label = this.buttonElement.html();
+ }
- // Animation
- var animation = {};
- animation[ref.size] = mode == 'show' ? distance : 0;
- animation[ref.position] = mode == 'show' ? 0 : distance / 2;
+ if ( this.element.is( ":disabled" ) ) {
+ options.disabled = true;
+ }
- // Animate
- animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- }});
+ this.buttonElement
+ .addClass( baseClasses )
+ .attr( "role", "button" )
+ .bind( "mouseenter.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).addClass( "ui-state-hover" );
+ if ( this === lastActive ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "mouseleave.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( hoverClass );
+ })
+ .bind( "focus.button", function() {
+ // no need to check disabled, focus won't be triggered anyway
+ $( this ).addClass( focusClass );
+ })
+ .bind( "blur.button", function() {
+ $( this ).removeClass( focusClass );
+ });
- });
+ if ( toggleButton ) {
+ this.element.bind( "change.button", function() {
+ self.refresh();
+ });
+ }
-};
+ if ( this.type === "checkbox" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).toggleClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", self.element[0].checked );
+ });
+ } else if ( this.type === "radio" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", true );
+
+ var radio = self.element[ 0 ];
+ radioGroup( radio )
+ .not( radio )
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ });
+ } else {
+ this.buttonElement
+ .bind( "mousedown.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ lastActive = this;
+ $( document ).one( "mouseup", function() {
+ lastActive = null;
+ });
+ })
+ .bind( "mouseup.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).removeClass( "ui-state-active" );
+ })
+ .bind( "keydown.button", function(event) {
+ if ( options.disabled ) {
+ return false;
+ }
+ if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "keyup.button", function() {
+ $( this ).removeClass( "ui-state-active" );
+ });
-})(jQuery);
-/*
- * jQuery UI Effects Drop 1.7.2
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Drop
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
+ if ( this.buttonElement.is("a") ) {
+ this.buttonElement.keyup(function(event) {
+ if ( event.keyCode === $.ui.keyCode.SPACE ) {
+ // TODO pass through original event correctly (just as 2nd argument doesn't work)
+ $( this ).click();
+ }
+ });
+ }
+ }
-$.effects.drop = function(o) {
+ // TODO: pull out $.Widget's handling for the disabled option into
+ // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
+ // be overridden by individual plugins
+ this._setOption( "disabled", options.disabled );
+ },
- return this.queue(function() {
+ _determineButtonType: function() {
+
+ if ( this.element.is(":checkbox") ) {
+ this.type = "checkbox";
+ } else {
+ if ( this.element.is(":radio") ) {
+ this.type = "radio";
+ } else {
+ if ( this.element.is("input") ) {
+ this.type = "input";
+ } else {
+ this.type = "button";
+ }
+ }
+ }
+
+ if ( this.type === "checkbox" || this.type === "radio" ) {
+ // we don't search against the document in case the element
+ // is disconnected from the DOM
+ this.buttonElement = this.element.parents().last()
+ .find( "[for=" + this.element.attr("id") + "]" );
+ this.element.addClass( "ui-helper-hidden-accessible" );
+
+ var checked = this.element.is( ":checked" );
+ if ( checked ) {
+ this.buttonElement.addClass( "ui-state-active" );
+ }
+ this.buttonElement.attr( "aria-pressed", checked );
+ } else {
+ this.buttonElement = this.element;
+ }
+ },
- // Create element
- var el = $(this), props = ['position','top','left','opacity'];
+ widget: function() {
+ return this.buttonElement;
+ },
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'left'; // Default Direction
+ destroy: function() {
+ this.element
+ .removeClass( "ui-helper-hidden-accessible" );
+ this.buttonElement
+ .removeClass( baseClasses + " " + otherClasses )
+ .removeAttr( "role" )
+ .removeAttr( "aria-pressed" )
+ .html( this.buttonElement.find(".ui-button-text").html() );
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
- if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+ if ( !this.hasTitle ) {
+ this.buttonElement.removeAttr( "title" );
+ }
- // Animation
- var animation = {opacity: mode == 'show' ? 1 : 0};
- animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+ $.Widget.prototype.destroy.call( this );
+ },
- // Animate
- el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
+ _setOption: function( key, value ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "disabled" ) {
+ if ( value ) {
+ this.element.attr( "disabled", true );
+ } else {
+ this.element.removeAttr( "disabled" );
+ }
+ }
+ this._resetButton();
+ },
- });
+ refresh: function() {
+ var isDisabled = this.element.is( ":disabled" );
+ if ( isDisabled !== this.options.disabled ) {
+ this._setOption( "disabled", isDisabled );
+ }
+ if ( this.type === "radio" ) {
+ radioGroup( this.element[0] ).each(function() {
+ if ( $( this ).is( ":checked" ) ) {
+ $( this ).button( "widget" )
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", true );
+ } else {
+ $( this ).button( "widget" )
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ }
+ });
+ } else if ( this.type === "checkbox" ) {
+ if ( this.element.is( ":checked" ) ) {
+ this.buttonElement
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", true );
+ } else {
+ this.buttonElement
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ }
+ }
+ },
-};
+ _resetButton: function() {
+ if ( this.type === "input" ) {
+ if ( this.options.label ) {
+ this.element.val( this.options.label );
+ }
+ return;
+ }
+ var buttonElement = this.buttonElement,
+ buttonText = $( "<span></span>" )
+ .addClass( "ui-button-text" )
+ .html( this.options.label )
+ .appendTo( buttonElement.empty() )
+ .text(),
+ icons = this.options.icons,
+ multipleIcons = icons.primary && icons.secondary;
+ if ( icons.primary || icons.secondary ) {
+ buttonElement.addClass( "ui-button-text-icon" +
+ ( multipleIcons ? "s" : "" ) );
+ if ( icons.primary ) {
+ buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
+ }
+ if ( icons.secondary ) {
+ buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
+ }
+ if ( !this.options.text ) {
+ buttonElement
+ .addClass( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" )
+ .removeClass( "ui-button-text-icons ui-button-text-icon" );
+ if ( !this.hasTitle ) {
+ buttonElement.attr( "title", buttonText );
+ }
+ }
+ } else {
+ buttonElement.addClass( "ui-button-text-only" );
+ }
+ }
+});
-})(jQuery);
-/*
- * jQuery UI Effects Explode 1.7.2
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Explode
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
+$.widget( "ui.buttonset", {
+ _create: function() {
+ this.element.addClass( "ui-buttonset" );
+ this._init();
+ },
+
+ _init: function() {
+ this.refresh();
+ },
-$.effects.explode = function(o) {
+ _setOption: function( key, value ) {
+ if ( key === "disabled" ) {
+ this.buttons.button( "option", key, value );
+ }
- return this.queue(function() {
-
- var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
- var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
-
- o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
- var el = $(this).show().css('visibility', 'hidden');
- var offset = el.offset();
-
- //Substract the margins - not fixing the problem yet.
- offset.top -= parseInt(el.css("marginTop"),10) || 0;
- offset.left -= parseInt(el.css("marginLeft"),10) || 0;
+ $.Widget.prototype._setOption.apply( this, arguments );
+ },
+
+ refresh: function() {
+ this.buttons = this.element.find( ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" )
+ .filter( ":ui-button" )
+ .button( "refresh" )
+ .end()
+ .not( ":ui-button" )
+ .button()
+ .end()
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
+ .filter( ":first" )
+ .addClass( "ui-corner-left" )
+ .end()
+ .filter( ":last" )
+ .addClass( "ui-corner-right" )
+ .end()
+ .end();
+ },
- var width = el.outerWidth(true);
- var height = el.outerHeight(true);
+ destroy: function() {
+ this.element.removeClass( "ui-buttonset" );
+ this.buttons
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-left ui-corner-right" )
+ .end()
+ .button( "destroy" )
- for(var i=0;i<rows;i++) { // =
- for(var j=0;j<cells;j++) { // ||
- el
- .clone()
- .appendTo('body')
- .wrap('<div></div>')
- .css({
- position: 'absolute',
- visibility: 'visible',
- left: -j*(width/cells),
- top: -i*(height/rows)
- })
- .parent()
- .addClass('ui-effects-explode')
- .css({
- position: 'absolute',
- overflow: 'hidden',
- width: width/cells,
- height: height/rows,
- left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
- top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
- opacity: o.options.mode == 'show' ? 0 : 1
- }).animate({
- left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
- top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
- opacity: o.options.mode == 'show' ? 1 : 0
- }, o.duration || 500);
- }
+ $.Widget.prototype.destroy.call( this );
}
+});
- // Set a timeout, to call the callback approx. when the other animations have finished
- setTimeout(function() {
-
- o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
- if(o.callback) o.callback.apply(el[0]); // Callback
- el.dequeue();
-
- $('div.ui-effects-explode').remove();
-
- }, o.duration || 500);
-
-
- });
-
-};
-
-})(jQuery);
+}( jQuery ) );
/*
- * jQuery UI Effects Fold 1.7.2
+ * jQuery UI Dialog 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
- * http://docs.jquery.com/UI/Effects/Fold
+ * http://docs.jquery.com/UI/Dialog
*
* Depends:
- * effects.core.js
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
*/
(function($) {
-$.effects.fold = function(o) {
+var uiDialogClasses =
+ 'ui-dialog ' +
+ 'ui-widget ' +
+ 'ui-widget-content ' +
+ 'ui-corner-all ';
- return this.queue(function() {
+$.widget("ui.dialog", {
+ options: {
+ autoOpen: true,
+ buttons: {},
+ closeOnEscape: true,
+ closeText: 'close',
+ dialogClass: '',
+ draggable: true,
+ hide: null,
+ height: 'auto',
+ maxHeight: false,
+ maxWidth: false,
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: 'center',
+ resizable: true,
+ show: null,
+ stack: true,
+ title: '',
+ width: 300,
+ zIndex: 1000
+ },
+ _create: function() {
+ this.originalTitle = this.element.attr('title');
- // Create element
- var el = $(this), props = ['position','top','left'];
+ var self = this,
+ options = self.options,
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var size = o.options.size || 15; // Default fold size
- var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
- var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+ title = options.title || self.originalTitle || ' ',
+ titleId = $.ui.dialog.getTitleId(self.element),
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var widthFirst = ((mode == 'show') != horizFirst);
- var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
- var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
- var percent = /([0-9]+)%/.exec(size);
- if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
- if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
+ uiDialog = (self.uiDialog = $('<div></div>'))
+ .appendTo(document.body)
+ .hide()
+ .addClass(uiDialogClasses + options.dialogClass)
+ .css({
+ zIndex: options.zIndex
+ })
+ // setting tabIndex makes the div focusable
+ // setting outline to 0 prevents a border on focus in Mozilla
+ .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+ if (options.closeOnEscape && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ self.close(event);
+ event.preventDefault();
+ }
+ })
+ .attr({
+ role: 'dialog',
+ 'aria-labelledby': titleId
+ })
+ .mousedown(function(event) {
+ self.moveToTop(false, event);
+ }),
- // Animation
- var animation1 = {}, animation2 = {};
- animation1[ref[0]] = mode == 'show' ? distance[0] : size;
- animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
+ uiDialogContent = self.element
+ .show()
+ .removeAttr('title')
+ .addClass(
+ 'ui-dialog-content ' +
+ 'ui-widget-content')
+ .appendTo(uiDialog),
- // Animate
- wrapper.animate(animation1, duration, o.options.easing)
- .animate(animation2, duration, o.options.easing, function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- });
+ uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
+ .addClass(
+ 'ui-dialog-titlebar ' +
+ 'ui-widget-header ' +
+ 'ui-corner-all ' +
+ 'ui-helper-clearfix'
+ )
+ .prependTo(uiDialog),
- });
+ uiDialogTitlebarClose = $('<a href="#"></a>')
+ .addClass(
+ 'ui-dialog-titlebar-close ' +
+ 'ui-corner-all'
+ )
+ .attr('role', 'button')
+ .hover(
+ function() {
+ uiDialogTitlebarClose.addClass('ui-state-hover');
+ },
+ function() {
+ uiDialogTitlebarClose.removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ uiDialogTitlebarClose.addClass('ui-state-focus');
+ })
+ .blur(function() {
+ uiDialogTitlebarClose.removeClass('ui-state-focus');
+ })
+ .click(function(event) {
+ self.close(event);
+ return false;
+ })
+ .appendTo(uiDialogTitlebar),
-};
+ uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
+ .addClass(
+ 'ui-icon ' +
+ 'ui-icon-closethick'
+ )
+ .text(options.closeText)
+ .appendTo(uiDialogTitlebarClose),
-})(jQuery);
-/*
- * jQuery UI Effects Highlight 1.7.2
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Highlight
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
+ uiDialogTitle = $('<span></span>')
+ .addClass('ui-dialog-title')
+ .attr('id', titleId)
+ .html(title)
+ .prependTo(uiDialogTitlebar);
-$.effects.highlight = function(o) {
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
+ options.beforeClose = options.beforeclose;
+ }
- return this.queue(function() {
+ uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
- // Create element
- var el = $(this), props = ['backgroundImage','backgroundColor','opacity'];
+ if (options.draggable && $.fn.draggable) {
+ self._makeDraggable();
+ }
+ if (options.resizable && $.fn.resizable) {
+ self._makeResizable();
+ }
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
- var color = o.options.color || "#ffff99"; // Default highlight color
- var oldColor = el.css("backgroundColor");
+ self._createButtons(options.buttons);
+ self._isOpen = false;
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- el.css({backgroundImage: 'none', backgroundColor: color}); // Shift
+ if ($.fn.bgiframe) {
+ uiDialog.bgiframe();
+ }
+ },
+ _init: function() {
+ if ( this.options.autoOpen ) {
+ this.open();
+ }
+ },
- // Animation
- var animation = {backgroundColor: oldColor };
- if (mode == "hide") animation['opacity'] = 0;
+ destroy: function() {
+ var self = this;
+
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.hide();
+ self.element
+ .unbind('.dialog')
+ .removeData('dialog')
+ .removeClass('ui-dialog-content ui-widget-content')
+ .hide().appendTo('body');
+ self.uiDialog.remove();
- // Animate
- el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == "hide") el.hide();
- $.effects.restore(el, props);
- if (mode == "show" && $.browser.msie) this.style.removeAttribute('filter');
- if(o.callback) o.callback.apply(this, arguments);
- el.dequeue();
- }});
+ if (self.originalTitle) {
+ self.element.attr('title', self.originalTitle);
+ }
- });
+ return self;
+ },
+
+ widget: function() {
+ return this.uiDialog;
+ },
-};
+ close: function(event) {
+ var self = this,
+ maxZ;
+
+ if (false === self._trigger('beforeClose', event)) {
+ return;
+ }
-})(jQuery);
-/*
- * jQuery UI Effects Pulsate 1.7.2
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Pulsate
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.unbind('keypress.ui-dialog');
-$.effects.pulsate = function(o) {
+ self._isOpen = false;
- return this.queue(function() {
+ if (self.options.hide) {
+ self.uiDialog.hide(self.options.hide, function() {
+ self._trigger('close', event);
+ });
+ } else {
+ self.uiDialog.hide();
+ self._trigger('close', event);
+ }
- // Create element
- var el = $(this);
+ $.ui.dialog.overlay.resize();
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
- var times = o.options.times || 5; // Default # of times
- var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ if (self.options.modal) {
+ maxZ = 0;
+ $('.ui-dialog').each(function() {
+ if (this !== self.uiDialog[0]) {
+ maxZ = Math.max(maxZ, $(this).css('z-index'));
+ }
+ });
+ $.ui.dialog.maxZ = maxZ;
+ }
- // Adjust
- if (mode == 'hide') times--;
- if (el.is(':hidden')) { // Show fadeIn
- el.css('opacity', 0);
- el.show(); // Show
- el.animate({opacity: 1}, duration, o.options.easing);
- times = times-2;
+ return self;
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ // the force parameter allows us to move modal dialogs to their correct
+ // position on open
+ moveToTop: function(force, event) {
+ var self = this,
+ options = self.options,
+ saveScroll;
+
+ if ((options.modal && !force) ||
+ (!options.stack && !options.modal)) {
+ return self._trigger('focus', event);
+ }
+
+ if (options.zIndex > $.ui.dialog.maxZ) {
+ $.ui.dialog.maxZ = options.zIndex;
+ }
+ if (self.overlay) {
+ $.ui.dialog.maxZ += 1;
+ self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
}
- // Animate
- for (var i = 0; i < times; i++) { // Pulsate
- el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing);
- };
- if (mode == 'hide') { // Last Pulse
- el.animate({opacity: 0}, duration, o.options.easing, function(){
- el.hide(); // Hide
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- } else {
- el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- };
- el.queue('fx', function() { el.dequeue(); });
- el.dequeue();
- });
+ //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+ // http://ui.jquery.com/bugs/ticket/3193
+ saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') };
+ $.ui.dialog.maxZ += 1;
+ self.uiDialog.css('z-index', $.ui.dialog.maxZ);
+ self.element.attr(saveScroll);
+ self._trigger('focus', event);
-};
+ return self;
+ },
-})(jQuery);
-/*
- * jQuery UI Effects Scale 1.7.2
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Scale
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
+ open: function() {
+ if (this._isOpen) { return; }
-$.effects.puff = function(o) {
+ var self = this,
+ options = self.options,
+ uiDialog = self.uiDialog;
- return this.queue(function() {
+ self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
+ if (uiDialog.next().length) {
+ uiDialog.appendTo('body');
+ }
+ self._size();
+ self._position(options.position);
+ uiDialog.show(options.show);
+ self.moveToTop(true);
- // Create element
- var el = $(this);
+ // prevent tabbing out of modal dialogs
+ if (options.modal) {
+ uiDialog.bind('keypress.ui-dialog', function(event) {
+ if (event.keyCode !== $.ui.keyCode.TAB) {
+ return;
+ }
+
+ var tabbables = $(':tabbable', this),
+ first = tabbables.filter(':first'),
+ last = tabbables.filter(':last');
+
+ if (event.target === last[0] && !event.shiftKey) {
+ first.focus(1);
+ return false;
+ } else if (event.target === first[0] && event.shiftKey) {
+ last.focus(1);
+ return false;
+ }
+ });
+ }
- // Set options
- var options = $.extend(true, {}, o.options);
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var percent = parseInt(o.options.percent,10) || 150; // Set default puff percent
- options.fade = true; // It's not a puff if it doesn't fade! :)
- var original = {height: el.height(), width: el.width()}; // Save original
+ // set focus to the first tabbable element in the content area or the first button
+ // if there are no tabbable elements, set focus on the dialog itself
+ $([])
+ .add(uiDialog.find('.ui-dialog-content :tabbable:first'))
+ .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
+ .add(uiDialog)
+ .filter(':first')
+ .focus();
- // Adjust
- var factor = percent / 100;
- el.from = (mode == 'hide') ? original : {height: original.height * factor, width: original.width * factor};
+ self._trigger('open');
+ self._isOpen = true;
- // Animation
- options.from = el.from;
- options.percent = (mode == 'hide') ? percent : 100;
- options.mode = mode;
+ return self;
+ },
- // Animate
- el.effect('scale', options, o.duration, o.callback);
- el.dequeue();
- });
+ _createButtons: function(buttons) {
+ var self = this,
+ hasButtons = false,
+ uiDialogButtonPane = $('<div></div>')
+ .addClass(
+ 'ui-dialog-buttonpane ' +
+ 'ui-widget-content ' +
+ 'ui-helper-clearfix'
+ );
-};
+ // if we already have a button pane, remove it
+ self.uiDialog.find('.ui-dialog-buttonpane').remove();
-$.effects.scale = function(o) {
+ if (typeof buttons === 'object' && buttons !== null) {
+ $.each(buttons, function() {
+ return !(hasButtons = true);
+ });
+ }
+ if (hasButtons) {
+ $.each(buttons, function(name, fn) {
+ var button = $('<button type="button"></button>')
+ .text(name)
+ .click(function() { fn.apply(self.element[0], arguments); })
+ .appendTo(uiDialogButtonPane);
+ if ($.fn.button) {
+ button.button();
+ }
+ });
+ uiDialogButtonPane.appendTo(self.uiDialog);
+ }
+ },
- return this.queue(function() {
+ _makeDraggable: function() {
+ var self = this,
+ options = self.options,
+ doc = $(document),
+ heightBeforeDrag;
- // Create element
- var el = $(this);
+ function filteredUi(ui) {
+ return {
+ position: ui.position,
+ offset: ui.offset
+ };
+ }
- // Set options
- var options = $.extend(true, {}, o.options);
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
- var direction = o.options.direction || 'both'; // Set default axis
- var origin = o.options.origin; // The origin of the scaling
- if (mode != 'effect') { // Set default origin and restore for show/hide
- options.origin = origin || ['middle','center'];
- options.restore = true;
+ self.uiDialog.draggable({
+ cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
+ handle: '.ui-dialog-titlebar',
+ containment: 'document',
+ start: function(event, ui) {
+ heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
+ $(this).height($(this).height()).addClass("ui-dialog-dragging");
+ self._trigger('dragStart', event, filteredUi(ui));
+ },
+ drag: function(event, ui) {
+ self._trigger('drag', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ options.position = [ui.position.left - doc.scrollLeft(),
+ ui.position.top - doc.scrollTop()];
+ $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+ self._trigger('dragStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ });
+ },
+
+ _makeResizable: function(handles) {
+ handles = (handles === undefined ? this.options.resizable : handles);
+ var self = this,
+ options = self.options,
+ // .ui-resizable has position: relative defined in the stylesheet
+ // but dialogs have to use absolute or fixed positioning
+ position = self.uiDialog.css('position'),
+ resizeHandles = (typeof handles === 'string' ?
+ handles :
+ 'n,e,s,w,se,sw,ne,nw'
+ );
+
+ function filteredUi(ui) {
+ return {
+ originalPosition: ui.originalPosition,
+ originalSize: ui.originalSize,
+ position: ui.position,
+ size: ui.size
+ };
}
- var original = {height: el.height(), width: el.width()}; // Save original
- el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
- // Adjust
- var factor = { // Set scaling factor
- y: direction != 'horizontal' ? (percent / 100) : 1,
- x: direction != 'vertical' ? (percent / 100) : 1
- };
- el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
+ self.uiDialog.resizable({
+ cancel: '.ui-dialog-content',
+ containment: 'document',
+ alsoResize: self.element,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: self._minHeight(),
+ handles: resizeHandles,
+ start: function(event, ui) {
+ $(this).addClass("ui-dialog-resizing");
+ self._trigger('resizeStart', event, filteredUi(ui));
+ },
+ resize: function(event, ui) {
+ self._trigger('resize', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ $(this).removeClass("ui-dialog-resizing");
+ options.height = $(this).height();
+ options.width = $(this).width();
+ self._trigger('resizeStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ })
+ .css('position', position)
+ .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ },
- if (o.options.fade) { // Fade option to support puff
- if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
- if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
- };
+ _minHeight: function() {
+ var options = this.options;
- // Animation
- options.from = el.from; options.to = el.to; options.mode = mode;
+ if (options.height === 'auto') {
+ return options.minHeight;
+ } else {
+ return Math.min(options.minHeight, options.height);
+ }
+ },
- // Animate
- el.effect('size', options, o.duration, o.callback);
- el.dequeue();
- });
+ _position: function(position) {
+ var myAt = [],
+ offset = [0, 0],
+ isVisible;
-};
+ position = position || $.ui.dialog.prototype.options.position;
-$.effects.size = function(o) {
+ // deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
+// if (typeof position == 'string' || $.isArray(position)) {
+// myAt = $.isArray(position) ? position : position.split(' ');
- return this.queue(function() {
+ if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
+ myAt = position.split ? position.split(' ') : [position[0], position[1]];
+ if (myAt.length === 1) {
+ myAt[1] = myAt[0];
+ }
- // Create element
- var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
- var props1 = ['position','top','left','overflow','opacity']; // Always restore
- var props2 = ['width','height','overflow']; // Copy for children
- var cProps = ['fontSize'];
- var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
- var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
+ $.each(['left', 'top'], function(i, offsetPosition) {
+ if (+myAt[i] === myAt[i]) {
+ offset[i] = myAt[i];
+ myAt[i] = offsetPosition;
+ }
+ });
+ } else if (typeof position === 'object') {
+ if ('left' in position) {
+ myAt[0] = 'left';
+ offset[0] = position.left;
+ } else if ('right' in position) {
+ myAt[0] = 'right';
+ offset[0] = -position.right;
+ }
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var restore = o.options.restore || false; // Default restore
- var scale = o.options.scale || 'both'; // Default scale mode
- var origin = o.options.origin; // The origin of the sizing
- var original = {height: el.height(), width: el.width()}; // Save original
- el.from = o.options.from || original; // Default from state
- el.to = o.options.to || original; // Default to state
- // Adjust
- if (origin) { // Calculate baseline shifts
- var baseline = $.effects.getBaseline(origin, original);
- el.from.top = (original.height - el.from.height) * baseline.y;
- el.from.left = (original.width - el.from.width) * baseline.x;
- el.to.top = (original.height - el.to.height) * baseline.y;
- el.to.left = (original.width - el.to.width) * baseline.x;
- };
- var factor = { // Set scaling factor
- from: {y: el.from.height / original.height, x: el.from.width / original.width},
- to: {y: el.to.height / original.height, x: el.to.width / original.width}
- };
- if (scale == 'box' || scale == 'both') { // Scale the css box
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- props = props.concat(vProps);
- el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
- el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
- };
- if (factor.from.x != factor.to.x) { // Horizontal props scaling
- props = props.concat(hProps);
- el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
- el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
- };
- };
- if (scale == 'content' || scale == 'both') { // Scale the content
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- props = props.concat(cProps);
- el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
- el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
- };
- };
- $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- el.css('overflow','hidden').css(el.from); // Shift
+ if ('top' in position) {
+ myAt[1] = 'top';
+ offset[1] = position.top;
+ } else if ('bottom' in position) {
+ myAt[1] = 'bottom';
+ offset[1] = -position.bottom;
+ }
+ }
- // Animate
- if (scale == 'content' || scale == 'both') { // Scale the children
- vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
- hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
- props2 = props.concat(vProps).concat(hProps); // Concat
- el.find("*[width]").each(function(){
- child = $(this);
- if (restore) $.effects.save(child, props2);
- var c_original = {height: child.height(), width: child.width()}; // Save original
- child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
- child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
- child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
- };
- if (factor.from.x != factor.to.x) { // Horizontal props scaling
- child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
- child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
- };
- child.css(child.from); // Shift children
- child.animate(child.to, o.duration, o.options.easing, function(){
- if (restore) $.effects.restore(child, props2); // Restore children
- }); // Animate children
+ // need to show the dialog to get the actual offset in the position plugin
+ isVisible = this.uiDialog.is(':visible');
+ if (!isVisible) {
+ this.uiDialog.show();
+ }
+ this.uiDialog
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .position({
+ my: myAt.join(' '),
+ at: myAt.join(' '),
+ offset: offset.join(' '),
+ of: window,
+ collision: 'fit',
+ // ensure that the titlebar is never outside the document
+ using: function(pos) {
+ var topOffset = $(this).css(pos).offset().top;
+ if (topOffset < 0) {
+ $(this).css('top', pos.top - topOffset);
+ }
+ }
});
- };
+ if (!isVisible) {
+ this.uiDialog.hide();
+ }
+ },
- // Animate
- el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
+ _setOption: function(key, value){
+ var self = this,
+ uiDialog = self.uiDialog,
+ isResizable = uiDialog.is(':data(resizable)'),
+ resize = false;
+
+ switch (key) {
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ case "beforeclose":
+ key = "beforeClose";
+ break;
+ case "buttons":
+ self._createButtons(value);
+ break;
+ case "closeText":
+ // convert whatever was passed in to a string, for text() to not throw up
+ self.uiDialogTitlebarCloseText.text("" + value);
+ break;
+ case "dialogClass":
+ uiDialog
+ .removeClass(self.options.dialogClass)
+ .addClass(uiDialogClasses + value);
+ break;
+ case "disabled":
+ if (value) {
+ uiDialog.addClass('ui-dialog-disabled');
+ } else {
+ uiDialog.removeClass('ui-dialog-disabled');
+ }
+ break;
+ case "draggable":
+ if (value) {
+ self._makeDraggable();
+ } else {
+ uiDialog.draggable('destroy');
+ }
+ break;
+ case "height":
+ resize = true;
+ break;
+ case "maxHeight":
+ if (isResizable) {
+ uiDialog.resizable('option', 'maxHeight', value);
+ }
+ resize = true;
+ break;
+ case "maxWidth":
+ if (isResizable) {
+ uiDialog.resizable('option', 'maxWidth', value);
+ }
+ resize = true;
+ break;
+ case "minHeight":
+ if (isResizable) {
+ uiDialog.resizable('option', 'minHeight', value);
+ }
+ resize = true;
+ break;
+ case "minWidth":
+ if (isResizable) {
+ uiDialog.resizable('option', 'minWidth', value);
+ }
+ resize = true;
+ break;
+ case "position":
+ self._position(value);
+ break;
+ case "resizable":
+ // currently resizable, becoming non-resizable
+ if (isResizable && !value) {
+ uiDialog.resizable('destroy');
+ }
- });
+ // currently resizable, changing handles
+ if (isResizable && typeof value === 'string') {
+ uiDialog.resizable('option', 'handles', value);
+ }
-};
+ // currently non-resizable, becoming resizable
+ if (!isResizable && value !== false) {
+ self._makeResizable(value);
+ }
+ break;
+ case "title":
+ // convert whatever was passed in o a string, for html() to not throw up
+ $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' '));
+ break;
+ case "width":
+ resize = true;
+ break;
+ }
-})(jQuery);
-/*
- * jQuery UI Effects Shake 1.7.2
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Shake
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
+ $.Widget.prototype._setOption.apply(self, arguments);
+ if (resize) {
+ self._size();
+ }
+ },
-$.effects.shake = function(o) {
+ _size: function() {
+ /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ * divs will both have width and height set, so we need to reset them
+ */
+ var options = this.options,
+ nonContentHeight;
- return this.queue(function() {
+ // reset content sizing
+ // hide for non content measurement because height: 0 doesn't work in IE quirks mode (see #4350)
+ this.element.css({
+ width: 'auto',
+ minHeight: 0,
+ height: 0
+ });
- // Create element
- var el = $(this), props = ['position','top','left'];
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ nonContentHeight = this.uiDialog.css({
+ height: 'auto',
+ width: options.width
+ })
+ .height();
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var direction = o.options.direction || 'left'; // Default direction
- var distance = o.options.distance || 20; // Default distance
- var times = o.options.times || 3; // Default # of times
- var speed = o.duration || o.options.duration || 140; // Default speed per shake
+ this.element
+ .css(options.height === 'auto' ? {
+ minHeight: Math.max(options.minHeight - nonContentHeight, 0),
+ height: 'auto'
+ } : {
+ minHeight: 0,
+ height: Math.max(options.height - nonContentHeight, 0)
+ })
+ .show();
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ if (this.uiDialog.is(':data(resizable)')) {
+ this.uiDialog.resizable('option', 'minHeight', this._minHeight());
+ }
+ }
+});
- // Animation
- var animation = {}, animation1 = {}, animation2 = {};
- animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
- animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
+$.extend($.ui.dialog, {
+ version: "1.8.1",
- // Animate
- el.animate(animation, speed, o.options.easing);
- for (var i = 1; i < times; i++) { // Shakes
- el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
- };
- el.animate(animation1, speed, o.options.easing).
- animate(animation, speed / 2, o.options.easing, function(){ // Last shake
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- el.queue('fx', function() { el.dequeue(); });
- el.dequeue();
- });
+ uuid: 0,
+ maxZ: 0,
-};
+ getTitleId: function($el) {
+ var id = $el.attr('id');
+ if (!id) {
+ this.uuid += 1;
+ id = this.uuid;
+ }
+ return 'ui-dialog-title-' + id;
+ },
-})(jQuery);
-/*
- * jQuery UI Effects Slide 1.7.2
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Slide
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
+ overlay: function(dialog) {
+ this.$el = $.ui.dialog.overlay.create(dialog);
+ }
+});
-$.effects.slide = function(o) {
+$.extend($.ui.dialog.overlay, {
+ instances: [],
+ // reuse old instances due to IE memory leak with alpha transparency (see #5185)
+ oldInstances: [],
+ maxZ: 0,
+ events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+ function(event) { return event + '.dialog-overlay'; }).join(' '),
+ create: function(dialog) {
+ if (this.instances.length === 0) {
+ // prevent use of anchors and inputs
+ // we use a setTimeout in case the overlay is created from an
+ // event that we're going to be cancelling (see #2804)
+ setTimeout(function() {
+ // handle $(el).dialog().dialog('close') (see #4065)
+ if ($.ui.dialog.overlay.instances.length) {
+ $(document).bind($.ui.dialog.overlay.events, function(event) {
+ // stop events if the z-index of the target is < the z-index of the overlay
+ return ($(event.target).zIndex() >= $.ui.dialog.overlay.maxZ);
+ });
+ }
+ }, 1);
- return this.queue(function() {
+ // allow closing by pressing the escape key
+ $(document).bind('keydown.dialog-overlay', function(event) {
+ if (dialog.options.closeOnEscape && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ dialog.close(event);
+ event.preventDefault();
+ }
+ });
- // Create element
- var el = $(this), props = ['position','top','left'];
+ // handle window resize
+ $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ }
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
- var direction = o.options.direction || 'left'; // Default Direction
+ var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
+ .appendTo(document.body)
+ .css({
+ width: this.width(),
+ height: this.height()
+ });
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
- if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift
+ if ($.fn.bgiframe) {
+ $el.bgiframe();
+ }
- // Animation
- var animation = {};
- animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+ this.instances.push($el);
+ return $el;
+ },
- // Animate
- el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
+ destroy: function($el) {
+ this.oldInstances.push(this.instances.splice($.inArray($el, this.instances), 1)[0]);
- });
+ if (this.instances.length === 0) {
+ $([document, window]).unbind('.dialog-overlay');
+ }
-};
+ $el.remove();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ var maxZ = 0;
+ $.each(this.instances, function() {
+ maxZ = Math.max(maxZ, this.css('z-index'));
+ });
+ this.maxZ = maxZ;
+ },
-})(jQuery);
-/*
- * jQuery UI Effects Transfer 1.7.2
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Transfer
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
+ height: function() {
+ var scrollHeight,
+ offsetHeight;
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ scrollHeight = Math.max(
+ document.documentElement.scrollHeight,
+ document.body.scrollHeight
+ );
+ offsetHeight = Math.max(
+ document.documentElement.offsetHeight,
+ document.body.offsetHeight
+ );
-$.effects.transfer = function(o) {
- return this.queue(function() {
- var elem = $(this),
- target = $(o.options.to),
- endPosition = target.offset(),
- animation = {
- top: endPosition.top,
- left: endPosition.left,
- height: target.innerHeight(),
- width: target.innerWidth()
- },
- startPosition = elem.offset(),
- transfer = $('<div class="ui-effects-transfer"></div>')
- .appendTo(document.body)
- .addClass(o.options.className)
- .css({
- top: startPosition.top,
- left: startPosition.left,
- height: elem.innerHeight(),
- width: elem.innerWidth(),
- position: 'absolute'
- })
- .animate(animation, o.duration, o.options.easing, function() {
- transfer.remove();
- (o.callback && o.callback.apply(elem[0], arguments));
- elem.dequeue();
- });
- });
-};
+ if (scrollHeight < offsetHeight) {
+ return $(window).height() + 'px';
+ } else {
+ return scrollHeight + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).height() + 'px';
+ }
+ },
-})(jQuery);
+ width: function() {
+ var scrollWidth,
+ offsetWidth;
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ scrollWidth = Math.max(
+ document.documentElement.scrollWidth,
+ document.body.scrollWidth
+ );
+ offsetWidth = Math.max(
+ document.documentElement.offsetWidth,
+ document.body.offsetWidth
+ );
+
+ if (scrollWidth < offsetWidth) {
+ return $(window).width() + 'px';
+ } else {
+ return scrollWidth + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).width() + 'px';
+ }
+ },
+
+ resize: function() {
+ /* If the dialog is draggable and the user drags it past the
+ * right edge of the window, the document becomes wider so we
+ * need to stretch the overlay. If the user then drags the
+ * dialog back to the left, the document will become narrower,
+ * so we need to shrink the overlay to the appropriate size.
+ * This is handled by shrinking the overlay before setting it
+ * to the full document size.
+ */
+ var $overlays = $([]);
+ $.each($.ui.dialog.overlay.instances, function() {
+ $overlays = $overlays.add(this);
+ });
+
+ $overlays.css({
+ width: 0,
+ height: 0
+ }).css({
+ width: $.ui.dialog.overlay.width(),
+ height: $.ui.dialog.overlay.height()
+ });
+ }
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+ destroy: function() {
+ $.ui.dialog.overlay.destroy(this.$el);
+ }
+});
+
+}(jQuery));
/*
- * jQuery UI Accordion 1.7.2
+ * jQuery UI Slider 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
- * http://docs.jquery.com/UI/Accordion
+ * http://docs.jquery.com/UI/Slider
*
* Depends:
- * ui.core.js
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
*/
-(function($) {
-$.widget("ui.accordion", {
+(function( $ ) {
- _init: function() {
+// number of pages in a slider
+// (how many times can you page up/down to go through the whole range)
+var numPages = 5;
- var o = this.options, self = this;
- this.running = 0;
+$.widget( "ui.slider", $.ui.mouse, {
- // if the user set the alwaysOpen option on init
- // then we need to set the collapsible option
- // if they set both on init, collapsible will take priority
- if (o.collapsible == $.ui.accordion.defaults.collapsible &&
- o.alwaysOpen != $.ui.accordion.defaults.alwaysOpen) {
- o.collapsible = !o.alwaysOpen;
- }
+ widgetEventPrefix: "slide",
- if ( o.navigation ) {
- var current = this.element.find("a").filter(o.navigationFilter);
- if ( current.length ) {
- if ( current.filter(o.header).length ) {
- this.active = current;
- } else {
- this.active = current.parent().parent().prev();
- current.addClass("ui-accordion-content-active");
- }
- }
- }
+ options: {
+ animate: false,
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: "horizontal",
+ range: false,
+ step: 1,
+ value: 0,
+ values: null
+ },
- this.element.addClass("ui-accordion ui-widget ui-helper-reset");
+ _create: function() {
+ var self = this,
+ o = this.options;
- // in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix
- if (this.element[0].nodeName == "UL") {
- this.element.children("li").addClass("ui-accordion-li-fix");
+ this._keySliding = false;
+ this._mouseSliding = false;
+ this._animateOff = true;
+ this._handleIndex = null;
+ this._detectOrientation();
+ this._mouseInit();
+
+ this.element
+ .addClass( "ui-slider" +
+ " ui-slider-" + this.orientation +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all" );
+
+ if ( o.disabled ) {
+ this.element.addClass( "ui-slider-disabled ui-disabled" );
}
- this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all")
- .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); })
- .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); })
- .bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); })
- .bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); });
+ this.range = $([]);
- this.headers
- .next()
- .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+ if ( o.range ) {
+ if ( o.range === true ) {
+ this.range = $( "<div></div>" );
+ if ( !o.values ) {
+ o.values = [ this._valueMin(), this._valueMin() ];
+ }
+ if ( o.values.length && o.values.length !== 2 ) {
+ o.values = [ o.values[0], o.values[0] ];
+ }
+ } else {
+ this.range = $( "<div></div>" );
+ }
- this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");
- this.active.next().addClass('ui-accordion-content-active');
+ this.range
+ .appendTo( this.element )
+ .addClass( "ui-slider-range" );
- //Append icon elements
- $("<span/>").addClass("ui-icon " + o.icons.header).prependTo(this.headers);
- this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);
+ if ( o.range === "min" || o.range === "max" ) {
+ this.range.addClass( "ui-slider-range-" + o.range );
+ }
- // IE7-/Win - Extra vertical space in lists fixed
- if ($.browser.msie) {
- this.element.find('a').css('zoom', '1');
+ // note: this isn't the most fittingly semantic framework class for this element,
+ // but worked best visually with a variety of themes
+ this.range.addClass( "ui-widget-header" );
}
- this.resize();
+ if ( $( ".ui-slider-handle", this.element ).length === 0 ) {
+ $( "<a href='#'></a>" )
+ .appendTo( this.element )
+ .addClass( "ui-slider-handle" );
+ }
- //ARIA
- this.element.attr('role','tablist');
+ if ( o.values && o.values.length ) {
+ while ( $(".ui-slider-handle", this.element).length < o.values.length ) {
+ $( "<a href='#'></a>" )
+ .appendTo( this.element )
+ .addClass( "ui-slider-handle" );
+ }
+ }
- this.headers
- .attr('role','tab')
- .bind('keydown', function(event) { return self._keydown(event); })
- .next()
- .attr('role','tabpanel');
+ this.handles = $( ".ui-slider-handle", this.element )
+ .addClass( "ui-state-default" +
+ " ui-corner-all" );
- this.headers
- .not(this.active || "")
- .attr('aria-expanded','false')
- .attr("tabIndex", "-1")
- .next()
- .hide();
+ this.handle = this.handles.eq( 0 );
- // make sure at least one header is in the tab order
- if (!this.active.length) {
- this.headers.eq(0).attr('tabIndex','0');
- } else {
- this.active
- .attr('aria-expanded','true')
- .attr('tabIndex', '0');
- }
+ this.handles.add( this.range ).filter( "a" )
+ .click(function( event ) {
+ event.preventDefault();
+ })
+ .hover(function() {
+ if ( !o.disabled ) {
+ $( this ).addClass( "ui-state-hover" );
+ }
+ }, function() {
+ $( this ).removeClass( "ui-state-hover" );
+ })
+ .focus(function() {
+ if ( !o.disabled ) {
+ $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" );
+ $( this ).addClass( "ui-state-focus" );
+ } else {
+ $( this ).blur();
+ }
+ })
+ .blur(function() {
+ $( this ).removeClass( "ui-state-focus" );
+ });
- // only need links in taborder for Safari
- if (!$.browser.safari)
- this.headers.find('a').attr('tabIndex','-1');
+ this.handles.each(function( i ) {
+ $( this ).data( "index.ui-slider-handle", i );
+ });
- if (o.event) {
- this.headers.bind((o.event) + ".accordion", function(event) { return self._clickHandler.call(self, event, this); });
- }
+ this.handles
+ .keydown(function( event ) {
+ var ret = true,
+ index = $( this ).data( "index.ui-slider-handle" ),
+ allowed,
+ curVal,
+ newVal,
+ step;
+
+ if ( self.options.disabled ) {
+ return;
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.PAGE_UP:
+ case $.ui.keyCode.PAGE_DOWN:
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ ret = false;
+ if ( !self._keySliding ) {
+ self._keySliding = true;
+ $( this ).addClass( "ui-state-active" );
+ allowed = self._start( event, index );
+ if ( allowed === false ) {
+ return;
+ }
+ }
+ break;
+ }
+
+ step = self.options.step;
+ if ( self.options.values && self.options.values.length ) {
+ curVal = newVal = self.values( index );
+ } else {
+ curVal = newVal = self.value();
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ newVal = self._valueMin();
+ break;
+ case $.ui.keyCode.END:
+ newVal = self._valueMax();
+ break;
+ case $.ui.keyCode.PAGE_UP:
+ newVal = curVal + ( (self._valueMax() - self._valueMin()) / numPages );
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ newVal = curVal - ( (self._valueMax() - self._valueMin()) / numPages );
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ if ( curVal === self._valueMax() ) {
+ return;
+ }
+ newVal = curVal + step;
+ break;
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if ( curVal === self._valueMin() ) {
+ return;
+ }
+ newVal = curVal - step;
+ break;
+ }
+
+ self._slide( event, index, newVal );
+
+ return ret;
+
+ })
+ .keyup(function( event ) {
+ var index = $( this ).data( "index.ui-slider-handle" );
+
+ if ( self._keySliding ) {
+ self._keySliding = false;
+ self._stop( event, index );
+ self._change( event, index );
+ $( this ).removeClass( "ui-state-active" );
+ }
+
+ });
+
+ this._refreshValue();
+ this._animateOff = false;
},
destroy: function() {
- var o = this.options;
+ this.handles.remove();
+ this.range.remove();
this.element
- .removeClass("ui-accordion ui-widget ui-helper-reset")
- .removeAttr("role")
- .unbind('.accordion')
- .removeData('accordion');
+ .removeClass( "ui-slider" +
+ " ui-slider-horizontal" +
+ " ui-slider-vertical" +
+ " ui-slider-disabled" +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all" )
+ .removeData( "slider" )
+ .unbind( ".slider" );
- this.headers
- .unbind(".accordion")
- .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top")
- .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");
+ this._mouseDestroy();
- this.headers.find("a").removeAttr("tabindex");
- this.headers.children(".ui-icon").remove();
- var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");
- if (o.autoHeight || o.fillHeight) {
- contents.css("height", "");
- }
+ return this;
},
- _setData: function(key, value) {
- if(key == 'alwaysOpen') { key = 'collapsible'; value = !value; }
- $.widget.prototype._setData.apply(this, arguments);
- },
+ _mouseCapture: function( event ) {
+ var o = this.options,
+ position,
+ normValue,
+ distance,
+ closestHandle,
+ self,
+ index,
+ allowed,
+ offset,
+ mouseOverHandle;
- _keydown: function(event) {
+ if ( o.disabled ) {
+ return false;
+ }
- var o = this.options, keyCode = $.ui.keyCode;
+ this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ };
+ this.elementOffset = this.element.offset();
- if (o.disabled || event.altKey || event.ctrlKey)
- return;
+ position = { x: event.pageX, y: event.pageY };
+ normValue = this._normValueFromMouse( position );
+ distance = this._valueMax() - this._valueMin() + 1;
+ self = this;
+ this.handles.each(function( i ) {
+ var thisDistance = Math.abs( normValue - self.values(i) );
+ if ( distance > thisDistance ) {
+ distance = thisDistance;
+ closestHandle = $( this );
+ index = i;
+ }
+ });
- var length = this.headers.length;
- var currentIndex = this.headers.index(event.target);
- var toFocus = false;
+ // workaround for bug #3736 (if both handles of a range are at 0,
+ // the first is always used as the one with least distance,
+ // and moving it is obviously prevented by preventing negative ranges)
+ if( o.range === true && this.values(1) === o.min ) {
+ index += 1;
+ closestHandle = $( this.handles[index] );
+ }
- switch(event.keyCode) {
- case keyCode.RIGHT:
- case keyCode.DOWN:
- toFocus = this.headers[(currentIndex + 1) % length];
- break;
- case keyCode.LEFT:
- case keyCode.UP:
- toFocus = this.headers[(currentIndex - 1 + length) % length];
- break;
- case keyCode.SPACE:
- case keyCode.ENTER:
- return this._clickHandler({ target: event.target }, event.target);
- }
-
- if (toFocus) {
- $(event.target).attr('tabIndex','-1');
- $(toFocus).attr('tabIndex','0');
- toFocus.focus();
+ allowed = this._start( event, index );
+ if ( allowed === false ) {
return false;
}
+ this._mouseSliding = true;
- return true;
-
- },
+ self._handleIndex = index;
- resize: function() {
+ closestHandle
+ .addClass( "ui-state-active" )
+ .focus();
+
+ offset = closestHandle.offset();
+ mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" );
+ this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+ left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
+ top: event.pageY - offset.top -
+ ( closestHandle.height() / 2 ) -
+ ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) -
+ ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) +
+ ( parseInt( closestHandle.css("marginTop"), 10 ) || 0)
+ };
- var o = this.options, maxHeight;
+ normValue = this._normValueFromMouse( position );
+ this._slide( event, index, normValue );
+ this._animateOff = true;
+ return true;
+ },
- if (o.fillSpace) {
+ _mouseStart: function( event ) {
+ return true;
+ },
- if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); }
- maxHeight = this.element.parent().height();
- if($.browser.msie) { this.element.parent().css('overflow', defOverflow); }
+ _mouseDrag: function( event ) {
+ var position = { x: event.pageX, y: event.pageY },
+ normValue = this._normValueFromMouse( position );
+
+ this._slide( event, this._handleIndex, normValue );
- this.headers.each(function() {
- maxHeight -= $(this).outerHeight();
- });
+ return false;
+ },
- var maxPadding = 0;
- this.headers.next().each(function() {
- maxPadding = Math.max(maxPadding, $(this).innerHeight() - $(this).height());
- }).height(Math.max(0, maxHeight - maxPadding))
- .css('overflow', 'auto');
+ _mouseStop: function( event ) {
+ this.handles.removeClass( "ui-state-active" );
+ this._mouseSliding = false;
- } else if ( o.autoHeight ) {
- maxHeight = 0;
- this.headers.next().each(function() {
- maxHeight = Math.max(maxHeight, $(this).outerHeight());
- }).height(maxHeight);
- }
+ this._stop( event, this._handleIndex );
+ this._change( event, this._handleIndex );
- },
+ this._handleIndex = null;
+ this._clickOffset = null;
+ this._animateOff = false;
- activate: function(index) {
- // call clickHandler with custom event
- var active = this._findActive(index)[0];
- this._clickHandler({ target: active }, active);
+ return false;
},
-
- _findActive: function(selector) {
- return selector
- ? typeof selector == "number"
- ? this.headers.filter(":eq(" + selector + ")")
- : this.headers.not(this.headers.not(selector))
- : selector === false
- ? $([])
- : this.headers.filter(":eq(0)");
+
+ _detectOrientation: function() {
+ this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
},
- _clickHandler: function(event, target) {
+ _normValueFromMouse: function( position ) {
+ var pixelTotal,
+ pixelMouse,
+ percentMouse,
+ valueTotal,
+ valueMouse;
- var o = this.options;
- if (o.disabled) return false;
+ if ( this.orientation === "horizontal" ) {
+ pixelTotal = this.elementSize.width;
+ pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
+ } else {
+ pixelTotal = this.elementSize.height;
+ pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
+ }
- // called only when using activate(false) to close all parts programmatically
- if (!event.target && o.collapsible) {
- this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
- .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
- this.active.next().addClass('ui-accordion-content-active');
- var toHide = this.active.next(),
- data = {
- options: o,
- newHeader: $([]),
- oldHeader: o.active,
- newContent: $([]),
- oldContent: toHide
- },
- toShow = (this.active = $([]));
- this._toggle(toShow, toHide, data);
- return false;
+ percentMouse = ( pixelMouse / pixelTotal );
+ if ( percentMouse > 1 ) {
+ percentMouse = 1;
+ }
+ if ( percentMouse < 0 ) {
+ percentMouse = 0;
+ }
+ if ( this.orientation === "vertical" ) {
+ percentMouse = 1 - percentMouse;
}
- // get the click target
- var clicked = $(event.currentTarget || target);
- var clickedIsActive = clicked[0] == this.active[0];
+ valueTotal = this._valueMax() - this._valueMin();
+ valueMouse = this._valueMin() + percentMouse * valueTotal;
- // if animations are still active, or the active header is the target, ignore click
- if (this.running || (!o.collapsible && clickedIsActive)) {
- return false;
- }
+ return this._trimAlignValue( valueMouse );
+ },
- // switch classes
- this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
- .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
- this.active.next().addClass('ui-accordion-content-active');
- if (!clickedIsActive) {
- clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top")
- .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);
- clicked.next().addClass('ui-accordion-content-active');
+ _start: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
}
+ return this._trigger( "start", event, uiHash );
+ },
- // find elements to show and hide
- var toShow = clicked.next(),
- toHide = this.active.next(),
- data = {
- options: o,
- newHeader: clickedIsActive && o.collapsible ? $([]) : clicked,
- oldHeader: this.active,
- newContent: clickedIsActive && o.collapsible ? $([]) : toShow.find('> *'),
- oldContent: toHide.find('> *')
- },
- down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+ _slide: function( event, index, newVal ) {
+ var otherVal,
+ newValues,
+ allowed;
- this.active = clickedIsActive ? $([]) : clicked;
- this._toggle(toShow, toHide, data, clickedIsActive, down);
+ if ( this.options.values && this.options.values.length ) {
+ otherVal = this.values( index ? 0 : 1 );
- return false;
+ if ( ( this.options.values.length === 2 && this.options.range === true ) &&
+ ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
+ ) {
+ newVal = otherVal;
+ }
+ if ( newVal !== this.values( index ) ) {
+ newValues = this.values();
+ newValues[ index ] = newVal;
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal,
+ values: newValues
+ } );
+ otherVal = this.values( index ? 0 : 1 );
+ if ( allowed !== false ) {
+ this.values( index, newVal, true );
+ }
+ }
+ } else {
+ if ( newVal !== this.value() ) {
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal
+ } );
+ if ( allowed !== false ) {
+ this.value( newVal );
+ }
+ }
+ }
},
- _toggle: function(toShow, toHide, data, clickedIsActive, down) {
+ _stop: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
- var o = this.options, self = this;
+ this._trigger( "stop", event, uiHash );
+ },
- this.toShow = toShow;
- this.toHide = toHide;
- this.data = data;
+ _change: function( event, index ) {
+ if ( !this._keySliding && !this._mouseSliding ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
- var complete = function() { if(!self) return; return self._completed.apply(self, arguments); };
+ this._trigger( "change", event, uiHash );
+ }
+ },
- // trigger changestart event
- this._trigger("changestart", null, this.data);
+ value: function( newValue ) {
+ if ( arguments.length ) {
+ this.options.value = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, 0 );
+ }
- // count elements to animate
- this.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+ return this._value();
+ },
- if (o.animated) {
+ values: function( index, newValue ) {
+ var vals,
+ newValues,
+ i;
- var animOptions = {};
+ if ( arguments.length > 1 ) {
+ this.options.values[ index ] = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, index );
+ }
- if ( o.collapsible && clickedIsActive ) {
- animOptions = {
- toShow: $([]),
- toHide: toHide,
- complete: complete,
- down: down,
- autoHeight: o.autoHeight || o.fillSpace
- };
+ if ( arguments.length ) {
+ if ( $.isArray( arguments[ 0 ] ) ) {
+ vals = this.options.values;
+ newValues = arguments[ 0 ];
+ for ( i = 0; i < vals.length; i += 1 ) {
+ vals[ i ] = this._trimAlignValue( newValues[ i ] );
+ this._change( null, i );
+ }
+ this._refreshValue();
} else {
- animOptions = {
- toShow: toShow,
- toHide: toHide,
- complete: complete,
- down: down,
- autoHeight: o.autoHeight || o.fillSpace
- };
+ if ( this.options.values && this.options.values.length ) {
+ return this._values( index );
+ } else {
+ return this.value();
+ }
}
+ } else {
+ return this._values();
+ }
+ },
- if (!o.proxied) {
- o.proxied = o.animated;
- }
+ _setOption: function( key, value ) {
+ var i,
+ valsLength = 0;
- if (!o.proxiedDuration) {
- o.proxiedDuration = o.duration;
- }
+ if ( $.isArray( this.options.values ) ) {
+ valsLength = this.options.values.length;
+ }
- o.animated = $.isFunction(o.proxied) ?
- o.proxied(animOptions) : o.proxied;
+ $.Widget.prototype._setOption.apply( this, arguments );
- o.duration = $.isFunction(o.proxiedDuration) ?
- o.proxiedDuration(animOptions) : o.proxiedDuration;
+ switch ( key ) {
+ case "disabled":
+ if ( value ) {
+ this.handles.filter( ".ui-state-focus" ).blur();
+ this.handles.removeClass( "ui-state-hover" );
+ this.handles.attr( "disabled", "disabled" );
+ this.element.addClass( "ui-disabled" );
+ } else {
+ this.handles.removeAttr( "disabled" );
+ this.element.removeClass( "ui-disabled" );
+ }
+ break;
+ case "orientation":
+ this._detectOrientation();
+ this.element
+ .removeClass( "ui-slider-horizontal ui-slider-vertical" )
+ .addClass( "ui-slider-" + this.orientation );
+ this._refreshValue();
+ break;
+ case "value":
+ this._animateOff = true;
+ this._refreshValue();
+ this._change( null, 0 );
+ this._animateOff = false;
+ break;
+ case "values":
+ this._animateOff = true;
+ this._refreshValue();
+ for ( i = 0; i < valsLength; i += 1 ) {
+ this._change( null, i );
+ }
+ this._animateOff = false;
+ break;
+ }
+ },
- var animations = $.ui.accordion.animations,
- duration = o.duration,
- easing = o.animated;
+ //internal value getter
+ // _value() returns value trimmed by min and max, aligned by step
+ _value: function() {
+ var val = this.options.value;
+ val = this._trimAlignValue( val );
- if (!animations[easing]) {
- animations[easing] = function(options) {
- this.slide(options, {
- easing: easing,
- duration: duration || 700
- });
- };
- }
+ return val;
+ },
- animations[easing](animOptions);
+ //internal values getter
+ // _values() returns array of values trimmed by min and max, aligned by step
+ // _values( index ) returns single value trimmed by min and max, aligned by step
+ _values: function( index ) {
+ var val,
+ vals,
+ i;
- } else {
+ if ( arguments.length ) {
+ val = this.options.values[ index ];
+ val = this._trimAlignValue( val );
- if (o.collapsible && clickedIsActive) {
- toShow.toggle();
- } else {
- toHide.hide();
- toShow.show();
+ return val;
+ } else {
+ // .slice() creates a copy of the array
+ // this copy gets trimmed by min and max and then returned
+ vals = this.options.values.slice();
+ for ( i = 0; i < vals.length; i+= 1) {
+ vals[ i ] = this._trimAlignValue( vals[ i ] );
}
- complete(true);
+ return vals;
+ }
+ },
+
+ // returns the step-aligned value that val is closest to, between (inclusive) min and max
+ _trimAlignValue: function( val ) {
+ if ( val < this._valueMin() ) {
+ return this._valueMin();
+ }
+ if ( val > this._valueMax() ) {
+ return this._valueMax();
+ }
+ var step = this.options.step,
+ valModStep = val % step,
+ alignValue = val - valModStep;
+ if ( valModStep >= ( step / 2 ) ) {
+ alignValue += step;
}
- toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur();
- toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus();
+ // Since JavaScript has problems with large floats, round
+ // the final value to 5 digits after the decimal point (see #4124)
+ return parseFloat( alignValue.toFixed(5) );
+ },
+ _valueMin: function() {
+ return this.options.min;
},
- _completed: function(cancel) {
+ _valueMax: function() {
+ return this.options.max;
+ },
+
+ _refreshValue: function() {
+ var oRange = this.options.range,
+ o = this.options,
+ self = this,
+ animate = ( !this._animateOff ) ? o.animate : false,
+ valPercent,
+ _set = {},
+ lastValPercent,
+ value,
+ valueMin,
+ valueMax;
+
+ if ( this.options.values && this.options.values.length ) {
+ this.handles.each(function( i, j ) {
+ valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100;
+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+ if ( self.options.range === true ) {
+ if ( self.orientation === "horizontal" ) {
+ if ( i === 0 ) {
+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ } else {
+ if ( i === 0 ) {
+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ }
+ lastValPercent = valPercent;
+ });
+ } else {
+ value = this.value();
+ valueMin = this._valueMin();
+ valueMax = this._valueMax();
+ valPercent = ( valueMax !== valueMin ) ?
+ ( value - valueMin ) / ( valueMax - valueMin ) * 100 :
+ 0;
+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+
+ if ( oRange === "min" && this.orientation === "horizontal" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "horizontal" ) {
+ this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ if ( oRange === "min" && this.orientation === "vertical" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "vertical" ) {
+ this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ }
- var o = this.options;
+});
- this.running = cancel ? 0 : --this.running;
- if (this.running) return;
-
- if (o.clearStyle) {
- this.toShow.add(this.toHide).css({
- height: "",
- overflow: ""
- });
- }
-
- this._trigger('change', null, this.data);
- }
-
-});
-
-
-$.extend($.ui.accordion, {
- version: "1.7.2",
- defaults: {
- active: null,
- alwaysOpen: true, //deprecated, use collapsible
- animated: 'slide',
- autoHeight: true,
- clearStyle: false,
- collapsible: false,
- event: "click",
- fillSpace: false,
- header: "> li > :first-child,> :not(li):even",
- icons: {
- header: "ui-icon-triangle-1-e",
- headerSelected: "ui-icon-triangle-1-s"
- },
- navigation: false,
- navigationFilter: function() {
- return this.href.toLowerCase() == location.href.toLowerCase();
- }
- },
- animations: {
- slide: function(options, additions) {
- options = $.extend({
- easing: "swing",
- duration: 300
- }, options, additions);
- if ( !options.toHide.size() ) {
- options.toShow.animate({height: "show"}, options);
- return;
- }
- if ( !options.toShow.size() ) {
- options.toHide.animate({height: "hide"}, options);
- return;
- }
- var overflow = options.toShow.css('overflow'),
- percentDone,
- showProps = {},
- hideProps = {},
- fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
- originalWidth;
- // fix width before calculating height of hidden element
- var s = options.toShow;
- originalWidth = s[0].style.width;
- s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) );
-
- $.each(fxAttrs, function(i, prop) {
- hideProps[prop] = 'hide';
-
- var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/);
- showProps[prop] = {
- value: parts[1],
- unit: parts[2] || 'px'
- };
- });
- options.toShow.css({ height: 0, overflow: 'hidden' }).show();
- options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{
- step: function(now, settings) {
- // only calculate the percent when animating height
- // IE gets very inconsistent results when animating elements
- // with small values, which is common for padding
- if (settings.prop == 'height') {
- percentDone = (settings.now - settings.start) / (settings.end - settings.start);
- }
-
- options.toShow[0].style[settings.prop] =
- (percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit;
- },
- duration: options.duration,
- easing: options.easing,
- complete: function() {
- if ( !options.autoHeight ) {
- options.toShow.css("height", "");
- }
- options.toShow.css("width", originalWidth);
- options.toShow.css({overflow: overflow});
- options.complete();
- }
- });
- },
- bounceslide: function(options) {
- this.slide(options, {
- easing: options.down ? "easeOutBounce" : "swing",
- duration: options.down ? 1000 : 200
- });
- },
- easeslide: function(options) {
- this.slide(options, {
- easing: "easeinout",
- duration: 700
- });
- }
- }
+$.extend( $.ui.slider, {
+ version: "1.8.1"
});
-})(jQuery);
+}(jQuery));
/*
- * jQuery UI Datepicker 1.7.2
+ * jQuery UI Tabs 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
- * http://docs.jquery.com/UI/Datepicker
+ * http://docs.jquery.com/UI/Tabs
*
* Depends:
- * ui.core.js
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
*/
+(function($) {
-(function($) { // hide the namespace
+var tabId = 0,
+ listId = 0;
-$.extend($.ui, { datepicker: { version: "1.7.2" } });
+$.widget("ui.tabs", {
+ options: {
+ add: null,
+ ajaxOptions: null,
+ cache: false,
+ cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+ collapsible: false,
+ disable: null,
+ disabled: [],
+ enable: null,
+ event: 'click',
+ fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
+ idPrefix: 'ui-tabs-',
+ load: null,
+ panelTemplate: '<div></div>',
+ remove: null,
+ select: null,
+ show: null,
+ spinner: '<em>Loading…</em>',
+ tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
+ },
+ _create: function() {
+ this._tabify(true);
+ },
-var PROP_NAME = 'datepicker';
+ _setOption: function(key, value) {
+ if (key == 'selected') {
+ if (this.options.collapsible && value == this.options.selected) {
+ return;
+ }
+ this.select(value);
+ }
+ else {
+ this.options[key] = value;
+ this._tabify();
+ }
+ },
-/* Date picker manager.
- Use the singleton instance of this class, $.datepicker, to interact with the date picker.
- Settings for (groups of) date pickers are maintained in an instance object,
- allowing multiple different settings on the same page. */
+ _tabId: function(a) {
+ return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
+ this.options.idPrefix + (++tabId);
+ },
-function Datepicker() {
- this.debug = false; // Change this to true to start debugging
- this._curInst = null; // The current instance in use
- this._keyEvent = false; // If the last event was a key event
- this._disabledInputs = []; // List of date picker inputs that have been disabled
- this._datepickerShowing = false; // True if the popup picker is showing , false if not
- this._inDialog = false; // True if showing within a "dialog", false if not
- this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
- this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
- this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
- this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
- this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
- this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
- this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
- this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
- this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
- this.regional = []; // Available regional settings, indexed by language code
- this.regional[''] = { // Default regional settings
- closeText: 'Done', // Display text for close link
- prevText: 'Prev', // Display text for previous month link
- nextText: 'Next', // Display text for next month link
- currentText: 'Today', // Display text for current month link
- monthNames: ['January','February','March','April','May','June',
- 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
- monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
- dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
- dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
- dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
- dateFormat: 'mm/dd/yy', // See format options on parseDate
- firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
- isRTL: false // True if right-to-left language, false if left-to-right
- };
- this._defaults = { // Global defaults for all the date picker instances
- showOn: 'focus', // 'focus' for popup on focus,
- // 'button' for trigger button, or 'both' for either
- showAnim: 'show', // Name of jQuery animation for popup
- showOptions: {}, // Options for enhanced animations
- defaultDate: null, // Used when field is blank: actual date,
- // +/-number for offset from today, null for today
- appendText: '', // Display text following the input box, e.g. showing the format
- buttonText: '...', // Text for trigger button
- buttonImage: '', // URL for trigger button image
- buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
- hideIfNoPrevNext: false, // True to hide next/previous month links
- // if not applicable, false to just disable them
- navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
- gotoCurrent: false, // True if today link goes back to current selection instead
- changeMonth: false, // True if month can be selected directly, false if only prev/next
- changeYear: false, // True if year can be selected directly, false if only prev/next
- showMonthAfterYear: false, // True if the year select precedes month, false for month then year
- yearRange: '-10:+10', // Range of years to display in drop-down,
- // either relative to current year (-nn:+nn) or absolute (nnnn:nnnn)
- showOtherMonths: false, // True to show dates in other months, false to leave blank
- calculateWeek: this.iso8601Week, // How to calculate the week of the year,
- // takes a Date and returns the number of the week for it
- shortYearCutoff: '+10', // Short year values < this are in the current century,
- // > this are in the previous century,
- // string value starting with '+' for current year + value
- minDate: null, // The earliest selectable date, or null for no limit
- maxDate: null, // The latest selectable date, or null for no limit
- duration: 'normal', // Duration of display/closure
- beforeShowDay: null, // Function that takes a date and returns an array with
- // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
- // [2] = cell title (optional), e.g. $.datepicker.noWeekends
- beforeShow: null, // Function that takes an input field and
- // returns a set of custom settings for the date picker
- onSelect: null, // Define a callback function when a date is selected
- onChangeMonthYear: null, // Define a callback function when the month or year is changed
- onClose: null, // Define a callback function when the datepicker is closed
- numberOfMonths: 1, // Number of months to show at a time
- showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
- stepMonths: 1, // Number of months to step back/forward
- stepBigMonths: 12, // Number of months to step back/forward for the big links
- altField: '', // Selector for an alternate field to store selected dates into
- altFormat: '', // The date format to use for the alternate field
- constrainInput: true, // The input is constrained by the current date format
- showButtonPanel: false // True to show button panel, false to not show it
- };
- $.extend(this._defaults, this.regional['']);
- this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
-}
+ _sanitizeSelector: function(hash) {
+ return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
+ },
-$.extend(Datepicker.prototype, {
- /* Class name added to elements to indicate already configured with a date picker. */
- markerClassName: 'hasDatepicker',
+ _cookie: function() {
+ var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + (++listId));
+ return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
+ },
- /* Debug logging (if enabled). */
- log: function () {
- if (this.debug)
- console.log.apply('', arguments);
+ _ui: function(tab, panel) {
+ return {
+ tab: tab,
+ panel: panel,
+ index: this.anchors.index(tab)
+ };
},
- /* Override the default settings for all instances of the date picker.
- @param settings object - the new settings to use as defaults (anonymous object)
- @return the manager object */
- setDefaults: function(settings) {
- extendRemove(this._defaults, settings || {});
- return this;
+ _cleanup: function() {
+ // restore all former loading tabs labels
+ this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
+ .find('span:data(label.tabs)')
+ .each(function() {
+ var el = $(this);
+ el.html(el.data('label.tabs')).removeData('label.tabs');
+ });
},
- /* Attach the date picker to a jQuery selection.
- @param target element - the target input field or division or span
- @param settings object - the new settings to use for this date picker instance (anonymous) */
- _attachDatepicker: function(target, settings) {
- // check for settings on the control itself - in namespace 'date:'
- var inlineSettings = null;
- for (var attrName in this._defaults) {
- var attrValue = target.getAttribute('date:' + attrName);
- if (attrValue) {
- inlineSettings = inlineSettings || {};
- try {
- inlineSettings[attrName] = eval(attrValue);
- } catch (err) {
- inlineSettings[attrName] = attrValue;
+ _tabify: function(init) {
+
+ this.list = this.element.find('ol,ul').eq(0);
+ this.lis = $('li:has(a[href])', this.list);
+ this.anchors = this.lis.map(function() { return $('a', this)[0]; });
+ this.panels = $([]);
+
+ var self = this, o = this.options;
+
+ var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+ this.anchors.each(function(i, a) {
+ var href = $(a).attr('href');
+
+ // For dynamically created HTML that contains a hash as href IE < 8 expands
+ // such href to the full page url with hash and then misinterprets tab as ajax.
+ // Same consideration applies for an added tab with a fragment identifier
+ // since a[href=#fragment-identifier] does unexpectedly not match.
+ // Thus normalize href attribute...
+ var hrefBase = href.split('#')[0], baseEl;
+ if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
+ (baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
+ href = a.hash;
+ a.href = href;
+ }
+
+ // inline tab
+ if (fragmentId.test(href)) {
+ self.panels = self.panels.add(self._sanitizeSelector(href));
+ }
+
+ // remote tab
+ else if (href != '#') { // prevent loading the page itself if href is just "#"
+ $.data(a, 'href.tabs', href); // required for restore on destroy
+
+ // TODO until #3808 is fixed strip fragment identifier from url
+ // (IE fails to load from such url)
+ $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
+
+ var id = self._tabId(a);
+ a.href = '#' + id;
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
+ .insertAfter(self.panels[i - 1] || self.list);
+ $panel.data('destroy.tabs', true);
}
+ self.panels = self.panels.add($panel);
}
- }
- var nodeName = target.nodeName.toLowerCase();
- var inline = (nodeName == 'div' || nodeName == 'span');
- if (!target.id)
- target.id = 'dp' + (++this.uuid);
- var inst = this._newInst($(target), inline);
- inst.settings = $.extend({}, settings || {}, inlineSettings || {});
- if (nodeName == 'input') {
- this._connectDatepicker(target, inst);
- } else if (inline) {
- this._inlineDatepicker(target, inst);
- }
- },
- /* Create a new instance object. */
- _newInst: function(target, inline) {
- var id = target[0].id.replace(/([:\[\]\.])/g, '\\\\$1'); // escape jQuery meta chars
- return {id: id, input: target, // associated target
- selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
- drawMonth: 0, drawYear: 0, // month being drawn
- inline: inline, // is datepicker inline or not
- dpDiv: (!inline ? this.dpDiv : // presentation div
- $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
- },
+ // invalid tab href
+ else {
+ o.disabled.push(i);
+ }
+ });
- /* Attach the date picker to an input field. */
- _connectDatepicker: function(target, inst) {
- var input = $(target);
- inst.append = $([]);
- inst.trigger = $([]);
- if (input.hasClass(this.markerClassName))
- return;
- var appendText = this._get(inst, 'appendText');
- var isRTL = this._get(inst, 'isRTL');
- if (appendText) {
- inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
- input[isRTL ? 'before' : 'after'](inst.append);
- }
- var showOn = this._get(inst, 'showOn');
- if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
- input.focus(this._showDatepicker);
- if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
- var buttonText = this._get(inst, 'buttonText');
- var buttonImage = this._get(inst, 'buttonImage');
- inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
- $('<img/>').addClass(this._triggerClass).
- attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
- $('<button type="button"></button>').addClass(this._triggerClass).
- html(buttonImage == '' ? buttonText : $('<img/>').attr(
- { src:buttonImage, alt:buttonText, title:buttonText })));
- input[isRTL ? 'before' : 'after'](inst.trigger);
- inst.trigger.click(function() {
- if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target)
- $.datepicker._hideDatepicker();
- else
- $.datepicker._showDatepicker(target);
- return false;
- });
- }
- input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).
- bind("setData.datepicker", function(event, key, value) {
- inst.settings[key] = value;
- }).bind("getData.datepicker", function(event, key) {
- return this._get(inst, key);
- });
- $.data(target, PROP_NAME, inst);
- },
+ // initialization from scratch
+ if (init) {
- /* Attach an inline date picker to a div. */
- _inlineDatepicker: function(target, inst) {
- var divSpan = $(target);
- if (divSpan.hasClass(this.markerClassName))
- return;
- divSpan.addClass(this.markerClassName).append(inst.dpDiv).
- bind("setData.datepicker", function(event, key, value){
- inst.settings[key] = value;
- }).bind("getData.datepicker", function(event, key){
- return this._get(inst, key);
+ // attach necessary classes for styling
+ this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
+ this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+ this.lis.addClass('ui-state-default ui-corner-top');
+ this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
+
+ // Selected tab
+ // use "selected" option or try to retrieve:
+ // 1. from fragment identifier in url
+ // 2. from cookie
+ // 3. from selected class attribute on <li>
+ if (o.selected === undefined) {
+ if (location.hash) {
+ this.anchors.each(function(i, a) {
+ if (a.hash == location.hash) {
+ o.selected = i;
+ return false; // break
+ }
+ });
+ }
+ if (typeof o.selected != 'number' && o.cookie) {
+ o.selected = parseInt(self._cookie(), 10);
+ }
+ if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+ }
+ o.selected = o.selected || (this.lis.length ? 0 : -1);
+ }
+ else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
+ o.selected = -1;
+ }
+
+ // sanity check - default to first tab...
+ o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ // A selected tab cannot become disabled.
+ o.disabled = $.unique(o.disabled.concat(
+ $.map(this.lis.filter('.ui-state-disabled'),
+ function(n, i) { return self.lis.index(n); } )
+ )).sort();
+
+ if ($.inArray(o.selected, o.disabled) != -1) {
+ o.disabled.splice($.inArray(o.selected, o.disabled), 1);
+ }
+
+ // highlight selected tab
+ this.panels.addClass('ui-tabs-hide');
+ this.lis.removeClass('ui-tabs-selected ui-state-active');
+ if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
+ this.panels.eq(o.selected).removeClass('ui-tabs-hide');
+ this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');
+
+ // seems to be expected behavior that the show callback is fired
+ self.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
+ });
+
+ this.load(o.selected);
+ }
+
+ // clean up to avoid memory leaks in certain versions of IE 6
+ $(window).bind('unload', function() {
+ self.lis.add(self.anchors).unbind('.tabs');
+ self.lis = self.anchors = self.panels = null;
});
- $.data(target, PROP_NAME, inst);
- this._setDate(inst, this._getDefaultDate(inst));
- this._updateDatepicker(inst);
- this._updateAlternate(inst);
- },
- /* Pop-up the date picker in a "dialog" box.
- @param input element - ignored
- @param dateText string - the initial date to display (in the current format)
- @param onSelect function - the function(dateText) to call when a date is selected
- @param settings object - update the dialog date picker instance's settings (anonymous object)
- @param pos int[2] - coordinates for the dialog's position within the screen or
- event - with x/y coordinates or
- leave empty for default (screen centre)
- @return the manager object */
- _dialogDatepicker: function(input, dateText, onSelect, settings, pos) {
- var inst = this._dialogInst; // internal instance
- if (!inst) {
- var id = 'dp' + (++this.uuid);
- this._dialogInput = $('<input type="text" id="' + id +
- '" size="1" style="position: absolute; top: -100px;"/>');
- this._dialogInput.keydown(this._doKeyDown);
- $('body').append(this._dialogInput);
- inst = this._dialogInst = this._newInst(this._dialogInput, false);
- inst.settings = {};
- $.data(this._dialogInput[0], PROP_NAME, inst);
}
- extendRemove(inst.settings, settings || {});
- this._dialogInput.val(dateText);
-
- this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
- if (!this._pos) {
- var browserWidth = window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth;
- var browserHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight;
- var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
- var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
- this._pos = // should use actual width/height below
- [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ // update selected after add/remove
+ else {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
}
- // move input on screen for focus, but hidden behind dialog
- this._dialogInput.css('left', this._pos[0] + 'px').css('top', this._pos[1] + 'px');
- inst.settings.onSelect = onSelect;
- this._inDialog = true;
- this.dpDiv.addClass(this._dialogClass);
- this._showDatepicker(this._dialogInput[0]);
- if ($.blockUI)
- $.blockUI(this.dpDiv);
- $.data(this._dialogInput[0], PROP_NAME, inst);
- return this;
- },
+ // update collapsible
+ this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');
- /* Detach a datepicker from its control.
- @param target element - the target input field or division or span */
- _destroyDatepicker: function(target) {
- var $target = $(target);
- var inst = $.data(target, PROP_NAME);
- if (!$target.hasClass(this.markerClassName)) {
- return;
+ // set or update cookie after init and add/remove respectively
+ if (o.cookie) {
+ this._cookie(o.selected, o.cookie);
}
- var nodeName = target.nodeName.toLowerCase();
- $.removeData(target, PROP_NAME);
- if (nodeName == 'input') {
- inst.append.remove();
- inst.trigger.remove();
- $target.removeClass(this.markerClassName).
- unbind('focus', this._showDatepicker).
- unbind('keydown', this._doKeyDown).
- unbind('keypress', this._doKeyPress);
- } else if (nodeName == 'div' || nodeName == 'span')
- $target.removeClass(this.markerClassName).empty();
- },
- /* Enable the date picker to a jQuery selection.
- @param target element - the target input field or division or span */
- _enableDatepicker: function(target) {
- var $target = $(target);
- var inst = $.data(target, PROP_NAME);
- if (!$target.hasClass(this.markerClassName)) {
- return;
- }
- var nodeName = target.nodeName.toLowerCase();
- if (nodeName == 'input') {
- target.disabled = false;
- inst.trigger.filter('button').
- each(function() { this.disabled = false; }).end().
- filter('img').css({opacity: '1.0', cursor: ''});
- }
- else if (nodeName == 'div' || nodeName == 'span') {
- var inline = $target.children('.' + this._inlineClass);
- inline.children().removeClass('ui-state-disabled');
+ // disable tabs
+ for (var i = 0, li; (li = this.lis[i]); i++) {
+ $(li)[$.inArray(i, o.disabled) != -1 &&
+ !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
}
- this._disabledInputs = $.map(this._disabledInputs,
- function(value) { return (value == target ? null : value); }); // delete entry
- },
- /* Disable the date picker to a jQuery selection.
- @param target element - the target input field or division or span */
- _disableDatepicker: function(target) {
- var $target = $(target);
- var inst = $.data(target, PROP_NAME);
- if (!$target.hasClass(this.markerClassName)) {
- return;
- }
- var nodeName = target.nodeName.toLowerCase();
- if (nodeName == 'input') {
- target.disabled = true;
- inst.trigger.filter('button').
- each(function() { this.disabled = true; }).end().
- filter('img').css({opacity: '0.5', cursor: 'default'});
- }
- else if (nodeName == 'div' || nodeName == 'span') {
- var inline = $target.children('.' + this._inlineClass);
- inline.children().addClass('ui-state-disabled');
+ // reset cache if switching from cached to not cached
+ if (o.cache === false) {
+ this.anchors.removeData('cache.tabs');
}
- this._disabledInputs = $.map(this._disabledInputs,
- function(value) { return (value == target ? null : value); }); // delete entry
- this._disabledInputs[this._disabledInputs.length] = target;
- },
- /* Is the first field in a jQuery collection disabled as a datepicker?
- @param target element - the target input field or division or span
- @return boolean - true if disabled, false if enabled */
- _isDisabledDatepicker: function(target) {
- if (!target) {
- return false;
- }
- for (var i = 0; i < this._disabledInputs.length; i++) {
- if (this._disabledInputs[i] == target)
- return true;
- }
- return false;
- },
+ // remove all handlers before, tabify may run on existing tabs after add or option change
+ this.lis.add(this.anchors).unbind('.tabs');
- /* Retrieve the instance data for the target control.
- @param target element - the target input field or division or span
- @return object - the associated instance data
- @throws error if a jQuery problem getting data */
- _getInst: function(target) {
- try {
- return $.data(target, PROP_NAME);
- }
- catch (err) {
- throw 'Missing instance data for this datepicker';
+ if (o.event != 'mouseover') {
+ var addState = function(state, el) {
+ if (el.is(':not(.ui-state-disabled)')) {
+ el.addClass('ui-state-' + state);
+ }
+ };
+ var removeState = function(state, el) {
+ el.removeClass('ui-state-' + state);
+ };
+ this.lis.bind('mouseover.tabs', function() {
+ addState('hover', $(this));
+ });
+ this.lis.bind('mouseout.tabs', function() {
+ removeState('hover', $(this));
+ });
+ this.anchors.bind('focus.tabs', function() {
+ addState('focus', $(this).closest('li'));
+ });
+ this.anchors.bind('blur.tabs', function() {
+ removeState('focus', $(this).closest('li'));
+ });
}
- },
- /* Update or retrieve the settings for a date picker attached to an input field or division.
- @param target element - the target input field or division or span
- @param name object - the new settings to update or
- string - the name of the setting to change or retrieve,
- when retrieving also 'all' for all instance settings or
- 'defaults' for all global defaults
- @param value any - the new value for the setting
- (omit if above is an object or to retrieve a value) */
- _optionDatepicker: function(target, name, value) {
- var inst = this._getInst(target);
- if (arguments.length == 2 && typeof name == 'string') {
- return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
- (inst ? (name == 'all' ? $.extend({}, inst.settings) :
- this._get(inst, name)) : null));
- }
- var settings = name || {};
- if (typeof name == 'string') {
- settings = {};
- settings[name] = value;
+ // set up animations
+ var hideFx, showFx;
+ if (o.fx) {
+ if ($.isArray(o.fx)) {
+ hideFx = o.fx[0];
+ showFx = o.fx[1];
+ }
+ else {
+ hideFx = showFx = o.fx;
+ }
}
- if (inst) {
- if (this._curInst == inst) {
- this._hideDatepicker(null);
+
+ // Reset certain styles left over from animation
+ // and prevent IE's ClearType bug...
+ function resetStyle($el, fx) {
+ $el.css({ display: '' });
+ if (!$.support.opacity && fx.opacity) {
+ $el[0].style.removeAttribute('filter');
}
- var date = this._getDateDatepicker(target);
- extendRemove(inst.settings, settings);
- this._setDateDatepicker(target, date);
- this._updateDatepicker(inst);
}
- },
- // change method deprecated
- _changeDatepicker: function(target, name, value) {
- this._optionDatepicker(target, name, value);
- },
+ // Show a tab...
+ var showTab = showFx ?
+ function(clicked, $show) {
+ $(clicked).closest('li').addClass('ui-tabs-selected ui-state-active');
+ $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
+ .animate(showFx, showFx.duration || 'normal', function() {
+ resetStyle($show, showFx);
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ });
+ } :
+ function(clicked, $show) {
+ $(clicked).closest('li').addClass('ui-tabs-selected ui-state-active');
+ $show.removeClass('ui-tabs-hide');
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ };
- /* Redraw the date picker attached to an input field or division.
- @param target element - the target input field or division or span */
- _refreshDatepicker: function(target) {
- var inst = this._getInst(target);
- if (inst) {
- this._updateDatepicker(inst);
- }
- },
+ // Hide a tab, $show is optional...
+ var hideTab = hideFx ?
+ function(clicked, $hide) {
+ $hide.animate(hideFx, hideFx.duration || 'normal', function() {
+ self.lis.removeClass('ui-tabs-selected ui-state-active');
+ $hide.addClass('ui-tabs-hide');
+ resetStyle($hide, hideFx);
+ self.element.dequeue("tabs");
+ });
+ } :
+ function(clicked, $hide, $show) {
+ self.lis.removeClass('ui-tabs-selected ui-state-active');
+ $hide.addClass('ui-tabs-hide');
+ self.element.dequeue("tabs");
+ };
- /* Set the dates for a jQuery selection.
- @param target element - the target input field or division or span
- @param date Date - the new date
- @param endDate Date - the new end date for a range (optional) */
- _setDateDatepicker: function(target, date, endDate) {
- var inst = this._getInst(target);
- if (inst) {
- this._setDate(inst, date, endDate);
- this._updateDatepicker(inst);
- this._updateAlternate(inst);
- }
- },
+ // attach tab event handler, unbind to avoid duplicates from former tabifying...
+ this.anchors.bind(o.event + '.tabs', function() {
+ var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
+ $show = $(self._sanitizeSelector(this.hash));
- /* Get the date(s) for the first entry in a jQuery selection.
- @param target element - the target input field or division or span
- @return Date - the current date or
- Date[2] - the current dates for a range */
- _getDateDatepicker: function(target) {
- var inst = this._getInst(target);
- if (inst && !inst.inline)
- this._setDateFromField(inst);
- return (inst ? this._getDate(inst) : null);
- },
+ // If tab is already selected and not collapsible or tab disabled or
+ // or is already loading or click callback returns false stop here.
+ // Check if click handler returns false last so that it is not executed
+ // for a disabled or loading tab!
+ if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
+ $li.hasClass('ui-state-disabled') ||
+ $li.hasClass('ui-state-processing') ||
+ self._trigger('select', null, self._ui(this, $show[0])) === false) {
+ this.blur();
+ return false;
+ }
- /* Handle keystrokes. */
- _doKeyDown: function(event) {
- var inst = $.datepicker._getInst(event.target);
- var handled = true;
- var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
- inst._keyEvent = true;
- if ($.datepicker._datepickerShowing)
- switch (event.keyCode) {
- case 9: $.datepicker._hideDatepicker(null, '');
- break; // hide on tab out
- case 13: var sel = $('td.' + $.datepicker._dayOverClass +
- ', td.' + $.datepicker._currentClass, inst.dpDiv);
- if (sel[0])
- $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
- else
- $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
- return false; // don't submit the form
- break; // select the value on enter
- case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
- break; // hide on escape
- case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- -$.datepicker._get(inst, 'stepBigMonths') :
- -$.datepicker._get(inst, 'stepMonths')), 'M');
- break; // previous month/year on page up/+ ctrl
- case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- +$.datepicker._get(inst, 'stepBigMonths') :
- +$.datepicker._get(inst, 'stepMonths')), 'M');
- break; // next month/year on page down/+ ctrl
- case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
- handled = event.ctrlKey || event.metaKey;
- break; // clear on ctrl or command +end
- case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
- handled = event.ctrlKey || event.metaKey;
- break; // current on ctrl or command +home
- case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
- handled = event.ctrlKey || event.metaKey;
- // -1 day on ctrl or command +left
- if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- -$.datepicker._get(inst, 'stepBigMonths') :
- -$.datepicker._get(inst, 'stepMonths')), 'M');
- // next month/year on alt +left on Mac
- break;
- case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
- handled = event.ctrlKey || event.metaKey;
- break; // -1 week on ctrl or command +up
- case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
- handled = event.ctrlKey || event.metaKey;
- // +1 day on ctrl or command +right
- if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- +$.datepicker._get(inst, 'stepBigMonths') :
- +$.datepicker._get(inst, 'stepMonths')), 'M');
- // next month/year on alt +right
- break;
- case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
- handled = event.ctrlKey || event.metaKey;
- break; // +1 week on ctrl or command +down
- default: handled = false;
- }
- else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
- $.datepicker._showDatepicker(this);
- else {
- handled = false;
- }
- if (handled) {
- event.preventDefault();
- event.stopPropagation();
- }
- },
+ o.selected = self.anchors.index(this);
- /* Filter entered characters - based on date format. */
- _doKeyPress: function(event) {
- var inst = $.datepicker._getInst(event.target);
- if ($.datepicker._get(inst, 'constrainInput')) {
- var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
- var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
- return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
- }
- },
+ self.abort();
- /* Pop-up the date picker for a given input field.
- @param input element - the input field attached to the date picker or
- event - if triggered by focus */
- _showDatepicker: function(input) {
- input = input.target || input;
- if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
- input = $('input', input.parentNode)[0];
- if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
- return;
- var inst = $.datepicker._getInst(input);
- var beforeShow = $.datepicker._get(inst, 'beforeShow');
- extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
- $.datepicker._hideDatepicker(null, '');
- $.datepicker._lastInput = input;
- $.datepicker._setDateFromField(inst);
- if ($.datepicker._inDialog) // hide cursor
- input.value = '';
- if (!$.datepicker._pos) { // position below input
- $.datepicker._pos = $.datepicker._findPos(input);
- $.datepicker._pos[1] += input.offsetHeight; // add the height
- }
- var isFixed = false;
- $(input).parents().each(function() {
- isFixed |= $(this).css('position') == 'fixed';
- return !isFixed;
- });
- if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
- $.datepicker._pos[0] -= document.documentElement.scrollLeft;
- $.datepicker._pos[1] -= document.documentElement.scrollTop;
- }
- var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
- $.datepicker._pos = null;
- inst.rangeStart = null;
- // determine sizing offscreen
- inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
- $.datepicker._updateDatepicker(inst);
- // fix width for dynamic number of date pickers
- // and adjust position before showing
- offset = $.datepicker._checkOffset(inst, offset, isFixed);
- inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
- 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
- left: offset.left + 'px', top: offset.top + 'px'});
- if (!inst.inline) {
- var showAnim = $.datepicker._get(inst, 'showAnim') || 'show';
- var duration = $.datepicker._get(inst, 'duration');
- var postProcess = function() {
- $.datepicker._datepickerShowing = true;
- if ($.browser.msie && parseInt($.browser.version,10) < 7) // fix IE < 7 select problems
- $('iframe.ui-datepicker-cover').css({width: inst.dpDiv.width() + 4,
- height: inst.dpDiv.height() + 4});
- };
- if ($.effects && $.effects[showAnim])
- inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
- else
- inst.dpDiv[showAnim](duration, postProcess);
- if (duration == '')
- postProcess();
- if (inst.input[0].type != 'hidden')
- inst.input[0].focus();
- $.datepicker._curInst = inst;
- }
- },
+ // if tab may be closed
+ if (o.collapsible) {
+ if ($li.hasClass('ui-tabs-selected')) {
+ o.selected = -1;
- /* Generate the date picker content. */
- _updateDatepicker: function(inst) {
- var dims = {width: inst.dpDiv.width() + 4,
- height: inst.dpDiv.height() + 4};
- var self = this;
- inst.dpDiv.empty().append(this._generateHTML(inst))
- .find('iframe.ui-datepicker-cover').
- css({width: dims.width, height: dims.height})
- .end()
- .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
- .bind('mouseout', function(){
- $(this).removeClass('ui-state-hover');
- if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
- if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
- })
- .bind('mouseover', function(){
- if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
- $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
- $(this).addClass('ui-state-hover');
- if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
- if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
}
- })
- .end()
- .find('.' + this._dayOverClass + ' a')
- .trigger('mouseover')
- .end();
- var numMonths = this._getNumberOfMonths(inst);
- var cols = numMonths[1];
- var width = 17;
- if (cols > 1) {
- inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
- } else {
- inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
- }
- inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
- 'Class']('ui-datepicker-multi');
- inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
- 'Class']('ui-datepicker-rtl');
- if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst)
- $(inst.input[0]).focus();
- },
-
- /* Check positioning to remain on screen. */
- _checkOffset: function(inst, offset, isFixed) {
- var dpWidth = inst.dpDiv.outerWidth();
- var dpHeight = inst.dpDiv.outerHeight();
- var inputWidth = inst.input ? inst.input.outerWidth() : 0;
- var inputHeight = inst.input ? inst.input.outerHeight() : 0;
- var viewWidth = (window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth) + $(document).scrollLeft();
- var viewHeight = (window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight) + $(document).scrollTop();
-
- offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
- offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
- offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
- // now check if datepicker is showing outside window viewport - move to a better place if so.
- offset.left -= (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? Math.abs(offset.left + dpWidth - viewWidth) : 0;
- offset.top -= (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? Math.abs(offset.top + dpHeight + inputHeight*2 - viewHeight) : 0;
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ }).dequeue("tabs");
+
+ this.blur();
+ return false;
+ }
+ else if (!$hide.length) {
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
- return offset;
- },
+ self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
+
+ this.blur();
+ return false;
+ }
+ }
- /* Find an object's position on the screen. */
- _findPos: function(obj) {
- while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
- obj = obj.nextSibling;
- }
- var position = $(obj).offset();
- return [position.left, position.top];
- },
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
- /* Hide the date picker from view.
- @param input element - the input field attached to the date picker
- @param duration string - the duration over which to close the date picker */
- _hideDatepicker: function(input, duration) {
- var inst = this._curInst;
- if (!inst || (input && inst != $.data(input, PROP_NAME)))
- return;
- if (inst.stayOpen)
- this._selectDate('#' + inst.id, this._formatDate(inst,
- inst.currentDay, inst.currentMonth, inst.currentYear));
- inst.stayOpen = false;
- if (this._datepickerShowing) {
- duration = (duration != null ? duration : this._get(inst, 'duration'));
- var showAnim = this._get(inst, 'showAnim');
- var postProcess = function() {
- $.datepicker._tidyDialog(inst);
- };
- if (duration != '' && $.effects && $.effects[showAnim])
- inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'),
- duration, postProcess);
- else
- inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' :
- (showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess);
- if (duration == '')
- this._tidyDialog(inst);
- var onClose = this._get(inst, 'onClose');
- if (onClose)
- onClose.apply((inst.input ? inst.input[0] : null),
- [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
- this._datepickerShowing = false;
- this._lastInput = null;
- if (this._inDialog) {
- this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
- if ($.blockUI) {
- $.unblockUI();
- $('body').append(this.dpDiv);
+ // show new tab
+ if ($show.length) {
+ if ($hide.length) {
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ });
}
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
+
+ self.load(self.anchors.index(this));
+ }
+ else {
+ throw 'jQuery UI Tabs: Mismatching fragment identifier.';
}
- this._inDialog = false;
- }
- this._curInst = null;
- },
- /* Tidy up after a dialog display. */
- _tidyDialog: function(inst) {
- inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
- },
+ // Prevent IE from keeping other link focussed when using the back button
+ // and remove dotted border from clicked link. This is controlled via CSS
+ // in modern browsers; blur() removes focus from address bar in Firefox
+ // which can become a usability and annoying problem with tabs('rotate').
+ if ($.browser.msie) {
+ this.blur();
+ }
- /* Close date picker if clicked elsewhere. */
- _checkExternalClick: function(event) {
- if (!$.datepicker._curInst)
- return;
- var $target = $(event.target);
- if (($target.parents('#' + $.datepicker._mainDivId).length == 0) &&
- !$target.hasClass($.datepicker.markerClassName) &&
- !$target.hasClass($.datepicker._triggerClass) &&
- $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
- $.datepicker._hideDatepicker(null, '');
- },
+ });
- /* Adjust one of the date sub-fields. */
- _adjustDate: function(id, offset, period) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- if (this._isDisabledDatepicker(target[0])) {
- return;
- }
- this._adjustInstDate(inst, offset +
- (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
- period);
- this._updateDatepicker(inst);
- },
+ // disable click in any case
+ this.anchors.bind('click.tabs', function(){return false;});
- /* Action for current link. */
- _gotoToday: function(id) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
- inst.selectedDay = inst.currentDay;
- inst.drawMonth = inst.selectedMonth = inst.currentMonth;
- inst.drawYear = inst.selectedYear = inst.currentYear;
- }
- else {
- var date = new Date();
- inst.selectedDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = date.getFullYear();
- }
- this._notifyChange(inst);
- this._adjustDate(target);
},
- /* Action for selecting a new month/year. */
- _selectMonthYear: function(id, select, period) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- inst._selectingMonthYear = false;
- inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
- inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
- parseInt(select.options[select.selectedIndex].value,10);
- this._notifyChange(inst);
- this._adjustDate(target);
- },
+ destroy: function() {
+ var o = this.options;
- /* Restore input focus after not changing month/year. */
- _clickMonthYear: function(id) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- if (inst.input && inst._selectingMonthYear && !$.browser.msie)
- inst.input[0].focus();
- inst._selectingMonthYear = !inst._selectingMonthYear;
+ this.abort();
+
+ this.element.unbind('.tabs')
+ .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
+ .removeData('tabs');
+
+ this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+
+ this.anchors.each(function() {
+ var href = $.data(this, 'href.tabs');
+ if (href) {
+ this.href = href;
+ }
+ var $this = $(this).unbind('.tabs');
+ $.each(['href', 'load', 'cache'], function(i, prefix) {
+ $this.removeData(prefix + '.tabs');
+ });
+ });
+
+ this.lis.unbind('.tabs').add(this.panels).each(function() {
+ if ($.data(this, 'destroy.tabs')) {
+ $(this).remove();
+ }
+ else {
+ $(this).removeClass([
+ 'ui-state-default',
+ 'ui-corner-top',
+ 'ui-tabs-selected',
+ 'ui-state-active',
+ 'ui-state-hover',
+ 'ui-state-focus',
+ 'ui-state-disabled',
+ 'ui-tabs-panel',
+ 'ui-widget-content',
+ 'ui-corner-bottom',
+ 'ui-tabs-hide'
+ ].join(' '));
+ }
+ });
+
+ if (o.cookie) {
+ this._cookie(null, o.cookie);
+ }
+
+ return this;
},
- /* Action for selecting a day. */
- _selectDay: function(id, month, year, td) {
- var target = $(id);
- if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
- return;
+ add: function(url, label, index) {
+ if (index === undefined) {
+ index = this.anchors.length; // append by default
}
- var inst = this._getInst(target[0]);
- inst.selectedDay = inst.currentDay = $('a', td).html();
- inst.selectedMonth = inst.currentMonth = month;
- inst.selectedYear = inst.currentYear = year;
- if (inst.stayOpen) {
- inst.endDay = inst.endMonth = inst.endYear = null;
+
+ var self = this, o = this.options,
+ $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
+ id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);
+
+ $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
+
+ // try to find an existing element before creating a new one
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
}
- this._selectDate(id, this._formatDate(inst,
- inst.currentDay, inst.currentMonth, inst.currentYear));
- if (inst.stayOpen) {
- inst.rangeStart = this._daylightSavingAdjust(
- new Date(inst.currentYear, inst.currentMonth, inst.currentDay));
- this._updateDatepicker(inst);
+ $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
+
+ if (index >= this.lis.length) {
+ $li.appendTo(this.list);
+ $panel.appendTo(this.list[0].parentNode);
+ }
+ else {
+ $li.insertBefore(this.lis[index]);
+ $panel.insertBefore(this.panels[index]);
+ }
+
+ o.disabled = $.map(o.disabled,
+ function(n, i) { return n >= index ? ++n : n; });
+
+ this._tabify();
+
+ if (this.anchors.length == 1) { // after tabify
+ o.selected = 0;
+ $li.addClass('ui-tabs-selected ui-state-active');
+ $panel.removeClass('ui-tabs-hide');
+ this.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
+ });
+
+ this.load(0);
}
+
+ // callback
+ this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
+ return this;
},
- /* Erase the input field and hide the date picker. */
- _clearDate: function(id) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- inst.stayOpen = false;
- inst.endDay = inst.endMonth = inst.endYear = inst.rangeStart = null;
- this._selectDate(target, '');
+ remove: function(index) {
+ var o = this.options, $li = this.lis.eq(index).remove(),
+ $panel = this.panels.eq(index).remove();
+
+ // If selected tab was removed focus tab to the right or
+ // in case the last tab was removed the tab to the left.
+ if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
+ this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
+ }
+
+ o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
+ function(n, i) { return n >= index ? --n : n; });
+
+ this._tabify();
+
+ // callback
+ this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
+ return this;
},
- /* Update the input field with the selected date. */
- _selectDate: function(id, dateStr) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
- if (inst.input)
- inst.input.val(dateStr);
- this._updateAlternate(inst);
- var onSelect = this._get(inst, 'onSelect');
- if (onSelect)
- onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
- else if (inst.input)
- inst.input.trigger('change'); // fire the change event
- if (inst.inline)
- this._updateDatepicker(inst);
- else if (!inst.stayOpen) {
- this._hideDatepicker(null, this._get(inst, 'duration'));
- this._lastInput = inst.input[0];
- if (typeof(inst.input[0]) != 'object')
- inst.input[0].focus(); // restore focus
- this._lastInput = null;
+ enable: function(index) {
+ var o = this.options;
+ if ($.inArray(index, o.disabled) == -1) {
+ return;
}
+
+ this.lis.eq(index).removeClass('ui-state-disabled');
+ o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
+
+ // callback
+ this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
+ return this;
},
- /* Update any alternate field to synchronise with the main field. */
- _updateAlternate: function(inst) {
- var altField = this._get(inst, 'altField');
- if (altField) { // update alternate field too
- var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
- var date = this._getDate(inst);
- dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
- $(altField).each(function() { $(this).val(dateStr); });
+ disable: function(index) {
+ var self = this, o = this.options;
+ if (index != o.selected) { // cannot disable already selected tab
+ this.lis.eq(index).addClass('ui-state-disabled');
+
+ o.disabled.push(index);
+ o.disabled.sort();
+
+ // callback
+ this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
}
+
+ return this;
},
- /* Set as beforeShowDay function to prevent selection of weekends.
- @param date Date - the date to customise
- @return [boolean, string] - is this date selectable?, what is its CSS class? */
- noWeekends: function(date) {
- var day = date.getDay();
- return [(day > 0 && day < 6), ''];
+ select: function(index) {
+ if (typeof index == 'string') {
+ index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
+ }
+ else if (index === null) { // usage of null is deprecated, TODO remove in next release
+ index = -1;
+ }
+ if (index == -1 && this.options.collapsible) {
+ index = this.options.selected;
+ }
+
+ this.anchors.eq(index).trigger(this.options.event + '.tabs');
+ return this;
},
- /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
- @param date Date - the date to get the week for
- @return number - the number of the week within the year that contains this date */
- iso8601Week: function(date) {
- var checkDate = new Date(date.getFullYear(), date.getMonth(), date.getDate());
- var firstMon = new Date(checkDate.getFullYear(), 1 - 1, 4); // First week always contains 4 Jan
- var firstDay = firstMon.getDay() || 7; // Day of week: Mon = 1, ..., Sun = 7
- firstMon.setDate(firstMon.getDate() + 1 - firstDay); // Preceding Monday
- if (firstDay < 4 && checkDate < firstMon) { // Adjust first three days in year if necessary
- checkDate.setDate(checkDate.getDate() - 3); // Generate for previous year
- return $.datepicker.iso8601Week(checkDate);
- } else if (checkDate > new Date(checkDate.getFullYear(), 12 - 1, 28)) { // Check last three days in year
- firstDay = new Date(checkDate.getFullYear() + 1, 1 - 1, 4).getDay() || 7;
- if (firstDay > 4 && (checkDate.getDay() || 7) < firstDay - 3) { // Adjust if necessary
- return 1;
- }
+ load: function(index) {
+ var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');
+
+ this.abort();
+
+ // not remote or from cache
+ if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
+ this.element.dequeue("tabs");
+ return;
+ }
+
+ // load remote from here on
+ this.lis.eq(index).addClass('ui-state-processing');
+
+ if (o.spinner) {
+ var span = $('span', a);
+ span.data('label.tabs', span.html()).html(o.spinner);
}
- return Math.floor(((checkDate - firstMon) / 86400000) / 7) + 1; // Weeks to given date
+
+ this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
+ url: url,
+ success: function(r, s) {
+ $(self._sanitizeSelector(a.hash)).html(r);
+
+ // take care of tab labels
+ self._cleanup();
+
+ if (o.cache) {
+ $.data(a, 'cache.tabs', true); // if loaded once do not load them again
+ }
+
+ // callbacks
+ self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
+ try {
+ o.ajaxOptions.success(r, s);
+ }
+ catch (e) {}
+ },
+ error: function(xhr, s, e) {
+ // take care of tab labels
+ self._cleanup();
+
+ // callbacks
+ self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
+ try {
+ // Passing index avoid a race condition when this method is
+ // called after the user has selected another tab.
+ // Pass the anchor that initiated this request allows
+ // loadError to manipulate the tab content panel via $(a.hash)
+ o.ajaxOptions.error(xhr, s, index, a);
+ }
+ catch (e) {}
+ }
+ }));
+
+ // last, so that load event is fired before show...
+ self.element.dequeue("tabs");
+
+ return this;
},
- /* Parse a string value into a date object.
- See formatDate below for the possible formats.
+ abort: function() {
+ // stop possibly running animations
+ this.element.queue([]);
+ this.panels.stop(false, true);
- @param format string - the expected format of the date
- @param value string - the date in the above format
- @param settings Object - attributes include:
- shortYearCutoff number - the cutoff year for determining the century (optional)
- dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
- dayNames string[7] - names of the days from Sunday (optional)
- monthNamesShort string[12] - abbreviated names of the months (optional)
- monthNames string[12] - names of the months (optional)
- @return Date - the extracted date value or null if value is blank */
- parseDate: function (format, value, settings) {
- if (format == null || value == null)
- throw 'Invalid arguments';
- value = (typeof value == 'object' ? value.toString() : value + '');
- if (value == '')
- return null;
- var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
- var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
- var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
- var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
- var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
- var year = -1;
- var month = -1;
- var day = -1;
- var doy = -1;
- var literal = false;
- // Check whether a format character is doubled
- var lookAhead = function(match) {
- var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
- if (matches)
- iFormat++;
- return matches;
- };
- // Extract a number from the string value
- var getNumber = function(match) {
- lookAhead(match);
- var origSize = (match == '@' ? 14 : (match == 'y' ? 4 : (match == 'o' ? 3 : 2)));
- var size = origSize;
- var num = 0;
- while (size > 0 && iValue < value.length &&
- value.charAt(iValue) >= '0' && value.charAt(iValue) <= '9') {
- num = num * 10 + parseInt(value.charAt(iValue++),10);
- size--;
- }
- if (size == origSize)
- throw 'Missing number at position ' + iValue;
- return num;
- };
- // Extract a name from the string value and convert to an index
- var getName = function(match, shortNames, longNames) {
- var names = (lookAhead(match) ? longNames : shortNames);
- var size = 0;
- for (var j = 0; j < names.length; j++)
- size = Math.max(size, names[j].length);
- var name = '';
- var iInit = iValue;
- while (size > 0 && iValue < value.length) {
- name += value.charAt(iValue++);
- for (var i = 0; i < names.length; i++)
- if (name == names[i])
- return i + 1;
- size--;
- }
- throw 'Unknown name at position ' + iInit;
- };
- // Confirm that a literal character matches the string value
- var checkLiteral = function() {
- if (value.charAt(iValue) != format.charAt(iFormat))
- throw 'Unexpected literal at position ' + iValue;
- iValue++;
- };
- var iValue = 0;
- for (var iFormat = 0; iFormat < format.length; iFormat++) {
- if (literal)
- if (format.charAt(iFormat) == "'" && !lookAhead("'"))
- literal = false;
- else
- checkLiteral();
- else
- switch (format.charAt(iFormat)) {
- case 'd':
- day = getNumber('d');
- break;
- case 'D':
- getName('D', dayNamesShort, dayNames);
- break;
- case 'o':
- doy = getNumber('o');
- break;
- case 'm':
- month = getNumber('m');
- break;
- case 'M':
- month = getName('M', monthNamesShort, monthNames);
- break;
- case 'y':
- year = getNumber('y');
- break;
- case '@':
- var date = new Date(getNumber('@'));
- year = date.getFullYear();
- month = date.getMonth() + 1;
- day = date.getDate();
- break;
- case "'":
- if (lookAhead("'"))
- checkLiteral();
- else
- literal = true;
- break;
- default:
- checkLiteral();
- }
- }
- if (year == -1)
- year = new Date().getFullYear();
- else if (year < 100)
- year += new Date().getFullYear() - new Date().getFullYear() % 100 +
- (year <= shortYearCutoff ? 0 : -100);
- if (doy > -1) {
- month = 1;
- day = doy;
- do {
- var dim = this._getDaysInMonth(year, month - 1);
- if (day <= dim)
- break;
- month++;
- day -= dim;
- } while (true);
- }
- var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
- if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
- throw 'Invalid date'; // E.g. 31/02/*
- return date;
- },
-
- /* Standard date formats. */
- ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
- COOKIE: 'D, dd M yy',
- ISO_8601: 'yy-mm-dd',
- RFC_822: 'D, d M y',
- RFC_850: 'DD, dd-M-y',
- RFC_1036: 'D, d M y',
- RFC_1123: 'D, d M yy',
- RFC_2822: 'D, d M yy',
- RSS: 'D, d M y', // RFC 822
- TIMESTAMP: '@',
- W3C: 'yy-mm-dd', // ISO 8601
-
- /* Format a date object into a string value.
- The format can be combinations of the following:
- d - day of month (no leading zero)
- dd - day of month (two digit)
- o - day of year (no leading zeros)
- oo - day of year (three digit)
- D - day name short
- DD - day name long
- m - month of year (no leading zero)
- mm - month of year (two digit)
- M - month name short
- MM - month name long
- y - year (two digit)
- yy - year (four digit)
- @ - Unix timestamp (ms since 01/01/1970)
- '...' - literal text
- '' - single quote
-
- @param format string - the desired format of the date
- @param date Date - the date value to format
- @param settings Object - attributes include:
- dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
- dayNames string[7] - names of the days from Sunday (optional)
- monthNamesShort string[12] - abbreviated names of the months (optional)
- monthNames string[12] - names of the months (optional)
- @return string - the date in the above format */
- formatDate: function (format, date, settings) {
- if (!date)
- return '';
- var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
- var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
- var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
- var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
- // Check whether a format character is doubled
- var lookAhead = function(match) {
- var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
- if (matches)
- iFormat++;
- return matches;
- };
- // Format a number, with leading zero if necessary
- var formatNumber = function(match, value, len) {
- var num = '' + value;
- if (lookAhead(match))
- while (num.length < len)
- num = '0' + num;
- return num;
- };
- // Format a name, short or long as requested
- var formatName = function(match, value, shortNames, longNames) {
- return (lookAhead(match) ? longNames[value] : shortNames[value]);
- };
- var output = '';
- var literal = false;
- if (date)
- for (var iFormat = 0; iFormat < format.length; iFormat++) {
- if (literal)
- if (format.charAt(iFormat) == "'" && !lookAhead("'"))
- literal = false;
- else
- output += format.charAt(iFormat);
- else
- switch (format.charAt(iFormat)) {
- case 'd':
- output += formatNumber('d', date.getDate(), 2);
- break;
- case 'D':
- output += formatName('D', date.getDay(), dayNamesShort, dayNames);
- break;
- case 'o':
- var doy = date.getDate();
- for (var m = date.getMonth() - 1; m >= 0; m--)
- doy += this._getDaysInMonth(date.getFullYear(), m);
- output += formatNumber('o', doy, 3);
- break;
- case 'm':
- output += formatNumber('m', date.getMonth() + 1, 2);
- break;
- case 'M':
- output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
- break;
- case 'y':
- output += (lookAhead('y') ? date.getFullYear() :
- (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
- break;
- case '@':
- output += date.getTime();
- break;
- case "'":
- if (lookAhead("'"))
- output += "'";
- else
- literal = true;
- break;
- default:
- output += format.charAt(iFormat);
- }
- }
- return output;
- },
-
- /* Extract all possible characters from the date format. */
- _possibleChars: function (format) {
- var chars = '';
- var literal = false;
- for (var iFormat = 0; iFormat < format.length; iFormat++)
- if (literal)
- if (format.charAt(iFormat) == "'" && !lookAhead("'"))
- literal = false;
- else
- chars += format.charAt(iFormat);
- else
- switch (format.charAt(iFormat)) {
- case 'd': case 'm': case 'y': case '@':
- chars += '0123456789';
- break;
- case 'D': case 'M':
- return null; // Accept anything
- case "'":
- if (lookAhead("'"))
- chars += "'";
- else
- literal = true;
- break;
- default:
- chars += format.charAt(iFormat);
- }
- return chars;
- },
-
- /* Get a setting value, defaulting if necessary. */
- _get: function(inst, name) {
- return inst.settings[name] !== undefined ?
- inst.settings[name] : this._defaults[name];
- },
-
- /* Parse existing date and initialise date picker. */
- _setDateFromField: function(inst) {
- var dateFormat = this._get(inst, 'dateFormat');
- var dates = inst.input ? inst.input.val() : null;
- inst.endDay = inst.endMonth = inst.endYear = null;
- var date = defaultDate = this._getDefaultDate(inst);
- var settings = this._getFormatConfig(inst);
- try {
- date = this.parseDate(dateFormat, dates, settings) || defaultDate;
- } catch (event) {
- this.log(event);
- date = defaultDate;
- }
- inst.selectedDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = date.getFullYear();
- inst.currentDay = (dates ? date.getDate() : 0);
- inst.currentMonth = (dates ? date.getMonth() : 0);
- inst.currentYear = (dates ? date.getFullYear() : 0);
- this._adjustInstDate(inst);
- },
+ // "tabs" queue must not contain more than two elements,
+ // which are the callbacks for the latest clicked tab...
+ this.element.queue("tabs", this.element.queue("tabs").splice(-2, 2));
- /* Retrieve the default date shown on opening. */
- _getDefaultDate: function(inst) {
- var date = this._determineDate(this._get(inst, 'defaultDate'), new Date());
- var minDate = this._getMinMaxDate(inst, 'min', true);
- var maxDate = this._getMinMaxDate(inst, 'max');
- date = (minDate && date < minDate ? minDate : date);
- date = (maxDate && date > maxDate ? maxDate : date);
- return date;
- },
-
- /* A date may be specified as an exact value or a relative one. */
- _determineDate: function(date, defaultDate) {
- var offsetNumeric = function(offset) {
- var date = new Date();
- date.setDate(date.getDate() + offset);
- return date;
- };
- var offsetString = function(offset, getDaysInMonth) {
- var date = new Date();
- var year = date.getFullYear();
- var month = date.getMonth();
- var day = date.getDate();
- var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
- var matches = pattern.exec(offset);
- while (matches) {
- switch (matches[2] || 'd') {
- case 'd' : case 'D' :
- day += parseInt(matches[1],10); break;
- case 'w' : case 'W' :
- day += parseInt(matches[1],10) * 7; break;
- case 'm' : case 'M' :
- month += parseInt(matches[1],10);
- day = Math.min(day, getDaysInMonth(year, month));
- break;
- case 'y': case 'Y' :
- year += parseInt(matches[1],10);
- day = Math.min(day, getDaysInMonth(year, month));
- break;
- }
- matches = pattern.exec(offset);
- }
- return new Date(year, month, day);
- };
- date = (date == null ? defaultDate :
- (typeof date == 'string' ? offsetString(date, this._getDaysInMonth) :
- (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
- date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
- if (date) {
- date.setHours(0);
- date.setMinutes(0);
- date.setSeconds(0);
- date.setMilliseconds(0);
- }
- return this._daylightSavingAdjust(date);
- },
-
- /* Handle switch to/from daylight saving.
- Hours may be non-zero on daylight saving cut-over:
- > 12 when midnight changeover, but then cannot generate
- midnight datetime, so jump to 1AM, otherwise reset.
- @param date (Date) the date to check
- @return (Date) the corrected date */
- _daylightSavingAdjust: function(date) {
- if (!date) return null;
- date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
- return date;
- },
-
- /* Set the date(s) directly. */
- _setDate: function(inst, date, endDate) {
- var clear = !(date);
- var origMonth = inst.selectedMonth;
- var origYear = inst.selectedYear;
- date = this._determineDate(date, new Date());
- inst.selectedDay = inst.currentDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
- if (origMonth != inst.selectedMonth || origYear != inst.selectedYear)
- this._notifyChange(inst);
- this._adjustInstDate(inst);
- if (inst.input) {
- inst.input.val(clear ? '' : this._formatDate(inst));
+ // terminate pending requests from other tabs
+ if (this.xhr) {
+ this.xhr.abort();
+ delete this.xhr;
}
+
+ // take care of tab labels
+ this._cleanup();
+ return this;
},
- /* Retrieve the date(s) directly. */
- _getDate: function(inst) {
- var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
- this._daylightSavingAdjust(new Date(
- inst.currentYear, inst.currentMonth, inst.currentDay)));
- return startDate;
+ url: function(index, url) {
+ this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
+ return this;
},
- /* Generate the HTML for the current state of the date picker. */
- _generateHTML: function(inst) {
- var today = new Date();
- today = this._daylightSavingAdjust(
- new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
- var isRTL = this._get(inst, 'isRTL');
- var showButtonPanel = this._get(inst, 'showButtonPanel');
- var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
- var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
- var numMonths = this._getNumberOfMonths(inst);
- var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
- var stepMonths = this._get(inst, 'stepMonths');
- var stepBigMonths = this._get(inst, 'stepBigMonths');
- var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
- var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
- new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
- var minDate = this._getMinMaxDate(inst, 'min', true);
- var maxDate = this._getMinMaxDate(inst, 'max');
- var drawMonth = inst.drawMonth - showCurrentAtPos;
- var drawYear = inst.drawYear;
- if (drawMonth < 0) {
- drawMonth += 12;
- drawYear--;
- }
- if (maxDate) {
- var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
- maxDate.getMonth() - numMonths[1] + 1, maxDate.getDate()));
- maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
- while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
- drawMonth--;
- if (drawMonth < 0) {
- drawMonth = 11;
- drawYear--;
- }
+ length: function() {
+ return this.anchors.length;
+ }
+
+});
+
+$.extend($.ui.tabs, {
+ version: '1.8.1'
+});
+
+/*
+ * Tabs Extensions
+ */
+
+/*
+ * Rotate
+ */
+$.extend($.ui.tabs.prototype, {
+ rotation: null,
+ rotate: function(ms, continuing) {
+
+ var self = this, o = this.options;
+
+ var rotate = self._rotate || (self._rotate = function(e) {
+ clearTimeout(self.rotation);
+ self.rotation = setTimeout(function() {
+ var t = o.selected;
+ self.select( ++t < self.anchors.length ? t : 0 );
+ }, ms);
+
+ if (e) {
+ e.stopPropagation();
}
- }
- inst.drawMonth = drawMonth;
- inst.drawYear = drawYear;
- var prevText = this._get(inst, 'prevText');
- prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
- this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
- this._getFormatConfig(inst)));
- var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
- '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
- ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
- (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
- var nextText = this._get(inst, 'nextText');
- nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
- this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
- this._getFormatConfig(inst)));
- var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
- '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
- ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
- (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
- var currentText = this._get(inst, 'currentText');
- var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
- currentText = (!navigationAsDateFormat ? currentText :
- this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
- var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
- var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
- (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery.datepicker._gotoToday(\'#' + inst.id + '\');"' +
- '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
- var firstDay = parseInt(this._get(inst, 'firstDay'),10);
- firstDay = (isNaN(firstDay) ? 0 : firstDay);
- var dayNames = this._get(inst, 'dayNames');
- var dayNamesShort = this._get(inst, 'dayNamesShort');
- var dayNamesMin = this._get(inst, 'dayNamesMin');
- var monthNames = this._get(inst, 'monthNames');
- var monthNamesShort = this._get(inst, 'monthNamesShort');
- var beforeShowDay = this._get(inst, 'beforeShowDay');
- var showOtherMonths = this._get(inst, 'showOtherMonths');
- var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
- var endDate = inst.endDay ? this._daylightSavingAdjust(
- new Date(inst.endYear, inst.endMonth, inst.endDay)) : currentDate;
- var defaultDate = this._getDefaultDate(inst);
- var html = '';
- for (var row = 0; row < numMonths[0]; row++) {
- var group = '';
- for (var col = 0; col < numMonths[1]; col++) {
- var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
- var cornerClass = ' ui-corner-all';
- var calender = '';
- if (isMultiMonth) {
- calender += '<div class="ui-datepicker-group ui-datepicker-group-';
- switch (col) {
- case 0: calender += 'first'; cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
- case numMonths[1]-1: calender += 'last'; cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
- default: calender += 'middle'; cornerClass = ''; break;
- }
- calender += '">';
- }
- calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
- (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
- (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
- this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
- selectedDate, row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
- '</div><table class="ui-datepicker-calendar"><thead>' +
- '<tr>';
- var thead = '';
- for (var dow = 0; dow < 7; dow++) { // days of the week
- var day = (dow + firstDay) % 7;
- thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
- '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
- }
- calender += thead + '</tr></thead><tbody>';
- var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
- if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
- inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
- var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
- var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
- var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
- for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
- calender += '<tr>';
- var tbody = '';
- for (var dow = 0; dow < 7; dow++) { // create date picker days
- var daySettings = (beforeShowDay ?
- beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
- var otherMonth = (printDate.getMonth() != drawMonth);
- var unselectable = otherMonth || !daySettings[0] ||
- (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
- tbody += '<td class="' +
- ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
- (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
- ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
- (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
- // or defaultDate is current printedDate and defaultDate is selectedDate
- ' ' + this._dayOverClass : '') + // highlight selected day
- (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
- (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
- (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
- ' ' + this._currentClass : '') + // highlight selected day
- (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
- ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
- (unselectable ? '' : ' onclick="DP_jQuery.datepicker._selectDay(\'#' +
- inst.id + '\',' + drawMonth + ',' + drawYear + ', this);return false;"') + '>' + // actions
- (otherMonth ? (showOtherMonths ? printDate.getDate() : ' ') : // display for other months
- (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
- (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
- (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
- ' ui-state-active' : '') + // highlight selected day
- '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display for this month
- printDate.setDate(printDate.getDate() + 1);
- printDate = this._daylightSavingAdjust(printDate);
- }
- calender += tbody + '</tr>';
+ });
+
+ var stop = self._unrotate || (self._unrotate = !continuing ?
+ function(e) {
+ if (e.clientX) { // in case of a true click
+ self.rotate(null);
}
- drawMonth++;
- if (drawMonth > 11) {
- drawMonth = 0;
- drawYear++;
+ } :
+ function(e) {
+ t = o.selected;
+ rotate();
+ });
+
+ // start rotation
+ if (ms) {
+ this.element.bind('tabsshow', rotate);
+ this.anchors.bind(o.event + '.tabs', stop);
+ rotate();
+ }
+ // stop rotation
+ else {
+ clearTimeout(self.rotation);
+ this.element.unbind('tabsshow', rotate);
+ this.anchors.unbind(o.event + '.tabs', stop);
+ delete this._rotate;
+ delete this._unrotate;
+ }
+
+ return this;
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Datepicker 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * jquery.ui.core.js
+ */
+
+(function($) { // hide the namespace
+
+$.extend($.ui, { datepicker: { version: "1.8.1" } });
+
+var PROP_NAME = 'datepicker';
+var dpuuid = new Date().getTime();
+
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+function Datepicker() {
+ this.debug = false; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
+ this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
+ this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
+ this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
+ this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
+ this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
+ this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
+ this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
+ this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ closeText: 'Done', // Display text for close link
+ prevText: 'Prev', // Display text for previous month link
+ nextText: 'Next', // Display text for next month link
+ currentText: 'Today', // Display text for current month link
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
+ weekHeader: 'Wk', // Column header for week of the year
+ dateFormat: 'mm/dd/yy', // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false, // True if right-to-left language, false if left-to-right
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearSuffix: '' // Additional text to append to the year in the month headers
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either
+ showAnim: 'show', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: '', // Display text following the input box, e.g. showing the format
+ buttonText: '...', // Text for trigger button
+ buttonImage: '', // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ yearRange: 'c-10:c+10', // Range of years to display in drop-down,
+ // either relative to today's year (-nn:+nn), relative to currently displayed year
+ // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
+ showWeek: false, // True to show week of the year, false to not show it
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: '+10', // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with '+' for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: '_default', // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: '', // Selector for an alternate field to store selected dates into
+ altFormat: '', // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false, // True to show button panel, false to not show it
+ autoSize: false // True to size the input for the date format, false to leave as is
+ };
+ $.extend(this._defaults, this.regional['']);
+ this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
+}
+
+$.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: 'hasDatepicker',
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ // TODO rename to "widget" when switching to widget factory
+ _widgetDatepicker: function() {
+ return this.dpDiv;
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this date picker instance (anonymous) */
+ _attachDatepicker: function(target, settings) {
+ // check for settings on the control itself - in namespace 'date:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('date:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
}
- calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
- ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
- group += calender;
}
- html += group;
}
- html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
- '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
- inst._keyEvent = false;
- return html;
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+ if (!target.id)
+ target.id = 'dp' + (++this.uuid);
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
},
- /* Generate the month and year header. */
- _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
- selectedDate, secondary, monthNames, monthNamesShort) {
- minDate = (inst.rangeStart && minDate && selectedDate < minDate ? selectedDate : minDate);
- var changeMonth = this._get(inst, 'changeMonth');
- var changeYear = this._get(inst, 'changeYear');
- var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
- var html = '<div class="ui-datepicker-title">';
- var monthHtml = '';
- // month selection
- if (secondary || !changeMonth)
- monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span> ';
- else {
- var inMinYear = (minDate && minDate.getFullYear() == drawYear);
- var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
- monthHtml += '<select class="ui-datepicker-month" ' +
- 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
- 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
- '>';
- for (var month = 0; month < 12; month++) {
- if ((!inMinYear || month >= minDate.getMonth()) &&
- (!inMaxYear || month <= maxDate.getMonth()))
- monthHtml += '<option value="' + month + '"' +
- (month == drawMonth ? ' selected="selected"' : '') +
- '>' + monthNamesShort[month] + '</option>';
- }
- monthHtml += '</select>';
+ /* Create a new instance object. */
+ _newInst: function(target, inline) {
+ var id = target[0].id.replace(/([^A-Za-z0-9_])/g, '\\\\$1'); // escape jQuery meta chars
+ return {id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function(target, inst) {
+ var input = $(target);
+ inst.append = $([]);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName))
+ return;
+ this._attachments(input, inst);
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).
+ keypress(this._doKeyPress).keyup(this._doKeyUp).
+ bind("setData.datepicker", function(event, key, value) {
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key) {
+ return this._get(inst, key);
+ });
+ this._autoSize(inst);
+ $.data(target, PROP_NAME, inst);
+ },
+
+ /* Make attachments based on settings. */
+ _attachments: function(input, inst) {
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (inst.append)
+ inst.append.remove();
+ if (appendText) {
+ inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ input[isRTL ? 'before' : 'after'](inst.append);
}
- if (!showMonthAfterYear)
- html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? ' ' : '');
- // year selection
- if (secondary || !changeYear)
- html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
- else {
- // determine range of years to display
- var years = this._get(inst, 'yearRange').split(':');
- var year = 0;
- var endYear = 0;
- if (years.length != 2) {
- year = drawYear - 10;
- endYear = drawYear + 10;
- } else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') {
- year = drawYear + parseInt(years[0], 10);
- endYear = drawYear + parseInt(years[1], 10);
- } else {
- year = parseInt(years[0], 10);
- endYear = parseInt(years[1], 10);
- }
- year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
- endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
- html += '<select class="ui-datepicker-year" ' +
- 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
- 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
- '>';
- for (; year <= endYear; year++) {
- html += '<option value="' + year + '"' +
- (year == drawYear ? ' selected="selected"' : '') +
- '>' + year + '</option>';
+ input.unbind('focus', this._showDatepicker);
+ if (inst.trigger)
+ inst.trigger.remove();
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
+ var buttonText = this._get(inst, 'buttonText');
+ var buttonImage = this._get(inst, 'buttonImage');
+ inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
+ $('<img/>').addClass(this._triggerClass).
+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+ $('<button type="button"></button>').addClass(this._triggerClass).
+ html(buttonImage == '' ? buttonText : $('<img/>').attr(
+ { src:buttonImage, alt:buttonText, title:buttonText })));
+ input[isRTL ? 'before' : 'after'](inst.trigger);
+ inst.trigger.click(function() {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0])
+ $.datepicker._hideDatepicker();
+ else
+ $.datepicker._showDatepicker(input[0]);
+ return false;
+ });
+ }
+ },
+
+ /* Apply the maximum length for the date format. */
+ _autoSize: function(inst) {
+ if (this._get(inst, 'autoSize') && !inst.inline) {
+ var date = new Date(2009, 12 - 1, 20); // Ensure double digits
+ var dateFormat = this._get(inst, 'dateFormat');
+ if (dateFormat.match(/[DM]/)) {
+ var findMax = function(names) {
+ var max = 0;
+ var maxI = 0;
+ for (var i = 0; i < names.length; i++) {
+ if (names[i].length > max) {
+ max = names[i].length;
+ maxI = i;
+ }
+ }
+ return maxI;
+ };
+ date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
+ 'monthNames' : 'monthNamesShort'))));
+ date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
+ 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay());
}
- html += '</select>';
+ inst.input.attr('size', this._formatDate(inst, date).length);
}
- if (showMonthAfterYear)
- html += (secondary || changeMonth || changeYear ? ' ' : '') + monthHtml;
- html += '</div>'; // Close datepicker_header
- return html;
},
- /* Adjust one of the date sub-fields. */
- _adjustInstDate: function(inst, offset, period) {
- var year = inst.drawYear + (period == 'Y' ? offset : 0);
- var month = inst.drawMonth + (period == 'M' ? offset : 0);
- var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
- (period == 'D' ? offset : 0);
- var date = this._daylightSavingAdjust(new Date(year, month, day));
- // ensure it is within the bounds set
- var minDate = this._getMinMaxDate(inst, 'min', true);
- var maxDate = this._getMinMaxDate(inst, 'max');
- date = (minDate && date < minDate ? minDate : date);
- date = (maxDate && date > maxDate ? maxDate : date);
- inst.selectedDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = date.getFullYear();
- if (period == 'M' || period == 'Y')
- this._notifyChange(inst);
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv).
+ bind("setData.datepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ this._setDate(inst, this._getDefaultDate(inst), true);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
},
- /* Notify change of month/year. */
- _notifyChange: function(inst) {
- var onChange = this._get(inst, 'onChangeMonthYear');
- if (onChange)
- onChange.apply((inst.input ? inst.input[0] : null),
- [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ /* Pop-up the date picker in a "dialog" box.
+ @param input element - ignored
+ @param date string or Date - the initial date to display
+ @param onSelect function - the function to call when a date is selected
+ @param settings object - update the dialog date picker instance's settings (anonymous object)
+ @param pos int[2] - coordinates for the dialog's position within the screen or
+ event - with x/y coordinates or
+ leave empty for default (screen centre)
+ @return the manager object */
+ _dialogDatepicker: function(input, date, onSelect, settings, pos) {
+ var inst = this._dialogInst; // internal instance
+ if (!inst) {
+ var id = 'dp' + (++this.uuid);
+ this._dialogInput = $('<input type="text" id="' + id +
+ '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');
+ this._dialogInput.keydown(this._doKeyDown);
+ $('body').append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ }
+ extendRemove(inst.settings, settings || {});
+ date = (date && date.constructor == Date ? this._formatDate(inst, date) : date);
+ this._dialogInput.val(date);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ var browserWidth = document.documentElement.clientWidth;
+ var browserHeight = document.documentElement.clientHeight;
+ var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px');
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI)
+ $.blockUI(this.dpDiv);
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ return this;
},
- /* Determine the number of months to show. */
- _getNumberOfMonths: function(inst) {
- var numMonths = this._get(inst, 'numberOfMonths');
- return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ /* Detach a datepicker from its control.
+ @param target element - the target input field or division or span */
+ _destroyDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, PROP_NAME);
+ if (nodeName == 'input') {
+ inst.append.remove();
+ inst.trigger.remove();
+ $target.removeClass(this.markerClassName).
+ unbind('focus', this._showDatepicker).
+ unbind('keydown', this._doKeyDown).
+ unbind('keypress', this._doKeyPress).
+ unbind('keyup', this._doKeyUp);
+ } else if (nodeName == 'div' || nodeName == 'span')
+ $target.removeClass(this.markerClassName).empty();
},
- /* Determine the current maximum date - ensure no time components are set - may be overridden for a range. */
- _getMinMaxDate: function(inst, minMax, checkRange) {
- var date = this._determineDate(this._get(inst, minMax + 'Date'), null);
- return (!checkRange || !inst.rangeStart ? date :
- (!date || inst.rangeStart > date ? inst.rangeStart : date));
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = false; }).end().
+ filter('img').css({opacity: '1.0', cursor: ''});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
},
- /* Find the number of days in a given month. */
- _getDaysInMonth: function(year, month) {
- return 32 - new Date(year, month, 32).getDate();
+ /* Disable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = true; }).end().
+ filter('img').css({opacity: '0.5', cursor: 'default'});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
},
- /* Find the day of the week of the first of a month. */
- _getFirstDayOfMonth: function(year, month) {
- return new Date(year, month, 1).getDay();
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ @param target element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledDatepicker: function(target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target)
+ return true;
+ }
+ return false;
},
- /* Determines if we should allow a "next/prev" month display change. */
- _canAdjustMonth: function(inst, offset, curYear, curMonth) {
- var numMonths = this._getNumberOfMonths(inst);
- var date = this._daylightSavingAdjust(new Date(
- curYear, curMonth + (offset < 0 ? offset : numMonths[1]), 1));
- if (offset < 0)
- date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
- return this._isInRange(inst, date);
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function(target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this datepicker';
+ }
},
- /* Is the given date in the accepted range? */
- _isInRange: function(inst, date) {
- // during range selection, use minimum of selected date and range start
- var newMinDate = (!inst.rangeStart ? null : this._daylightSavingAdjust(
- new Date(inst.selectedYear, inst.selectedMonth, inst.selectedDay)));
- newMinDate = (newMinDate && inst.rangeStart < newMinDate ? inst.rangeStart : newMinDate);
- var minDate = newMinDate || this._getMinMaxDate(inst, 'min');
- var maxDate = this._getMinMaxDate(inst, 'max');
- return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate));
+ /* Update or retrieve the settings for a date picker attached to an input field or division.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or retrieve,
+ when retrieving also 'all' for all instance settings or
+ 'defaults' for all global defaults
+ @param value any - the new value for the setting
+ (omit if above is an object or to retrieve a value) */
+ _optionDatepicker: function(target, name, value) {
+ var inst = this._getInst(target);
+ if (arguments.length == 2 && typeof name == 'string') {
+ return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
+ (inst ? (name == 'all' ? $.extend({}, inst.settings) :
+ this._get(inst, name)) : null));
+ }
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideDatepicker();
+ }
+ var date = this._getDateDatepicker(target, true);
+ extendRemove(inst.settings, settings);
+ this._attachments($(target), inst);
+ this._autoSize(inst);
+ this._setDateDatepicker(target, date);
+ this._updateDatepicker(inst);
+ }
},
- /* Provide the configuration settings for formatting/parsing. */
- _getFormatConfig: function(inst) {
- var shortYearCutoff = this._get(inst, 'shortYearCutoff');
- shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
- new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
- return {shortYearCutoff: shortYearCutoff,
- dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
- monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ // change method deprecated
+ _changeDatepicker: function(target, name, value) {
+ this._optionDatepicker(target, name, value);
},
- /* Format the given date for display. */
- _formatDate: function(inst, day, month, year) {
- if (!day) {
- inst.currentDay = inst.selectedDay;
- inst.currentMonth = inst.selectedMonth;
- inst.currentYear = inst.selectedYear;
+ /* Redraw the date picker attached to an input field or division.
+ @param target element - the target input field or division or span */
+ _refreshDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
}
- var date = (day ? (typeof day == 'object' ? day :
- this._daylightSavingAdjust(new Date(year, month, day))) :
- this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
- return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
- }
-});
-
-/* jQuery extend now ignores nulls! */
-function extendRemove(target, props) {
- $.extend(target, props);
- for (var name in props)
- if (props[name] == null || props[name] == undefined)
- target[name] = props[name];
- return target;
-};
-
-/* Determine whether an object is an array. */
-function isArray(a) {
- return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
- (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
-};
-
-/* Invoke the datepicker functionality.
- @param options string - a command, optionally followed by additional parameters or
- Object - settings for attaching new datepicker functionality
- @return jQuery object */
-$.fn.datepicker = function(options){
-
- /* Initialise the date picker. */
- if (!$.datepicker.initialized) {
- $(document).mousedown($.datepicker._checkExternalClick).
- find('body').append($.datepicker.dpDiv);
- $.datepicker.initialized = true;
- }
-
- var otherArgs = Array.prototype.slice.call(arguments, 1);
- if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate'))
- return $.datepicker['_' + options + 'Datepicker'].
- apply($.datepicker, [this[0]].concat(otherArgs));
- if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
- return $.datepicker['_' + options + 'Datepicker'].
- apply($.datepicker, [this[0]].concat(otherArgs));
- return this.each(function() {
- typeof options == 'string' ?
- $.datepicker['_' + options + 'Datepicker'].
- apply($.datepicker, [this].concat(otherArgs)) :
- $.datepicker._attachDatepicker(this, options);
- });
-};
-
-$.datepicker = new Datepicker(); // singleton instance
-$.datepicker.initialized = false;
-$.datepicker.uuid = new Date().getTime();
-$.datepicker.version = "1.7.2";
-
-// Workaround for #4055
-// Add another global to avoid noConflict issues with inline event handlers
-window.DP_jQuery = $;
+ },
-})(jQuery);
-/*
- * jQuery UI Dialog 1.7.2
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Dialog
- *
- * Depends:
- * ui.core.js
- * ui.draggable.js
- * ui.resizable.js
- */
-(function($) {
+ /* Set the dates for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param date Date - the new date */
+ _setDateDatepicker: function(target, date) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
-var setDataSwitch = {
- dragStart: "start.draggable",
- drag: "drag.draggable",
- dragStop: "stop.draggable",
- maxHeight: "maxHeight.resizable",
- minHeight: "minHeight.resizable",
- maxWidth: "maxWidth.resizable",
- minWidth: "minWidth.resizable",
- resizeStart: "start.resizable",
- resize: "drag.resizable",
- resizeStop: "stop.resizable"
- },
-
- uiDialogClasses =
- 'ui-dialog ' +
- 'ui-widget ' +
- 'ui-widget-content ' +
- 'ui-corner-all ';
+ /* Get the date(s) for the first entry in a jQuery selection.
+ @param target element - the target input field or division or span
+ @param noDefault boolean - true if no default date is to be used
+ @return Date - the current date */
+ _getDateDatepicker: function(target, noDefault) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline)
+ this._setDateFromField(inst, noDefault);
+ return (inst ? this._getDate(inst) : null);
+ },
-$.widget("ui.dialog", {
+ /* Handle keystrokes. */
+ _doKeyDown: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ var handled = true;
+ var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing)
+ switch (event.keyCode) {
+ case 9: $.datepicker._hideDatepicker();
+ handled = false;
+ break; // hide on tab out
+ case 13: var sel = $('td.' + $.datepicker._dayOverClass, inst.dpDiv).
+ add($('td.' + $.datepicker._currentClass, inst.dpDiv));
+ if (sel[0])
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ else
+ $.datepicker._hideDatepicker();
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.datepicker._hideDatepicker();
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // next month/year on page down/+ ctrl
+ case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +right
+ break;
+ case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
- _init: function() {
- this.originalTitle = this.element.attr('title');
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if ($.datepicker._get(inst, 'constrainInput')) {
+ var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
+ var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
+ return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+ }
+ },
- var self = this,
- options = this.options,
+ /* Synchronise manual entry and field/alternate field. */
+ _doKeyUp: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if (inst.input.val() != inst.lastVal) {
+ try {
+ var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ (inst.input ? inst.input.val() : null),
+ $.datepicker._getFormatConfig(inst));
+ if (date) { // only if valid
+ $.datepicker._setDateFromField(inst);
+ $.datepicker._updateAlternate(inst);
+ $.datepicker._updateDatepicker(inst);
+ }
+ }
+ catch (event) {
+ $.datepicker.log(event);
+ }
+ }
+ return true;
+ },
- title = options.title || this.originalTitle || ' ',
- titleId = $.ui.dialog.getTitleId(this.element),
+ /* Pop-up the date picker for a given input field.
+ @param input element - the input field attached to the date picker or
+ event - if triggered by focus */
+ _showDatepicker: function(input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
+ input = $('input', input.parentNode)[0];
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
+ return;
+ var inst = $.datepicker._getInst(input);
+ if ($.datepicker._curInst && $.datepicker._curInst != inst) {
+ $.datepicker._curInst.dpDiv.stop(true, true);
+ }
+ var beforeShow = $.datepicker._get(inst, 'beforeShow');
+ extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+ inst.lastVal = null;
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+ if ($.datepicker._inDialog) // hide cursor
+ input.value = '';
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function() {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.datepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.datepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+ var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ // determine sizing offscreen
+ inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'});
+ if (!inst.inline) {
+ var showAnim = $.datepicker._get(inst, 'showAnim');
+ var duration = $.datepicker._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._datepickerShowing = true;
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ inst.dpDiv.find('iframe.ui-datepicker-cover'). // IE6- only
+ css({left: -borders[0], top: -borders[1],
+ width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()});
+ };
+ inst.dpDiv.zIndex($(input).zIndex()+1);
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess);
+ if (!showAnim || !duration)
+ postProcess();
+ if (inst.input.is(':visible') && !inst.input.is(':disabled'))
+ inst.input.focus();
+ $.datepicker._curInst = inst;
+ }
+ },
- uiDialog = (this.uiDialog = $('<div/>'))
- .appendTo(document.body)
- .hide()
- .addClass(uiDialogClasses + options.dialogClass)
- .css({
- position: 'absolute',
- overflow: 'hidden',
- zIndex: options.zIndex
- })
- // setting tabIndex makes the div focusable
- // setting outline to 0 prevents a border on focus in Mozilla
- .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
- (options.closeOnEscape && event.keyCode
- && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event));
+ /* Generate the date picker content. */
+ _updateDatepicker: function(inst) {
+ var self = this;
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ inst.dpDiv.empty().append(this._generateHTML(inst))
+ .find('iframe.ui-datepicker-cover') // IE6- only
+ .css({left: -borders[0], top: -borders[1],
+ width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()})
+ .end()
+ .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
+ .bind('mouseout', function(){
+ $(this).removeClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
})
- .attr({
- role: 'dialog',
- 'aria-labelledby': titleId
+ .bind('mouseover', function(){
+ if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
+ $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+ $(this).addClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
+ }
})
- .mousedown(function(event) {
- self.moveToTop(false, event);
- }),
+ .end()
+ .find('.' + this._dayOverClass + ' a')
+ .trigger('mouseover')
+ .end();
+ var numMonths = this._getNumberOfMonths(inst);
+ var cols = numMonths[1];
+ var width = 17;
+ if (cols > 1)
+ inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
+ else
+ inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
+ inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-multi');
+ inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-rtl');
+ if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input &&
+ inst.input.is(':visible') && !inst.input.is(':disabled'))
+ inst.input.focus();
+ },
- uiDialogContent = this.element
- .show()
- .removeAttr('title')
- .addClass(
- 'ui-dialog-content ' +
- 'ui-widget-content')
- .appendTo(uiDialog),
+ /* Retrieve the size of left and top borders for an element.
+ @param elem (jQuery object) the element of interest
+ @return (number[2]) the left and top borders */
+ _getBorders: function(elem) {
+ var convert = function(value) {
+ return {thin: 1, medium: 2, thick: 3}[value] || value;
+ };
+ return [parseFloat(convert(elem.css('border-left-width'))),
+ parseFloat(convert(elem.css('border-top-width')))];
+ },
- uiDialogTitlebar = (this.uiDialogTitlebar = $('<div></div>'))
- .addClass(
- 'ui-dialog-titlebar ' +
- 'ui-widget-header ' +
- 'ui-corner-all ' +
- 'ui-helper-clearfix'
- )
- .prependTo(uiDialog),
+ /* Check positioning to remain on screen. */
+ _checkOffset: function(inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth();
+ var dpHeight = inst.dpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft();
+ var viewHeight = document.documentElement.clientHeight + $(document).scrollTop();
- uiDialogTitlebarClose = $('<a href="#"/>')
- .addClass(
- 'ui-dialog-titlebar-close ' +
- 'ui-corner-all'
- )
- .attr('role', 'button')
- .hover(
- function() {
- uiDialogTitlebarClose.addClass('ui-state-hover');
- },
- function() {
- uiDialogTitlebarClose.removeClass('ui-state-hover');
- }
- )
- .focus(function() {
- uiDialogTitlebarClose.addClass('ui-state-focus');
- })
- .blur(function() {
- uiDialogTitlebarClose.removeClass('ui-state-focus');
- })
- .mousedown(function(ev) {
- ev.stopPropagation();
- })
- .click(function(event) {
- self.close(event);
- return false;
- })
- .appendTo(uiDialogTitlebar),
+ offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
- uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('<span/>'))
- .addClass(
- 'ui-icon ' +
- 'ui-icon-closethick'
- )
- .text(options.closeText)
- .appendTo(uiDialogTitlebarClose),
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
+ Math.abs(offset.left + dpWidth - viewWidth) : 0);
+ offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
+ Math.abs(dpHeight + inputHeight) : 0);
- uiDialogTitle = $('<span/>')
- .addClass('ui-dialog-title')
- .attr('id', titleId)
- .html(title)
- .prependTo(uiDialogTitlebar);
+ return offset;
+ },
- uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+ /* Find an object's position on the screen. */
+ _findPos: function(obj) {
+ var inst = this._getInst(obj);
+ var isRTL = this._get(inst, 'isRTL');
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
+ obj = obj[isRTL ? 'previousSibling' : 'nextSibling'];
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
- (options.draggable && $.fn.draggable && this._makeDraggable());
- (options.resizable && $.fn.resizable && this._makeResizable());
+ /* Hide the date picker from view.
+ @param input element - the input field attached to the date picker */
+ _hideDatepicker: function(input) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME)))
+ return;
+ if (this._datepickerShowing) {
+ var showAnim = this._get(inst, 'showAnim');
+ var duration = this._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._tidyDialog(inst);
+ this._curInst = null;
+ };
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess);
+ if (!showAnim)
+ postProcess();
+ var onClose = this._get(inst, 'onClose');
+ if (onClose)
+ onClose.apply((inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
+ this._datepickerShowing = false;
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ },
- this._createButtons(options.buttons);
- this._isOpen = false;
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function(inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+ },
- (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe());
- (options.autoOpen && this.open());
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function(event) {
+ if (!$.datepicker._curInst)
+ return;
+ var $target = $(event.target);
+ if ($target[0].id != $.datepicker._mainDivId &&
+ $target.parents('#' + $.datepicker._mainDivId).length == 0 &&
+ !$target.hasClass($.datepicker.markerClassName) &&
+ !$target.hasClass($.datepicker._triggerClass) &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
+ $.datepicker._hideDatepicker();
+ },
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function(id, offset, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
},
- destroy: function() {
- (this.overlay && this.overlay.destroy());
- this.uiDialog.hide();
- this.element
- .unbind('.dialog')
- .removeData('dialog')
- .removeClass('ui-dialog-content ui-widget-content')
- .hide().appendTo('body');
- this.uiDialog.remove();
+ /* Action for current link. */
+ _gotoToday: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ }
+ else {
+ var date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
- (this.originalTitle && this.element.attr('title', this.originalTitle));
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function(id, select, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst._selectingMonthYear = false;
+ inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
+ inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
+ parseInt(select.options[select.selectedIndex].value,10);
+ this._notifyChange(inst);
+ this._adjustDate(target);
},
- close: function(event) {
- var self = this;
+ /* Restore input focus after not changing month/year. */
+ _clickMonthYear: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (inst.input && inst._selectingMonthYear && !$.browser.msie)
+ inst.input.focus();
+ inst._selectingMonthYear = !inst._selectingMonthYear;
+ },
- if (false === self._trigger('beforeclose', event)) {
+ /* Action for selecting a day. */
+ _selectDay: function(id, month, year, td) {
+ var target = $(id);
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
return;
}
+ var inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $('a', td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ },
- (self.overlay && self.overlay.destroy());
- self.uiDialog.unbind('keypress.ui-dialog');
-
- (self.options.hide
- ? self.uiDialog.hide(self.options.hide, function() {
- self._trigger('close', event);
- })
- : self.uiDialog.hide() && self._trigger('close', event));
-
- $.ui.dialog.overlay.resize();
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ this._selectDate(target, '');
+ },
- self._isOpen = false;
+ /* Update the input field with the selected date. */
+ _selectDate: function(id, dateStr) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input)
+ inst.input.val(dateStr);
+ this._updateAlternate(inst);
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect)
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ else if (inst.input)
+ inst.input.trigger('change'); // fire the change event
+ if (inst.inline)
+ this._updateDatepicker(inst);
+ else {
+ this._hideDatepicker();
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) != 'object')
+ inst.input.focus(); // restore focus
+ this._lastInput = null;
+ }
+ },
- // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
- if (self.options.modal) {
- var maxZ = 0;
- $('.ui-dialog').each(function() {
- if (this != self.uiDialog[0]) {
- maxZ = Math.max(maxZ, $(this).css('z-index'));
- }
- });
- $.ui.dialog.maxZ = maxZ;
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
+ var date = this._getDate(inst);
+ var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function() { $(this).val(dateStr); });
}
},
- isOpen: function() {
- return this._isOpen;
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ @param date Date - the date to customise
+ @return [boolean, string] - is this date selectable?, what is its CSS class? */
+ noWeekends: function(date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ''];
},
- // the force parameter allows us to move modal dialogs to their correct
- // position on open
- moveToTop: function(force, event) {
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ @param date Date - the date to get the week for
+ @return number - the number of the week within the year that contains this date */
+ iso8601Week: function(date) {
+ var checkDate = new Date(date.getTime());
+ // Find Thursday of this week starting on Monday
+ checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
+ var time = checkDate.getTime();
+ checkDate.setMonth(0); // Compare with Jan 1
+ checkDate.setDate(1);
+ return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
+ },
- if ((this.options.modal && !force)
- || (!this.options.stack && !this.options.modal)) {
- return this._trigger('focus', event);
- }
+ /* Parse a string value into a date object.
+ See formatDate below for the possible formats.
- if (this.options.zIndex > $.ui.dialog.maxZ) {
- $.ui.dialog.maxZ = this.options.zIndex;
+ @param format string - the expected format of the date
+ @param value string - the date in the above format
+ @param settings Object - attributes include:
+ shortYearCutoff number - the cutoff year for determining the century (optional)
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return Date - the extracted date value or null if value is blank */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null)
+ throw 'Invalid arguments';
+ value = (typeof value == 'object' ? value.toString() : value + '');
+ if (value == '')
+ return null;
+ var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ var year = -1;
+ var month = -1;
+ var day = -1;
+ var doy = -1;
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Extract a number from the string value
+ var getNumber = function(match) {
+ lookAhead(match);
+ var size = (match == '@' ? 14 : (match == '!' ? 20 :
+ (match == 'y' ? 4 : (match == 'o' ? 3 : 2))));
+ var digits = new RegExp('^\\d{1,' + size + '}');
+ var num = value.substring(iValue).match(digits);
+ if (!num)
+ throw 'Missing number at position ' + iValue;
+ iValue += num[0].length;
+ return parseInt(num[0], 10);
+ };
+ // Extract a name from the string value and convert to an index
+ var getName = function(match, shortNames, longNames) {
+ var names = (lookAhead(match) ? longNames : shortNames);
+ for (var i = 0; i < names.length; i++) {
+ if (value.substr(iValue, names[i].length) == names[i]) {
+ iValue += names[i].length;
+ return i + 1;
+ }
+ }
+ throw 'Unknown name at position ' + iValue;
+ };
+ // Confirm that a literal character matches the string value
+ var checkLiteral = function() {
+ if (value.charAt(iValue) != format.charAt(iFormat))
+ throw 'Unexpected literal at position ' + iValue;
+ iValue++;
+ };
+ var iValue = 0;
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ checkLiteral();
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ day = getNumber('d');
+ break;
+ case 'D':
+ getName('D', dayNamesShort, dayNames);
+ break;
+ case 'o':
+ doy = getNumber('o');
+ break;
+ case 'm':
+ month = getNumber('m');
+ break;
+ case 'M':
+ month = getName('M', monthNamesShort, monthNames);
+ break;
+ case 'y':
+ year = getNumber('y');
+ break;
+ case '@':
+ var date = new Date(getNumber('@'));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case '!':
+ var date = new Date((getNumber('!') - this._ticksTo1970) / 10000);
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ checkLiteral();
+ else
+ literal = true;
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ if (year == -1)
+ year = new Date().getFullYear();
+ else if (year < 100)
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ var dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim)
+ break;
+ month++;
+ day -= dim;
+ } while (true);
}
- (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ));
-
- //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
- // http://ui.jquery.com/bugs/ticket/3193
- var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') };
- this.uiDialog.css('z-index', ++$.ui.dialog.maxZ);
- this.element.attr(saveScroll);
- this._trigger('focus', event);
+ var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
+ throw 'Invalid date'; // E.g. 31/02/*
+ return date;
},
- open: function() {
- if (this._isOpen) { return; }
-
- var options = this.options,
- uiDialog = this.uiDialog;
-
- this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null;
- (uiDialog.next().length && uiDialog.appendTo('body'));
- this._size();
- this._position(options.position);
- uiDialog.show(options.show);
- this.moveToTop(true);
+ /* Standard date formats. */
+ ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
+ COOKIE: 'D, dd M yy',
+ ISO_8601: 'yy-mm-dd',
+ RFC_822: 'D, d M y',
+ RFC_850: 'DD, dd-M-y',
+ RFC_1036: 'D, d M y',
+ RFC_1123: 'D, d M yy',
+ RFC_2822: 'D, d M yy',
+ RSS: 'D, d M y', // RFC 822
+ TICKS: '!',
+ TIMESTAMP: '@',
+ W3C: 'yy-mm-dd', // ISO 8601
- // prevent tabbing out of modal dialogs
- (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) {
- if (event.keyCode != $.ui.keyCode.TAB) {
- return;
- }
+ _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
+ Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
- var tabbables = $(':tabbable', this),
- first = tabbables.filter(':first')[0],
- last = tabbables.filter(':last')[0];
+ /* Format a date object into a string value.
+ The format can be combinations of the following:
+ d - day of month (no leading zero)
+ dd - day of month (two digit)
+ o - day of year (no leading zeros)
+ oo - day of year (three digit)
+ D - day name short
+ DD - day name long
+ m - month of year (no leading zero)
+ mm - month of year (two digit)
+ M - month name short
+ MM - month name long
+ y - year (two digit)
+ yy - year (four digit)
+ @ - Unix timestamp (ms since 01/01/1970)
+ ! - Windows ticks (100ns since 01/01/0001)
+ '...' - literal text
+ '' - single quote
- if (event.target == last && !event.shiftKey) {
- setTimeout(function() {
- first.focus();
- }, 1);
- } else if (event.target == first && event.shiftKey) {
- setTimeout(function() {
- last.focus();
- }, 1);
+ @param format string - the desired format of the date
+ @param date Date - the date value to format
+ @param settings Object - attributes include:
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return string - the date in the above format */
+ formatDate: function (format, date, settings) {
+ if (!date)
+ return '';
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Format a number, with leading zero if necessary
+ var formatNumber = function(match, value, len) {
+ var num = '' + value;
+ if (lookAhead(match))
+ while (num.length < len)
+ num = '0' + num;
+ return num;
+ };
+ // Format a name, short or long as requested
+ var formatName = function(match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ };
+ var output = '';
+ var literal = false;
+ if (date)
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ output += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ output += formatNumber('d', date.getDate(), 2);
+ break;
+ case 'D':
+ output += formatName('D', date.getDay(), dayNamesShort, dayNames);
+ break;
+ case 'o':
+ output += formatNumber('o',
+ (date.getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000, 3);
+ break;
+ case 'm':
+ output += formatNumber('m', date.getMonth() + 1, 2);
+ break;
+ case 'M':
+ output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case 'y':
+ output += (lookAhead('y') ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
+ break;
+ case '@':
+ output += date.getTime();
+ break;
+ case '!':
+ output += date.getTime() * 10000 + this._ticksTo1970;
+ break;
+ case "'":
+ if (lookAhead("'"))
+ output += "'";
+ else
+ literal = true;
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
}
- }));
-
- // set focus to the first tabbable element in the content area or the first button
- // if there are no tabbable elements, set focus on the dialog itself
- $([])
- .add(uiDialog.find('.ui-dialog-content :tabbable:first'))
- .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
- .add(uiDialog)
- .filter(':first')
- .focus();
-
- this._trigger('open');
- this._isOpen = true;
+ return output;
},
- _createButtons: function(buttons) {
- var self = this,
- hasButtons = false,
- uiDialogButtonPane = $('<div></div>')
- .addClass(
- 'ui-dialog-buttonpane ' +
- 'ui-widget-content ' +
- 'ui-helper-clearfix'
- );
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var chars = '';
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ for (var iFormat = 0; iFormat < format.length; iFormat++)
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ chars += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd': case 'm': case 'y': case '@':
+ chars += '0123456789';
+ break;
+ case 'D': case 'M':
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'"))
+ chars += "'";
+ else
+ literal = true;
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ return chars;
+ },
- // if we already have a button pane, remove it
- this.uiDialog.find('.ui-dialog-buttonpane').remove();
+ /* Get a setting value, defaulting if necessary. */
+ _get: function(inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
- (typeof buttons == 'object' && buttons !== null &&
- $.each(buttons, function() { return !(hasButtons = true); }));
- if (hasButtons) {
- $.each(buttons, function(name, fn) {
- $('<button type="button"></button>')
- .addClass(
- 'ui-state-default ' +
- 'ui-corner-all'
- )
- .text(name)
- .click(function() { fn.apply(self.element[0], arguments); })
- .hover(
- function() {
- $(this).addClass('ui-state-hover');
- },
- function() {
- $(this).removeClass('ui-state-hover');
- }
- )
- .focus(function() {
- $(this).addClass('ui-state-focus');
- })
- .blur(function() {
- $(this).removeClass('ui-state-focus');
- })
- .appendTo(uiDialogButtonPane);
- });
- uiDialogButtonPane.appendTo(this.uiDialog);
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function(inst, noDefault) {
+ if (inst.input.val() == inst.lastVal) {
+ return;
+ }
+ var dateFormat = this._get(inst, 'dateFormat');
+ var dates = inst.lastVal = inst.input ? inst.input.val() : null;
+ var date, defaultDate;
+ date = defaultDate = this._getDefaultDate(inst);
+ var settings = this._getFormatConfig(inst);
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ this.log(event);
+ dates = (noDefault ? '' : dates);
}
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
},
- _makeDraggable: function() {
- var self = this,
- options = this.options,
- heightBeforeDrag;
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function(inst) {
+ return this._restrictMinMax(inst,
+ this._determineDate(inst, this._get(inst, 'defaultDate'), new Date()));
+ },
- this.uiDialog.draggable({
- cancel: '.ui-dialog-content',
- handle: '.ui-dialog-titlebar',
- containment: 'document',
- start: function() {
- heightBeforeDrag = options.height;
- $(this).height($(this).height()).addClass("ui-dialog-dragging");
- (options.dragStart && options.dragStart.apply(self.element[0], arguments));
- },
- drag: function() {
- (options.drag && options.drag.apply(self.element[0], arguments));
- },
- stop: function() {
- $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
- (options.dragStop && options.dragStop.apply(self.element[0], arguments));
- $.ui.dialog.overlay.resize();
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function(inst, date, defaultDate) {
+ var offsetNumeric = function(offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ };
+ var offsetString = function(offset) {
+ try {
+ return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ offset, $.datepicker._getFormatConfig(inst));
}
- });
+ catch (e) {
+ // Ignore
+ }
+ var date = (offset.toLowerCase().match(/^c/) ?
+ $.datepicker._getDate(inst) : null) || new Date();
+ var year = date.getFullYear();
+ var month = date.getMonth();
+ var day = date.getDate();
+ var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
+ var matches = pattern.exec(offset);
+ while (matches) {
+ switch (matches[2] || 'd') {
+ case 'd' : case 'D' :
+ day += parseInt(matches[1],10); break;
+ case 'w' : case 'W' :
+ day += parseInt(matches[1],10) * 7; break;
+ case 'm' : case 'M' :
+ month += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ case 'y': case 'Y' :
+ year += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ };
+ date = (date == null ? defaultDate : (typeof date == 'string' ? offsetString(date) :
+ (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
+ date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
+ if (date) {
+ date.setHours(0);
+ date.setMinutes(0);
+ date.setSeconds(0);
+ date.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(date);
},
- _makeResizable: function(handles) {
- handles = (handles === undefined ? this.options.resizable : handles);
- var self = this,
- options = this.options,
- resizeHandles = typeof handles == 'string'
- ? handles
- : 'n,e,s,w,se,sw,ne,nw';
+ /* Handle switch to/from daylight saving.
+ Hours may be non-zero on daylight saving cut-over:
+ > 12 when midnight changeover, but then cannot generate
+ midnight datetime, so jump to 1AM, otherwise reset.
+ @param date (Date) the date to check
+ @return (Date) the corrected date */
+ _daylightSavingAdjust: function(date) {
+ if (!date) return null;
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
- this.uiDialog.resizable({
- cancel: '.ui-dialog-content',
- alsoResize: this.element,
- maxWidth: options.maxWidth,
- maxHeight: options.maxHeight,
- minWidth: options.minWidth,
- minHeight: options.minHeight,
- start: function() {
- $(this).addClass("ui-dialog-resizing");
- (options.resizeStart && options.resizeStart.apply(self.element[0], arguments));
- },
- resize: function() {
- (options.resize && options.resize.apply(self.element[0], arguments));
- },
- handles: resizeHandles,
- stop: function() {
- $(this).removeClass("ui-dialog-resizing");
- options.height = $(this).height();
- options.width = $(this).width();
- (options.resizeStop && options.resizeStop.apply(self.element[0], arguments));
- $.ui.dialog.overlay.resize();
- }
- })
- .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ /* Set the date(s) directly. */
+ _setDate: function(inst, date, noChange) {
+ var clear = !(date);
+ var origMonth = inst.selectedMonth;
+ var origYear = inst.selectedYear;
+ date = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
+ inst.selectedDay = inst.currentDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
+ if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange)
+ this._notifyChange(inst);
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? '' : this._formatDate(inst));
+ }
},
- _position: function(pos) {
- var wnd = $(window), doc = $(document),
- pTop = doc.scrollTop(), pLeft = doc.scrollLeft(),
- minTop = pTop;
+ /* Retrieve the date(s) directly. */
+ _getDate: function(inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
- if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) {
- pos = [
- pos == 'right' || pos == 'left' ? pos : 'center',
- pos == 'top' || pos == 'bottom' ? pos : 'middle'
- ];
- }
- if (pos.constructor != Array) {
- pos = ['center', 'middle'];
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function(inst) {
+ var today = new Date();
+ today = this._daylightSavingAdjust(
+ new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
+ var isRTL = this._get(inst, 'isRTL');
+ var showButtonPanel = this._get(inst, 'showButtonPanel');
+ var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
+ var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
+ var numMonths = this._getNumberOfMonths(inst);
+ var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
+ var stepMonths = this._get(inst, 'stepMonths');
+ var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
+ var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var drawMonth = inst.drawMonth - showCurrentAtPos;
+ var drawYear = inst.drawYear;
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
}
- if (pos[0].constructor == Number) {
- pLeft += pos[0];
- } else {
- switch (pos[0]) {
- case 'left':
- pLeft += 0;
- break;
- case 'right':
- pLeft += wnd.width() - this.uiDialog.outerWidth();
- break;
- default:
- case 'center':
- pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2;
+ if (maxDate) {
+ var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
}
}
- if (pos[1].constructor == Number) {
- pTop += pos[1];
- } else {
- switch (pos[1]) {
- case 'top':
- pTop += 0;
- break;
- case 'bottom':
- pTop += wnd.height() - this.uiDialog.outerHeight();
- break;
- default:
- case 'middle':
- pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2;
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+ var prevText = this._get(inst, 'prevText');
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
+ ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
+ var nextText = this._get(inst, 'nextText');
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
+ ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
+ var currentText = this._get(inst, 'currentText');
+ var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+ var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
+ var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
+ (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._gotoToday(\'#' + inst.id + '\');"' +
+ '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
+ var firstDay = parseInt(this._get(inst, 'firstDay'),10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+ var showWeek = this._get(inst, 'showWeek');
+ var dayNames = this._get(inst, 'dayNames');
+ var dayNamesShort = this._get(inst, 'dayNamesShort');
+ var dayNamesMin = this._get(inst, 'dayNamesMin');
+ var monthNames = this._get(inst, 'monthNames');
+ var monthNamesShort = this._get(inst, 'monthNamesShort');
+ var beforeShowDay = this._get(inst, 'beforeShowDay');
+ var showOtherMonths = this._get(inst, 'showOtherMonths');
+ var selectOtherMonths = this._get(inst, 'selectOtherMonths');
+ var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
+ var defaultDate = this._getDefaultDate(inst);
+ var html = '';
+ for (var row = 0; row < numMonths[0]; row++) {
+ var group = '';
+ for (var col = 0; col < numMonths[1]; col++) {
+ var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ var cornerClass = ' ui-corner-all';
+ var calender = '';
+ if (isMultiMonth) {
+ calender += '<div class="ui-datepicker-group';
+ if (numMonths[1] > 1)
+ switch (col) {
+ case 0: calender += ' ui-datepicker-group-first';
+ cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
+ case numMonths[1]-1: calender += ' ui-datepicker-group-last';
+ cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
+ default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break;
+ }
+ calender += '">';
+ }
+ calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
+ (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
+ (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ '</div><table class="ui-datepicker-calendar"><thead>' +
+ '<tr>';
+ var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : '');
+ for (var dow = 0; dow < 7; dow++) { // days of the week
+ var day = (dow + firstDay) % 7;
+ thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
+ '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
+ }
+ calender += thead + '</tr></thead><tbody>';
+ var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
+ var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += '<tr>';
+ var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' +
+ this._get(inst, 'calculateWeek')(printDate) + '</td>');
+ for (var dow = 0; dow < 7; dow++) { // create date picker days
+ var daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
+ var otherMonth = (printDate.getMonth() != drawMonth);
+ var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += '<td class="' +
+ ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
+ (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
+ ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ ' ' + this._dayOverClass : '') + // highlight selected day
+ (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
+ (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day
+ (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
+ (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' +
+ inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions
+ (otherMonth && !showOtherMonths ? ' ' : // display for other months
+ (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
+ (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
+ (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day
+ (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months
+ '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + '</tr>';
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
+ ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
+ group += calender;
}
+ html += group;
}
-
- // prevent the dialog from being too high (make sure the titlebar
- // is accessible)
- pTop = Math.max(pTop, minTop);
- this.uiDialog.css({top: pTop, left: pLeft});
+ html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
+ inst._keyEvent = false;
+ return html;
},
- _setData: function(key, value){
- (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value));
- switch (key) {
- case "buttons":
- this._createButtons(value);
- break;
- case "closeText":
- this.uiDialogTitlebarCloseText.text(value);
- break;
- case "dialogClass":
- this.uiDialog
- .removeClass(this.options.dialogClass)
- .addClass(uiDialogClasses + value);
- break;
- case "draggable":
- (value
- ? this._makeDraggable()
- : this.uiDialog.draggable('destroy'));
- break;
- case "height":
- this.uiDialog.height(value);
- break;
- case "position":
- this._position(value);
- break;
- case "resizable":
- var uiDialog = this.uiDialog,
- isResizable = this.uiDialog.is(':data(resizable)');
-
- // currently resizable, becoming non-resizable
- (isResizable && !value && uiDialog.resizable('destroy'));
-
- // currently resizable, changing handles
- (isResizable && typeof value == 'string' &&
- uiDialog.resizable('option', 'handles', value));
-
- // currently non-resizable, becoming resizable
- (isResizable || this._makeResizable(value));
- break;
- case "title":
- $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' ');
- break;
- case "width":
- this.uiDialog.width(value);
- break;
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+ secondary, monthNames, monthNamesShort) {
+ var changeMonth = this._get(inst, 'changeMonth');
+ var changeYear = this._get(inst, 'changeYear');
+ var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
+ var html = '<div class="ui-datepicker-title">';
+ var monthHtml = '';
+ // month selection
+ if (secondary || !changeMonth)
+ monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>';
+ else {
+ var inMinYear = (minDate && minDate.getFullYear() == drawYear);
+ var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
+ monthHtml += '<select class="ui-datepicker-month" ' +
+ 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
+ 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (var month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) &&
+ (!inMaxYear || month <= maxDate.getMonth()))
+ monthHtml += '<option value="' + month + '"' +
+ (month == drawMonth ? ' selected="selected"' : '') +
+ '>' + monthNamesShort[month] + '</option>';
+ }
+ monthHtml += '</select>';
+ }
+ if (!showMonthAfterYear)
+ html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : '');
+ // year selection
+ if (secondary || !changeYear)
+ html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
+ else {
+ // determine range of years to display
+ var years = this._get(inst, 'yearRange').split(':');
+ var thisYear = new Date().getFullYear();
+ var determineYear = function(value) {
+ var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) :
+ (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) :
+ parseInt(value, 10)));
+ return (isNaN(year) ? thisYear : year);
+ };
+ var year = determineYear(years[0]);
+ var endYear = Math.max(year, determineYear(years[1] || ''));
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ html += '<select class="ui-datepicker-year" ' +
+ 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
+ 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (; year <= endYear; year++) {
+ html += '<option value="' + year + '"' +
+ (year == drawYear ? ' selected="selected"' : '') +
+ '>' + year + '</option>';
+ }
+ html += '</select>';
}
-
- $.widget.prototype._setData.apply(this, arguments);
+ html += this._get(inst, 'yearSuffix');
+ if (showMonthAfterYear)
+ html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml;
+ html += '</div>'; // Close datepicker_header
+ return html;
},
- _size: function() {
- /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
- * divs will both have width and height set, so we need to reset them
- */
- var options = this.options;
-
- // reset content sizing
- this.element.css({
- height: 0,
- minHeight: 0,
- width: 'auto'
- });
-
- // reset wrapper sizing
- // determine the height of all the non-content elements
- var nonContentHeight = this.uiDialog.css({
- height: 'auto',
- width: options.width
- })
- .height();
-
- this.element
- .css({
- minHeight: Math.max(options.minHeight - nonContentHeight, 0),
- height: options.height == 'auto'
- ? 'auto'
- : Math.max(options.height - nonContentHeight, 0)
- });
- }
-});
-
-$.extend($.ui.dialog, {
- version: "1.7.2",
- defaults: {
- autoOpen: true,
- bgiframe: false,
- buttons: {},
- closeOnEscape: true,
- closeText: 'close',
- dialogClass: '',
- draggable: true,
- hide: null,
- height: 'auto',
- maxHeight: false,
- maxWidth: false,
- minHeight: 150,
- minWidth: 150,
- modal: false,
- position: 'center',
- resizable: true,
- show: null,
- stack: true,
- title: '',
- width: 300,
- zIndex: 1000
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function(inst, offset, period) {
+ var year = inst.drawYear + (period == 'Y' ? offset : 0);
+ var month = inst.drawMonth + (period == 'M' ? offset : 0);
+ var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
+ (period == 'D' ? offset : 0);
+ var date = this._restrictMinMax(inst,
+ this._daylightSavingAdjust(new Date(year, month, day)));
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period == 'M' || period == 'Y')
+ this._notifyChange(inst);
},
- getter: 'isOpen',
-
- uuid: 0,
- maxZ: 0,
-
- getTitleId: function($el) {
- return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid);
+ /* Ensure a date is within any min/max bounds. */
+ _restrictMinMax: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ return date;
},
- overlay: function(dialog) {
- this.$el = $.ui.dialog.overlay.create(dialog);
- }
-});
-
-$.extend($.ui.dialog.overlay, {
- instances: [],
- maxZ: 0,
- events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
- function(event) { return event + '.dialog-overlay'; }).join(' '),
- create: function(dialog) {
- if (this.instances.length === 0) {
- // prevent use of anchors and inputs
- // we use a setTimeout in case the overlay is created from an
- // event that we're going to be cancelling (see #2804)
- setTimeout(function() {
- // handle $(el).dialog().dialog('close') (see #4065)
- if ($.ui.dialog.overlay.instances.length) {
- $(document).bind($.ui.dialog.overlay.events, function(event) {
- var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0;
- return (dialogZ > $.ui.dialog.overlay.maxZ);
- });
- }
- }, 1);
-
- // allow closing by pressing the escape key
- $(document).bind('keydown.dialog-overlay', function(event) {
- (dialog.options.closeOnEscape && event.keyCode
- && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event));
- });
-
- // handle window resize
- $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
- }
-
- var $el = $('<div></div>').appendTo(document.body)
- .addClass('ui-widget-overlay').css({
- width: this.width(),
- height: this.height()
- });
-
- (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe());
-
- this.instances.push($el);
- return $el;
+ /* Notify change of month/year. */
+ _notifyChange: function(inst) {
+ var onChange = this._get(inst, 'onChangeMonthYear');
+ if (onChange)
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
},
- destroy: function($el) {
- this.instances.splice($.inArray(this.instances, $el), 1);
-
- if (this.instances.length === 0) {
- $([document, window]).unbind('.dialog-overlay');
- }
-
- $el.remove();
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function(inst) {
+ var numMonths = this._get(inst, 'numberOfMonths');
+ return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ },
- // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
- var maxZ = 0;
- $.each(this.instances, function() {
- maxZ = Math.max(maxZ, this.css('z-index'));
- });
- this.maxZ = maxZ;
+ /* Determine the current maximum date - ensure no time components are set. */
+ _getMinMaxDate: function(inst, minMax) {
+ return this._determineDate(inst, this._get(inst, minMax + 'Date'), null);
},
- height: function() {
- // handle IE 6
- if ($.browser.msie && $.browser.version < 7) {
- var scrollHeight = Math.max(
- document.documentElement.scrollHeight,
- document.body.scrollHeight
- );
- var offsetHeight = Math.max(
- document.documentElement.offsetHeight,
- document.body.offsetHeight
- );
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function(year, month) {
+ return 32 - new Date(year, month, 32).getDate();
+ },
- if (scrollHeight < offsetHeight) {
- return $(window).height() + 'px';
- } else {
- return scrollHeight + 'px';
- }
- // handle "good" browsers
- } else {
- return $(document).height() + 'px';
- }
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function(year, month) {
+ return new Date(year, month, 1).getDay();
},
- width: function() {
- // handle IE 6
- if ($.browser.msie && $.browser.version < 7) {
- var scrollWidth = Math.max(
- document.documentElement.scrollWidth,
- document.body.scrollWidth
- );
- var offsetWidth = Math.max(
- document.documentElement.offsetWidth,
- document.body.offsetWidth
- );
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function(inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst);
+ var date = this._daylightSavingAdjust(new Date(curYear,
+ curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
+ if (offset < 0)
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ return this._isInRange(inst, date);
+ },
- if (scrollWidth < offsetWidth) {
- return $(window).width() + 'px';
- } else {
- return scrollWidth + 'px';
- }
- // handle "good" browsers
- } else {
- return $(document).width() + 'px';
- }
+ /* Is the given date in the accepted range? */
+ _isInRange: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ return ((!minDate || date.getTime() >= minDate.getTime()) &&
+ (!maxDate || date.getTime() <= maxDate.getTime()));
},
- resize: function() {
- /* If the dialog is draggable and the user drags it past the
- * right edge of the window, the document becomes wider so we
- * need to stretch the overlay. If the user then drags the
- * dialog back to the left, the document will become narrower,
- * so we need to shrink the overlay to the appropriate size.
- * This is handled by shrinking the overlay before setting it
- * to the full document size.
- */
- var $overlays = $([]);
- $.each($.ui.dialog.overlay.instances, function() {
- $overlays = $overlays.add(this);
- });
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function(inst) {
+ var shortYearCutoff = this._get(inst, 'shortYearCutoff');
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
+ monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ },
- $overlays.css({
- width: 0,
- height: 0
- }).css({
- width: $.ui.dialog.overlay.width(),
- height: $.ui.dialog.overlay.height()
- });
+ /* Format the given date for display. */
+ _formatDate: function(inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day == 'object' ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
}
});
-$.extend($.ui.dialog.overlay.prototype, {
- destroy: function() {
- $.ui.dialog.overlay.destroy(this.$el);
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+ return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
+ (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
+};
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function(options){
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick).
+ find('body').append($.datepicker.dpDiv);
+ $.datepicker.initialized = true;
}
-});
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget'))
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ return this.each(function() {
+ typeof options == 'string' ?
+ $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.8.1";
+
+// Workaround for #4055
+// Add another global to avoid noConflict issues with inline event handlers
+window['DP_jQuery_' + dpuuid] = $;
})(jQuery);
/*
- * jQuery UI Progressbar 1.7.2
+ * jQuery UI Progressbar 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
* http://docs.jquery.com/UI/Progressbar
*
* Depends:
- * ui.core.js
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
*/
-(function($) {
-
-$.widget("ui.progressbar", {
-
- _init: function() {
+(function( $ ) {
+$.widget( "ui.progressbar", {
+ options: {
+ value: 0
+ },
+ _create: function() {
this.element
- .addClass("ui-progressbar"
- + " ui-widget"
- + " ui-widget-content"
- + " ui-corner-all")
+ .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
.attr({
role: "progressbar",
"aria-valuemin": this._valueMin(),
@@ -7802,1332 +9380,1592 @@ $.widget("ui.progressbar", {
"aria-valuenow": this._value()
});
- this.valueDiv = $('<div class="ui-progressbar-value ui-widget-header ui-corner-left"></div>').appendTo(this.element);
+ this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" )
+ .appendTo( this.element );
this._refreshValue();
-
},
destroy: function() {
-
this.element
- .removeClass("ui-progressbar"
- + " ui-widget"
- + " ui-widget-content"
- + " ui-corner-all")
- .removeAttr("role")
- .removeAttr("aria-valuemin")
- .removeAttr("aria-valuemax")
- .removeAttr("aria-valuenow")
- .removeData("progressbar")
- .unbind(".progressbar");
+ .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-valuemin" )
+ .removeAttr( "aria-valuemax" )
+ .removeAttr( "aria-valuenow" );
this.valueDiv.remove();
- $.widget.prototype.destroy.apply(this, arguments);
-
+ $.Widget.prototype.destroy.apply( this, arguments );
},
- value: function(newValue) {
- if (newValue === undefined) {
+ value: function( newValue ) {
+ if ( newValue === undefined ) {
return this._value();
}
- this._setData('value', newValue);
+ this._setOption( "value", newValue );
return this;
},
- _setData: function(key, value) {
-
- switch (key) {
- case 'value':
+ _setOption: function( key, value ) {
+ switch ( key ) {
+ case "value":
this.options.value = value;
this._refreshValue();
- this._trigger('change', null, {});
+ this._trigger( "change" );
break;
}
- $.widget.prototype._setData.apply(this, arguments);
-
+ $.Widget.prototype._setOption.apply( this, arguments );
},
_value: function() {
-
var val = this.options.value;
- if (val < this._valueMin()) val = this._valueMin();
- if (val > this._valueMax()) val = this._valueMax();
+ // normalize invalid value
+ if ( typeof val !== "number" ) {
+ val = 0;
+ }
+ if ( val < this._valueMin() ) {
+ val = this._valueMin();
+ }
+ if ( val > this._valueMax() ) {
+ val = this._valueMax();
+ }
return val;
-
},
_valueMin: function() {
- var valueMin = 0;
- return valueMin;
+ return 0;
},
_valueMax: function() {
- var valueMax = 100;
- return valueMax;
+ return 100;
},
_refreshValue: function() {
var value = this.value();
- this.valueDiv[value == this._valueMax() ? 'addClass' : 'removeClass']("ui-corner-right");
- this.valueDiv.width(value + '%');
- this.element.attr("aria-valuenow", value);
+ this.valueDiv
+ [ value === this._valueMax() ? "addClass" : "removeClass"]( "ui-corner-right" )
+ .width( value + "%" );
+ this.element.attr( "aria-valuenow", value );
}
-
});
-$.extend($.ui.progressbar, {
- version: "1.7.2",
- defaults: {
- value: 0
- }
+$.extend( $.ui.progressbar, {
+ version: "1.8.1"
});
-})(jQuery);
+})( jQuery );
/*
- * jQuery UI Slider 1.7.2
+ * jQuery UI Effects 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
- * http://docs.jquery.com/UI/Slider
- *
- * Depends:
- * ui.core.js
+ * http://docs.jquery.com/UI/Effects/
*/
+;jQuery.effects || (function($) {
-(function($) {
-
-$.widget("ui.slider", $.extend({}, $.ui.mouse, {
-
- _init: function() {
-
- var self = this, o = this.options;
- this._keySliding = false;
- this._handleIndex = null;
- this._detectOrientation();
- this._mouseInit();
-
- this.element
- .addClass("ui-slider"
- + " ui-slider-" + this.orientation
- + " ui-widget"
- + " ui-widget-content"
- + " ui-corner-all");
-
- this.range = $([]);
-
- if (o.range) {
-
- if (o.range === true) {
- this.range = $('<div></div>');
- if (!o.values) o.values = [this._valueMin(), this._valueMin()];
- if (o.values.length && o.values.length != 2) {
- o.values = [o.values[0], o.values[0]];
- }
- } else {
- this.range = $('<div></div>');
- }
+$.effects = {};
- this.range
- .appendTo(this.element)
- .addClass("ui-slider-range");
- if (o.range == "min" || o.range == "max") {
- this.range.addClass("ui-slider-range-" + o.range);
- }
- // note: this isn't the most fittingly semantic framework class for this element,
- // but worked best visually with a variety of themes
- this.range.addClass("ui-widget-header");
+/******************************************************************************/
+/****************************** COLOR ANIMATIONS ******************************/
+/******************************************************************************/
+// override the animation for color styles
+$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor',
+ 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'],
+function(i, attr) {
+ $.fx.step[attr] = function(fx) {
+ if (!fx.colorInit) {
+ fx.start = getColor(fx.elem, attr);
+ fx.end = getRGB(fx.end);
+ fx.colorInit = true;
}
- if ($(".ui-slider-handle", this.element).length == 0)
- $('<a href="#"></a>')
- .appendTo(this.element)
- .addClass("ui-slider-handle");
-
- if (o.values && o.values.length) {
- while ($(".ui-slider-handle", this.element).length < o.values.length)
- $('<a href="#"></a>')
- .appendTo(this.element)
- .addClass("ui-slider-handle");
- }
+ fx.elem.style[attr] = 'rgb(' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')';
+ };
+});
- this.handles = $(".ui-slider-handle", this.element)
- .addClass("ui-state-default"
- + " ui-corner-all");
+// Color Conversion functions from highlightFade
+// By Blair Mitchelmore
+// http://jquery.offput.ca/highlightFade/
- this.handle = this.handles.eq(0);
+// Parse strings looking for color tuples [255,255,255]
+function getRGB(color) {
+ var result;
- this.handles.add(this.range).filter("a")
- .click(function(event) {
- event.preventDefault();
- })
- .hover(function() {
- if (!o.disabled) {
- $(this).addClass('ui-state-hover');
- }
- }, function() {
- $(this).removeClass('ui-state-hover');
- })
- .focus(function() {
- if (!o.disabled) {
- $(".ui-slider .ui-state-focus").removeClass('ui-state-focus'); $(this).addClass('ui-state-focus');
- } else {
- $(this).blur();
- }
- })
- .blur(function() {
- $(this).removeClass('ui-state-focus');
- });
+ // Check if we're already dealing with an array of colors
+ if ( color && color.constructor == Array && color.length == 3 )
+ return color;
- this.handles.each(function(i) {
- $(this).data("index.ui-slider-handle", i);
- });
+ // Look for rgb(num,num,num)
+ if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
+ return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
- this.handles.keydown(function(event) {
+ // Look for rgb(num%,num%,num%)
+ if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
+ return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
- var ret = true;
+ // Look for #a0b1c2
+ if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
+ return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
- var index = $(this).data("index.ui-slider-handle");
+ // Look for #fff
+ if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
+ return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
- if (self.options.disabled)
- return;
+ // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
+ if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
+ return colors['transparent'];
- switch (event.keyCode) {
- case $.ui.keyCode.HOME:
- case $.ui.keyCode.END:
- case $.ui.keyCode.UP:
- case $.ui.keyCode.RIGHT:
- case $.ui.keyCode.DOWN:
- case $.ui.keyCode.LEFT:
- ret = false;
- if (!self._keySliding) {
- self._keySliding = true;
- $(this).addClass("ui-state-active");
- self._start(event, index);
- }
- break;
- }
+ // Otherwise, we're most likely dealing with a named color
+ return colors[$.trim(color).toLowerCase()];
+}
- var curVal, newVal, step = self._step();
- if (self.options.values && self.options.values.length) {
- curVal = newVal = self.values(index);
- } else {
- curVal = newVal = self.value();
- }
+function getColor(elem, attr) {
+ var color;
- switch (event.keyCode) {
- case $.ui.keyCode.HOME:
- newVal = self._valueMin();
- break;
- case $.ui.keyCode.END:
- newVal = self._valueMax();
- break;
- case $.ui.keyCode.UP:
- case $.ui.keyCode.RIGHT:
- if(curVal == self._valueMax()) return;
- newVal = curVal + step;
- break;
- case $.ui.keyCode.DOWN:
- case $.ui.keyCode.LEFT:
- if(curVal == self._valueMin()) return;
- newVal = curVal - step;
- break;
- }
+ do {
+ color = $.curCSS(elem, attr);
- self._slide(event, index, newVal);
+ // Keep going until we find an element that has color, or we hit the body
+ if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
+ break;
- return ret;
+ attr = "backgroundColor";
+ } while ( elem = elem.parentNode );
- }).keyup(function(event) {
+ return getRGB(color);
+};
- var index = $(this).data("index.ui-slider-handle");
+// Some named colors to work with
+// From Interface by Stefan Petre
+// http://interface.eyecon.ro/
- if (self._keySliding) {
- self._stop(event, index);
- self._change(event, index);
- self._keySliding = false;
- $(this).removeClass("ui-state-active");
- }
+var colors = {
+ aqua:[0,255,255],
+ azure:[240,255,255],
+ beige:[245,245,220],
+ black:[0,0,0],
+ blue:[0,0,255],
+ brown:[165,42,42],
+ cyan:[0,255,255],
+ darkblue:[0,0,139],
+ darkcyan:[0,139,139],
+ darkgrey:[169,169,169],
+ darkgreen:[0,100,0],
+ darkkhaki:[189,183,107],
+ darkmagenta:[139,0,139],
+ darkolivegreen:[85,107,47],
+ darkorange:[255,140,0],
+ darkorchid:[153,50,204],
+ darkred:[139,0,0],
+ darksalmon:[233,150,122],
+ darkviolet:[148,0,211],
+ fuchsia:[255,0,255],
+ gold:[255,215,0],
+ green:[0,128,0],
+ indigo:[75,0,130],
+ khaki:[240,230,140],
+ lightblue:[173,216,230],
+ lightcyan:[224,255,255],
+ lightgreen:[144,238,144],
+ lightgrey:[211,211,211],
+ lightpink:[255,182,193],
+ lightyellow:[255,255,224],
+ lime:[0,255,0],
+ magenta:[255,0,255],
+ maroon:[128,0,0],
+ navy:[0,0,128],
+ olive:[128,128,0],
+ orange:[255,165,0],
+ pink:[255,192,203],
+ purple:[128,0,128],
+ violet:[128,0,128],
+ red:[255,0,0],
+ silver:[192,192,192],
+ white:[255,255,255],
+ yellow:[255,255,0],
+ transparent: [255,255,255]
+};
- });
- this._refreshValue();
- },
+/******************************************************************************/
+/****************************** CLASS ANIMATIONS ******************************/
+/******************************************************************************/
- destroy: function() {
+var classAnimationActions = ['add', 'remove', 'toggle'],
+ shorthandStyles = {
+ border: 1,
+ borderBottom: 1,
+ borderColor: 1,
+ borderLeft: 1,
+ borderRight: 1,
+ borderTop: 1,
+ borderWidth: 1,
+ margin: 1,
+ padding: 1
+ };
- this.handles.remove();
- this.range.remove();
+function getElementStyles() {
+ var style = document.defaultView
+ ? document.defaultView.getComputedStyle(this, null)
+ : this.currentStyle,
+ newStyle = {},
+ key,
+ camelCase;
+
+ // webkit enumerates style porperties
+ if (style && style.length && style[0] && style[style[0]]) {
+ var len = style.length;
+ while (len--) {
+ key = style[len];
+ if (typeof style[key] == 'string') {
+ camelCase = key.replace(/\-(\w)/g, function(all, letter){
+ return letter.toUpperCase();
+ });
+ newStyle[camelCase] = style[key];
+ }
+ }
+ } else {
+ for (key in style) {
+ if (typeof style[key] === 'string') {
+ newStyle[key] = style[key];
+ }
+ }
+ }
+
+ return newStyle;
+}
- this.element
- .removeClass("ui-slider"
- + " ui-slider-horizontal"
- + " ui-slider-vertical"
- + " ui-slider-disabled"
- + " ui-widget"
- + " ui-widget-content"
- + " ui-corner-all")
- .removeData("slider")
- .unbind(".slider");
+function filterStyles(styles) {
+ var name, value;
+ for (name in styles) {
+ value = styles[name];
+ if (
+ // ignore null and undefined values
+ value == null ||
+ // ignore functions (when does this occur?)
+ $.isFunction(value) ||
+ // shorthand styles that need to be expanded
+ name in shorthandStyles ||
+ // ignore scrollbars (break in IE)
+ (/scrollbar/).test(name) ||
+
+ // only colors or values that can be converted to numbers
+ (!(/color/i).test(name) && isNaN(parseFloat(value)))
+ ) {
+ delete styles[name];
+ }
+ }
+
+ return styles;
+}
- this._mouseDestroy();
+function styleDifference(oldStyle, newStyle) {
+ var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459
+ name;
- },
+ for (name in newStyle) {
+ if (oldStyle[name] != newStyle[name]) {
+ diff[name] = newStyle[name];
+ }
+ }
- _mouseCapture: function(event) {
+ return diff;
+}
- var o = this.options;
+$.effects.animateClass = function(value, duration, easing, callback) {
+ if ($.isFunction(easing)) {
+ callback = easing;
+ easing = null;
+ }
- if (o.disabled)
- return false;
+ return this.each(function() {
- this.elementSize = {
- width: this.element.outerWidth(),
- height: this.element.outerHeight()
- };
- this.elementOffset = this.element.offset();
+ var that = $(this),
+ originalStyleAttr = that.attr('style') || ' ',
+ originalStyle = filterStyles(getElementStyles.call(this)),
+ newStyle,
+ className = that.attr('className');
- var position = { x: event.pageX, y: event.pageY };
- var normValue = this._normValueFromMouse(position);
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) {
+ that[action + 'Class'](value[action]);
+ }
+ });
+ newStyle = filterStyles(getElementStyles.call(this));
+ that.attr('className', className);
- var distance = this._valueMax() - this._valueMin() + 1, closestHandle;
- var self = this, index;
- this.handles.each(function(i) {
- var thisDistance = Math.abs(normValue - self.values(i));
- if (distance > thisDistance) {
- distance = thisDistance;
- closestHandle = $(this);
- index = i;
+ that.animate(styleDifference(originalStyle, newStyle), duration, easing, function() {
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) { that[action + 'Class'](value[action]); }
+ });
+ // work around bug in IE by clearing the cssText before setting it
+ if (typeof that.attr('style') == 'object') {
+ that.attr('style').cssText = '';
+ that.attr('style').cssText = originalStyleAttr;
+ } else {
+ that.attr('style', originalStyleAttr);
}
+ if (callback) { callback.apply(this, arguments); }
});
+ });
+};
- // workaround for bug #3736 (if both handles of a range are at 0,
- // the first is always used as the one with least distance,
- // and moving it is obviously prevented by preventing negative ranges)
- if(o.range == true && this.values(1) == o.min) {
- closestHandle = $(this.handles[++index]);
+$.fn.extend({
+ _addClass: $.fn.addClass,
+ addClass: function(classNames, speed, easing, callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
+ },
+
+ _removeClass: $.fn.removeClass,
+ removeClass: function(classNames,speed,easing,callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
+ },
+
+ _toggleClass: $.fn.toggleClass,
+ toggleClass: function(classNames, force, speed, easing, callback) {
+ if ( typeof force == "boolean" || force === undefined ) {
+ if ( !speed ) {
+ // without speed parameter;
+ return this._toggleClass(classNames, force);
+ } else {
+ return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]);
+ }
+ } else {
+ // without switch parameter;
+ return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]);
}
+ },
- this._start(event, index);
+ switchClass: function(remove,add,speed,easing,callback) {
+ return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+ }
+});
- self._handleIndex = index;
- closestHandle
- .addClass("ui-state-active")
- .focus();
- var offset = closestHandle.offset();
- var mouseOverHandle = !$(event.target).parents().andSelf().is('.ui-slider-handle');
- this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
- left: event.pageX - offset.left - (closestHandle.width() / 2),
- top: event.pageY - offset.top
- - (closestHandle.height() / 2)
- - (parseInt(closestHandle.css('borderTopWidth'),10) || 0)
- - (parseInt(closestHandle.css('borderBottomWidth'),10) || 0)
- + (parseInt(closestHandle.css('marginTop'),10) || 0)
- };
+/******************************************************************************/
+/*********************************** EFFECTS **********************************/
+/******************************************************************************/
- normValue = this._normValueFromMouse(position);
- this._slide(event, index, normValue);
- return true;
+$.extend($.effects, {
+ version: "1.8.1",
+ // Saves a set of properties in a data storage
+ save: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+ }
},
- _mouseStart: function(event) {
- return true;
+ // Restores a set of previously saved properties from a data storage
+ restore: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ }
},
- _mouseDrag: function(event) {
-
- var position = { x: event.pageX, y: event.pageY };
- var normValue = this._normValueFromMouse(position);
+ setMode: function(el, mode) {
+ if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
+ return mode;
+ },
- this._slide(event, this._handleIndex, normValue);
+ getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ var y, x;
+ switch (origin[0]) {
+ case 'top': y = 0; break;
+ case 'middle': y = 0.5; break;
+ case 'bottom': y = 1; break;
+ default: y = origin[0] / original.height;
+ };
+ switch (origin[1]) {
+ case 'left': x = 0; break;
+ case 'center': x = 0.5; break;
+ case 'right': x = 1; break;
+ default: x = origin[1] / original.width;
+ };
+ return {x: x, y: y};
+ },
- return false;
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function(element) {
- },
+ // if the element is already wrapped, return it
+ if (element.parent().is('.ui-effects-wrapper')) {
+ return element.parent();
+ }
- _mouseStop: function(event) {
+ // wrap the element
+ var props = {
+ width: element.outerWidth(true),
+ height: element.outerHeight(true),
+ 'float': element.css('float')
+ },
+ wrapper = $('<div></div>')
+ .addClass('ui-effects-wrapper')
+ .css({
+ fontSize: '100%',
+ background: 'transparent',
+ border: 'none',
+ margin: 0,
+ padding: 0
+ });
- this.handles.removeClass("ui-state-active");
- this._stop(event, this._handleIndex);
- this._change(event, this._handleIndex);
- this._handleIndex = null;
- this._clickOffset = null;
+ element.wrap(wrapper);
+ wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element
- return false;
+ // transfer positioning properties to the wrapper
+ if (element.css('position') == 'static') {
+ wrapper.css({ position: 'relative' });
+ element.css({ position: 'relative' });
+ } else {
+ $.extend(props, {
+ position: element.css('position'),
+ zIndex: element.css('z-index')
+ });
+ $.each(['top', 'left', 'bottom', 'right'], function(i, pos) {
+ props[pos] = element.css(pos);
+ if (isNaN(parseInt(props[pos], 10))) {
+ props[pos] = 'auto';
+ }
+ });
+ element.css({position: 'relative', top: 0, left: 0 });
+ }
+ return wrapper.css(props).show();
},
- _detectOrientation: function() {
- this.orientation = this.options.orientation == 'vertical' ? 'vertical' : 'horizontal';
+ removeWrapper: function(element) {
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent().replaceWith(element);
+ return element;
},
- _normValueFromMouse: function(position) {
+ setTransition: function(element, list, factor, value) {
+ value = value || {};
+ $.each(list, function(i, x){
+ unit = element.cssUnit(x);
+ if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
+ });
+ return value;
+ }
+});
+
- var pixelTotal, pixelMouse;
- if ('horizontal' == this.orientation) {
- pixelTotal = this.elementSize.width;
- pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0);
- } else {
- pixelTotal = this.elementSize.height;
- pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0);
- }
+function _normalizeArguments(effect, options, speed, callback) {
+ // shift params for method overloading
+ if (typeof effect == 'object') {
+ callback = options;
+ speed = null;
+ options = effect;
+ effect = options.effect;
+ }
+ if ($.isFunction(options)) {
+ callback = options;
+ speed = null;
+ options = {};
+ }
+ if ($.isFunction(speed)) {
+ callback = speed;
+ speed = null;
+ }
+ if (typeof options == 'number' || $.fx.speeds[options]) {
+ callback = speed;
+ speed = options;
+ options = {};
+ }
- var percentMouse = (pixelMouse / pixelTotal);
- if (percentMouse > 1) percentMouse = 1;
- if (percentMouse < 0) percentMouse = 0;
- if ('vertical' == this.orientation)
- percentMouse = 1 - percentMouse;
+ options = options || {};
- var valueTotal = this._valueMax() - this._valueMin(),
- valueMouse = percentMouse * valueTotal,
- valueMouseModStep = valueMouse % this.options.step,
- normValue = this._valueMin() + valueMouse - valueMouseModStep;
+ speed = speed || options.duration;
+ speed = $.fx.off ? 0 : typeof speed == 'number'
+ ? speed : $.fx.speeds[speed] || $.fx.speeds._default;
- if (valueMouseModStep > (this.options.step / 2))
- normValue += this.options.step;
+ callback = callback || options.complete;
- // Since JavaScript has problems with large floats, round
- // the final value to 5 digits after the decimal point (see #4124)
- return parseFloat(normValue.toFixed(5));
+ return [effect, options, speed, callback];
+}
+$.fn.extend({
+ effect: function(effect, options, speed, callback) {
+ var args = _normalizeArguments.apply(this, arguments),
+ // TODO: make effects takes actual parameters instead of a hash
+ args2 = {
+ options: args[1],
+ duration: args[2],
+ callback: args[3]
+ },
+ effectMethod = $.effects[effect];
+
+ return effectMethod && !$.fx.off ? effectMethod.call(this, args2) : this;
},
- _start: function(event, index) {
- var uiHash = {
- handle: this.handles[index],
- value: this.value()
- };
- if (this.options.values && this.options.values.length) {
- uiHash.value = this.values(index);
- uiHash.values = this.values();
+ _show: $.fn.show,
+ show: function(speed) {
+ if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) {
+ return this._show.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'show';
+ return this.effect.apply(this, args);
}
- this._trigger("start", event, uiHash);
},
- _slide: function(event, index, newVal) {
-
- var handle = this.handles[index];
-
- if (this.options.values && this.options.values.length) {
+ _hide: $.fn.hide,
+ hide: function(speed) {
+ if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) {
+ return this._hide.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'hide';
+ return this.effect.apply(this, args);
+ }
+ },
- var otherVal = this.values(index ? 0 : 1);
+ // jQuery core overloads toggle and create _toggle
+ __toggle: $.fn.toggle,
+ toggle: function(speed) {
+ if (!speed || typeof speed == 'number' || $.fx.speeds[speed] ||
+ typeof speed == 'boolean' || $.isFunction(speed)) {
+ return this.__toggle.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'toggle';
+ return this.effect.apply(this, args);
+ }
+ },
- if ((this.options.values.length == 2 && this.options.range === true) &&
- ((index == 0 && newVal > otherVal) || (index == 1 && newVal < otherVal))){
- newVal = otherVal;
- }
+ // helper functions
+ cssUnit: function(key) {
+ var style = this.css(key), val = [];
+ $.each( ['em','px','%','pt'], function(i, unit){
+ if(style.indexOf(unit) > 0)
+ val = [parseFloat(style), unit];
+ });
+ return val;
+ }
+});
- if (newVal != this.values(index)) {
- var newValues = this.values();
- newValues[index] = newVal;
- // A slide can be canceled by returning false from the slide callback
- var allowed = this._trigger("slide", event, {
- handle: this.handles[index],
- value: newVal,
- values: newValues
- });
- var otherVal = this.values(index ? 0 : 1);
- if (allowed !== false) {
- this.values(index, newVal, ( event.type == 'mousedown' && this.options.animate ), true);
- }
- }
- } else {
- if (newVal != this.value()) {
- // A slide can be canceled by returning false from the slide callback
- var allowed = this._trigger("slide", event, {
- handle: this.handles[index],
- value: newVal
- });
- if (allowed !== false) {
- this._setData('value', newVal, ( event.type == 'mousedown' && this.options.animate ));
- }
+/******************************************************************************/
+/*********************************** EASING ***********************************/
+/******************************************************************************/
- }
+/*
+ * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
+ *
+ * Uses the built in easing capabilities added In jQuery 1.1
+ * to offer multiple easing options
+ *
+ * TERMS OF USE - jQuery Easing
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2008 George McGinley Smith
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+*/
- }
+// t: current time, b: begInnIng value, c: change In value, d: duration
+$.easing.jswing = $.easing.swing;
+$.extend($.easing,
+{
+ def: 'easeOutQuad',
+ swing: function (x, t, b, c, d) {
+ //alert($.easing.default);
+ return $.easing[$.easing.def](x, t, b, c, d);
},
-
- _stop: function(event, index) {
- var uiHash = {
- handle: this.handles[index],
- value: this.value()
- };
- if (this.options.values && this.options.values.length) {
- uiHash.value = this.values(index);
- uiHash.values = this.values();
- }
- this._trigger("stop", event, uiHash);
+ easeInQuad: function (x, t, b, c, d) {
+ return c*(t/=d)*t + b;
},
-
- _change: function(event, index) {
- var uiHash = {
- handle: this.handles[index],
- value: this.value()
- };
- if (this.options.values && this.options.values.length) {
- uiHash.value = this.values(index);
- uiHash.values = this.values();
- }
- this._trigger("change", event, uiHash);
+ easeOutQuad: function (x, t, b, c, d) {
+ return -c *(t/=d)*(t-2) + b;
+ },
+ easeInOutQuad: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t + b;
+ return -c/2 * ((--t)*(t-2) - 1) + b;
+ },
+ easeInCubic: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t + b;
+ },
+ easeOutCubic: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t + 1) + b;
+ },
+ easeInOutCubic: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t + b;
+ return c/2*((t-=2)*t*t + 2) + b;
+ },
+ easeInQuart: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t + b;
+ },
+ easeOutQuart: function (x, t, b, c, d) {
+ return -c * ((t=t/d-1)*t*t*t - 1) + b;
+ },
+ easeInOutQuart: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
+ return -c/2 * ((t-=2)*t*t*t - 2) + b;
+ },
+ easeInQuint: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t*t + b;
+ },
+ easeOutQuint: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t*t*t + 1) + b;
+ },
+ easeInOutQuint: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
+ return c/2*((t-=2)*t*t*t*t + 2) + b;
+ },
+ easeInSine: function (x, t, b, c, d) {
+ return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
+ },
+ easeOutSine: function (x, t, b, c, d) {
+ return c * Math.sin(t/d * (Math.PI/2)) + b;
+ },
+ easeInOutSine: function (x, t, b, c, d) {
+ return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
+ },
+ easeInExpo: function (x, t, b, c, d) {
+ return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+ },
+ easeOutExpo: function (x, t, b, c, d) {
+ return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+ },
+ easeInOutExpo: function (x, t, b, c, d) {
+ if (t==0) return b;
+ if (t==d) return b+c;
+ if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
+ return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
},
-
- value: function(newValue) {
-
- if (arguments.length) {
- this._setData("value", newValue);
- this._change(null, 0);
- }
-
- return this._value();
-
+ easeInCirc: function (x, t, b, c, d) {
+ return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
},
-
- values: function(index, newValue, animated, noPropagation) {
-
- if (arguments.length > 1) {
- this.options.values[index] = newValue;
- this._refreshValue(animated);
- if(!noPropagation) this._change(null, index);
- }
-
- if (arguments.length) {
- if (this.options.values && this.options.values.length) {
- return this._values(index);
- } else {
- return this.value();
- }
- } else {
- return this._values();
- }
-
+ easeOutCirc: function (x, t, b, c, d) {
+ return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
},
-
- _setData: function(key, value, animated) {
-
- $.widget.prototype._setData.apply(this, arguments);
-
- switch (key) {
- case 'disabled':
- if (value) {
- this.handles.filter(".ui-state-focus").blur();
- this.handles.removeClass("ui-state-hover");
- this.handles.attr("disabled", "disabled");
- } else {
- this.handles.removeAttr("disabled");
- }
- case 'orientation':
-
- this._detectOrientation();
-
- this.element
- .removeClass("ui-slider-horizontal ui-slider-vertical")
- .addClass("ui-slider-" + this.orientation);
- this._refreshValue(animated);
- break;
- case 'value':
- this._refreshValue(animated);
- break;
- }
-
+ easeInOutCirc: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
+ return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
},
-
- _step: function() {
- var step = this.options.step;
- return step;
+ easeInElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
},
-
- _value: function() {
-
- var val = this.options.value;
- if (val < this._valueMin()) val = this._valueMin();
- if (val > this._valueMax()) val = this._valueMax();
-
- return val;
-
+ easeOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
},
-
- _values: function(index) {
-
- if (arguments.length) {
- var val = this.options.values[index];
- if (val < this._valueMin()) val = this._valueMin();
- if (val > this._valueMax()) val = this._valueMax();
-
- return val;
- } else {
- return this.options.values;
- }
-
+ easeInOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
},
-
- _valueMin: function() {
- var valueMin = this.options.min;
- return valueMin;
+ easeInBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*(t/=d)*t*((s+1)*t - s) + b;
},
-
- _valueMax: function() {
- var valueMax = this.options.max;
- return valueMax;
+ easeOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
},
-
- _refreshValue: function(animate) {
-
- var oRange = this.options.range, o = this.options, self = this;
-
- if (this.options.values && this.options.values.length) {
- var vp0, vp1;
- this.handles.each(function(i, j) {
- var valPercent = (self.values(i) - self._valueMin()) / (self._valueMax() - self._valueMin()) * 100;
- var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
- $(this).stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
- if (self.options.range === true) {
- if (self.orientation == 'horizontal') {
- (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ left: valPercent + '%' }, o.animate);
- (i == 1) && self.range[animate ? 'animate' : 'css']({ width: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
- } else {
- (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ bottom: (valPercent) + '%' }, o.animate);
- (i == 1) && self.range[animate ? 'animate' : 'css']({ height: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
- }
- }
- lastValPercent = valPercent;
- });
+ easeInOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
+ return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+ },
+ easeInBounce: function (x, t, b, c, d) {
+ return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+ },
+ easeOutBounce: function (x, t, b, c, d) {
+ if ((t/=d) < (1/2.75)) {
+ return c*(7.5625*t*t) + b;
+ } else if (t < (2/2.75)) {
+ return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
+ } else if (t < (2.5/2.75)) {
+ return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
} else {
- var value = this.value(),
- valueMin = this._valueMin(),
- valueMax = this._valueMax(),
- valPercent = valueMax != valueMin
- ? (value - valueMin) / (valueMax - valueMin) * 100
- : 0;
- var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
- this.handle.stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
-
- (oRange == "min") && (this.orientation == "horizontal") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ width: valPercent + '%' }, o.animate);
- (oRange == "max") && (this.orientation == "horizontal") && this.range[animate ? 'animate' : 'css']({ width: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
- (oRange == "min") && (this.orientation == "vertical") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ height: valPercent + '%' }, o.animate);
- (oRange == "max") && (this.orientation == "vertical") && this.range[animate ? 'animate' : 'css']({ height: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
+ return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
}
-
- }
-
-}));
-
-$.extend($.ui.slider, {
- getter: "value values",
- version: "1.7.2",
- eventPrefix: "slide",
- defaults: {
- animate: false,
- delay: 0,
- distance: 0,
- max: 100,
- min: 0,
- orientation: 'horizontal',
- range: false,
- step: 1,
- value: 0,
- values: null
+ },
+ easeInOutBounce: function (x, t, b, c, d) {
+ if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
+ return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
}
});
+/*
+ *
+ * TERMS OF USE - EASING EQUATIONS
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2001 Robert Penner
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */
+
})(jQuery);
/*
- * jQuery UI Tabs 1.7.2
+ * jQuery UI Effects Blind 1.8.1
*
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt)
* and GPL (GPL-LICENSE.txt) licenses.
*
- * http://docs.jquery.com/UI/Tabs
+ * http://docs.jquery.com/UI/Effects/Blind
*
* Depends:
- * ui.core.js
+ * jquery.effects.core.js
*/
(function($) {
-$.widget("ui.tabs", {
-
- _init: function() {
- if (this.options.deselectable !== undefined) {
- this.options.collapsible = this.options.deselectable;
- }
- this._tabify(true);
- },
-
- _setData: function(key, value) {
- if (key == 'selected') {
- if (this.options.collapsible && value == this.options.selected) {
- return;
- }
- this.select(value);
- }
- else {
- this.options[key] = value;
- if (key == 'deselectable') {
- this.options.collapsible = value;
- }
- this._tabify();
- }
- },
-
- _tabId: function(a) {
- return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
- this.options.idPrefix + $.data(a);
- },
-
- _sanitizeSelector: function(hash) {
- return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
- },
+$.effects.blind = function(o) {
- _cookie: function() {
- var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0]));
- return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
- },
+ return this.queue(function() {
- _ui: function(tab, panel) {
- return {
- tab: tab,
- panel: panel,
- index: this.anchors.index(tab)
- };
- },
+ // Create element
+ var el = $(this), props = ['position','top','left'];
- _cleanup: function() {
- // restore all former loading tabs labels
- this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
- .find('span:data(label.tabs)')
- .each(function() {
- var el = $(this);
- el.html(el.data('label.tabs')).removeData('label.tabs');
- });
- },
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
- _tabify: function(init) {
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'vertical') ? 'height' : 'width';
+ var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
+ if(mode == 'show') wrapper.css(ref, 0); // Shift
- this.list = this.element.children('ul:first');
- this.lis = $('li:has(a[href])', this.list);
- this.anchors = this.lis.map(function() { return $('a', this)[0]; });
- this.panels = $([]);
+ // Animation
+ var animation = {};
+ animation[ref] = mode == 'show' ? distance : 0;
- var self = this, o = this.options;
+ // Animate
+ wrapper.animate(animation, o.duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
- var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
- this.anchors.each(function(i, a) {
- var href = $(a).attr('href');
+ });
- // For dynamically created HTML that contains a hash as href IE < 8 expands
- // such href to the full page url with hash and then misinterprets tab as ajax.
- // Same consideration applies for an added tab with a fragment identifier
- // since a[href=#fragment-identifier] does unexpectedly not match.
- // Thus normalize href attribute...
- var hrefBase = href.split('#')[0], baseEl;
- if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
- (baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
- href = a.hash;
- a.href = href;
- }
+};
- // inline tab
- if (fragmentId.test(href)) {
- self.panels = self.panels.add(self._sanitizeSelector(href));
- }
+})(jQuery);
+/*
+ * jQuery UI Effects Bounce 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
- // remote tab
- else if (href != '#') { // prevent loading the page itself if href is just "#"
- $.data(a, 'href.tabs', href); // required for restore on destroy
+$.effects.bounce = function(o) {
- // TODO until #3808 is fixed strip fragment identifier from url
- // (IE fails to load from such url)
- $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
+ return this.queue(function() {
- var id = self._tabId(a);
- a.href = '#' + id;
- var $panel = $('#' + id);
- if (!$panel.length) {
- $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
- .insertAfter(self.panels[i - 1] || self.list);
- $panel.data('destroy.tabs', true);
- }
- self.panels = self.panels.add($panel);
- }
+ // Create element
+ var el = $(this), props = ['position','top','left'];
- // invalid tab href
- else {
- o.disabled.push(i);
- }
- });
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'up'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 5; // Default # of times
+ var speed = o.duration || 250; // Default speed per bounce
+ if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
- // initialization from scratch
- if (init) {
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+ if (mode == 'hide') distance = distance / (times * 2);
+ if (mode != 'hide') times--;
- // attach necessary classes for styling
- this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
- this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
- this.lis.addClass('ui-state-default ui-corner-top');
- this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
+ // Animate
+ if (mode == 'show') { // Show Bounce
+ var animation = {opacity: 1};
+ animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation, speed / 2, o.options.easing);
+ distance = distance / 2;
+ times--;
+ };
+ for (var i = 0; i < times; i++) { // Bounces
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
+ distance = (mode == 'hide') ? distance * 2 : distance / 2;
+ };
+ if (mode == 'hide') { // Last Bounce
+ var animation = {opacity: 0};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ el.animate(animation, speed / 2, o.options.easing, function(){
+ el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
- // Selected tab
- // use "selected" option or try to retrieve:
- // 1. from fragment identifier in url
- // 2. from cookie
- // 3. from selected class attribute on <li>
- if (o.selected === undefined) {
- if (location.hash) {
- this.anchors.each(function(i, a) {
- if (a.hash == location.hash) {
- o.selected = i;
- return false; // break
- }
- });
- }
- if (typeof o.selected != 'number' && o.cookie) {
- o.selected = parseInt(self._cookie(), 10);
- }
- if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
- o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
- }
- o.selected = o.selected || 0;
- }
- else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
- o.selected = -1;
- }
+};
- // sanity check - default to first tab...
- o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;
+})(jQuery);
+/*
+ * jQuery UI Effects Clip 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
- // Take disabling tabs via class attribute from HTML
- // into account and update option properly.
- // A selected tab cannot become disabled.
- o.disabled = $.unique(o.disabled.concat(
- $.map(this.lis.filter('.ui-state-disabled'),
- function(n, i) { return self.lis.index(n); } )
- )).sort();
+$.effects.clip = function(o) {
- if ($.inArray(o.selected, o.disabled) != -1) {
- o.disabled.splice($.inArray(o.selected, o.disabled), 1);
- }
+ return this.queue(function() {
- // highlight selected tab
- this.panels.addClass('ui-tabs-hide');
- this.lis.removeClass('ui-tabs-selected ui-state-active');
- if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
- this.panels.eq(o.selected).removeClass('ui-tabs-hide');
- this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');
+ // Create element
+ var el = $(this), props = ['position','top','left','height','width'];
- // seems to be expected behavior that the show callback is fired
- self.element.queue("tabs", function() {
- self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
- });
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
- this.load(o.selected);
- }
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var animate = el[0].tagName == 'IMG' ? wrapper : el;
+ var ref = {
+ size: (direction == 'vertical') ? 'height' : 'width',
+ position: (direction == 'vertical') ? 'top' : 'left'
+ };
+ var distance = (direction == 'vertical') ? animate.height() : animate.width();
+ if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
- // clean up to avoid memory leaks in certain versions of IE 6
- $(window).bind('unload', function() {
- self.lis.add(self.anchors).unbind('.tabs');
- self.lis = self.anchors = self.panels = null;
- });
+ // Animation
+ var animation = {};
+ animation[ref.size] = mode == 'show' ? distance : 0;
+ animation[ref.position] = mode == 'show' ? 0 : distance / 2;
- }
- // update selected after add/remove
- else {
- o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
- }
+ // Animate
+ animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ }});
- // update collapsible
- this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');
+ });
- // set or update cookie after init and add/remove respectively
- if (o.cookie) {
- this._cookie(o.selected, o.cookie);
- }
+};
- // disable tabs
- for (var i = 0, li; (li = this.lis[i]); i++) {
- $(li)[$.inArray(i, o.disabled) != -1 &&
- !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
- }
+})(jQuery);
+/*
+ * jQuery UI Effects Drop 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
- // reset cache if switching from cached to not cached
- if (o.cache === false) {
- this.anchors.removeData('cache.tabs');
- }
+$.effects.drop = function(o) {
- // remove all handlers before, tabify may run on existing tabs after add or option change
- this.lis.add(this.anchors).unbind('.tabs');
+ return this.queue(function() {
- if (o.event != 'mouseover') {
- var addState = function(state, el) {
- if (el.is(':not(.ui-state-disabled)')) {
- el.addClass('ui-state-' + state);
- }
- };
- var removeState = function(state, el) {
- el.removeClass('ui-state-' + state);
- };
- this.lis.bind('mouseover.tabs', function() {
- addState('hover', $(this));
- });
- this.lis.bind('mouseout.tabs', function() {
- removeState('hover', $(this));
- });
- this.anchors.bind('focus.tabs', function() {
- addState('focus', $(this).closest('li'));
- });
- this.anchors.bind('blur.tabs', function() {
- removeState('focus', $(this).closest('li'));
- });
- }
+ // Create element
+ var el = $(this), props = ['position','top','left','opacity'];
- // set up animations
- var hideFx, showFx;
- if (o.fx) {
- if ($.isArray(o.fx)) {
- hideFx = o.fx[0];
- showFx = o.fx[1];
- }
- else {
- hideFx = showFx = o.fx;
- }
- }
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
- // Reset certain styles left over from animation
- // and prevent IE's ClearType bug...
- function resetStyle($el, fx) {
- $el.css({ display: '' });
- if ($.browser.msie && fx.opacity) {
- $el[0].style.removeAttribute('filter');
- }
- }
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
- // Show a tab...
- var showTab = showFx ?
- function(clicked, $show) {
- $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
- $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
- .animate(showFx, showFx.duration || 'normal', function() {
- resetStyle($show, showFx);
- self._trigger('show', null, self._ui(clicked, $show[0]));
- });
- } :
- function(clicked, $show) {
- $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
- $show.removeClass('ui-tabs-hide');
- self._trigger('show', null, self._ui(clicked, $show[0]));
- };
+ // Animation
+ var animation = {opacity: mode == 'show' ? 1 : 0};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
- // Hide a tab, $show is optional...
- var hideTab = hideFx ?
- function(clicked, $hide) {
- $hide.animate(hideFx, hideFx.duration || 'normal', function() {
- self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
- $hide.addClass('ui-tabs-hide');
- resetStyle($hide, hideFx);
- self.element.dequeue("tabs");
- });
- } :
- function(clicked, $hide, $show) {
- self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
- $hide.addClass('ui-tabs-hide');
- self.element.dequeue("tabs");
- };
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
- // attach tab event handler, unbind to avoid duplicates from former tabifying...
- this.anchors.bind(o.event + '.tabs', function() {
- var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
- $show = $(self._sanitizeSelector(this.hash));
+ });
- // If tab is already selected and not collapsible or tab disabled or
- // or is already loading or click callback returns false stop here.
- // Check if click handler returns false last so that it is not executed
- // for a disabled or loading tab!
- if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
- $li.hasClass('ui-state-disabled') ||
- $li.hasClass('ui-state-processing') ||
- self._trigger('select', null, self._ui(this, $show[0])) === false) {
- this.blur();
- return false;
- }
+};
- o.selected = self.anchors.index(this);
+})(jQuery);
+/*
+ * jQuery UI Effects Explode 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
- self.abort();
+$.effects.explode = function(o) {
- // if tab may be closed
- if (o.collapsible) {
- if ($li.hasClass('ui-tabs-selected')) {
- o.selected = -1;
+ return this.queue(function() {
- if (o.cookie) {
- self._cookie(o.selected, o.cookie);
- }
+ var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+ var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
- self.element.queue("tabs", function() {
- hideTab(el, $hide);
- }).dequeue("tabs");
+ o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
+ var el = $(this).show().css('visibility', 'hidden');
+ var offset = el.offset();
- this.blur();
- return false;
- }
- else if (!$hide.length) {
- if (o.cookie) {
- self._cookie(o.selected, o.cookie);
- }
+ //Substract the margins - not fixing the problem yet.
+ offset.top -= parseInt(el.css("marginTop"),10) || 0;
+ offset.left -= parseInt(el.css("marginLeft"),10) || 0;
- self.element.queue("tabs", function() {
- showTab(el, $show);
- });
+ var width = el.outerWidth(true);
+ var height = el.outerHeight(true);
- self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
+ for(var i=0;i<rows;i++) { // =
+ for(var j=0;j<cells;j++) { // ||
+ el
+ .clone()
+ .appendTo('body')
+ .wrap('<div></div>')
+ .css({
+ position: 'absolute',
+ visibility: 'visible',
+ left: -j*(width/cells),
+ top: -i*(height/rows)
+ })
+ .parent()
+ .addClass('ui-effects-explode')
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ width: width/cells,
+ height: height/rows,
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
+ opacity: o.options.mode == 'show' ? 0 : 1
+ }).animate({
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
+ opacity: o.options.mode == 'show' ? 1 : 0
+ }, o.duration || 500);
+ }
+ }
- this.blur();
- return false;
- }
- }
+ // Set a timeout, to call the callback approx. when the other animations have finished
+ setTimeout(function() {
- if (o.cookie) {
- self._cookie(o.selected, o.cookie);
- }
+ o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
+ if(o.callback) o.callback.apply(el[0]); // Callback
+ el.dequeue();
- // show new tab
- if ($show.length) {
- if ($hide.length) {
- self.element.queue("tabs", function() {
- hideTab(el, $hide);
- });
- }
- self.element.queue("tabs", function() {
- showTab(el, $show);
- });
+ $('div.ui-effects-explode').remove();
- self.load(self.anchors.index(this));
- }
- else {
- throw 'jQuery UI Tabs: Mismatching fragment identifier.';
- }
+ }, o.duration || 500);
- // Prevent IE from keeping other link focussed when using the back button
- // and remove dotted border from clicked link. This is controlled via CSS
- // in modern browsers; blur() removes focus from address bar in Firefox
- // which can become a usability and annoying problem with tabs('rotate').
- if ($.browser.msie) {
- this.blur();
- }
- });
+ });
- // disable click in any case
- this.anchors.bind('click.tabs', function(){return false;});
+};
- },
+})(jQuery);
+/*
+ * jQuery UI Effects Fold 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
- destroy: function() {
- var o = this.options;
+$.effects.fold = function(o) {
- this.abort();
+ return this.queue(function() {
- this.element.unbind('.tabs')
- .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
- .removeData('tabs');
+ // Create element
+ var el = $(this), props = ['position','top','left'];
- this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var size = o.options.size || 15; // Default fold size
+ var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
- this.anchors.each(function() {
- var href = $.data(this, 'href.tabs');
- if (href) {
- this.href = href;
- }
- var $this = $(this).unbind('.tabs');
- $.each(['href', 'load', 'cache'], function(i, prefix) {
- $this.removeData(prefix + '.tabs');
- });
- });
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var widthFirst = ((mode == 'show') != horizFirst);
+ var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
+ var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
+ var percent = /([0-9]+)%/.exec(size);
+ if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
+ if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
- this.lis.unbind('.tabs').add(this.panels).each(function() {
- if ($.data(this, 'destroy.tabs')) {
- $(this).remove();
- }
- else {
- $(this).removeClass([
- 'ui-state-default',
- 'ui-corner-top',
- 'ui-tabs-selected',
- 'ui-state-active',
- 'ui-state-hover',
- 'ui-state-focus',
- 'ui-state-disabled',
- 'ui-tabs-panel',
- 'ui-widget-content',
- 'ui-corner-bottom',
- 'ui-tabs-hide'
- ].join(' '));
- }
+ // Animation
+ var animation1 = {}, animation2 = {};
+ animation1[ref[0]] = mode == 'show' ? distance[0] : size;
+ animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
+
+ // Animate
+ wrapper.animate(animation1, duration, o.options.easing)
+ .animate(animation2, duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
});
- if (o.cookie) {
- this._cookie(null, o.cookie);
- }
- },
+ });
- add: function(url, label, index) {
- if (index === undefined) {
- index = this.anchors.length; // append by default
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Highlight 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.highlight = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ props = ['backgroundImage', 'backgroundColor', 'opacity'],
+ mode = $.effects.setMode(elem, o.options.mode || 'show'),
+ animation = {
+ backgroundColor: elem.css('backgroundColor')
+ };
+
+ if (mode == 'hide') {
+ animation.opacity = 0;
}
- var self = this, o = this.options,
- $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
- id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);
+ $.effects.save(elem, props);
+ elem
+ .show()
+ .css({
+ backgroundImage: 'none',
+ backgroundColor: o.options.color || '#ffff99'
+ })
+ .animate(animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.options.easing,
+ complete: function() {
+ (mode == 'hide' && elem.hide());
+ $.effects.restore(elem, props);
+ (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter'));
+ (o.callback && o.callback.apply(this, arguments));
+ elem.dequeue();
+ }
+ });
+ });
+};
- $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
+})(jQuery);
+/*
+ * jQuery UI Effects Pulsate 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
- // try to find an existing element before creating a new one
- var $panel = $('#' + id);
- if (!$panel.length) {
- $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
+$.effects.pulsate = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'show');
+ times = ((o.options.times || 5) * 2) - 1;
+ duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2,
+ isVisible = elem.is(':visible'),
+ animateTo = 0;
+
+ if (!isVisible) {
+ elem.css('opacity', 0).show();
+ animateTo = 1;
}
- $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
- if (index >= this.lis.length) {
- $li.appendTo(this.list);
- $panel.appendTo(this.list[0].parentNode);
+ if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) {
+ times--;
}
- else {
- $li.insertBefore(this.lis[index]);
- $panel.insertBefore(this.panels[index]);
+
+ for (var i = 0; i < times; i++) {
+ elem.animate({ opacity: animateTo }, duration, o.options.easing);
+ animateTo = (animateTo + 1) % 2;
}
- o.disabled = $.map(o.disabled,
- function(n, i) { return n >= index ? ++n : n; });
+ elem.animate({ opacity: animateTo }, duration, o.options.easing, function() {
+ if (animateTo == 0) {
+ elem.hide();
+ }
+ (o.callback && o.callback.apply(this, arguments));
+ });
- this._tabify();
+ elem
+ .queue('fx', function() { elem.dequeue(); })
+ .dequeue();
+ });
+};
- if (this.anchors.length == 1) { // after tabify
- $li.addClass('ui-tabs-selected ui-state-active');
- $panel.removeClass('ui-tabs-hide');
- this.element.queue("tabs", function() {
- self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
- });
+})(jQuery);
+/*
+ * jQuery UI Effects Scale 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
- this.load(0);
- }
+$.effects.puff = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'hide'),
+ percent = parseInt(o.options.percent, 10) || 150,
+ factor = percent / 100,
+ original = { height: elem.height(), width: elem.width() };
+
+ $.extend(o.options, {
+ fade: true,
+ mode: mode,
+ percent: mode == 'hide' ? percent : 100,
+ from: mode == 'hide'
+ ? original
+ : {
+ height: original.height * factor,
+ width: original.width * factor
+ }
+ });
- // callback
- this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
- },
+ elem.effect('scale', o.options, o.duration, o.callback);
+ elem.dequeue();
+ });
+};
- remove: function(index) {
- var o = this.options, $li = this.lis.eq(index).remove(),
- $panel = this.panels.eq(index).remove();
+$.effects.scale = function(o) {
- // If selected tab was removed focus tab to the right or
- // in case the last tab was removed the tab to the left.
- if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
- this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
+ var direction = o.options.direction || 'both'; // Set default axis
+ var origin = o.options.origin; // The origin of the scaling
+ if (mode != 'effect') { // Set default origin and restore for show/hide
+ options.origin = origin || ['middle','center'];
+ options.restore = true;
}
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
- o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
- function(n, i) { return n >= index ? --n : n; });
+ // Adjust
+ var factor = { // Set scaling factor
+ y: direction != 'horizontal' ? (percent / 100) : 1,
+ x: direction != 'vertical' ? (percent / 100) : 1
+ };
+ el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
- this._tabify();
+ if (o.options.fade) { // Fade option to support puff
+ if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
+ if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
+ };
- // callback
- this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
- },
+ // Animation
+ options.from = el.from; options.to = el.to; options.mode = mode;
- enable: function(index) {
- var o = this.options;
- if ($.inArray(index, o.disabled) == -1) {
- return;
- }
+ // Animate
+ el.effect('size', options, o.duration, o.callback);
+ el.dequeue();
+ });
- this.lis.eq(index).removeClass('ui-state-disabled');
- o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
+};
- // callback
- this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
- },
+$.effects.size = function(o) {
- disable: function(index) {
- var self = this, o = this.options;
- if (index != o.selected) { // cannot disable already selected tab
- this.lis.eq(index).addClass('ui-state-disabled');
+ return this.queue(function() {
- o.disabled.push(index);
- o.disabled.sort();
+ // Create element
+ var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
+ var props1 = ['position','top','left','overflow','opacity']; // Always restore
+ var props2 = ['width','height','overflow']; // Copy for children
+ var cProps = ['fontSize'];
+ var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
+ var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
- // callback
- this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
- }
- },
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var restore = o.options.restore || false; // Default restore
+ var scale = o.options.scale || 'both'; // Default scale mode
+ var origin = o.options.origin; // The origin of the sizing
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || original; // Default from state
+ el.to = o.options.to || original; // Default to state
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ var baseline = $.effects.getBaseline(origin, original);
+ el.from.top = (original.height - el.from.height) * baseline.y;
+ el.from.left = (original.width - el.from.width) * baseline.x;
+ el.to.top = (original.height - el.to.height) * baseline.y;
+ el.to.left = (original.width - el.to.width) * baseline.x;
+ };
+ var factor = { // Set scaling factor
+ from: {y: el.from.height / original.height, x: el.from.width / original.width},
+ to: {y: el.to.height / original.height, x: el.to.width / original.width}
+ };
+ if (scale == 'box' || scale == 'both') { // Scale the css box
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(vProps);
+ el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ props = props.concat(hProps);
+ el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
+ el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
+ };
+ };
+ if (scale == 'content' || scale == 'both') { // Scale the content
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(cProps);
+ el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
+ };
+ };
+ $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ el.css('overflow','hidden').css(el.from); // Shift
+
+ // Animate
+ if (scale == 'content' || scale == 'both') { // Scale the children
+ vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
+ hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
+ props2 = props.concat(vProps).concat(hProps); // Concat
+ el.find("*[width]").each(function(){
+ child = $(this);
+ if (restore) $.effects.save(child, props2);
+ var c_original = {height: child.height(), width: child.width()}; // Save original
+ child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
+ child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
+ child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
+ child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
+ };
+ child.css(child.from); // Shift children
+ child.animate(child.to, o.duration, o.options.easing, function(){
+ if (restore) $.effects.restore(child, props2); // Restore children
+ }); // Animate children
+ });
+ };
+
+ // Animate
+ el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if (el.to.opacity === 0) {
+ el.css('opacity', el.from.opacity);
+ }
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
- select: function(index) {
- if (typeof index == 'string') {
- index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
- }
- else if (index === null) { // usage of null is deprecated, TODO remove in next release
- index = -1;
- }
- if (index == -1 && this.options.collapsible) {
- index = this.options.selected;
- }
+ });
- this.anchors.eq(index).trigger(this.options.event + '.tabs');
- },
+};
- load: function(index) {
- var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');
+})(jQuery);
+/*
+ * jQuery UI Effects Shake 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
- this.abort();
+$.effects.shake = function(o) {
- // not remote or from cache
- if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
- this.element.dequeue("tabs");
- return;
- }
+ return this.queue(function() {
- // load remote from here on
- this.lis.eq(index).addClass('ui-state-processing');
+ // Create element
+ var el = $(this), props = ['position','top','left'];
- if (o.spinner) {
- var span = $('span', a);
- span.data('label.tabs', span.html()).html(o.spinner);
- }
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 3; // Default # of times
+ var speed = o.duration || o.options.duration || 140; // Default speed per shake
- this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
- url: url,
- success: function(r, s) {
- $(self._sanitizeSelector(a.hash)).html(r);
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- // take care of tab labels
- self._cleanup();
+ // Animation
+ var animation = {}, animation1 = {}, animation2 = {};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
+ animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
- if (o.cache) {
- $.data(a, 'cache.tabs', true); // if loaded once do not load them again
- }
+ // Animate
+ el.animate(animation, speed, o.options.easing);
+ for (var i = 1; i < times; i++) { // Shakes
+ el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
+ };
+ el.animate(animation1, speed, o.options.easing).
+ animate(animation, speed / 2, o.options.easing, function(){ // Last shake
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
- // callbacks
- self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
- try {
- o.ajaxOptions.success(r, s);
- }
- catch (e) {}
+};
- // last, so that load event is fired before show...
- self.element.dequeue("tabs");
- }
- }));
- },
+})(jQuery);
+/*
+ * jQuery UI Effects Slide 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
- abort: function() {
- // stop possibly running animations
- this.element.queue([]);
- this.panels.stop(false, true);
+$.effects.slide = function(o) {
- // terminate pending requests from other tabs
- if (this.xhr) {
- this.xhr.abort();
- delete this.xhr;
- }
+ return this.queue(function() {
- // take care of tab labels
- this._cleanup();
+ // Create element
+ var el = $(this), props = ['position','top','left'];
- },
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
- url: function(index, url) {
- this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
- },
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
+ if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift
- length: function() {
- return this.anchors.length;
- }
+ // Animation
+ var animation = {};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
-});
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
-$.extend($.ui.tabs, {
- version: '1.7.2',
- getter: 'length',
- defaults: {
- ajaxOptions: null,
- cache: false,
- cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
- collapsible: false,
- disabled: [],
- event: 'click',
- fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
- idPrefix: 'ui-tabs-',
- panelTemplate: '<div></div>',
- spinner: '<em>Loading…</em>',
- tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
- }
-});
+ });
-/*
- * Tabs Extensions
- */
+};
+})(jQuery);
/*
- * Rotate
+ * jQuery UI Effects Transfer 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * jquery.effects.core.js
*/
-$.extend($.ui.tabs.prototype, {
- rotation: null,
- rotate: function(ms, continuing) {
-
- var self = this, o = this.options;
-
- var rotate = self._rotate || (self._rotate = function(e) {
- clearTimeout(self.rotation);
- self.rotation = setTimeout(function() {
- var t = o.selected;
- self.select( ++t < self.anchors.length ? t : 0 );
- }, ms);
-
- if (e) {
- e.stopPropagation();
- }
- });
-
- var stop = self._unrotate || (self._unrotate = !continuing ?
- function(e) {
- if (e.clientX) { // in case of a true click
- self.rotate(null);
- }
- } :
- function(e) {
- t = o.selected;
- rotate();
- });
+(function($) {
- // start rotation
- if (ms) {
- this.element.bind('tabsshow', rotate);
- this.anchors.bind(o.event + '.tabs', stop);
- rotate();
- }
- // stop rotation
- else {
- clearTimeout(self.rotation);
- this.element.unbind('tabsshow', rotate);
- this.anchors.unbind(o.event + '.tabs', stop);
- delete this._rotate;
- delete this._unrotate;
- }
- }
-});
+$.effects.transfer = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ target = $(o.options.to),
+ endPosition = target.offset(),
+ animation = {
+ top: endPosition.top,
+ left: endPosition.left,
+ height: target.innerHeight(),
+ width: target.innerWidth()
+ },
+ startPosition = elem.offset(),
+ transfer = $('<div class="ui-effects-transfer"></div>')
+ .appendTo(document.body)
+ .addClass(o.options.className)
+ .css({
+ top: startPosition.top,
+ left: startPosition.left,
+ height: elem.innerHeight(),
+ width: elem.innerWidth(),
+ position: 'absolute'
+ })
+ .animate(animation, o.duration, o.options.easing, function() {
+ transfer.remove();
+ (o.callback && o.callback.apply(elem[0], arguments));
+ elem.dequeue();
+ });
+ });
+};
})(jQuery);
diff --git a/libs/jquery/original lib/jquery.js b/libs/jquery/original lib/jquery.js
index e3a442aa95..fff6776433 100644
--- a/libs/jquery/original lib/jquery.js
+++ b/libs/jquery/original lib/jquery.js
@@ -1,665 +1,541 @@
/*!
- * jQuery JavaScript Library v1.3.2
+ * jQuery JavaScript Library v1.4.2
* http://jquery.com/
*
- * Copyright (c) 2009 John Resig
- * Dual licensed under the MIT and GPL licenses.
- * http://docs.jquery.com/License
+ * Copyright 2010, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
*
- * Date: 2009-02-19 17:34:21 -0500 (Thu, 19 Feb 2009)
- * Revision: 6246
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ * Copyright 2010, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ *
+ * Date: Sat Feb 13 22:33:48 2010 -0500
*/
-(function(){
+(function( window, undefined ) {
+
+// Define a local copy of jQuery
+var jQuery = function( selector, context ) {
+ // The jQuery object is actually just the init constructor 'enhanced'
+ return new jQuery.fn.init( selector, context );
+ },
-var
- // Will speed up references to window, and allows munging its name.
- window = this,
- // Will speed up references to undefined, and allows munging its name.
- undefined,
// Map over jQuery in case of overwrite
_jQuery = window.jQuery,
+
// Map over the $ in case of overwrite
_$ = window.$,
- jQuery = window.jQuery = window.$ = function( selector, context ) {
- // The jQuery object is actually just the init constructor 'enhanced'
- return new jQuery.fn.init( selector, context );
- },
+ // Use the correct document accordingly with window argument (sandbox)
+ document = window.document,
+
+ // A central reference to the root jQuery(document)
+ rootjQuery,
// A simple way to check for HTML strings or ID strings
// (both of which we optimize for)
- quickExpr = /^[^<]*(<(.|\s)+>)[^>]*$|^#([\w-]+)$/,
+ quickExpr = /^[^<]*(<[\w\W]+>)[^>]*$|^#([\w-]+)$/,
+
// Is it a simple selector
- isSimple = /^.[^:#\[\.,]*$/;
+ isSimple = /^.[^:#\[\.,]*$/,
+
+ // Check if a string has a non-whitespace character in it
+ rnotwhite = /\S/,
+
+ // Used for trimming whitespace
+ rtrim = /^(\s|\u00A0)+|(\s|\u00A0)+$/g,
+
+ // Match a standalone tag
+ rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/,
+
+ // Keep a UserAgent string for use with jQuery.browser
+ userAgent = navigator.userAgent,
+
+ // For matching the engine and version of the browser
+ browserMatch,
+
+ // Has the ready events already been bound?
+ readyBound = false,
+
+ // The functions to execute on DOM ready
+ readyList = [],
+
+ // The ready event handler
+ DOMContentLoaded,
+
+ // Save a reference to some core methods
+ toString = Object.prototype.toString,
+ hasOwnProperty = Object.prototype.hasOwnProperty,
+ push = Array.prototype.push,
+ slice = Array.prototype.slice,
+ indexOf = Array.prototype.indexOf;
jQuery.fn = jQuery.prototype = {
init: function( selector, context ) {
- // Make sure that a selection was provided
- selector = selector || document;
+ var match, elem, ret, doc;
+
+ // Handle $(""), $(null), or $(undefined)
+ if ( !selector ) {
+ return this;
+ }
// Handle $(DOMElement)
if ( selector.nodeType ) {
- this[0] = selector;
+ this.context = this[0] = selector;
+ this.length = 1;
+ return this;
+ }
+
+ // The body element only exists once, optimize finding it
+ if ( selector === "body" && !context ) {
+ this.context = document;
+ this[0] = document.body;
+ this.selector = "body";
this.length = 1;
- this.context = selector;
return this;
}
+
// Handle HTML strings
if ( typeof selector === "string" ) {
// Are we dealing with HTML string or an ID?
- var match = quickExpr.exec( selector );
+ match = quickExpr.exec( selector );
// Verify a match, and that no context was specified for #id
if ( match && (match[1] || !context) ) {
// HANDLE: $(html) -> $(array)
- if ( match[1] )
- selector = jQuery.clean( [ match[1] ], context );
+ if ( match[1] ) {
+ doc = (context ? context.ownerDocument || context : document);
+
+ // If a single string is passed in and it's a single tag
+ // just do a createElement and skip the rest
+ ret = rsingleTag.exec( selector );
+
+ if ( ret ) {
+ if ( jQuery.isPlainObject( context ) ) {
+ selector = [ document.createElement( ret[1] ) ];
+ jQuery.fn.attr.call( selector, context, true );
+ } else {
+ selector = [ doc.createElement( ret[1] ) ];
+ }
+
+ } else {
+ ret = buildFragment( [ match[1] ], [ doc ] );
+ selector = (ret.cacheable ? ret.fragment.cloneNode(true) : ret.fragment).childNodes;
+ }
+
+ return jQuery.merge( this, selector );
+
// HANDLE: $("#id")
- else {
- var elem = document.getElementById( match[3] );
-
- // Handle the case where IE and Opera return items
- // by name instead of ID
- if ( elem && elem.id != match[3] )
- return jQuery().find( selector );
-
- // Otherwise, we inject the element directly into the jQuery object
- var ret = jQuery( elem || [] );
- ret.context = document;
- ret.selector = selector;
- return ret;
+ } else {
+ elem = document.getElementById( match[2] );
+
+ if ( elem ) {
+ // Handle the case where IE and Opera return items
+ // by name instead of ID
+ if ( elem.id !== match[2] ) {
+ return rootjQuery.find( selector );
+ }
+
+ // Otherwise, we inject the element directly into the jQuery object
+ this.length = 1;
+ this[0] = elem;
+ }
+
+ this.context = document;
+ this.selector = selector;
+ return this;
}
- // HANDLE: $(expr, [context])
- // (which is just equivalent to: $(content).find(expr)
- } else
+ // HANDLE: $("TAG")
+ } else if ( !context && /^\w+$/.test( selector ) ) {
+ this.selector = selector;
+ this.context = document;
+ selector = document.getElementsByTagName( selector );
+ return jQuery.merge( this, selector );
+
+ // HANDLE: $(expr, $(...))
+ } else if ( !context || context.jquery ) {
+ return (context || rootjQuery).find( selector );
+
+ // HANDLE: $(expr, context)
+ // (which is just equivalent to: $(context).find(expr)
+ } else {
return jQuery( context ).find( selector );
+ }
// HANDLE: $(function)
// Shortcut for document ready
- } else if ( jQuery.isFunction( selector ) )
- return jQuery( document ).ready( selector );
+ } else if ( jQuery.isFunction( selector ) ) {
+ return rootjQuery.ready( selector );
+ }
- // Make sure that old selector state is passed along
- if ( selector.selector && selector.context ) {
+ if (selector.selector !== undefined) {
this.selector = selector.selector;
this.context = selector.context;
}
- return this.setArray(jQuery.isArray( selector ) ?
- selector :
- jQuery.makeArray(selector));
+ return jQuery.makeArray( selector, this );
},
// Start with an empty selector
selector: "",
// The current version of jQuery being used
- jquery: "1.3.2",
+ jquery: "1.4.2",
+
+ // The default length of a jQuery object is 0
+ length: 0,
// The number of elements contained in the matched element set
size: function() {
return this.length;
},
+ toArray: function() {
+ return slice.call( this, 0 );
+ },
+
// Get the Nth element in the matched element set OR
// Get the whole matched element set as a clean array
get: function( num ) {
- return num === undefined ?
+ return num == null ?
// Return a 'clean' array
- Array.prototype.slice.call( this ) :
+ this.toArray() :
// Return just the object
- this[ num ];
+ ( num < 0 ? this.slice(num)[ 0 ] : this[ num ] );
},
// Take an array of elements and push it onto the stack
// (returning the new matched element set)
pushStack: function( elems, name, selector ) {
// Build a new jQuery matched element set
- var ret = jQuery( elems );
+ var ret = jQuery();
+
+ if ( jQuery.isArray( elems ) ) {
+ push.apply( ret, elems );
+
+ } else {
+ jQuery.merge( ret, elems );
+ }
// Add the old object onto the stack (as a reference)
ret.prevObject = this;
ret.context = this.context;
- if ( name === "find" )
+ if ( name === "find" ) {
ret.selector = this.selector + (this.selector ? " " : "") + selector;
- else if ( name )
+ } else if ( name ) {
ret.selector = this.selector + "." + name + "(" + selector + ")";
+ }
// Return the newly-formed element set
return ret;
},
- // Force the current matched set of elements to become
- // the specified array of elements (destroying the stack in the process)
- // You should use pushStack() in order to do this, but maintain the stack
- setArray: function( elems ) {
- // Resetting the length to 0, then using the native Array push
- // is a super-fast way to populate an object with array-like properties
- this.length = 0;
- Array.prototype.push.apply( this, elems );
-
- return this;
- },
-
// Execute a callback for every element in the matched set.
// (You can seed the arguments with an array of args, but this is
// only used internally.)
each: function( callback, args ) {
return jQuery.each( this, callback, args );
},
+
+ ready: function( fn ) {
+ // Attach the listeners
+ jQuery.bindReady();
- // Determine the position of an element within
- // the matched set of elements
- index: function( elem ) {
- // Locate the position of the desired element
- return jQuery.inArray(
- // If it receives a jQuery object, the first element is used
- elem && elem.jquery ? elem[0] : elem
- , this );
- },
-
- attr: function( name, value, type ) {
- var options = name;
-
- // Look for the case where we're accessing a style value
- if ( typeof name === "string" )
- if ( value === undefined )
- return this[0] && jQuery[ type || "attr" ]( this[0], name );
-
- else {
- options = {};
- options[ name ] = value;
- }
-
- // Check to see if we're setting style values
- return this.each(function(i){
- // Set all the styles
- for ( name in options )
- jQuery.attr(
- type ?
- this.style :
- this,
- name, jQuery.prop( this, options[ name ], type, i, name )
- );
- });
- },
-
- css: function( key, value ) {
- // ignore negative width and height values
- if ( (key == 'width' || key == 'height') && parseFloat(value) < 0 )
- value = undefined;
- return this.attr( key, value, "curCSS" );
- },
-
- text: function( text ) {
- if ( typeof text !== "object" && text != null )
- return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) );
-
- var ret = "";
-
- jQuery.each( text || this, function(){
- jQuery.each( this.childNodes, function(){
- if ( this.nodeType != 8 )
- ret += this.nodeType != 1 ?
- this.nodeValue :
- jQuery.fn.text( [ this ] );
- });
- });
-
- return ret;
- },
-
- wrapAll: function( html ) {
- if ( this[0] ) {
- // The elements to wrap the target around
- var wrap = jQuery( html, this[0].ownerDocument ).clone();
-
- if ( this[0].parentNode )
- wrap.insertBefore( this[0] );
-
- wrap.map(function(){
- var elem = this;
-
- while ( elem.firstChild )
- elem = elem.firstChild;
+ // If the DOM is already ready
+ if ( jQuery.isReady ) {
+ // Execute the function immediately
+ fn.call( document, jQuery );
- return elem;
- }).append(this);
+ // Otherwise, remember the function for later
+ } else if ( readyList ) {
+ // Add the function to the wait list
+ readyList.push( fn );
}
return this;
},
-
- wrapInner: function( html ) {
- return this.each(function(){
- jQuery( this ).contents().wrapAll( html );
- });
- },
-
- wrap: function( html ) {
- return this.each(function(){
- jQuery( this ).wrapAll( html );
- });
+
+ eq: function( i ) {
+ return i === -1 ?
+ this.slice( i ) :
+ this.slice( i, +i + 1 );
},
- append: function() {
- return this.domManip(arguments, true, function(elem){
- if (this.nodeType == 1)
- this.appendChild( elem );
- });
+ first: function() {
+ return this.eq( 0 );
},
- prepend: function() {
- return this.domManip(arguments, true, function(elem){
- if (this.nodeType == 1)
- this.insertBefore( elem, this.firstChild );
- });
+ last: function() {
+ return this.eq( -1 );
},
- before: function() {
- return this.domManip(arguments, false, function(elem){
-//try{
- this.parentNode.insertBefore( elem, this );
-//}catch(e) {
-//}
- });
+ slice: function() {
+ return this.pushStack( slice.apply( this, arguments ),
+ "slice", slice.call(arguments).join(",") );
},
- after: function() {
- return this.domManip(arguments, false, function(elem){
- this.parentNode.insertBefore( elem, this.nextSibling );
- });
+ map: function( callback ) {
+ return this.pushStack( jQuery.map(this, function( elem, i ) {
+ return callback.call( elem, i, elem );
+ }));
},
-
+
end: function() {
- return this.prevObject || jQuery( [] );
+ return this.prevObject || jQuery(null);
},
// For internal use only.
// Behaves like an Array's method, not like a jQuery method.
- push: [].push,
+ push: push,
sort: [].sort,
- splice: [].splice,
+ splice: [].splice
+};
- find: function( selector ) {
- if ( this.length === 1 ) {
- var ret = this.pushStack( [], "find", selector );
- ret.length = 0;
- jQuery.find( selector, this[0], ret );
- return ret;
- } else {
- return this.pushStack( jQuery.unique(jQuery.map(this, function(elem){
- return jQuery.find( selector, elem );
- })), "find", selector );
- }
- },
+// Give the init function the jQuery prototype for later instantiation
+jQuery.fn.init.prototype = jQuery.fn;
- clone: function( events ) {
- // Do the clone
- var ret = this.map(function(){
- if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) {
- // IE copies events bound via attachEvent when
- // using cloneNode. Calling detachEvent on the
- // clone will also remove the events from the orignal
- // In order to get around this, we use innerHTML.
- // Unfortunately, this means some modifications to
- // attributes in IE that are actually only stored
- // as properties will not be copied (such as the
- // the name attribute on an input).
- var html = this.outerHTML;
- if ( !html ) {
- var div = this.ownerDocument.createElement("div");
- div.appendChild( this.cloneNode(true) );
- html = div.innerHTML;
- }
+jQuery.extend = jQuery.fn.extend = function() {
+ // copy reference to target object
+ var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options, name, src, copy;
- return jQuery.clean([html.replace(/ jQuery\d+="(?:\d+|null)"/g, "").replace(/^\s*/, "")])[0];
- } else
- return this.cloneNode(true);
- });
+ // Handle a deep copy situation
+ if ( typeof target === "boolean" ) {
+ deep = target;
+ target = arguments[1] || {};
+ // skip the boolean and the target
+ i = 2;
+ }
- // Copy the events from the original to the clone
- if ( events === true ) {
- var orig = this.find("*").andSelf(), i = 0;
+ // Handle case when target is a string or something (possible in deep copy)
+ if ( typeof target !== "object" && !jQuery.isFunction(target) ) {
+ target = {};
+ }
- ret.find("*").andSelf().each(function(){
- if ( this.nodeName !== orig[i].nodeName )
- return;
+ // extend jQuery itself if only one argument is passed
+ if ( length === i ) {
+ target = this;
+ --i;
+ }
- var events = jQuery.data( orig[i], "events" );
+ for ( ; i < length; i++ ) {
+ // Only deal with non-null/undefined values
+ if ( (options = arguments[ i ]) != null ) {
+ // Extend the base object
+ for ( name in options ) {
+ src = target[ name ];
+ copy = options[ name ];
- for ( var type in events ) {
- for ( var handler in events[ type ] ) {
- jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data );
- }
+ // Prevent never-ending loop
+ if ( target === copy ) {
+ continue;
}
- i++;
- });
- }
+ // Recurse if we're merging object literal values or arrays
+ if ( deep && copy && ( jQuery.isPlainObject(copy) || jQuery.isArray(copy) ) ) {
+ var clone = src && ( jQuery.isPlainObject(src) || jQuery.isArray(src) ) ? src
+ : jQuery.isArray(copy) ? [] : {};
- // Return the cloned set
- return ret;
- },
+ // Never move original objects, clone them
+ target[ name ] = jQuery.extend( deep, clone, copy );
- filter: function( selector ) {
- return this.pushStack(
- jQuery.isFunction( selector ) &&
- jQuery.grep(this, function(elem, i){
- return selector.call( elem, i );
- }) ||
-
- jQuery.multiFilter( selector, jQuery.grep(this, function(elem){
- return elem.nodeType === 1;
- }) ), "filter", selector );
- },
-
- closest: function( selector ) {
- var pos = jQuery.expr.match.POS.test( selector ) ? jQuery(selector) : null,
- closer = 0;
-
- return this.map(function(){
- var cur = this;
- while ( cur && cur.ownerDocument ) {
- if ( pos ? pos.index(cur) > -1 : jQuery(cur).is(selector) ) {
- jQuery.data(cur, "closest", closer);
- return cur;
+ // Don't bring in undefined values
+ } else if ( copy !== undefined ) {
+ target[ name ] = copy;
}
- cur = cur.parentNode;
- closer++;
}
- });
- },
+ }
+ }
- not: function( selector ) {
- if ( typeof selector === "string" )
- // test special case where just one selector is passed in
- if ( isSimple.test( selector ) )
- return this.pushStack( jQuery.multiFilter( selector, this, true ), "not", selector );
- else
- selector = jQuery.multiFilter( selector, this );
-
- var isArrayLike = selector.length && selector[selector.length - 1] !== undefined && !selector.nodeType;
- return this.filter(function() {
- return isArrayLike ? jQuery.inArray( this, selector ) < 0 : this != selector;
- });
- },
+ // Return the modified object
+ return target;
+};
- add: function( selector ) {
- return this.pushStack( jQuery.unique( jQuery.merge(
- this.get(),
- typeof selector === "string" ?
- jQuery( selector ) :
- jQuery.makeArray( selector )
- )));
- },
+jQuery.extend({
+ noConflict: function( deep ) {
+ window.$ = _$;
- is: function( selector ) {
- return !!selector && jQuery.multiFilter( selector, this ).length > 0;
- },
+ if ( deep ) {
+ window.jQuery = _jQuery;
+ }
- hasClass: function( selector ) {
- return !!selector && this.is( "." + selector );
+ return jQuery;
},
+
+ // Is the DOM ready to be used? Set to true once it occurs.
+ isReady: false,
+
+ // Handle when the DOM is ready
+ ready: function() {
+ // Make sure that the DOM is not already loaded
+ if ( !jQuery.isReady ) {
+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+ if ( !document.body ) {
+ return setTimeout( jQuery.ready, 13 );
+ }
- val: function( value ) {
- if ( value === undefined ) {
- var elem = this[0];
-
- if ( elem ) {
- if( jQuery.nodeName( elem, 'option' ) )
- return (elem.attributes.value || {}).specified ? elem.value : elem.text;
-
- // We need to handle select boxes special
- if ( jQuery.nodeName( elem, "select" ) ) {
- var index = elem.selectedIndex,
- values = [],
- options = elem.options,
- one = elem.type == "select-one";
+ // Remember that the DOM is ready
+ jQuery.isReady = true;
- // Nothing was selected
- if ( index < 0 )
- return null;
+ // If there are functions bound, to execute
+ if ( readyList ) {
+ // Execute all of them
+ var fn, i = 0;
+ while ( (fn = readyList[ i++ ]) ) {
+ fn.call( document, jQuery );
+ }
- // Loop through all the selected options
- for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) {
- var option = options[ i ];
+ // Reset the list of functions
+ readyList = null;
+ }
- if ( option.selected ) {
- // Get the specifc value for the option
- value = jQuery(option).val();
+ // Trigger any bound ready events
+ if ( jQuery.fn.triggerHandler ) {
+ jQuery( document ).triggerHandler( "ready" );
+ }
+ }
+ },
+
+ bindReady: function() {
+ if ( readyBound ) {
+ return;
+ }
- // We don't need an array for one selects
- if ( one )
- return value;
+ readyBound = true;
- // Multi-Selects return an array
- values.push( value );
- }
- }
+ // Catch cases where $(document).ready() is called after the
+ // browser event has already occurred.
+ if ( document.readyState === "complete" ) {
+ return jQuery.ready();
+ }
- return values;
- }
+ // Mozilla, Opera and webkit nightlies currently support this event
+ if ( document.addEventListener ) {
+ // Use the handy event callback
+ document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+
+ // A fallback to window.onload, that will always work
+ window.addEventListener( "load", jQuery.ready, false );
+
+ // If IE event model is used
+ } else if ( document.attachEvent ) {
+ // ensure firing before onload,
+ // maybe late but safe also for iframes
+ document.attachEvent("onreadystatechange", DOMContentLoaded);
+
+ // A fallback to window.onload, that will always work
+ window.attachEvent( "onload", jQuery.ready );
+
+ // If IE and not a frame
+ // continually check to see if the document is ready
+ var toplevel = false;
- // Everything else, we just grab the value
- return (elem.value || "").replace(/\r/g, "");
+ try {
+ toplevel = window.frameElement == null;
+ } catch(e) {}
+ if ( document.documentElement.doScroll && toplevel ) {
+ doScrollCheck();
}
-
- return undefined;
}
-
- if ( typeof value === "number" )
- value += '';
-
- return this.each(function(){
- if ( this.nodeType != 1 )
- return;
-
- if ( jQuery.isArray(value) && /radio|checkbox/.test( this.type ) )
- this.checked = (jQuery.inArray(this.value, value) >= 0 ||
- jQuery.inArray(this.name, value) >= 0);
-
- else if ( jQuery.nodeName( this, "select" ) ) {
- var values = jQuery.makeArray(value);
-
- jQuery( "option", this ).each(function(){
- this.selected = (jQuery.inArray( this.value, values ) >= 0 ||
- jQuery.inArray( this.text, values ) >= 0);
- });
-
- if ( !values.length )
- this.selectedIndex = -1;
-
- } else
- this.value = value;
- });
- },
-
- html: function( value ) {
- return value === undefined ?
- (this[0] ?
- this[0].innerHTML.replace(/ jQuery\d+="(?:\d+|null)"/g, "") :
- null) :
- this.empty().append( value );
},
- replaceWith: function( value ) {
- return this.after( value ).remove();
+ // See test/unit/core.js for details concerning isFunction.
+ // Since version 1.3, DOM methods and functions like alert
+ // aren't supported. They return false on IE (#2968).
+ isFunction: function( obj ) {
+ return toString.call(obj) === "[object Function]";
},
- eq: function( i ) {
- return this.slice( i, +i + 1 );
+ isArray: function( obj ) {
+ return toString.call(obj) === "[object Array]";
},
- slice: function() {
- return this.pushStack( Array.prototype.slice.apply( this, arguments ),
- "slice", Array.prototype.slice.call(arguments).join(",") );
+ isPlainObject: function( obj ) {
+ // Must be an Object.
+ // Because of IE, we also have to check the presence of the constructor property.
+ // Make sure that DOM nodes and window objects don't pass through, as well
+ if ( !obj || toString.call(obj) !== "[object Object]" || obj.nodeType || obj.setInterval ) {
+ return false;
+ }
+
+ // Not own constructor property must be Object
+ if ( obj.constructor
+ && !hasOwnProperty.call(obj, "constructor")
+ && !hasOwnProperty.call(obj.constructor.prototype, "isPrototypeOf") ) {
+ return false;
+ }
+
+ // Own properties are enumerated firstly, so to speed up,
+ // if last one is own, then all properties are own.
+
+ var key;
+ for ( key in obj ) {}
+
+ return key === undefined || hasOwnProperty.call( obj, key );
},
- map: function( callback ) {
- return this.pushStack( jQuery.map(this, function(elem, i){
- return callback.call( elem, i, elem );
- }));
+ isEmptyObject: function( obj ) {
+ for ( var name in obj ) {
+ return false;
+ }
+ return true;
},
-
- andSelf: function() {
- return this.add( this.prevObject );
+
+ error: function( msg ) {
+ throw msg;
},
-
- domManip: function( args, table, callback ) {
- if ( this[0] ) {
- var fragment = (this[0].ownerDocument || this[0]).createDocumentFragment(),
- scripts = jQuery.clean( args, (this[0].ownerDocument || this[0]), fragment ),
- first = fragment.firstChild;
-
- if ( first )
- for ( var i = 0, l = this.length; i < l; i++ )
- callback.call( root(this[i], first), this.length > 1 || i > 0 ?
- fragment.cloneNode(true) : fragment );
-
- if ( scripts )
- jQuery.each( scripts, evalScript );
+
+ parseJSON: function( data ) {
+ if ( typeof data !== "string" || !data ) {
+ return null;
}
- return this;
-
- function root( elem, cur ) {
- return table && jQuery.nodeName(elem, "table") && jQuery.nodeName(cur, "tr") ?
- (elem.getElementsByTagName("tbody")[0] ||
- elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
- elem;
- }
- }
-};
-
-// Give the init function the jQuery prototype for later instantiation
-jQuery.fn.init.prototype = jQuery.fn;
-
-function evalScript( i, elem ) {
- if ( elem.src )
- jQuery.ajax({
- url: elem.src,
- async: false,
- dataType: "script"
- });
-
- else
- jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" );
-
- if ( elem.parentNode )
- elem.parentNode.removeChild( elem );
-}
-
-function now(){
- return +new Date;
-}
-
-jQuery.extend = jQuery.fn.extend = function() {
- // copy reference to target object
- var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options;
-
- // Handle a deep copy situation
- if ( typeof target === "boolean" ) {
- deep = target;
- target = arguments[1] || {};
- // skip the boolean and the target
- i = 2;
- }
-
- // Handle case when target is a string or something (possible in deep copy)
- if ( typeof target !== "object" && !jQuery.isFunction(target) )
- target = {};
-
- // extend jQuery itself if only one argument is passed
- if ( length == i ) {
- target = this;
- --i;
- }
-
- for ( ; i < length; i++ )
- // Only deal with non-null/undefined values
- if ( (options = arguments[ i ]) != null )
- // Extend the base object
- for ( var name in options ) {
- var src = target[ name ], copy = options[ name ];
-
- // Prevent never-ending loop
- if ( target === copy )
- continue;
-
- // Recurse if we're merging object values
- if ( deep && copy && typeof copy === "object" && !copy.nodeType )
- target[ name ] = jQuery.extend( deep,
- // Never move original objects, clone them
- src || ( copy.length != null ? [ ] : { } )
- , copy );
-
- // Don't bring in undefined values
- else if ( copy !== undefined )
- target[ name ] = copy;
-
- }
-
- // Return the modified object
- return target;
-};
-
-// exclude the following css properties to add px
-var exclude = /z-?index|font-?weight|opacity|zoom|line-?height/i,
- // cache defaultView
- defaultView = document.defaultView || {},
- toString = Object.prototype.toString;
-
-jQuery.extend({
- noConflict: function( deep ) {
- window.$ = _$;
-
- if ( deep )
- window.jQuery = _jQuery;
-
- return jQuery;
- },
+ // Make sure leading/trailing whitespace is removed (IE can't handle it)
+ data = jQuery.trim( data );
+
+ // Make sure the incoming data is actual JSON
+ // Logic borrowed from http://json.org/json2.js
+ if ( /^[\],:{}\s]*$/.test(data.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, "@")
+ .replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, "]")
+ .replace(/(?:^|:|,)(?:\s*\[)+/g, "")) ) {
- // See test/unit/core.js for details concerning isFunction.
- // Since version 1.3, DOM methods and functions like alert
- // aren't supported. They return false on IE (#2968).
- isFunction: function( obj ) {
- return toString.call(obj) === "[object Function]";
- },
+ // Try to use the native JSON parser first
+ return window.JSON && window.JSON.parse ?
+ window.JSON.parse( data ) :
+ (new Function("return " + data))();
- isArray: function( obj ) {
- return toString.call(obj) === "[object Array]";
+ } else {
+ jQuery.error( "Invalid JSON: " + data );
+ }
},
- // check if an element is in a (or is an) XML document
- isXMLDoc: function( elem ) {
- return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" ||
- !!elem.ownerDocument && jQuery.isXMLDoc( elem.ownerDocument );
- },
+ noop: function() {},
// Evalulates a script in a global context
globalEval: function( data ) {
- if ( data && /\S/.test(data) ) {
+ if ( data && rnotwhite.test(data) ) {
// Inspired by code by Andrea Giammarchi
// http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html
var head = document.getElementsByTagName("head")[0] || document.documentElement,
script = document.createElement("script");
script.type = "text/javascript";
- if ( jQuery.support.scriptEval )
+
+ if ( jQuery.support.scriptEval ) {
script.appendChild( document.createTextNode( data ) );
- else
+ } else {
script.text = data;
+ }
- // Use insertBefore instead of appendChild to circumvent an IE6 bug.
+ // Use insertBefore instead of appendChild to circumvent an IE6 bug.
// This arises when a base node is used (#2709).
head.insertBefore( script, head.firstChild );
head.removeChild( script );
@@ -667,875 +543,2238 @@ jQuery.extend({
},
nodeName: function( elem, name ) {
- return elem.nodeName && elem.nodeName.toUpperCase() == name.toUpperCase();
+ return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase();
},
// args is for internal usage only
each: function( object, callback, args ) {
- var name, i = 0, length = object.length;
+ var name, i = 0,
+ length = object.length,
+ isObj = length === undefined || jQuery.isFunction(object);
if ( args ) {
- if ( length === undefined ) {
- for ( name in object )
- if ( callback.apply( object[ name ], args ) === false )
+ if ( isObj ) {
+ for ( name in object ) {
+ if ( callback.apply( object[ name ], args ) === false ) {
break;
- } else
- for ( ; i < length; )
- if ( callback.apply( object[ i++ ], args ) === false )
+ }
+ }
+ } else {
+ for ( ; i < length; ) {
+ if ( callback.apply( object[ i++ ], args ) === false ) {
break;
+ }
+ }
+ }
// A special, fast, case for the most common use of each
} else {
- if ( length === undefined ) {
- for ( name in object )
- if ( callback.call( object[ name ], name, object[ name ] ) === false )
+ if ( isObj ) {
+ for ( name in object ) {
+ if ( callback.call( object[ name ], name, object[ name ] ) === false ) {
break;
- } else
+ }
+ }
+ } else {
for ( var value = object[0];
- i < length && callback.call( value, i, value ) !== false; value = object[++i] ){}
+ i < length && callback.call( value, i, value ) !== false; value = object[++i] ) {}
+ }
}
return object;
},
- prop: function( elem, value, type, i, name ) {
- // Handle executable functions
- if ( jQuery.isFunction( value ) )
- value = value.call( elem, i );
-
- // Handle passing in a number to a CSS property
- return typeof value === "number" && type == "curCSS" && !exclude.test( name ) ?
- value + "px" :
- value;
+ trim: function( text ) {
+ return (text || "").replace( rtrim, "" );
},
- className: {
- // internal only, use addClass("class")
- add: function( elem, classNames ) {
- jQuery.each((classNames || "").split(/\s+/), function(i, className){
- if ( elem.nodeType == 1 && !jQuery.className.has( elem.className, className ) )
- elem.className += (elem.className ? " " : "") + className;
- });
- },
-
- // internal only, use removeClass("class")
- remove: function( elem, classNames ) {
- if (elem.nodeType == 1)
- elem.className = classNames !== undefined ?
- jQuery.grep(elem.className.split(/\s+/), function(className){
- return !jQuery.className.has( classNames, className );
- }).join(" ") :
- "";
- },
+ // results is for internal usage only
+ makeArray: function( array, results ) {
+ var ret = results || [];
- // internal only, use hasClass("class")
- has: function( elem, className ) {
- return elem && jQuery.inArray( className, (elem.className || elem).toString().split(/\s+/) ) > -1;
+ if ( array != null ) {
+ // The window, strings (and functions) also have 'length'
+ // The extra typeof function check is to prevent crashes
+ // in Safari 2 (See: #3039)
+ if ( array.length == null || typeof array === "string" || jQuery.isFunction(array) || (typeof array !== "function" && array.setInterval) ) {
+ push.call( ret, array );
+ } else {
+ jQuery.merge( ret, array );
+ }
}
+
+ return ret;
},
- // A method for quickly swapping in/out CSS properties to get correct calculations
- swap: function( elem, options, callback ) {
- var old = {};
- // Remember the old values, and insert the new ones
- for ( var name in options ) {
- old[ name ] = elem.style[ name ];
- elem.style[ name ] = options[ name ];
+ inArray: function( elem, array ) {
+ if ( array.indexOf ) {
+ return array.indexOf( elem );
}
- callback.call( elem );
+ for ( var i = 0, length = array.length; i < length; i++ ) {
+ if ( array[ i ] === elem ) {
+ return i;
+ }
+ }
- // Revert the old values
- for ( var name in options )
- elem.style[ name ] = old[ name ];
+ return -1;
},
- css: function( elem, name, force, extra ) {
- if ( name == "width" || name == "height" ) {
- var val, props = { position: "absolute", visibility: "hidden", display:"block" }, which = name == "width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ];
+ merge: function( first, second ) {
+ var i = first.length, j = 0;
- function getWH() {
- val = name == "width" ? elem.offsetWidth : elem.offsetHeight;
+ if ( typeof second.length === "number" ) {
+ for ( var l = second.length; j < l; j++ ) {
+ first[ i++ ] = second[ j ];
+ }
+
+ } else {
+ while ( second[j] !== undefined ) {
+ first[ i++ ] = second[ j++ ];
+ }
+ }
- if ( extra === "border" )
- return;
+ first.length = i;
- jQuery.each( which, function() {
- if ( !extra )
- val -= parseFloat(jQuery.curCSS( elem, "padding" + this, true)) || 0;
- if ( extra === "margin" )
- val += parseFloat(jQuery.curCSS( elem, "margin" + this, true)) || 0;
- else
- val -= parseFloat(jQuery.curCSS( elem, "border" + this + "Width", true)) || 0;
- });
- }
+ return first;
+ },
- if ( elem.offsetWidth !== 0 )
- getWH();
- else
- jQuery.swap( elem, props, getWH );
+ grep: function( elems, callback, inv ) {
+ var ret = [];
- return Math.max(0, Math.round(val));
+ // Go through the array, only saving the items
+ // that pass the validator function
+ for ( var i = 0, length = elems.length; i < length; i++ ) {
+ if ( !inv !== !callback( elems[ i ], i ) ) {
+ ret.push( elems[ i ] );
+ }
}
- return jQuery.curCSS( elem, name, force );
+ return ret;
},
- curCSS: function( elem, name, force ) {
- var ret, style = elem.style;
+ // arg is for internal usage only
+ map: function( elems, callback, arg ) {
+ var ret = [], value;
- // We need to handle opacity special in IE
- if ( name == "opacity" && !jQuery.support.opacity ) {
- ret = jQuery.attr( style, "opacity" );
+ // Go through the array, translating each of the items to their
+ // new value (or values).
+ for ( var i = 0, length = elems.length; i < length; i++ ) {
+ value = callback( elems[ i ], i, arg );
- return ret == "" ?
- "1" :
- ret;
+ if ( value != null ) {
+ ret[ ret.length ] = value;
+ }
}
- // Make sure we're using the right name for getting the float value
- if ( name.match( /float/i ) )
- name = styleFloat;
+ return ret.concat.apply( [], ret );
+ },
- if ( !force && style && style[ name ] )
- ret = style[ name ];
+ // A global GUID counter for objects
+ guid: 1,
- else if ( defaultView.getComputedStyle ) {
+ proxy: function( fn, proxy, thisObject ) {
+ if ( arguments.length === 2 ) {
+ if ( typeof proxy === "string" ) {
+ thisObject = fn;
+ fn = thisObject[ proxy ];
+ proxy = undefined;
- // Only "float" is needed here
- if ( name.match( /float/i ) )
- name = "float";
+ } else if ( proxy && !jQuery.isFunction( proxy ) ) {
+ thisObject = proxy;
+ proxy = undefined;
+ }
+ }
- name = name.replace( /([A-Z])/g, "-$1" ).toLowerCase();
+ if ( !proxy && fn ) {
+ proxy = function() {
+ return fn.apply( thisObject || this, arguments );
+ };
+ }
- var computedStyle = defaultView.getComputedStyle( elem, null );
+ // Set the guid of unique handler to the same of original handler, so it can be removed
+ if ( fn ) {
+ proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++;
+ }
- if ( computedStyle )
- ret = computedStyle.getPropertyValue( name );
+ // So proxy can be declared as an argument
+ return proxy;
+ },
- // We should always get a number back from opacity
- if ( name == "opacity" && ret == "" )
- ret = "1";
+ // Use of jQuery.browser is frowned upon.
+ // More details: http://docs.jquery.com/Utilities/jQuery.browser
+ uaMatch: function( ua ) {
+ ua = ua.toLowerCase();
- } else if ( elem.currentStyle ) {
- var camelCase = name.replace(/\-(\w)/g, function(all, letter){
- return letter.toUpperCase();
- });
+ var match = /(webkit)[ \/]([\w.]+)/.exec( ua ) ||
+ /(opera)(?:.*version)?[ \/]([\w.]+)/.exec( ua ) ||
+ /(msie) ([\w.]+)/.exec( ua ) ||
+ !/compatible/.test( ua ) && /(mozilla)(?:.*? rv:([\w.]+))?/.exec( ua ) ||
+ [];
- ret = elem.currentStyle[ name ] || elem.currentStyle[ camelCase ];
+ return { browser: match[1] || "", version: match[2] || "0" };
+ },
- // From the awesome hack by Dean Edwards
- // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+ browser: {}
+});
- // If we're not dealing with a regular pixel number
- // but a number that has a weird ending, we need to convert it to pixels
- if ( !/^\d+(px)?$/i.test( ret ) && /^\d/.test( ret ) ) {
- // Remember the original values
- var left = style.left, rsLeft = elem.runtimeStyle.left;
+browserMatch = jQuery.uaMatch( userAgent );
+if ( browserMatch.browser ) {
+ jQuery.browser[ browserMatch.browser ] = true;
+ jQuery.browser.version = browserMatch.version;
+}
- // Put in the new values to get a computed value out
- elem.runtimeStyle.left = elem.currentStyle.left;
- style.left = ret || 0;
- ret = style.pixelLeft + "px";
+// Deprecated, use jQuery.browser.webkit instead
+if ( jQuery.browser.webkit ) {
+ jQuery.browser.safari = true;
+}
- // Revert the changed values
- style.left = left;
- elem.runtimeStyle.left = rsLeft;
- }
- }
+if ( indexOf ) {
+ jQuery.inArray = function( elem, array ) {
+ return indexOf.call( array, elem );
+ };
+}
- return ret;
- },
+// All jQuery objects should point back to these
+rootjQuery = jQuery(document);
- clean: function( elems, context, fragment ) {
- context = context || document;
+// Cleanup functions for the document ready method
+if ( document.addEventListener ) {
+ DOMContentLoaded = function() {
+ document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+ jQuery.ready();
+ };
- // !context.createElement fails in IE with an error but returns typeof 'object'
- if ( typeof context.createElement === "undefined" )
- context = context.ownerDocument || context[0] && context[0].ownerDocument || document;
-
- // If a single string is passed in and it's a single tag
- // just do a createElement and skip the rest
- if ( !fragment && elems.length === 1 && typeof elems[0] === "string" ) {
- var match = /^<(\w+)\s*\/?>$/.exec(elems[0]);
- if ( match )
- return [ context.createElement( match[1] ) ];
+} else if ( document.attachEvent ) {
+ DOMContentLoaded = function() {
+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+ if ( document.readyState === "complete" ) {
+ document.detachEvent( "onreadystatechange", DOMContentLoaded );
+ jQuery.ready();
}
+ };
+}
- var ret = [], scripts = [], div = context.createElement("div");
+// The DOM ready check for Internet Explorer
+function doScrollCheck() {
+ if ( jQuery.isReady ) {
+ return;
+ }
- jQuery.each(elems, function(i, elem){
- if ( typeof elem === "number" )
- elem += '';
+ try {
+ // If IE is used, use the trick by Diego Perini
+ // http://javascript.nwbox.com/IEContentLoaded/
+ document.documentElement.doScroll("left");
+ } catch( error ) {
+ setTimeout( doScrollCheck, 1 );
+ return;
+ }
- if ( !elem )
- return;
+ // and execute any waiting functions
+ jQuery.ready();
+}
- // Convert html string into DOM nodes
- if ( typeof elem === "string" ) {
- // Fix "XHTML"-style tags in all browsers
- elem = elem.replace(/(<(\w+)[^>]*?)\/>/g, function(all, front, tag){
- return tag.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i) ?
- all :
- front + "></" + tag + ">";
- });
+function evalScript( i, elem ) {
+ if ( elem.src ) {
+ jQuery.ajax({
+ url: elem.src,
+ async: false,
+ dataType: "script"
+ });
+ } else {
+ jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" );
+ }
- // Trim whitespace, otherwise indexOf won't work as expected
- var tags = elem.replace(/^\s+/, "").substring(0, 10).toLowerCase();
+ if ( elem.parentNode ) {
+ elem.parentNode.removeChild( elem );
+ }
+}
- var wrap =
- // option or optgroup
- !tags.indexOf("<opt") &&
- [ 1, "<select multiple='multiple'>", "</select>" ] ||
+// Mutifunctional method to get and set values to a collection
+// The value/s can be optionally by executed if its a function
+function access( elems, key, value, exec, fn, pass ) {
+ var length = elems.length;
+
+ // Setting many attributes
+ if ( typeof key === "object" ) {
+ for ( var k in key ) {
+ access( elems, k, key[k], exec, fn, value );
+ }
+ return elems;
+ }
+
+ // Setting one attribute
+ if ( value !== undefined ) {
+ // Optionally, function values get executed if exec is true
+ exec = !pass && exec && jQuery.isFunction(value);
+
+ for ( var i = 0; i < length; i++ ) {
+ fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass );
+ }
+
+ return elems;
+ }
+
+ // Getting an attribute
+ return length ? fn( elems[0], key ) : undefined;
+}
- !tags.indexOf("<leg") &&
- [ 1, "<fieldset>", "</fieldset>" ] ||
+function now() {
+ return (new Date).getTime();
+}
+(function() {
- tags.match(/^<(thead|tbody|tfoot|colg|cap)/) &&
- [ 1, "<table>", "</table>" ] ||
+ jQuery.support = {};
- !tags.indexOf("<tr") &&
- [ 2, "<table><tbody>", "</tbody></table>" ] ||
+ var root = document.documentElement,
+ script = document.createElement("script"),
+ div = document.createElement("div"),
+ id = "script" + now();
- // <thead> matched above
- (!tags.indexOf("<td") || !tags.indexOf("<th")) &&
- [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ] ||
+ div.style.display = "none";
+ div.innerHTML = " <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
- !tags.indexOf("<col") &&
- [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ] ||
+ var all = div.getElementsByTagName("*"),
+ a = div.getElementsByTagName("a")[0];
- // IE can't serialize <link> and <script> tags normally
- !jQuery.support.htmlSerialize &&
- [ 1, "div<div>", "</div>" ] ||
+ // Can't get basic test support
+ if ( !all || !all.length || !a ) {
+ return;
+ }
- [ 0, "", "" ];
+ jQuery.support = {
+ // IE strips leading whitespace when .innerHTML is used
+ leadingWhitespace: div.firstChild.nodeType === 3,
- // Go to html and back, then peel off extra wrappers
- div.innerHTML = wrap[1] + elem + wrap[2];
+ // Make sure that tbody elements aren't automatically inserted
+ // IE will insert them into empty tables
+ tbody: !div.getElementsByTagName("tbody").length,
- // Move to the right depth
- while ( wrap[0]-- )
- div = div.lastChild;
+ // Make sure that link elements get serialized correctly by innerHTML
+ // This requires a wrapper element in IE
+ htmlSerialize: !!div.getElementsByTagName("link").length,
- // Remove IE's autoinserted <tbody> from table fragments
- if ( !jQuery.support.tbody ) {
+ // Get the style information from getAttribute
+ // (IE uses .cssText insted)
+ style: /red/.test( a.getAttribute("style") ),
- // String was a <table>, *may* have spurious <tbody>
- var hasBody = /<tbody/i.test(elem),
- tbody = !tags.indexOf("<table") && !hasBody ?
- div.firstChild && div.firstChild.childNodes :
+ // Make sure that URLs aren't manipulated
+ // (IE normalizes it by default)
+ hrefNormalized: a.getAttribute("href") === "/a",
- // String was a bare <thead> or <tfoot>
- wrap[1] == "<table>" && !hasBody ?
- div.childNodes :
- [];
+ // Make sure that element opacity exists
+ // (IE uses filter instead)
+ // Use a regex to work around a WebKit issue. See #5145
+ opacity: /^0.55$/.test( a.style.opacity ),
- for ( var j = tbody.length - 1; j >= 0 ; --j )
- if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length )
- tbody[ j ].parentNode.removeChild( tbody[ j ] );
+ // Verify style float existence
+ // (IE uses styleFloat instead of cssFloat)
+ cssFloat: !!a.style.cssFloat,
- }
+ // Make sure that if no value is specified for a checkbox
+ // that it defaults to "on".
+ // (WebKit defaults to "" instead)
+ checkOn: div.getElementsByTagName("input")[0].value === "on",
- // IE completely kills leading whitespace when innerHTML is used
- if ( !jQuery.support.leadingWhitespace && /^\s/.test( elem ) )
- div.insertBefore( context.createTextNode( elem.match(/^\s*/)[0] ), div.firstChild );
+ // Make sure that a selected-by-default option has a working selected property.
+ // (WebKit defaults to false instead of true, IE too, if it's in an optgroup)
+ optSelected: document.createElement("select").appendChild( document.createElement("option") ).selected,
- elem = jQuery.makeArray( div.childNodes );
- }
+ parentNode: div.removeChild( div.appendChild( document.createElement("div") ) ).parentNode === null,
- if ( elem.nodeType )
- ret.push( elem );
- else
- ret = jQuery.merge( ret, elem );
+ // Will be defined later
+ deleteExpando: true,
+ checkClone: false,
+ scriptEval: false,
+ noCloneEvent: true,
+ boxModel: null
+ };
- });
+ script.type = "text/javascript";
+ try {
+ script.appendChild( document.createTextNode( "window." + id + "=1;" ) );
+ } catch(e) {}
- if ( fragment ) {
- for ( var i = 0; ret[i]; i++ ) {
- if ( jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) {
- scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] );
- } else {
- if ( ret[i].nodeType === 1 )
- ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) );
- fragment.appendChild( ret[i] );
- }
- }
+ root.insertBefore( script, root.firstChild );
- return scripts;
- }
+ // Make sure that the execution of code works by injecting a script
+ // tag with appendChild/createTextNode
+ // (IE doesn't support this, fails, and uses .text instead)
+ if ( window[ id ] ) {
+ jQuery.support.scriptEval = true;
+ delete window[ id ];
+ }
- return ret;
- },
+ // Test to see if it's possible to delete an expando from an element
+ // Fails in Internet Explorer
+ try {
+ delete script.test;
+
+ } catch(e) {
+ jQuery.support.deleteExpando = false;
+ }
- attr: function( elem, name, value ) {
- // don't set attributes on text and comment nodes
- if (!elem || elem.nodeType == 3 || elem.nodeType == 8)
- return undefined;
+ root.removeChild( script );
- var notxml = !jQuery.isXMLDoc( elem ),
- // Whether we are setting (or getting)
- set = value !== undefined;
+ if ( div.attachEvent && div.fireEvent ) {
+ div.attachEvent("onclick", function click() {
+ // Cloning a node shouldn't copy over any
+ // bound event handlers (IE does this)
+ jQuery.support.noCloneEvent = false;
+ div.detachEvent("onclick", click);
+ });
+ div.cloneNode(true).fireEvent("onclick");
+ }
- // Try to normalize/fix the name
- name = notxml && jQuery.props[ name ] || name;
+ div = document.createElement("div");
+ div.innerHTML = "<input type='radio' name='radiotest' checked='checked'/>";
- // Only do all the following if this is a node (faster for style)
- // IE elem.getAttribute passes even for style
- if ( elem.tagName ) {
+ var fragment = document.createDocumentFragment();
+ fragment.appendChild( div.firstChild );
- // These attributes require special treatment
- var special = /href|src|style/.test( name );
+ // WebKit doesn't clone checked state correctly in fragments
+ jQuery.support.checkClone = fragment.cloneNode(true).cloneNode(true).lastChild.checked;
- // Safari mis-reports the default selected property of a hidden option
- // Accessing the parent's selectedIndex property fixes it
- if ( name == "selected" && elem.parentNode )
- elem.parentNode.selectedIndex;
+ // Figure out if the W3C box model works as expected
+ // document.body must exist before we can do this
+ jQuery(function() {
+ var div = document.createElement("div");
+ div.style.width = div.style.paddingLeft = "1px";
- // If applicable, access the attribute via the DOM 0 way
- if ( name in elem && notxml && !special ) {
- if ( set ){
- // We can't allow the type property to be changed (since it causes problems in IE)
- if ( name == "type" && jQuery.nodeName( elem, "input" ) && elem.parentNode )
- throw "type property can't be changed";
+ document.body.appendChild( div );
+ jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2;
+ document.body.removeChild( div ).style.display = 'none';
- elem[ name ] = value;
- }
+ div = null;
+ });
- // browsers index elements by id/name on forms, give priority to attributes.
- if( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) )
- return elem.getAttributeNode( name ).nodeValue;
+ // Technique from Juriy Zaytsev
+ // http://thinkweb2.com/projects/prototype/detecting-event-support-without-browser-sniffing/
+ var eventSupported = function( eventName ) {
+ var el = document.createElement("div");
+ eventName = "on" + eventName;
- // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
- // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
- if ( name == "tabIndex" ) {
- var attributeNode = elem.getAttributeNode( "tabIndex" );
- return attributeNode && attributeNode.specified
- ? attributeNode.value
- : elem.nodeName.match(/(button|input|object|select|textarea)/i)
- ? 0
- : elem.nodeName.match(/^(a|area)$/i) && elem.href
- ? 0
- : undefined;
- }
+ var isSupported = (eventName in el);
+ if ( !isSupported ) {
+ el.setAttribute(eventName, "return;");
+ isSupported = typeof el[eventName] === "function";
+ }
+ el = null;
- return elem[ name ];
- }
+ return isSupported;
+ };
+
+ jQuery.support.submitBubbles = eventSupported("submit");
+ jQuery.support.changeBubbles = eventSupported("change");
- if ( !jQuery.support.style && notxml && name == "style" )
- return jQuery.attr( elem.style, "cssText", value );
+ // release memory in IE
+ root = script = div = all = a = null;
+})();
- if ( set )
- // convert the value to a string (all browsers do this but IE) see #1070
- elem.setAttribute( name, "" + value );
+jQuery.props = {
+ "for": "htmlFor",
+ "class": "className",
+ readonly: "readOnly",
+ maxlength: "maxLength",
+ cellspacing: "cellSpacing",
+ rowspan: "rowSpan",
+ colspan: "colSpan",
+ tabindex: "tabIndex",
+ usemap: "useMap",
+ frameborder: "frameBorder"
+};
+var expando = "jQuery" + now(), uuid = 0, windowData = {};
- var attr = !jQuery.support.hrefNormalized && notxml && special
- // Some attributes require a special call on IE
- ? elem.getAttribute( name, 2 )
- : elem.getAttribute( name );
+jQuery.extend({
+ cache: {},
+
+ expando:expando,
+
+ // The following elements throw uncatchable exceptions if you
+ // attempt to add expando properties to them.
+ noData: {
+ "embed": true,
+ "object": true,
+ "applet": true
+ },
- // Non-existent attributes return null, we normalize to undefined
- return attr === null ? undefined : attr;
+ data: function( elem, name, data ) {
+ if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
+ return;
}
- // elem is actually elem.style ... set the style
-
- // IE uses filters for opacity
- if ( !jQuery.support.opacity && name == "opacity" ) {
- if ( set ) {
- // IE has trouble with opacity if it does not have layout
- // Force it by setting the zoom level
- elem.zoom = 1;
+ elem = elem == window ?
+ windowData :
+ elem;
- // Set the alpha filter to set the opacity
- elem.filter = (elem.filter || "").replace( /alpha\([^)]*\)/, "" ) +
- (parseInt( value ) + '' == "NaN" ? "" : "alpha(opacity=" + value * 100 + ")");
- }
+ var id = elem[ expando ], cache = jQuery.cache, thisCache;
- return elem.filter && elem.filter.indexOf("opacity=") >= 0 ?
- (parseFloat( elem.filter.match(/opacity=([^)]*)/)[1] ) / 100) + '':
- "";
+ if ( !id && typeof name === "string" && data === undefined ) {
+ return null;
}
- name = name.replace(/-([a-z])/ig, function(all, letter){
- return letter.toUpperCase();
- });
-
- if ( set )
- elem[ name ] = value;
-
- return elem[ name ];
- },
-
- trim: function( text ) {
- return (text || "").replace( /^\s+|\s+$/g, "" );
- },
+ // Compute a unique ID for the element
+ if ( !id ) {
+ id = ++uuid;
+ }
- makeArray: function( array ) {
- var ret = [];
+ // Avoid generating a new cache unless none exists and we
+ // want to manipulate it.
+ if ( typeof name === "object" ) {
+ elem[ expando ] = id;
+ thisCache = cache[ id ] = jQuery.extend(true, {}, name);
- if( array != null ){
- var i = array.length;
- // The window, strings (and functions) also have 'length'
- if( i == null || typeof array === "string" || jQuery.isFunction(array) || array.setInterval )
- ret[0] = array;
- else
- while( i )
- ret[--i] = array[i];
+ } else if ( !cache[ id ] ) {
+ elem[ expando ] = id;
+ cache[ id ] = {};
}
- return ret;
- },
+ thisCache = cache[ id ];
- inArray: function( elem, array ) {
- for ( var i = 0, length = array.length; i < length; i++ )
- // Use === because on IE, window == document
- if ( array[ i ] === elem )
- return i;
+ // Prevent overriding the named cache with undefined values
+ if ( data !== undefined ) {
+ thisCache[ name ] = data;
+ }
- return -1;
+ return typeof name === "string" ? thisCache[ name ] : thisCache;
},
- merge: function( first, second ) {
- // We have to loop this way because IE & Opera overwrite the length
- // expando of getElementsByTagName
- var i = 0, elem, pos = first.length;
- // Also, we need to make sure that the correct elements are being returned
- // (IE returns comment nodes in a '*' query)
- if ( !jQuery.support.getAll ) {
- while ( (elem = second[ i++ ]) != null )
- if ( elem.nodeType != 8 )
- first[ pos++ ] = elem;
-
- } else
- while ( (elem = second[ i++ ]) != null )
- first[ pos++ ] = elem;
-
- return first;
- },
+ removeData: function( elem, name ) {
+ if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) {
+ return;
+ }
- unique: function( array ) {
- var ret = [], done = {};
+ elem = elem == window ?
+ windowData :
+ elem;
- try {
+ var id = elem[ expando ], cache = jQuery.cache, thisCache = cache[ id ];
- for ( var i = 0, length = array.length; i < length; i++ ) {
- var id = jQuery.data( array[ i ] );
+ // If we want to remove a specific section of the element's data
+ if ( name ) {
+ if ( thisCache ) {
+ // Remove the section of cache data
+ delete thisCache[ name ];
- if ( !done[ id ] ) {
- done[ id ] = true;
- ret.push( array[ i ] );
+ // If we've removed all the data, remove the element's cache
+ if ( jQuery.isEmptyObject(thisCache) ) {
+ jQuery.removeData( elem );
}
}
- } catch( e ) {
- ret = array;
- }
+ // Otherwise, we want to remove all of the element's data
+ } else {
+ if ( jQuery.support.deleteExpando ) {
+ delete elem[ jQuery.expando ];
- return ret;
- },
+ } else if ( elem.removeAttribute ) {
+ elem.removeAttribute( jQuery.expando );
+ }
- grep: function( elems, callback, inv ) {
- var ret = [];
+ // Completely remove the data cache
+ delete cache[ id ];
+ }
+ }
+});
- // Go through the array, only saving the items
- // that pass the validator function
- for ( var i = 0, length = elems.length; i < length; i++ )
- if ( !inv != !callback( elems[ i ], i ) )
- ret.push( elems[ i ] );
+jQuery.fn.extend({
+ data: function( key, value ) {
+ if ( typeof key === "undefined" && this.length ) {
+ return jQuery.data( this[0] );
- return ret;
- },
+ } else if ( typeof key === "object" ) {
+ return this.each(function() {
+ jQuery.data( this, key );
+ });
+ }
- map: function( elems, callback ) {
- var ret = [];
+ var parts = key.split(".");
+ parts[1] = parts[1] ? "." + parts[1] : "";
- // Go through the array, translating each of the items to their
- // new value (or values).
- for ( var i = 0, length = elems.length; i < length; i++ ) {
- var value = callback( elems[ i ], i );
+ if ( value === undefined ) {
+ var data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);
- if ( value != null )
- ret[ ret.length ] = value;
+ if ( data === undefined && this.length ) {
+ data = jQuery.data( this[0], key );
+ }
+ return data === undefined && parts[1] ?
+ this.data( parts[0] ) :
+ data;
+ } else {
+ return this.trigger("setData" + parts[1] + "!", [parts[0], value]).each(function() {
+ jQuery.data( this, key, value );
+ });
}
+ },
- return ret.concat.apply( [], ret );
+ removeData: function( key ) {
+ return this.each(function() {
+ jQuery.removeData( this, key );
+ });
}
});
+jQuery.extend({
+ queue: function( elem, type, data ) {
+ if ( !elem ) {
+ return;
+ }
-// Use of jQuery.browser is deprecated.
-// It's included for backwards compatibility and plugins,
-// although they should work to migrate away.
+ type = (type || "fx") + "queue";
+ var q = jQuery.data( elem, type );
-var userAgent = navigator.userAgent.toLowerCase();
+ // Speed up dequeue by getting out quickly if this is just a lookup
+ if ( !data ) {
+ return q || [];
+ }
-// Figure out what browser is being used
-jQuery.browser = {
- version: (userAgent.match( /.+(?:rv|it|ra|ie)[\/: ]([\d.]+)/ ) || [0,'0'])[1],
- safari: /webkit/.test( userAgent ),
- opera: /opera/.test( userAgent ),
- msie: /msie/.test( userAgent ) && !/opera/.test( userAgent ),
- mozilla: /mozilla/.test( userAgent ) && !/(compatible|webkit)/.test( userAgent )
-};
+ if ( !q || jQuery.isArray(data) ) {
+ q = jQuery.data( elem, type, jQuery.makeArray(data) );
-jQuery.each({
- parent: function(elem){return elem.parentNode;},
- parents: function(elem){return jQuery.dir(elem,"parentNode");},
- next: function(elem){return jQuery.nth(elem,2,"nextSibling");},
- prev: function(elem){return jQuery.nth(elem,2,"previousSibling");},
- nextAll: function(elem){return jQuery.dir(elem,"nextSibling");},
- prevAll: function(elem){return jQuery.dir(elem,"previousSibling");},
- siblings: function(elem){return jQuery.sibling(elem.parentNode.firstChild,elem);},
- children: function(elem){return jQuery.sibling(elem.firstChild);},
- contents: function(elem){return jQuery.nodeName(elem,"iframe")?elem.contentDocument||elem.contentWindow.document:jQuery.makeArray(elem.childNodes);}
-}, function(name, fn){
- jQuery.fn[ name ] = function( selector ) {
- var ret = jQuery.map( this, fn );
+ } else {
+ q.push( data );
+ }
- if ( selector && typeof selector == "string" )
- ret = jQuery.multiFilter( selector, ret );
+ return q;
+ },
- return this.pushStack( jQuery.unique( ret ), name, selector );
- };
-});
+ dequeue: function( elem, type ) {
+ type = type || "fx";
-jQuery.each({
- appendTo: "append",
- prependTo: "prepend",
- insertBefore: "before",
- insertAfter: "after",
- replaceAll: "replaceWith"
-}, function(name, original){
- jQuery.fn[ name ] = function( selector ) {
- var ret = [], insert = jQuery( selector );
+ var queue = jQuery.queue( elem, type ), fn = queue.shift();
- for ( var i = 0, l = insert.length; i < l; i++ ) {
- var elems = (i > 0 ? this.clone(true) : this).get();
- jQuery.fn[ original ].apply( jQuery(insert[i]), elems );
- ret = ret.concat( elems );
+ // If the fx queue is dequeued, always remove the progress sentinel
+ if ( fn === "inprogress" ) {
+ fn = queue.shift();
}
- return this.pushStack( ret, name, selector );
- };
+ if ( fn ) {
+ // Add a progress sentinel to prevent the fx queue from being
+ // automatically dequeued
+ if ( type === "fx" ) {
+ queue.unshift("inprogress");
+ }
+
+ fn.call(elem, function() {
+ jQuery.dequeue(elem, type);
+ });
+ }
+ }
});
-jQuery.each({
- removeAttr: function( name ) {
- jQuery.attr( this, name, "" );
- if (this.nodeType == 1)
- this.removeAttribute( name );
- },
+jQuery.fn.extend({
+ queue: function( type, data ) {
+ if ( typeof type !== "string" ) {
+ data = type;
+ type = "fx";
+ }
- addClass: function( classNames ) {
- jQuery.className.add( this, classNames );
- },
+ if ( data === undefined ) {
+ return jQuery.queue( this[0], type );
+ }
+ return this.each(function( i, elem ) {
+ var queue = jQuery.queue( this, type, data );
- removeClass: function( classNames ) {
- jQuery.className.remove( this, classNames );
+ if ( type === "fx" && queue[0] !== "inprogress" ) {
+ jQuery.dequeue( this, type );
+ }
+ });
},
-
- toggleClass: function( classNames, state ) {
- if( typeof state !== "boolean" )
- state = !jQuery.className.has( this, classNames );
- jQuery.className[ state ? "add" : "remove" ]( this, classNames );
+ dequeue: function( type ) {
+ return this.each(function() {
+ jQuery.dequeue( this, type );
+ });
},
- remove: function( selector ) {
- if ( !selector || jQuery.filter( selector, [ this ] ).length ) {
- // Prevent memory leaks
- jQuery( "*", this ).add([this]).each(function(){
- jQuery.event.remove(this);
- jQuery.removeData(this);
- });
- if (this.parentNode)
- this.parentNode.removeChild( this );
- }
+ // Based off of the plugin by Clint Helfers, with permission.
+ // http://blindsignals.com/index.php/2009/07/jquery-delay/
+ delay: function( time, type ) {
+ time = jQuery.fx ? jQuery.fx.speeds[time] || time : time;
+ type = type || "fx";
+
+ return this.queue( type, function() {
+ var elem = this;
+ setTimeout(function() {
+ jQuery.dequeue( elem, type );
+ }, time );
+ });
},
- empty: function() {
- // Remove element nodes and prevent memory leaks
- jQuery(this).children().remove();
-
- // Remove any remaining nodes
- while ( this.firstChild )
- this.removeChild( this.firstChild );
+ clearQueue: function( type ) {
+ return this.queue( type || "fx", [] );
}
-}, function(name, fn){
- jQuery.fn[ name ] = function(){
- return this.each( fn, arguments );
- };
});
+var rclass = /[\n\t]/g,
+ rspace = /\s+/,
+ rreturn = /\r/g,
+ rspecialurl = /href|src|style/,
+ rtype = /(button|input)/i,
+ rfocusable = /(button|input|object|select|textarea)/i,
+ rclickable = /^(a|area)$/i,
+ rradiocheck = /radio|checkbox/;
-// Helper function used by the dimensions and offset modules
-function num(elem, prop) {
- return elem[0] && parseInt( jQuery.curCSS(elem[0], prop, true), 10 ) || 0;
-}
-var expando = "jQuery" + now(), uuid = 0, windowData = {};
-
-jQuery.extend({
- cache: {},
-
- data: function( elem, name, data ) {
- elem = elem == window ?
- windowData :
- elem;
-
- var id = elem[ expando ];
-
- // Compute a unique ID for the element
- if ( !id )
- id = elem[ expando ] = ++uuid;
-
- // Only generate the data cache if we're
- // trying to access or manipulate it
- if ( name && !jQuery.cache[ id ] )
- jQuery.cache[ id ] = {};
-
- // Prevent overriding the named cache with undefined values
- if ( data !== undefined )
- jQuery.cache[ id ][ name ] = data;
-
- // Return the named cache data, or the ID for the element
- return name ?
- jQuery.cache[ id ][ name ] :
- id;
+jQuery.fn.extend({
+ attr: function( name, value ) {
+ return access( this, name, value, true, jQuery.attr );
},
- removeData: function( elem, name ) {
- elem = elem == window ?
- windowData :
- elem;
+ removeAttr: function( name, fn ) {
+ return this.each(function(){
+ jQuery.attr( this, name, "" );
+ if ( this.nodeType === 1 ) {
+ this.removeAttribute( name );
+ }
+ });
+ },
- var id = elem[ expando ];
+ addClass: function( value ) {
+ if ( jQuery.isFunction(value) ) {
+ return this.each(function(i) {
+ var self = jQuery(this);
+ self.addClass( value.call(this, i, self.attr("class")) );
+ });
+ }
- // If we want to remove a specific section of the element's data
- if ( name ) {
- if ( jQuery.cache[ id ] ) {
- // Remove the section of cache data
- delete jQuery.cache[ id ][ name ];
+ if ( value && typeof value === "string" ) {
+ var classNames = (value || "").split( rspace );
- // If we've removed all the data, remove the element's cache
- name = "";
+ for ( var i = 0, l = this.length; i < l; i++ ) {
+ var elem = this[i];
- for ( name in jQuery.cache[ id ] )
- break;
+ if ( elem.nodeType === 1 ) {
+ if ( !elem.className ) {
+ elem.className = value;
- if ( !name )
- jQuery.removeData( elem );
+ } else {
+ var className = " " + elem.className + " ", setClass = elem.className;
+ for ( var c = 0, cl = classNames.length; c < cl; c++ ) {
+ if ( className.indexOf( " " + classNames[c] + " " ) < 0 ) {
+ setClass += " " + classNames[c];
+ }
+ }
+ elem.className = jQuery.trim( setClass );
+ }
+ }
}
+ }
- // Otherwise, we want to remove all of the element's data
- } else {
- // Clean up the element expando
- try {
- delete elem[ expando ];
- } catch(e){
- // IE has trouble directly removing the expando
- // but it's ok with using removeAttribute
- if ( elem.removeAttribute )
- elem.removeAttribute( expando );
- }
+ return this;
+ },
- // Completely remove the data cache
- delete jQuery.cache[ id ];
+ removeClass: function( value ) {
+ if ( jQuery.isFunction(value) ) {
+ return this.each(function(i) {
+ var self = jQuery(this);
+ self.removeClass( value.call(this, i, self.attr("class")) );
+ });
}
- },
- queue: function( elem, type, data ) {
- if ( elem ){
- type = (type || "fx") + "queue";
+ if ( (value && typeof value === "string") || value === undefined ) {
+ var classNames = (value || "").split(rspace);
- var q = jQuery.data( elem, type );
+ for ( var i = 0, l = this.length; i < l; i++ ) {
+ var elem = this[i];
- if ( !q || jQuery.isArray(data) )
- q = jQuery.data( elem, type, jQuery.makeArray(data) );
- else if( data )
- q.push( data );
+ if ( elem.nodeType === 1 && elem.className ) {
+ if ( value ) {
+ var className = (" " + elem.className + " ").replace(rclass, " ");
+ for ( var c = 0, cl = classNames.length; c < cl; c++ ) {
+ className = className.replace(" " + classNames[c] + " ", " ");
+ }
+ elem.className = jQuery.trim( className );
+ } else {
+ elem.className = "";
+ }
+ }
+ }
}
- return q;
- },
- dequeue: function( elem, type ){
- var queue = jQuery.queue( elem, type ),
- fn = queue.shift();
-
- if( !type || type === "fx" )
- fn = queue[0];
-
- if( fn !== undefined )
- fn.call(elem);
- }
-});
+ return this;
+ },
-jQuery.fn.extend({
- data: function( key, value ){
- var parts = key.split(".");
- parts[1] = parts[1] ? "." + parts[1] : "";
+ toggleClass: function( value, stateVal ) {
+ var type = typeof value, isBool = typeof stateVal === "boolean";
- if ( value === undefined ) {
- var data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function(i) {
+ var self = jQuery(this);
+ self.toggleClass( value.call(this, i, self.attr("class"), stateVal), stateVal );
+ });
+ }
- if ( data === undefined && this.length )
- data = jQuery.data( this[0], key );
+ return this.each(function() {
+ if ( type === "string" ) {
+ // toggle individual class names
+ var className, i = 0, self = jQuery(this),
+ state = stateVal,
+ classNames = value.split( rspace );
+
+ while ( (className = classNames[ i++ ]) ) {
+ // check each className given, space seperated list
+ state = isBool ? state : !self.hasClass( className );
+ self[ state ? "addClass" : "removeClass" ]( className );
+ }
- return data === undefined && parts[1] ?
- this.data( parts[0] ) :
- data;
- } else
- return this.trigger("setData" + parts[1] + "!", [parts[0], value]).each(function(){
- jQuery.data( this, key, value );
- });
- },
+ } else if ( type === "undefined" || type === "boolean" ) {
+ if ( this.className ) {
+ // store className if set
+ jQuery.data( this, "__className__", this.className );
+ }
- removeData: function( key ){
- return this.each(function(){
- jQuery.removeData( this, key );
+ // toggle whole className
+ this.className = this.className || value === false ? "" : jQuery.data( this, "__className__" ) || "";
+ }
});
},
- queue: function(type, data){
- if ( typeof type !== "string" ) {
- data = type;
- type = "fx";
- }
-
- if ( data === undefined )
- return jQuery.queue( this[0], type );
- return this.each(function(){
- var queue = jQuery.queue( this, type, data );
+ hasClass: function( selector ) {
+ var className = " " + selector + " ";
+ for ( var i = 0, l = this.length; i < l; i++ ) {
+ if ( (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) {
+ return true;
+ }
+ }
- if( type == "fx" && queue.length == 1 )
- queue[0].call(this);
- });
+ return false;
},
- dequeue: function(type){
- return this.each(function(){
- jQuery.dequeue( this, type );
- });
- }
-});/*!
- * Sizzle CSS Selector Engine - v0.9.3
- * Copyright 2009, The Dojo Foundation
- * Released under the MIT, BSD, and GPL Licenses.
- * More information: http://sizzlejs.com/
- */
-(function(){
-var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?/g,
- done = 0,
- toString = Object.prototype.toString;
+ val: function( value ) {
+ if ( value === undefined ) {
+ var elem = this[0];
-var Sizzle = function(selector, context, results, seed) {
- results = results || [];
- context = context || document;
+ if ( elem ) {
+ if ( jQuery.nodeName( elem, "option" ) ) {
+ return (elem.attributes.value || {}).specified ? elem.value : elem.text;
+ }
- if ( context.nodeType !== 1 && context.nodeType !== 9 )
- return [];
+ // We need to handle select boxes special
+ if ( jQuery.nodeName( elem, "select" ) ) {
+ var index = elem.selectedIndex,
+ values = [],
+ options = elem.options,
+ one = elem.type === "select-one";
- if ( !selector || typeof selector !== "string" ) {
- return results;
- }
+ // Nothing was selected
+ if ( index < 0 ) {
+ return null;
+ }
- var parts = [], m, set, checkSet, check, mode, extra, prune = true;
+ // Loop through all the selected options
+ for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) {
+ var option = options[ i ];
- // Reset the position of the chunker regexp (start from head)
- chunker.lastIndex = 0;
+ if ( option.selected ) {
+ // Get the specifc value for the option
+ value = jQuery(option).val();
- while ( (m = chunker.exec(selector)) !== null ) {
- parts.push( m[1] );
+ // We don't need an array for one selects
+ if ( one ) {
+ return value;
+ }
- if ( m[2] ) {
- extra = RegExp.rightContext;
- break;
- }
- }
+ // Multi-Selects return an array
+ values.push( value );
+ }
+ }
- if ( parts.length > 1 && origPOS.exec( selector ) ) {
- if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
- set = posProcess( parts[0] + parts[1], context );
- } else {
- set = Expr.relative[ parts[0] ] ?
- [ context ] :
- Sizzle( parts.shift(), context );
+ return values;
+ }
- while ( parts.length ) {
- selector = parts.shift();
+ // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified
+ if ( rradiocheck.test( elem.type ) && !jQuery.support.checkOn ) {
+ return elem.getAttribute("value") === null ? "on" : elem.value;
+ }
+
- if ( Expr.relative[ selector ] )
- selector += parts.shift();
+ // Everything else, we just grab the value
+ return (elem.value || "").replace(rreturn, "");
- set = posProcess( selector, set );
}
- }
- } else {
- var ret = seed ?
- { expr: parts.pop(), set: makeArray(seed) } :
- Sizzle.find( parts.pop(), parts.length === 1 && context.parentNode ? context.parentNode : context, isXML(context) );
- set = Sizzle.filter( ret.expr, ret.set );
- if ( parts.length > 0 ) {
- checkSet = makeArray(set);
- } else {
- prune = false;
+ return undefined;
}
- while ( parts.length ) {
- var cur = parts.pop(), pop = cur;
+ var isFunction = jQuery.isFunction(value);
- if ( !Expr.relative[ cur ] ) {
- cur = "";
- } else {
- pop = parts.pop();
+ return this.each(function(i) {
+ var self = jQuery(this), val = value;
+
+ if ( this.nodeType !== 1 ) {
+ return;
}
- if ( pop == null ) {
- pop = context;
+ if ( isFunction ) {
+ val = value.call(this, i, self.val());
}
- Expr.relative[ cur ]( checkSet, pop, isXML(context) );
- }
- }
+ // Typecast each time if the value is a Function and the appended
+ // value is therefore different each time.
+ if ( typeof val === "number" ) {
+ val += "";
+ }
- if ( !checkSet ) {
- checkSet = set;
- }
+ if ( jQuery.isArray(val) && rradiocheck.test( this.type ) ) {
+ this.checked = jQuery.inArray( self.val(), val ) >= 0;
- if ( !checkSet ) {
- throw "Syntax error, unrecognized expression: " + (cur || selector);
- }
+ } else if ( jQuery.nodeName( this, "select" ) ) {
+ var values = jQuery.makeArray(val);
- if ( toString.call(checkSet) === "[object Array]" ) {
- if ( !prune ) {
- results.push.apply( results, checkSet );
- } else if ( context.nodeType === 1 ) {
- for ( var i = 0; checkSet[i] != null; i++ ) {
- if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) {
- results.push( set[i] );
- }
- }
- } else {
- for ( var i = 0; checkSet[i] != null; i++ ) {
- if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
- results.push( set[i] );
+ jQuery( "option", this ).each(function() {
+ this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0;
+ });
+
+ if ( !values.length ) {
+ this.selectedIndex = -1;
}
+
+ } else {
+ this.value = val;
}
- }
- } else {
- makeArray( checkSet, results );
+ });
}
+});
- if ( extra ) {
- Sizzle( extra, context, results, seed );
+jQuery.extend({
+ attrFn: {
+ val: true,
+ css: true,
+ html: true,
+ text: true,
+ data: true,
+ width: true,
+ height: true,
+ offset: true
+ },
+
+ attr: function( elem, name, value, pass ) {
+ // don't set attributes on text and comment nodes
+ if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
+ return undefined;
+ }
- if ( sortOrder ) {
- hasDuplicate = false;
- results.sort(sortOrder);
+ if ( pass && name in jQuery.attrFn ) {
+ return jQuery(elem)[name](value);
+ }
- if ( hasDuplicate ) {
- for ( var i = 1; i < results.length; i++ ) {
- if ( results[i] === results[i-1] ) {
- results.splice(i--, 1);
+ var notxml = elem.nodeType !== 1 || !jQuery.isXMLDoc( elem ),
+ // Whether we are setting (or getting)
+ set = value !== undefined;
+
+ // Try to normalize/fix the name
+ name = notxml && jQuery.props[ name ] || name;
+
+ // Only do all the following if this is a node (faster for style)
+ if ( elem.nodeType === 1 ) {
+ // These attributes require special treatment
+ var special = rspecialurl.test( name );
+
+ // Safari mis-reports the default selected property of an option
+ // Accessing the parent's selectedIndex property fixes it
+ if ( name === "selected" && !jQuery.support.optSelected ) {
+ var parent = elem.parentNode;
+ if ( parent ) {
+ parent.selectedIndex;
+
+ // Make sure that it also works with optgroups, see #5701
+ if ( parent.parentNode ) {
+ parent.parentNode.selectedIndex;
+ }
+ }
+ }
+
+ // If applicable, access the attribute via the DOM 0 way
+ if ( name in elem && notxml && !special ) {
+ if ( set ) {
+ // We can't allow the type property to be changed (since it causes problems in IE)
+ if ( name === "type" && rtype.test( elem.nodeName ) && elem.parentNode ) {
+ jQuery.error( "type property can't be changed" );
}
+
+ elem[ name ] = value;
+ }
+
+ // browsers index elements by id/name on forms, give priority to attributes.
+ if ( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) {
+ return elem.getAttributeNode( name ).nodeValue;
+ }
+
+ // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set
+ // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+ if ( name === "tabIndex" ) {
+ var attributeNode = elem.getAttributeNode( "tabIndex" );
+
+ return attributeNode && attributeNode.specified ?
+ attributeNode.value :
+ rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ?
+ 0 :
+ undefined;
+ }
+
+ return elem[ name ];
+ }
+
+ if ( !jQuery.support.style && notxml && name === "style" ) {
+ if ( set ) {
+ elem.style.cssText = "" + value;
+ }
+
+ return elem.style.cssText;
+ }
+
+ if ( set ) {
+ // convert the value to a string (all browsers do this but IE) see #1070
+ elem.setAttribute( name, "" + value );
+ }
+
+ var attr = !jQuery.support.hrefNormalized && notxml && special ?
+ // Some attributes require a special call on IE
+ elem.getAttribute( name, 2 ) :
+ elem.getAttribute( name );
+
+ // Non-existent attributes return null, we normalize to undefined
+ return attr === null ? undefined : attr;
+ }
+
+ // elem is actually elem.style ... set the style
+ // Using attr for specific style information is now deprecated. Use style instead.
+ return jQuery.style( elem, name, value );
+ }
+});
+var rnamespaces = /\.(.*)$/,
+ fcleanup = function( nm ) {
+ return nm.replace(/[^\w\s\.\|`]/g, function( ch ) {
+ return "\\" + ch;
+ });
+ };
+
+/*
+ * A number of helper functions used for managing events.
+ * Many of the ideas behind this code originated from
+ * Dean Edwards' addEvent library.
+ */
+jQuery.event = {
+
+ // Bind an event to an element
+ // Original by Dean Edwards
+ add: function( elem, types, handler, data ) {
+ if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+ return;
+ }
+
+ // For whatever reason, IE has trouble passing the window object
+ // around, causing it to be cloned in the process
+ if ( elem.setInterval && ( elem !== window && !elem.frameElement ) ) {
+ elem = window;
+ }
+
+ var handleObjIn, handleObj;
+
+ if ( handler.handler ) {
+ handleObjIn = handler;
+ handler = handleObjIn.handler;
+ }
+
+ // Make sure that the function being executed has a unique ID
+ if ( !handler.guid ) {
+ handler.guid = jQuery.guid++;
+ }
+
+ // Init the element's event structure
+ var elemData = jQuery.data( elem );
+
+ // If no elemData is found then we must be trying to bind to one of the
+ // banned noData elements
+ if ( !elemData ) {
+ return;
+ }
+
+ var events = elemData.events = elemData.events || {},
+ eventHandle = elemData.handle, eventHandle;
+
+ if ( !eventHandle ) {
+ elemData.handle = eventHandle = function() {
+ // Handle the second event of a trigger and when
+ // an event is called after a page has unloaded
+ return typeof jQuery !== "undefined" && !jQuery.event.triggered ?
+ jQuery.event.handle.apply( eventHandle.elem, arguments ) :
+ undefined;
+ };
+ }
+
+ // Add elem as a property of the handle function
+ // This is to prevent a memory leak with non-native events in IE.
+ eventHandle.elem = elem;
+
+ // Handle multiple events separated by a space
+ // jQuery(...).bind("mouseover mouseout", fn);
+ types = types.split(" ");
+
+ var type, i = 0, namespaces;
+
+ while ( (type = types[ i++ ]) ) {
+ handleObj = handleObjIn ?
+ jQuery.extend({}, handleObjIn) :
+ { handler: handler, data: data };
+
+ // Namespaced event handlers
+ if ( type.indexOf(".") > -1 ) {
+ namespaces = type.split(".");
+ type = namespaces.shift();
+ handleObj.namespace = namespaces.slice(0).sort().join(".");
+
+ } else {
+ namespaces = [];
+ handleObj.namespace = "";
+ }
+
+ handleObj.type = type;
+ handleObj.guid = handler.guid;
+
+ // Get the current list of functions bound to this event
+ var handlers = events[ type ],
+ special = jQuery.event.special[ type ] || {};
+
+ // Init the event handler queue
+ if ( !handlers ) {
+ handlers = events[ type ] = [];
+
+ // Check for a special event handler
+ // Only use addEventListener/attachEvent if the special
+ // events handler returns false
+ if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+ // Bind the global event handler to the element
+ if ( elem.addEventListener ) {
+ elem.addEventListener( type, eventHandle, false );
+
+ } else if ( elem.attachEvent ) {
+ elem.attachEvent( "on" + type, eventHandle );
+ }
+ }
+ }
+
+ if ( special.add ) {
+ special.add.call( elem, handleObj );
+
+ if ( !handleObj.handler.guid ) {
+ handleObj.handler.guid = handler.guid;
+ }
+ }
+
+ // Add the function to the element's handler list
+ handlers.push( handleObj );
+
+ // Keep track of which events have been used, for global triggering
+ jQuery.event.global[ type ] = true;
+ }
+
+ // Nullify elem to prevent memory leaks in IE
+ elem = null;
+ },
+
+ global: {},
+
+ // Detach an event or set of events from an element
+ remove: function( elem, types, handler, pos ) {
+ // don't do events on text and comment nodes
+ if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+ return;
+ }
+
+ var ret, type, fn, i = 0, all, namespaces, namespace, special, eventType, handleObj, origType,
+ elemData = jQuery.data( elem ),
+ events = elemData && elemData.events;
+
+ if ( !elemData || !events ) {
+ return;
+ }
+
+ // types is actually an event object here
+ if ( types && types.type ) {
+ handler = types.handler;
+ types = types.type;
+ }
+
+ // Unbind all events for the element
+ if ( !types || typeof types === "string" && types.charAt(0) === "." ) {
+ types = types || "";
+
+ for ( type in events ) {
+ jQuery.event.remove( elem, type + types );
+ }
+
+ return;
+ }
+
+ // Handle multiple events separated by a space
+ // jQuery(...).unbind("mouseover mouseout", fn);
+ types = types.split(" ");
+
+ while ( (type = types[ i++ ]) ) {
+ origType = type;
+ handleObj = null;
+ all = type.indexOf(".") < 0;
+ namespaces = [];
+
+ if ( !all ) {
+ // Namespaced event handlers
+ namespaces = type.split(".");
+ type = namespaces.shift();
+
+ namespace = new RegExp("(^|\\.)" +
+ jQuery.map( namespaces.slice(0).sort(), fcleanup ).join("\\.(?:.*\\.)?") + "(\\.|$)")
+ }
+
+ eventType = events[ type ];
+
+ if ( !eventType ) {
+ continue;
+ }
+
+ if ( !handler ) {
+ for ( var j = 0; j < eventType.length; j++ ) {
+ handleObj = eventType[ j ];
+
+ if ( all || namespace.test( handleObj.namespace ) ) {
+ jQuery.event.remove( elem, origType, handleObj.handler, j );
+ eventType.splice( j--, 1 );
+ }
+ }
+
+ continue;
+ }
+
+ special = jQuery.event.special[ type ] || {};
+
+ for ( var j = pos || 0; j < eventType.length; j++ ) {
+ handleObj = eventType[ j ];
+
+ if ( handler.guid === handleObj.guid ) {
+ // remove the given handler for the given type
+ if ( all || namespace.test( handleObj.namespace ) ) {
+ if ( pos == null ) {
+ eventType.splice( j--, 1 );
+ }
+
+ if ( special.remove ) {
+ special.remove.call( elem, handleObj );
+ }
+ }
+
+ if ( pos != null ) {
+ break;
+ }
+ }
+ }
+
+ // remove generic event handler if no more handlers exist
+ if ( eventType.length === 0 || pos != null && eventType.length === 1 ) {
+ if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) {
+ removeEvent( elem, type, elemData.handle );
+ }
+
+ ret = null;
+ delete events[ type ];
+ }
+ }
+
+ // Remove the expando if it's no longer used
+ if ( jQuery.isEmptyObject( events ) ) {
+ var handle = elemData.handle;
+ if ( handle ) {
+ handle.elem = null;
+ }
+
+ delete elemData.events;
+ delete elemData.handle;
+
+ if ( jQuery.isEmptyObject( elemData ) ) {
+ jQuery.removeData( elem );
+ }
+ }
+ },
+
+ // bubbling is internal
+ trigger: function( event, data, elem /*, bubbling */ ) {
+ // Event object or event type
+ var type = event.type || event,
+ bubbling = arguments[3];
+
+ if ( !bubbling ) {
+ event = typeof event === "object" ?
+ // jQuery.Event object
+ event[expando] ? event :
+ // Object literal
+ jQuery.extend( jQuery.Event(type), event ) :
+ // Just the event type (string)
+ jQuery.Event(type);
+
+ if ( type.indexOf("!") >= 0 ) {
+ event.type = type = type.slice(0, -1);
+ event.exclusive = true;
+ }
+
+ // Handle a global trigger
+ if ( !elem ) {
+ // Don't bubble custom events when global (to avoid too much overhead)
+ event.stopPropagation();
+
+ // Only trigger if we've ever bound an event for it
+ if ( jQuery.event.global[ type ] ) {
+ jQuery.each( jQuery.cache, function() {
+ if ( this.events && this.events[type] ) {
+ jQuery.event.trigger( event, data, this.handle.elem );
+ }
+ });
+ }
+ }
+
+ // Handle triggering a single element
+
+ // don't do events on text and comment nodes
+ if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
+ return undefined;
+ }
+
+ // Clean up in case it is reused
+ event.result = undefined;
+ event.target = elem;
+
+ // Clone the incoming data, if any
+ data = jQuery.makeArray( data );
+ data.unshift( event );
+ }
+
+ event.currentTarget = elem;
+
+ // Trigger the event, it is assumed that "handle" is a function
+ var handle = jQuery.data( elem, "handle" );
+ if ( handle ) {
+ handle.apply( elem, data );
+ }
+
+ var parent = elem.parentNode || elem.ownerDocument;
+
+ // Trigger an inline bound script
+ try {
+ if ( !(elem && elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()]) ) {
+ if ( elem[ "on" + type ] && elem[ "on" + type ].apply( elem, data ) === false ) {
+ event.result = false;
+ }
+ }
+
+ // prevent IE from throwing an error for some elements with some event types, see #3533
+ } catch (e) {}
+
+ if ( !event.isPropagationStopped() && parent ) {
+ jQuery.event.trigger( event, data, parent, true );
+
+ } else if ( !event.isDefaultPrevented() ) {
+ var target = event.target, old,
+ isClick = jQuery.nodeName(target, "a") && type === "click",
+ special = jQuery.event.special[ type ] || {};
+
+ if ( (!special._default || special._default.call( elem, event ) === false) &&
+ !isClick && !(target && target.nodeName && jQuery.noData[target.nodeName.toLowerCase()]) ) {
+
+ try {
+ if ( target[ type ] ) {
+ // Make sure that we don't accidentally re-trigger the onFOO events
+ old = target[ "on" + type ];
+
+ if ( old ) {
+ target[ "on" + type ] = null;
+ }
+
+ jQuery.event.triggered = true;
+ target[ type ]();
+ }
+
+ // prevent IE from throwing an error for some elements with some event types, see #3533
+ } catch (e) {}
+
+ if ( old ) {
+ target[ "on" + type ] = old;
+ }
+
+ jQuery.event.triggered = false;
+ }
+ }
+ },
+
+ handle: function( event ) {
+ var all, handlers, namespaces, namespace, events;
+
+ event = arguments[0] = jQuery.event.fix( event || window.event );
+ event.currentTarget = this;
+
+ // Namespaced event handlers
+ all = event.type.indexOf(".") < 0 && !event.exclusive;
+
+ if ( !all ) {
+ namespaces = event.type.split(".");
+ event.type = namespaces.shift();
+ namespace = new RegExp("(^|\\.)" + namespaces.slice(0).sort().join("\\.(?:.*\\.)?") + "(\\.|$)");
+ }
+
+ var events = jQuery.data(this, "events"), handlers = events[ event.type ];
+
+ if ( events && handlers ) {
+ // Clone the handlers to prevent manipulation
+ handlers = handlers.slice(0);
+
+ for ( var j = 0, l = handlers.length; j < l; j++ ) {
+ var handleObj = handlers[ j ];
+
+ // Filter the functions by class
+ if ( all || namespace.test( handleObj.namespace ) ) {
+ // Pass in a reference to the handler function itself
+ // So that we can later remove it
+ event.handler = handleObj.handler;
+ event.data = handleObj.data;
+ event.handleObj = handleObj;
+
+ var ret = handleObj.handler.apply( this, arguments );
+
+ if ( ret !== undefined ) {
+ event.result = ret;
+ if ( ret === false ) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ }
+
+ if ( event.isImmediatePropagationStopped() ) {
+ break;
+ }
+ }
+ }
+ }
+
+ return event.result;
+ },
+
+ props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
+
+ fix: function( event ) {
+ if ( event[ expando ] ) {
+ return event;
+ }
+
+ // store a copy of the original event object
+ // and "clone" to set read-only properties
+ var originalEvent = event;
+ event = jQuery.Event( originalEvent );
+
+ for ( var i = this.props.length, prop; i; ) {
+ prop = this.props[ --i ];
+ event[ prop ] = originalEvent[ prop ];
+ }
+
+ // Fix target property, if necessary
+ if ( !event.target ) {
+ event.target = event.srcElement || document; // Fixes #1925 where srcElement might not be defined either
+ }
+
+ // check if target is a textnode (safari)
+ if ( event.target.nodeType === 3 ) {
+ event.target = event.target.parentNode;
+ }
+
+ // Add relatedTarget, if necessary
+ if ( !event.relatedTarget && event.fromElement ) {
+ event.relatedTarget = event.fromElement === event.target ? event.toElement : event.fromElement;
+ }
+
+ // Calculate pageX/Y if missing and clientX/Y available
+ if ( event.pageX == null && event.clientX != null ) {
+ var doc = document.documentElement, body = document.body;
+ event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc && doc.clientLeft || body && body.clientLeft || 0);
+ event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc && doc.clientTop || body && body.clientTop || 0);
+ }
+
+ // Add which for key events
+ if ( !event.which && ((event.charCode || event.charCode === 0) ? event.charCode : event.keyCode) ) {
+ event.which = event.charCode || event.keyCode;
+ }
+
+ // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs)
+ if ( !event.metaKey && event.ctrlKey ) {
+ event.metaKey = event.ctrlKey;
+ }
+
+ // Add which for click: 1 === left; 2 === middle; 3 === right
+ // Note: button is not normalized, so don't use it
+ if ( !event.which && event.button !== undefined ) {
+ event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) ));
+ }
+
+ return event;
+ },
+
+ // Deprecated, use jQuery.guid instead
+ guid: 1E8,
+
+ // Deprecated, use jQuery.proxy instead
+ proxy: jQuery.proxy,
+
+ special: {
+ ready: {
+ // Make sure the ready event is setup
+ setup: jQuery.bindReady,
+ teardown: jQuery.noop
+ },
+
+ live: {
+ add: function( handleObj ) {
+ jQuery.event.add( this, handleObj.origType, jQuery.extend({}, handleObj, {handler: liveHandler}) );
+ },
+
+ remove: function( handleObj ) {
+ var remove = true,
+ type = handleObj.origType.replace(rnamespaces, "");
+
+ jQuery.each( jQuery.data(this, "events").live || [], function() {
+ if ( type === this.origType.replace(rnamespaces, "") ) {
+ remove = false;
+ return false;
+ }
+ });
+
+ if ( remove ) {
+ jQuery.event.remove( this, handleObj.origType, liveHandler );
+ }
+ }
+
+ },
+
+ beforeunload: {
+ setup: function( data, namespaces, eventHandle ) {
+ // We only want to do this special case on windows
+ if ( this.setInterval ) {
+ this.onbeforeunload = eventHandle;
+ }
+
+ return false;
+ },
+ teardown: function( namespaces, eventHandle ) {
+ if ( this.onbeforeunload === eventHandle ) {
+ this.onbeforeunload = null;
+ }
+ }
+ }
+ }
+};
+
+var removeEvent = document.removeEventListener ?
+ function( elem, type, handle ) {
+ elem.removeEventListener( type, handle, false );
+ } :
+ function( elem, type, handle ) {
+ elem.detachEvent( "on" + type, handle );
+ };
+
+jQuery.Event = function( src ) {
+ // Allow instantiation without the 'new' keyword
+ if ( !this.preventDefault ) {
+ return new jQuery.Event( src );
+ }
+
+ // Event object
+ if ( src && src.type ) {
+ this.originalEvent = src;
+ this.type = src.type;
+ // Event type
+ } else {
+ this.type = src;
+ }
+
+ // timeStamp is buggy for some events on Firefox(#3843)
+ // So we won't rely on the native value
+ this.timeStamp = now();
+
+ // Mark it as fixed
+ this[ expando ] = true;
+};
+
+function returnFalse() {
+ return false;
+}
+function returnTrue() {
+ return true;
+}
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+ preventDefault: function() {
+ this.isDefaultPrevented = returnTrue;
+
+ var e = this.originalEvent;
+ if ( !e ) {
+ return;
+ }
+
+ // if preventDefault exists run it on the original event
+ if ( e.preventDefault ) {
+ e.preventDefault();
+ }
+ // otherwise set the returnValue property of the original event to false (IE)
+ e.returnValue = false;
+ },
+ stopPropagation: function() {
+ this.isPropagationStopped = returnTrue;
+
+ var e = this.originalEvent;
+ if ( !e ) {
+ return;
+ }
+ // if stopPropagation exists run it on the original event
+ if ( e.stopPropagation ) {
+ e.stopPropagation();
+ }
+ // otherwise set the cancelBubble property of the original event to true (IE)
+ e.cancelBubble = true;
+ },
+ stopImmediatePropagation: function() {
+ this.isImmediatePropagationStopped = returnTrue;
+ this.stopPropagation();
+ },
+ isDefaultPrevented: returnFalse,
+ isPropagationStopped: returnFalse,
+ isImmediatePropagationStopped: returnFalse
+};
+
+// Checks if an event happened on an element within another element
+// Used in jQuery.event.special.mouseenter and mouseleave handlers
+var withinElement = function( event ) {
+ // Check if mouse(over|out) are still within the same parent element
+ var parent = event.relatedTarget;
+
+ // Firefox sometimes assigns relatedTarget a XUL element
+ // which we cannot access the parentNode property of
+ try {
+ // Traverse up the tree
+ while ( parent && parent !== this ) {
+ parent = parent.parentNode;
+ }
+
+ if ( parent !== this ) {
+ // set the correct event type
+ event.type = event.data;
+
+ // handle event if we actually just moused on to a non sub-element
+ jQuery.event.handle.apply( this, arguments );
+ }
+
+ // assuming we've left the element since we most likely mousedover a xul element
+ } catch(e) { }
+},
+
+// In case of event delegation, we only need to rename the event.type,
+// liveHandler will take care of the rest.
+delegate = function( event ) {
+ event.type = event.data;
+ jQuery.event.handle.apply( this, arguments );
+};
+
+// Create mouseenter and mouseleave events
+jQuery.each({
+ mouseenter: "mouseover",
+ mouseleave: "mouseout"
+}, function( orig, fix ) {
+ jQuery.event.special[ orig ] = {
+ setup: function( data ) {
+ jQuery.event.add( this, fix, data && data.selector ? delegate : withinElement, orig );
+ },
+ teardown: function( data ) {
+ jQuery.event.remove( this, fix, data && data.selector ? delegate : withinElement );
+ }
+ };
+});
+
+// submit delegation
+if ( !jQuery.support.submitBubbles ) {
+
+ jQuery.event.special.submit = {
+ setup: function( data, namespaces ) {
+ if ( this.nodeName.toLowerCase() !== "form" ) {
+ jQuery.event.add(this, "click.specialSubmit", function( e ) {
+ var elem = e.target, type = elem.type;
+
+ if ( (type === "submit" || type === "image") && jQuery( elem ).closest("form").length ) {
+ return trigger( "submit", this, arguments );
+ }
+ });
+
+ jQuery.event.add(this, "keypress.specialSubmit", function( e ) {
+ var elem = e.target, type = elem.type;
+
+ if ( (type === "text" || type === "password") && jQuery( elem ).closest("form").length && e.keyCode === 13 ) {
+ return trigger( "submit", this, arguments );
+ }
+ });
+
+ } else {
+ return false;
+ }
+ },
+
+ teardown: function( namespaces ) {
+ jQuery.event.remove( this, ".specialSubmit" );
+ }
+ };
+
+}
+
+// change delegation, happens here so we have bind.
+if ( !jQuery.support.changeBubbles ) {
+
+ var formElems = /textarea|input|select/i,
+
+ changeFilters,
+
+ getVal = function( elem ) {
+ var type = elem.type, val = elem.value;
+
+ if ( type === "radio" || type === "checkbox" ) {
+ val = elem.checked;
+
+ } else if ( type === "select-multiple" ) {
+ val = elem.selectedIndex > -1 ?
+ jQuery.map( elem.options, function( elem ) {
+ return elem.selected;
+ }).join("-") :
+ "";
+
+ } else if ( elem.nodeName.toLowerCase() === "select" ) {
+ val = elem.selectedIndex;
+ }
+
+ return val;
+ },
+
+ testChange = function testChange( e ) {
+ var elem = e.target, data, val;
+
+ if ( !formElems.test( elem.nodeName ) || elem.readOnly ) {
+ return;
+ }
+
+ data = jQuery.data( elem, "_change_data" );
+ val = getVal(elem);
+
+ // the current data will be also retrieved by beforeactivate
+ if ( e.type !== "focusout" || elem.type !== "radio" ) {
+ jQuery.data( elem, "_change_data", val );
+ }
+
+ if ( data === undefined || val === data ) {
+ return;
+ }
+
+ if ( data != null || val ) {
+ e.type = "change";
+ return jQuery.event.trigger( e, arguments[1], elem );
+ }
+ };
+
+ jQuery.event.special.change = {
+ filters: {
+ focusout: testChange,
+
+ click: function( e ) {
+ var elem = e.target, type = elem.type;
+
+ if ( type === "radio" || type === "checkbox" || elem.nodeName.toLowerCase() === "select" ) {
+ return testChange.call( this, e );
+ }
+ },
+
+ // Change has to be called before submit
+ // Keydown will be called before keypress, which is used in submit-event delegation
+ keydown: function( e ) {
+ var elem = e.target, type = elem.type;
+
+ if ( (e.keyCode === 13 && elem.nodeName.toLowerCase() !== "textarea") ||
+ (e.keyCode === 32 && (type === "checkbox" || type === "radio")) ||
+ type === "select-multiple" ) {
+ return testChange.call( this, e );
+ }
+ },
+
+ // Beforeactivate happens also before the previous element is blurred
+ // with this event you can't trigger a change event, but you can store
+ // information/focus[in] is not needed anymore
+ beforeactivate: function( e ) {
+ var elem = e.target;
+ jQuery.data( elem, "_change_data", getVal(elem) );
+ }
+ },
+
+ setup: function( data, namespaces ) {
+ if ( this.type === "file" ) {
+ return false;
+ }
+
+ for ( var type in changeFilters ) {
+ jQuery.event.add( this, type + ".specialChange", changeFilters[type] );
+ }
+
+ return formElems.test( this.nodeName );
+ },
+
+ teardown: function( namespaces ) {
+ jQuery.event.remove( this, ".specialChange" );
+
+ return formElems.test( this.nodeName );
+ }
+ };
+
+ changeFilters = jQuery.event.special.change.filters;
+}
+
+function trigger( type, elem, args ) {
+ args[0].type = type;
+ return jQuery.event.handle.apply( elem, args );
+}
+
+// Create "bubbling" focus and blur events
+if ( document.addEventListener ) {
+ jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) {
+ jQuery.event.special[ fix ] = {
+ setup: function() {
+ this.addEventListener( orig, handler, true );
+ },
+ teardown: function() {
+ this.removeEventListener( orig, handler, true );
+ }
+ };
+
+ function handler( e ) {
+ e = jQuery.event.fix( e );
+ e.type = fix;
+ return jQuery.event.handle.call( this, e );
+ }
+ });
+}
+
+jQuery.each(["bind", "one"], function( i, name ) {
+ jQuery.fn[ name ] = function( type, data, fn ) {
+ // Handle object literals
+ if ( typeof type === "object" ) {
+ for ( var key in type ) {
+ this[ name ](key, data, type[key], fn);
+ }
+ return this;
+ }
+
+ if ( jQuery.isFunction( data ) ) {
+ fn = data;
+ data = undefined;
+ }
+
+ var handler = name === "one" ? jQuery.proxy( fn, function( event ) {
+ jQuery( this ).unbind( event, handler );
+ return fn.apply( this, arguments );
+ }) : fn;
+
+ if ( type === "unload" && name !== "one" ) {
+ this.one( type, data, fn );
+
+ } else {
+ for ( var i = 0, l = this.length; i < l; i++ ) {
+ jQuery.event.add( this[i], type, handler, data );
+ }
+ }
+
+ return this;
+ };
+});
+
+jQuery.fn.extend({
+ unbind: function( type, fn ) {
+ // Handle object literals
+ if ( typeof type === "object" && !type.preventDefault ) {
+ for ( var key in type ) {
+ this.unbind(key, type[key]);
+ }
+
+ } else {
+ for ( var i = 0, l = this.length; i < l; i++ ) {
+ jQuery.event.remove( this[i], type, fn );
+ }
+ }
+
+ return this;
+ },
+
+ delegate: function( selector, types, data, fn ) {
+ return this.live( types, data, fn, selector );
+ },
+
+ undelegate: function( selector, types, fn ) {
+ if ( arguments.length === 0 ) {
+ return this.unbind( "live" );
+
+ } else {
+ return this.die( types, null, fn, selector );
+ }
+ },
+
+ trigger: function( type, data ) {
+ return this.each(function() {
+ jQuery.event.trigger( type, data, this );
+ });
+ },
+
+ triggerHandler: function( type, data ) {
+ if ( this[0] ) {
+ var event = jQuery.Event( type );
+ event.preventDefault();
+ event.stopPropagation();
+ jQuery.event.trigger( event, data, this[0] );
+ return event.result;
+ }
+ },
+
+ toggle: function( fn ) {
+ // Save reference to arguments for access in closure
+ var args = arguments, i = 1;
+
+ // link all the functions, so any of them can unbind this click handler
+ while ( i < args.length ) {
+ jQuery.proxy( fn, args[ i++ ] );
+ }
+
+ return this.click( jQuery.proxy( fn, function( event ) {
+ // Figure out which function to execute
+ var lastToggle = ( jQuery.data( this, "lastToggle" + fn.guid ) || 0 ) % i;
+ jQuery.data( this, "lastToggle" + fn.guid, lastToggle + 1 );
+
+ // Make sure that clicks stop
+ event.preventDefault();
+
+ // and execute the function
+ return args[ lastToggle ].apply( this, arguments ) || false;
+ }));
+ },
+
+ hover: function( fnOver, fnOut ) {
+ return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
+ }
+});
+
+var liveMap = {
+ focus: "focusin",
+ blur: "focusout",
+ mouseenter: "mouseover",
+ mouseleave: "mouseout"
+};
+
+jQuery.each(["live", "die"], function( i, name ) {
+ jQuery.fn[ name ] = function( types, data, fn, origSelector /* Internal Use Only */ ) {
+ var type, i = 0, match, namespaces, preType,
+ selector = origSelector || this.selector,
+ context = origSelector ? this : jQuery( this.context );
+
+ if ( jQuery.isFunction( data ) ) {
+ fn = data;
+ data = undefined;
+ }
+
+ types = (types || "").split(" ");
+
+ while ( (type = types[ i++ ]) != null ) {
+ match = rnamespaces.exec( type );
+ namespaces = "";
+
+ if ( match ) {
+ namespaces = match[0];
+ type = type.replace( rnamespaces, "" );
+ }
+
+ if ( type === "hover" ) {
+ types.push( "mouseenter" + namespaces, "mouseleave" + namespaces );
+ continue;
+ }
+
+ preType = type;
+
+ if ( type === "focus" || type === "blur" ) {
+ types.push( liveMap[ type ] + namespaces );
+ type = type + namespaces;
+
+ } else {
+ type = (liveMap[ type ] || type) + namespaces;
+ }
+
+ if ( name === "live" ) {
+ // bind live handler
+ context.each(function(){
+ jQuery.event.add( this, liveConvert( type, selector ),
+ { data: data, selector: selector, handler: fn, origType: type, origHandler: fn, preType: preType } );
+ });
+
+ } else {
+ // unbind live handler
+ context.unbind( liveConvert( type, selector ), fn );
+ }
+ }
+
+ return this;
+ }
+});
+
+function liveHandler( event ) {
+ var stop, elems = [], selectors = [], args = arguments,
+ related, match, handleObj, elem, j, i, l, data,
+ events = jQuery.data( this, "events" );
+
+ // Make sure we avoid non-left-click bubbling in Firefox (#3861)
+ if ( event.liveFired === this || !events || !events.live || event.button && event.type === "click" ) {
+ return;
+ }
+
+ event.liveFired = this;
+
+ var live = events.live.slice(0);
+
+ for ( j = 0; j < live.length; j++ ) {
+ handleObj = live[j];
+
+ if ( handleObj.origType.replace( rnamespaces, "" ) === event.type ) {
+ selectors.push( handleObj.selector );
+
+ } else {
+ live.splice( j--, 1 );
+ }
+ }
+
+ match = jQuery( event.target ).closest( selectors, event.currentTarget );
+
+ for ( i = 0, l = match.length; i < l; i++ ) {
+ for ( j = 0; j < live.length; j++ ) {
+ handleObj = live[j];
+
+ if ( match[i].selector === handleObj.selector ) {
+ elem = match[i].elem;
+ related = null;
+
+ // Those two events require additional checking
+ if ( handleObj.preType === "mouseenter" || handleObj.preType === "mouseleave" ) {
+ related = jQuery( event.relatedTarget ).closest( handleObj.selector )[0];
+ }
+
+ if ( !related || related !== elem ) {
+ elems.push({ elem: elem, handleObj: handleObj });
+ }
+ }
+ }
+ }
+
+ for ( i = 0, l = elems.length; i < l; i++ ) {
+ match = elems[i];
+ event.currentTarget = match.elem;
+ event.data = match.handleObj.data;
+ event.handleObj = match.handleObj;
+
+ if ( match.handleObj.origHandler.apply( match.elem, args ) === false ) {
+ stop = false;
+ break;
+ }
+ }
+
+ return stop;
+}
+
+function liveConvert( type, selector ) {
+ return "live." + (type && type !== "*" ? type + "." : "") + selector.replace(/\./g, "`").replace(/ /g, "&");
+}
+
+jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " +
+ "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+ "change select submit keydown keypress keyup error").split(" "), function( i, name ) {
+
+ // Handle event binding
+ jQuery.fn[ name ] = function( fn ) {
+ return fn ? this.bind( name, fn ) : this.trigger( name );
+ };
+
+ if ( jQuery.attrFn ) {
+ jQuery.attrFn[ name ] = true;
+ }
+});
+
+// Prevent memory leaks in IE
+// Window isn't included so as not to unbind existing unload events
+// More info:
+// - http://isaacschlueter.com/2006/10/msie-memory-leaks/
+if ( window.attachEvent && !window.addEventListener ) {
+ window.attachEvent("onunload", function() {
+ for ( var id in jQuery.cache ) {
+ if ( jQuery.cache[ id ].handle ) {
+ // Try/Catch is to handle iframes being unloaded, see #4280
+ try {
+ jQuery.event.remove( jQuery.cache[ id ].handle.elem );
+ } catch(e) {}
+ }
+ }
+ });
+}
+/*!
+ * Sizzle CSS Selector Engine - v1.0
+ * Copyright 2009, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ * More information: http://sizzlejs.com/
+ */
+(function(){
+
+var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
+ done = 0,
+ toString = Object.prototype.toString,
+ hasDuplicate = false,
+ baseHasDuplicate = true;
+
+// Here we check if the JavaScript engine is using some sort of
+// optimization where it does not always call our comparision
+// function. If that is the case, discard the hasDuplicate value.
+// Thus far that includes Google Chrome.
+[0, 0].sort(function(){
+ baseHasDuplicate = false;
+ return 0;
+});
+
+var Sizzle = function(selector, context, results, seed) {
+ results = results || [];
+ var origContext = context = context || document;
+
+ if ( context.nodeType !== 1 && context.nodeType !== 9 ) {
+ return [];
+ }
+
+ if ( !selector || typeof selector !== "string" ) {
+ return results;
+ }
+
+ var parts = [], m, set, checkSet, extra, prune = true, contextXML = isXML(context),
+ soFar = selector;
+
+ // Reset the position of the chunker regexp (start from head)
+ while ( (chunker.exec(""), m = chunker.exec(soFar)) !== null ) {
+ soFar = m[3];
+
+ parts.push( m[1] );
+
+ if ( m[2] ) {
+ extra = m[3];
+ break;
+ }
+ }
+
+ if ( parts.length > 1 && origPOS.exec( selector ) ) {
+ if ( parts.length === 2 && Expr.relative[ parts[0] ] ) {
+ set = posProcess( parts[0] + parts[1], context );
+ } else {
+ set = Expr.relative[ parts[0] ] ?
+ [ context ] :
+ Sizzle( parts.shift(), context );
+
+ while ( parts.length ) {
+ selector = parts.shift();
+
+ if ( Expr.relative[ selector ] ) {
+ selector += parts.shift();
+ }
+
+ set = posProcess( selector, set );
+ }
+ }
+ } else {
+ // Take a shortcut and set the context if the root selector is an ID
+ // (but not if it'll be faster if the inner selector is an ID)
+ if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML &&
+ Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) {
+ var ret = Sizzle.find( parts.shift(), context, contextXML );
+ context = ret.expr ? Sizzle.filter( ret.expr, ret.set )[0] : ret.set[0];
+ }
+
+ if ( context ) {
+ var ret = seed ?
+ { expr: parts.pop(), set: makeArray(seed) } :
+ Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML );
+ set = ret.expr ? Sizzle.filter( ret.expr, ret.set ) : ret.set;
+
+ if ( parts.length > 0 ) {
+ checkSet = makeArray(set);
+ } else {
+ prune = false;
+ }
+
+ while ( parts.length ) {
+ var cur = parts.pop(), pop = cur;
+
+ if ( !Expr.relative[ cur ] ) {
+ cur = "";
+ } else {
+ pop = parts.pop();
+ }
+
+ if ( pop == null ) {
+ pop = context;
+ }
+
+ Expr.relative[ cur ]( checkSet, pop, contextXML );
+ }
+ } else {
+ checkSet = parts = [];
+ }
+ }
+
+ if ( !checkSet ) {
+ checkSet = set;
+ }
+
+ if ( !checkSet ) {
+ Sizzle.error( cur || selector );
+ }
+
+ if ( toString.call(checkSet) === "[object Array]" ) {
+ if ( !prune ) {
+ results.push.apply( results, checkSet );
+ } else if ( context && context.nodeType === 1 ) {
+ for ( var i = 0; checkSet[i] != null; i++ ) {
+ if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) {
+ results.push( set[i] );
+ }
+ }
+ } else {
+ for ( var i = 0; checkSet[i] != null; i++ ) {
+ if ( checkSet[i] && checkSet[i].nodeType === 1 ) {
+ results.push( set[i] );
+ }
+ }
+ }
+ } else {
+ makeArray( checkSet, results );
+ }
+
+ if ( extra ) {
+ Sizzle( extra, origContext, results, seed );
+ Sizzle.uniqueSort( results );
+ }
+
+ return results;
+};
+
+Sizzle.uniqueSort = function(results){
+ if ( sortOrder ) {
+ hasDuplicate = baseHasDuplicate;
+ results.sort(sortOrder);
+
+ if ( hasDuplicate ) {
+ for ( var i = 1; i < results.length; i++ ) {
+ if ( results[i] === results[i-1] ) {
+ results.splice(i--, 1);
}
}
}
@@ -1557,9 +2796,10 @@ Sizzle.find = function(expr, context, isXML){
for ( var i = 0, l = Expr.order.length; i < l; i++ ) {
var type = Expr.order[i], match;
-
- if ( (match = Expr.match[ type ].exec( expr )) ) {
- var left = RegExp.leftContext;
+
+ if ( (match = Expr.leftMatch[ type ].exec( expr )) ) {
+ var left = match[1];
+ match.splice(1,1);
if ( left.substr( left.length - 1 ) !== "\\" ) {
match[1] = (match[1] || "").replace(/\\/g, "");
@@ -1585,11 +2825,17 @@ Sizzle.filter = function(expr, set, inplace, not){
while ( expr && set.length ) {
for ( var type in Expr.filter ) {
- if ( (match = Expr.match[ type ].exec( expr )) != null ) {
- var filter = Expr.filter[ type ], found, item;
+ if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) {
+ var filter = Expr.filter[ type ], found, item, left = match[1];
anyFound = false;
- if ( curLoop == result ) {
+ match.splice(1,1);
+
+ if ( left.substr( left.length - 1 ) === "\\" ) {
+ continue;
+ }
+
+ if ( curLoop === result ) {
result = [];
}
@@ -1640,9 +2886,9 @@ Sizzle.filter = function(expr, set, inplace, not){
}
// Improper expression
- if ( expr == old ) {
+ if ( expr === old ) {
if ( anyFound == null ) {
- throw "Syntax error, unrecognized expression: " + expr;
+ Sizzle.error( expr );
} else {
break;
}
@@ -1654,18 +2900,23 @@ Sizzle.filter = function(expr, set, inplace, not){
return curLoop;
};
+Sizzle.error = function( msg ) {
+ throw "Syntax error, unrecognized expression: " + msg;
+};
+
var Expr = Sizzle.selectors = {
order: [ "ID", "NAME", "TAG" ],
match: {
- ID: /#((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,
- CLASS: /\.((?:[\w\u00c0-\uFFFF_-]|\\.)+)/,
- NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF_-]|\\.)+)['"]*\]/,
- ATTR: /\[\s*((?:[\w\u00c0-\uFFFF_-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,
- TAG: /^((?:[\w\u00c0-\uFFFF\*_-]|\\.)+)/,
+ ID: /#((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
+ CLASS: /\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
+ NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/,
+ ATTR: /\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,
+ TAG: /^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/,
CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,
POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,
- PSEUDO: /:((?:[\w\u00c0-\uFFFF_-]|\\.)+)(?:\((['"]*)((?:\([^\)]+\)|[^\2\(\)]*)+)\2\))?/
+ PSEUDO: /:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/
},
+ leftMatch: {},
attrMap: {
"class": "className",
"for": "htmlFor"
@@ -1676,20 +2927,20 @@ var Expr = Sizzle.selectors = {
}
},
relative: {
- "+": function(checkSet, part, isXML){
+ "+": function(checkSet, part){
var isPartStr = typeof part === "string",
isTag = isPartStr && !/\W/.test(part),
isPartStrNotTag = isPartStr && !isTag;
- if ( isTag && !isXML ) {
- part = part.toUpperCase();
+ if ( isTag ) {
+ part = part.toLowerCase();
}
for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) {
if ( (elem = checkSet[i]) ) {
while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {}
- checkSet[i] = isPartStrNotTag || elem && elem.nodeName === part ?
+ checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ?
elem || false :
elem === part;
}
@@ -1699,17 +2950,17 @@ var Expr = Sizzle.selectors = {
Sizzle.filter( part, checkSet, true );
}
},
- ">": function(checkSet, part, isXML){
+ ">": function(checkSet, part){
var isPartStr = typeof part === "string";
if ( isPartStr && !/\W/.test(part) ) {
- part = isXML ? part : part.toUpperCase();
+ part = part.toLowerCase();
for ( var i = 0, l = checkSet.length; i < l; i++ ) {
var elem = checkSet[i];
if ( elem ) {
var parent = elem.parentNode;
- checkSet[i] = parent.nodeName === part ? parent : false;
+ checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false;
}
}
} else {
@@ -1730,8 +2981,8 @@ var Expr = Sizzle.selectors = {
"": function(checkSet, part, isXML){
var doneName = done++, checkFn = dirCheck;
- if ( !part.match(/\W/) ) {
- var nodeCheck = part = isXML ? part : part.toUpperCase();
+ if ( typeof part === "string" && !/\W/.test(part) ) {
+ var nodeCheck = part = part.toLowerCase();
checkFn = dirNodeCheck;
}
@@ -1740,8 +2991,8 @@ var Expr = Sizzle.selectors = {
"~": function(checkSet, part, isXML){
var doneName = done++, checkFn = dirCheck;
- if ( typeof part === "string" && !part.match(/\W/) ) {
- var nodeCheck = part = isXML ? part : part.toUpperCase();
+ if ( typeof part === "string" && !/\W/.test(part) ) {
+ var nodeCheck = part = part.toLowerCase();
checkFn = dirNodeCheck;
}
@@ -1755,7 +3006,7 @@ var Expr = Sizzle.selectors = {
return m ? [m] : [];
}
},
- NAME: function(match, context, isXML){
+ NAME: function(match, context){
if ( typeof context.getElementsByName !== "undefined" ) {
var ret = [], results = context.getElementsByName(match[1]);
@@ -1782,9 +3033,10 @@ var Expr = Sizzle.selectors = {
for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) {
if ( elem ) {
- if ( not ^ (elem.className && (" " + elem.className + " ").indexOf(match) >= 0) ) {
- if ( !inplace )
+ if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n]/g, " ").indexOf(match) >= 0) ) {
+ if ( !inplace ) {
result.push( elem );
+ }
} else if ( inplace ) {
curLoop[i] = false;
}
@@ -1797,14 +3049,13 @@ var Expr = Sizzle.selectors = {
return match[1].replace(/\\/g, "");
},
TAG: function(match, curLoop){
- for ( var i = 0; curLoop[i] === false; i++ ){}
- return curLoop[i] && isXML(curLoop[i]) ? match[1] : match[1].toUpperCase();
+ return match[1].toLowerCase();
},
CHILD: function(match){
- if ( match[1] == "nth" ) {
+ if ( match[1] === "nth" ) {
// parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6'
var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec(
- match[2] == "even" && "2n" || match[2] == "odd" && "2n+1" ||
+ match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" ||
!/\D/.test( match[2] ) && "0n+" + match[2] || match[2]);
// calculate the numbers (first)n+(last) including if they are negative
@@ -1819,7 +3070,7 @@ var Expr = Sizzle.selectors = {
},
ATTR: function(match, curLoop, inplace, result, not, isXML){
var name = match[1].replace(/\\/g, "");
-
+
if ( !isXML && Expr.attrMap[name] ) {
match[1] = Expr.attrMap[name];
}
@@ -1833,7 +3084,7 @@ var Expr = Sizzle.selectors = {
PSEUDO: function(match, curLoop, inplace, result, not){
if ( match[1] === "not" ) {
// If we're dealing with a complex expression, or a simple one
- if ( match[3].match(chunker).length > 1 || /^\w/.test(match[3]) ) {
+ if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) {
match[3] = Sizzle(match[3], null, null, curLoop);
} else {
var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not);
@@ -1845,7 +3096,7 @@ var Expr = Sizzle.selectors = {
} else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) {
return true;
}
-
+
return match;
},
POS: function(match){
@@ -1906,7 +3157,7 @@ var Expr = Sizzle.selectors = {
return "reset" === elem.type;
},
button: function(elem){
- return "button" === elem.type || elem.nodeName.toUpperCase() === "BUTTON";
+ return "button" === elem.type || elem.nodeName.toLowerCase() === "button";
},
input: function(elem){
return /input|select|textarea|button/i.test(elem.nodeName);
@@ -1932,10 +3183,10 @@ var Expr = Sizzle.selectors = {
return i > match[3] - 0;
},
nth: function(elem, i, match){
- return match[3] - 0 == i;
+ return match[3] - 0 === i;
},
eq: function(elem, i, match){
- return match[3] - 0 == i;
+ return match[3] - 0 === i;
}
},
filter: {
@@ -1945,7 +3196,7 @@ var Expr = Sizzle.selectors = {
if ( filter ) {
return filter( elem, i, match, array );
} else if ( name === "contains" ) {
- return (elem.textContent || elem.innerText || "").indexOf(match[3]) >= 0;
+ return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0;
} else if ( name === "not" ) {
var not = match[3];
@@ -1956,6 +3207,8 @@ var Expr = Sizzle.selectors = {
}
return true;
+ } else {
+ Sizzle.error( "Syntax error, unrecognized expression: " + name );
}
},
CHILD: function(elem, match){
@@ -1963,41 +3216,47 @@ var Expr = Sizzle.selectors = {
switch (type) {
case 'only':
case 'first':
- while (node = node.previousSibling) {
- if ( node.nodeType === 1 ) return false;
+ while ( (node = node.previousSibling) ) {
+ if ( node.nodeType === 1 ) {
+ return false;
+ }
+ }
+ if ( type === "first" ) {
+ return true;
}
- if ( type == 'first') return true;
node = elem;
case 'last':
- while (node = node.nextSibling) {
- if ( node.nodeType === 1 ) return false;
+ while ( (node = node.nextSibling) ) {
+ if ( node.nodeType === 1 ) {
+ return false;
+ }
}
return true;
case 'nth':
var first = match[2], last = match[3];
- if ( first == 1 && last == 0 ) {
+ if ( first === 1 && last === 0 ) {
return true;
}
-
+
var doneName = match[0],
parent = elem.parentNode;
-
+
if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) {
var count = 0;
for ( node = parent.firstChild; node; node = node.nextSibling ) {
if ( node.nodeType === 1 ) {
node.nodeIndex = ++count;
}
- }
+ }
parent.sizcache = doneName;
}
-
+
var diff = elem.nodeIndex - last;
- if ( first == 0 ) {
- return diff == 0;
+ if ( first === 0 ) {
+ return diff === 0;
} else {
- return ( diff % first == 0 && diff / first >= 0 );
+ return ( diff % first === 0 && diff / first >= 0 );
}
}
},
@@ -2005,7 +3264,7 @@ var Expr = Sizzle.selectors = {
return elem.nodeType === 1 && elem.getAttribute("id") === match;
},
TAG: function(elem, match){
- return (match === "*" && elem.nodeType === 1) || elem.nodeName === match;
+ return (match === "*" && elem.nodeType === 1) || elem.nodeName.toLowerCase() === match;
},
CLASS: function(elem, match){
return (" " + (elem.className || elem.getAttribute("class")) + " ")
@@ -2033,7 +3292,7 @@ var Expr = Sizzle.selectors = {
!check ?
value && result !== false :
type === "!=" ?
- value != check :
+ value !== check :
type === "^=" ?
value.indexOf(check) === 0 :
type === "$=" ?
@@ -2055,24 +3314,29 @@ var Expr = Sizzle.selectors = {
var origPOS = Expr.match.POS;
for ( var type in Expr.match ) {
- Expr.match[ type ] = RegExp( Expr.match[ type ].source + /(?![^\[]*\])(?![^\(]*\))/.source );
+ Expr.match[ type ] = new RegExp( Expr.match[ type ].source + /(?![^\[]*\])(?![^\(]*\))/.source );
+ Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, function(all, num){
+ return "\\" + (num - 0 + 1);
+ }));
}
var makeArray = function(array, results) {
- array = Array.prototype.slice.call( array );
+ array = Array.prototype.slice.call( array, 0 );
if ( results ) {
results.push.apply( results, array );
return results;
}
-
+
return array;
};
// Perform a simple check to determine if the browser is capable of
// converting a NodeList to an array using builtin methods.
+// Also verifies that the returned array holds DOM nodes
+// (which is not the case in the Blackberry browser)
try {
- Array.prototype.slice.call( document.documentElement.childNodes );
+ Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType;
// Provide a fallback method if it does not work
} catch(e){
@@ -2101,6 +3365,13 @@ var sortOrder;
if ( document.documentElement.compareDocumentPosition ) {
sortOrder = function( a, b ) {
+ if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) {
+ if ( a == b ) {
+ hasDuplicate = true;
+ }
+ return a.compareDocumentPosition ? -1 : 1;
+ }
+
var ret = a.compareDocumentPosition(b) & 4 ? -1 : a === b ? 0 : 1;
if ( ret === 0 ) {
hasDuplicate = true;
@@ -2109,6 +3380,13 @@ if ( document.documentElement.compareDocumentPosition ) {
};
} else if ( "sourceIndex" in document.documentElement ) {
sortOrder = function( a, b ) {
+ if ( !a.sourceIndex || !b.sourceIndex ) {
+ if ( a == b ) {
+ hasDuplicate = true;
+ }
+ return a.sourceIndex ? -1 : 1;
+ }
+
var ret = a.sourceIndex - b.sourceIndex;
if ( ret === 0 ) {
hasDuplicate = true;
@@ -2117,11 +3395,18 @@ if ( document.documentElement.compareDocumentPosition ) {
};
} else if ( document.createRange ) {
sortOrder = function( a, b ) {
+ if ( !a.ownerDocument || !b.ownerDocument ) {
+ if ( a == b ) {
+ hasDuplicate = true;
+ }
+ return a.ownerDocument ? -1 : 1;
+ }
+
var aRange = a.ownerDocument.createRange(), bRange = b.ownerDocument.createRange();
- aRange.selectNode(a);
- aRange.collapse(true);
- bRange.selectNode(b);
- bRange.collapse(true);
+ aRange.setStart(a, 0);
+ aRange.setEnd(a, 0);
+ bRange.setStart(b, 0);
+ bRange.setEnd(b, 0);
var ret = aRange.compareBoundaryPoints(Range.START_TO_END, bRange);
if ( ret === 0 ) {
hasDuplicate = true;
@@ -2130,13 +3415,33 @@ if ( document.documentElement.compareDocumentPosition ) {
};
}
+// Utility function for retreiving the text value of an array of DOM nodes
+function getText( elems ) {
+ var ret = "", elem;
+
+ for ( var i = 0; elems[i]; i++ ) {
+ elem = elems[i];
+
+ // Get the text from text nodes and CDATA nodes
+ if ( elem.nodeType === 3 || elem.nodeType === 4 ) {
+ ret += elem.nodeValue;
+
+ // Traverse everything else, except comment nodes
+ } else if ( elem.nodeType !== 8 ) {
+ ret += getText( elem.childNodes );
+ }
+ }
+
+ return ret;
+}
+
// Check to see if the browser returns elements by name when
// querying by getElementById (and provide a workaround)
(function(){
// We're going to inject a fake input element with a specified name
- var form = document.createElement("form"),
+ var form = document.createElement("div"),
id = "script" + (new Date).getTime();
- form.innerHTML = "<input name='" + id + "'/>";
+ form.innerHTML = "<a name='" + id + "'/>";
// Inject it into the root element, check its status, and remove it quickly
var root = document.documentElement;
@@ -2144,7 +3449,7 @@ if ( document.documentElement.compareDocumentPosition ) {
// The workaround has to do additional checks after a getElementById
// Which slows things down for other browsers (hence the branching)
- if ( !!document.getElementById( id ) ) {
+ if ( document.getElementById( id ) ) {
Expr.find.ID = function(match, context, isXML){
if ( typeof context.getElementById !== "undefined" && !isXML ) {
var m = context.getElementById(match[1]);
@@ -2159,6 +3464,7 @@ if ( document.documentElement.compareDocumentPosition ) {
}
root.removeChild( form );
+ root = form = null; // release memory in IE
})();
(function(){
@@ -2199,69 +3505,75 @@ if ( document.documentElement.compareDocumentPosition ) {
return elem.getAttribute("href", 2);
};
}
-})();
-
-if ( document.querySelectorAll ) (function(){
- var oldSizzle = Sizzle, div = document.createElement("div");
- div.innerHTML = "<p class='TEST'></p>";
- // Safari can't handle uppercase or unicode characters when
- // in quirks mode.
- if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) {
- return;
- }
+ div = null; // release memory in IE
+})();
- Sizzle = function(query, context, extra, seed){
- context = context || document;
+if ( document.querySelectorAll ) {
+ (function(){
+ var oldSizzle = Sizzle, div = document.createElement("div");
+ div.innerHTML = "<p class='TEST'></p>";
- // Only use querySelectorAll on non-XML documents
- // (ID selectors don't work in non-HTML documents)
- if ( !seed && context.nodeType === 9 && !isXML(context) ) {
- try {
- return makeArray( context.querySelectorAll(query), extra );
- } catch(e){}
+ // Safari can't handle uppercase or unicode characters when
+ // in quirks mode.
+ if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) {
+ return;
}
+
+ Sizzle = function(query, context, extra, seed){
+ context = context || document;
+
+ // Only use querySelectorAll on non-XML documents
+ // (ID selectors don't work in non-HTML documents)
+ if ( !seed && context.nodeType === 9 && !isXML(context) ) {
+ try {
+ return makeArray( context.querySelectorAll(query), extra );
+ } catch(e){}
+ }
+
+ return oldSizzle(query, context, extra, seed);
+ };
- return oldSizzle(query, context, extra, seed);
- };
+ for ( var prop in oldSizzle ) {
+ Sizzle[ prop ] = oldSizzle[ prop ];
+ }
- Sizzle.find = oldSizzle.find;
- Sizzle.filter = oldSizzle.filter;
- Sizzle.selectors = oldSizzle.selectors;
- Sizzle.matches = oldSizzle.matches;
-})();
+ div = null; // release memory in IE
+ })();
+}
-if ( document.getElementsByClassName && document.documentElement.getElementsByClassName ) (function(){
+(function(){
var div = document.createElement("div");
+
div.innerHTML = "<div class='test e'></div><div class='test'></div>";
// Opera can't find a second classname (in 9.6)
- if ( div.getElementsByClassName("e").length === 0 )
+ // Also, make sure that getElementsByClassName actually exists
+ if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) {
return;
+ }
// Safari caches class attributes, doesn't catch changes (in 3.2)
div.lastChild.className = "e";
- if ( div.getElementsByClassName("e").length === 1 )
+ if ( div.getElementsByClassName("e").length === 1 ) {
return;
-
+ }
+
Expr.order.splice(1, 0, "CLASS");
Expr.find.CLASS = function(match, context, isXML) {
if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) {
return context.getElementsByClassName(match[1]);
}
};
+
+ div = null; // release memory in IE
})();
function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
- var sibDir = dir == "previousSibling" && !isXML;
for ( var i = 0, l = checkSet.length; i < l; i++ ) {
var elem = checkSet[i];
if ( elem ) {
- if ( sibDir && elem.nodeType === 1 ){
- elem.sizcache = doneName;
- elem.sizset = i;
- }
elem = elem[dir];
var match = false;
@@ -2276,7 +3588,7 @@ function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
elem.sizset = i;
}
- if ( elem.nodeName === cur ) {
+ if ( elem.nodeName.toLowerCase() === cur ) {
match = elem;
break;
}
@@ -2290,14 +3602,9 @@ function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
}
function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
- var sibDir = dir == "previousSibling" && !isXML;
for ( var i = 0, l = checkSet.length; i < l; i++ ) {
var elem = checkSet[i];
if ( elem ) {
- if ( sibDir && elem.nodeType === 1 ) {
- elem.sizcache = doneName;
- elem.sizset = i;
- }
elem = elem[dir];
var match = false;
@@ -2332,15 +3639,17 @@ function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) {
}
}
-var contains = document.compareDocumentPosition ? function(a, b){
- return a.compareDocumentPosition(b) & 16;
+var contains = document.compareDocumentPosition ? function(a, b){
+ return !!(a.compareDocumentPosition(b) & 16);
} : function(a, b){
return a !== b && (a.contains ? a.contains(b) : true);
};
var isXML = function(elem){
- return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" ||
- !!elem.ownerDocument && isXML( elem.ownerDocument );
+ // documentElement is verified for cases where it doesn't yet exist
+ // (such as loading iframes in IE - #4833)
+ var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement;
+ return documentElement ? documentElement.nodeName !== "HTML" : false;
};
var posProcess = function(selector, context){
@@ -2365,872 +3674,1122 @@ var posProcess = function(selector, context){
// EXPOSE
jQuery.find = Sizzle;
-jQuery.filter = Sizzle.filter;
jQuery.expr = Sizzle.selectors;
jQuery.expr[":"] = jQuery.expr.filters;
+jQuery.unique = Sizzle.uniqueSort;
+jQuery.text = getText;
+jQuery.isXMLDoc = isXML;
+jQuery.contains = contains;
-Sizzle.selectors.filters.hidden = function(elem){
- return elem.offsetWidth === 0 || elem.offsetHeight === 0;
-};
+return;
-Sizzle.selectors.filters.visible = function(elem){
- return elem.offsetWidth > 0 || elem.offsetHeight > 0;
-};
+window.Sizzle = Sizzle;
-Sizzle.selectors.filters.animated = function(elem){
- return jQuery.grep(jQuery.timers, function(fn){
- return elem === fn.elem;
- }).length;
-};
+})();
+var runtil = /Until$/,
+ rparentsprev = /^(?:parents|prevUntil|prevAll)/,
+ // Note: This RegExp should be improved, or likely pulled from Sizzle
+ rmultiselector = /,/,
+ slice = Array.prototype.slice;
+
+// Implement the identical functionality for filter and not
+var winnow = function( elements, qualifier, keep ) {
+ if ( jQuery.isFunction( qualifier ) ) {
+ return jQuery.grep(elements, function( elem, i ) {
+ return !!qualifier.call( elem, i, elem ) === keep;
+ });
-jQuery.multiFilter = function( expr, elems, not ) {
- if ( not ) {
- expr = ":not(" + expr + ")";
- }
+ } else if ( qualifier.nodeType ) {
+ return jQuery.grep(elements, function( elem, i ) {
+ return (elem === qualifier) === keep;
+ });
- return Sizzle.matches(expr, elems);
-};
+ } else if ( typeof qualifier === "string" ) {
+ var filtered = jQuery.grep(elements, function( elem ) {
+ return elem.nodeType === 1;
+ });
-jQuery.dir = function( elem, dir ){
- var matched = [], cur = elem[dir];
- while ( cur && cur != document ) {
- if ( cur.nodeType == 1 )
- matched.push( cur );
- cur = cur[dir];
+ if ( isSimple.test( qualifier ) ) {
+ return jQuery.filter(qualifier, filtered, !keep);
+ } else {
+ qualifier = jQuery.filter( qualifier, filtered );
+ }
}
- return matched;
+
+ return jQuery.grep(elements, function( elem, i ) {
+ return (jQuery.inArray( elem, qualifier ) >= 0) === keep;
+ });
};
-jQuery.nth = function(cur, result, dir, elem){
- result = result || 1;
- var num = 0;
+jQuery.fn.extend({
+ find: function( selector ) {
+ var ret = this.pushStack( "", "find", selector ), length = 0;
+
+ for ( var i = 0, l = this.length; i < l; i++ ) {
+ length = ret.length;
+ jQuery.find( selector, this[i], ret );
+
+ if ( i > 0 ) {
+ // Make sure that the results are unique
+ for ( var n = length; n < ret.length; n++ ) {
+ for ( var r = 0; r < length; r++ ) {
+ if ( ret[r] === ret[n] ) {
+ ret.splice(n--, 1);
+ break;
+ }
+ }
+ }
+ }
+ }
- for ( ; cur; cur = cur[dir] )
- if ( cur.nodeType == 1 && ++num == result )
- break;
+ return ret;
+ },
- return cur;
-};
+ has: function( target ) {
+ var targets = jQuery( target );
+ return this.filter(function() {
+ for ( var i = 0, l = targets.length; i < l; i++ ) {
+ if ( jQuery.contains( this, targets[i] ) ) {
+ return true;
+ }
+ }
+ });
+ },
-jQuery.sibling = function(n, elem){
- var r = [];
+ not: function( selector ) {
+ return this.pushStack( winnow(this, selector, false), "not", selector);
+ },
- for ( ; n; n = n.nextSibling ) {
- if ( n.nodeType == 1 && n != elem )
- r.push( n );
- }
+ filter: function( selector ) {
+ return this.pushStack( winnow(this, selector, true), "filter", selector );
+ },
+
+ is: function( selector ) {
+ return !!selector && jQuery.filter( selector, this ).length > 0;
+ },
- return r;
-};
+ closest: function( selectors, context ) {
+ if ( jQuery.isArray( selectors ) ) {
+ var ret = [], cur = this[0], match, matches = {}, selector;
-return;
+ if ( cur && selectors.length ) {
+ for ( var i = 0, l = selectors.length; i < l; i++ ) {
+ selector = selectors[i];
-window.Sizzle = Sizzle;
+ if ( !matches[selector] ) {
+ matches[selector] = jQuery.expr.match.POS.test( selector ) ?
+ jQuery( selector, context || this.context ) :
+ selector;
+ }
+ }
-})();
-/*
- * A number of helper functions used for managing events.
- * Many of the ideas behind this code originated from
- * Dean Edwards' addEvent library.
- */
-jQuery.event = {
+ while ( cur && cur.ownerDocument && cur !== context ) {
+ for ( selector in matches ) {
+ match = matches[selector];
- // Bind an event to an element
- // Original by Dean Edwards
- add: function(elem, types, handler, data) {
- if ( elem.nodeType == 3 || elem.nodeType == 8 )
- return;
+ if ( match.jquery ? match.index(cur) > -1 : jQuery(cur).is(match) ) {
+ ret.push({ selector: selector, elem: cur });
+ delete matches[selector];
+ }
+ }
+ cur = cur.parentNode;
+ }
+ }
- // For whatever reason, IE has trouble passing the window object
- // around, causing it to be cloned in the process
- if ( elem.setInterval && elem != window )
- elem = window;
+ return ret;
+ }
- // Make sure that the function being executed has a unique ID
- if ( !handler.guid )
- handler.guid = this.guid++;
+ var pos = jQuery.expr.match.POS.test( selectors ) ?
+ jQuery( selectors, context || this.context ) : null;
- // if data is passed, bind to handler
- if ( data !== undefined ) {
- // Create temporary function pointer to original handler
- var fn = handler;
+ return this.map(function( i, cur ) {
+ while ( cur && cur.ownerDocument && cur !== context ) {
+ if ( pos ? pos.index(cur) > -1 : jQuery(cur).is(selectors) ) {
+ return cur;
+ }
+ cur = cur.parentNode;
+ }
+ return null;
+ });
+ },
+
+ // Determine the position of an element within
+ // the matched set of elements
+ index: function( elem ) {
+ if ( !elem || typeof elem === "string" ) {
+ return jQuery.inArray( this[0],
+ // If it receives a string, the selector is used
+ // If it receives nothing, the siblings are used
+ elem ? jQuery( elem ) : this.parent().children() );
+ }
+ // Locate the position of the desired element
+ return jQuery.inArray(
+ // If it receives a jQuery object, the first element is used
+ elem.jquery ? elem[0] : elem, this );
+ },
+
+ add: function( selector, context ) {
+ var set = typeof selector === "string" ?
+ jQuery( selector, context || this.context ) :
+ jQuery.makeArray( selector ),
+ all = jQuery.merge( this.get(), set );
+
+ return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ?
+ all :
+ jQuery.unique( all ) );
+ },
+
+ andSelf: function() {
+ return this.add( this.prevObject );
+ }
+});
- // Create unique handler function, wrapped around original handler
- handler = this.proxy( fn );
+// A painfully simple check to see if an element is disconnected
+// from a document (should be improved, where feasible).
+function isDisconnected( node ) {
+ return !node || !node.parentNode || node.parentNode.nodeType === 11;
+}
- // Store data in unique handler
- handler.data = data;
+jQuery.each({
+ parent: function( elem ) {
+ var parent = elem.parentNode;
+ return parent && parent.nodeType !== 11 ? parent : null;
+ },
+ parents: function( elem ) {
+ return jQuery.dir( elem, "parentNode" );
+ },
+ parentsUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "parentNode", until );
+ },
+ next: function( elem ) {
+ return jQuery.nth( elem, 2, "nextSibling" );
+ },
+ prev: function( elem ) {
+ return jQuery.nth( elem, 2, "previousSibling" );
+ },
+ nextAll: function( elem ) {
+ return jQuery.dir( elem, "nextSibling" );
+ },
+ prevAll: function( elem ) {
+ return jQuery.dir( elem, "previousSibling" );
+ },
+ nextUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "nextSibling", until );
+ },
+ prevUntil: function( elem, i, until ) {
+ return jQuery.dir( elem, "previousSibling", until );
+ },
+ siblings: function( elem ) {
+ return jQuery.sibling( elem.parentNode.firstChild, elem );
+ },
+ children: function( elem ) {
+ return jQuery.sibling( elem.firstChild );
+ },
+ contents: function( elem ) {
+ return jQuery.nodeName( elem, "iframe" ) ?
+ elem.contentDocument || elem.contentWindow.document :
+ jQuery.makeArray( elem.childNodes );
+ }
+}, function( name, fn ) {
+ jQuery.fn[ name ] = function( until, selector ) {
+ var ret = jQuery.map( this, fn, until );
+
+ if ( !runtil.test( name ) ) {
+ selector = until;
}
- // Init the element's event structure
- var events = jQuery.data(elem, "events") || jQuery.data(elem, "events", {}),
- handle = jQuery.data(elem, "handle") || jQuery.data(elem, "handle", function(){
- // Handle the second event of a trigger and when
- // an event is called after a page has unloaded
- return typeof jQuery !== "undefined" && !jQuery.event.triggered ?
- jQuery.event.handle.apply(arguments.callee.elem, arguments) :
- undefined;
- });
- // Add elem as a property of the handle function
- // This is to prevent a memory leak with non-native
- // event in IE.
- handle.elem = elem;
+ if ( selector && typeof selector === "string" ) {
+ ret = jQuery.filter( selector, ret );
+ }
- // Handle multiple events separated by a space
- // jQuery(...).bind("mouseover mouseout", fn);
- jQuery.each(types.split(/\s+/), function(index, type) {
- // Namespaced event handlers
- var namespaces = type.split(".");
- type = namespaces.shift();
- handler.type = namespaces.slice().sort().join(".");
+ ret = this.length > 1 ? jQuery.unique( ret ) : ret;
- // Get the current list of functions bound to this event
- var handlers = events[type];
+ if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) {
+ ret = ret.reverse();
+ }
- if ( jQuery.event.specialAll[type] )
- jQuery.event.specialAll[type].setup.call(elem, data, namespaces);
+ return this.pushStack( ret, name, slice.call(arguments).join(",") );
+ };
+});
- // Init the event handler queue
- if (!handlers) {
- handlers = events[type] = {};
+jQuery.extend({
+ filter: function( expr, elems, not ) {
+ if ( not ) {
+ expr = ":not(" + expr + ")";
+ }
- // Check for a special event handler
- // Only use addEventListener/attachEvent if the special
- // events handler returns false
- if ( !jQuery.event.special[type] || jQuery.event.special[type].setup.call(elem, data, namespaces) === false ) {
- // Bind the global event handler to the element
- if (elem.addEventListener)
- elem.addEventListener(type, handle, false);
- else if (elem.attachEvent)
- elem.attachEvent("on" + type, handle);
- }
+ return jQuery.find.matches(expr, elems);
+ },
+
+ dir: function( elem, dir, until ) {
+ var matched = [], cur = elem[dir];
+ while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) {
+ if ( cur.nodeType === 1 ) {
+ matched.push( cur );
}
+ cur = cur[dir];
+ }
+ return matched;
+ },
- // Add the function to the element's handler list
- handlers[handler.guid] = handler;
+ nth: function( cur, result, dir, elem ) {
+ result = result || 1;
+ var num = 0;
- // Keep track of which events have been used, for global triggering
- jQuery.event.global[type] = true;
- });
+ for ( ; cur; cur = cur[dir] ) {
+ if ( cur.nodeType === 1 && ++num === result ) {
+ break;
+ }
+ }
- // Nullify elem to prevent memory leaks in IE
- elem = null;
+ return cur;
},
- guid: 1,
- global: {},
+ sibling: function( n, elem ) {
+ var r = [];
- // Detach an event or set of events from an element
- remove: function(elem, types, handler) {
- // don't do events on text and comment nodes
- if ( elem.nodeType == 3 || elem.nodeType == 8 )
- return;
+ for ( ; n; n = n.nextSibling ) {
+ if ( n.nodeType === 1 && n !== elem ) {
+ r.push( n );
+ }
+ }
- var events = jQuery.data(elem, "events"), ret, index;
+ return r;
+ }
+});
+var rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g,
+ rleadingWhitespace = /^\s+/,
+ rxhtmlTag = /(<([\w:]+)[^>]*?)\/>/g,
+ rselfClosing = /^(?:area|br|col|embed|hr|img|input|link|meta|param)$/i,
+ rtagName = /<([\w:]+)/,
+ rtbody = /<tbody/i,
+ rhtml = /<|&#?\w+;/,
+ rnocache = /<script|<object|<embed|<option|<style/i,
+ rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, // checked="checked" or checked (html5)
+ fcloseTag = function( all, front, tag ) {
+ return rselfClosing.test( tag ) ?
+ all :
+ front + "></" + tag + ">";
+ },
+ wrapMap = {
+ option: [ 1, "<select multiple='multiple'>", "</select>" ],
+ legend: [ 1, "<fieldset>", "</fieldset>" ],
+ thead: [ 1, "<table>", "</table>" ],
+ tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+ td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+ col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ],
+ area: [ 1, "<map>", "</map>" ],
+ _default: [ 0, "", "" ]
+ };
- if ( events ) {
- // Unbind all events for the element
- if ( types === undefined || (typeof types === "string" && types.charAt(0) == ".") )
- for ( var type in events )
- this.remove( elem, type + (types || "") );
- else {
- // types is actually an event object here
- if ( types.type ) {
- handler = types.handler;
- types = types.type;
- }
+wrapMap.optgroup = wrapMap.option;
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
- // Handle multiple events seperated by a space
- // jQuery(...).unbind("mouseover mouseout", fn);
- jQuery.each(types.split(/\s+/), function(index, type){
- // Namespaced event handlers
- var namespaces = type.split(".");
- type = namespaces.shift();
- var namespace = RegExp("(^|\\.)" + namespaces.slice().sort().join(".*\\.") + "(\\.|$)");
-
- if ( events[type] ) {
- // remove the given handler for the given type
- if ( handler )
- delete events[type][handler.guid];
-
- // remove all handlers for the given type
- else
- for ( var handle in events[type] )
- // Handle the removal of namespaced events
- if ( namespace.test(events[type][handle].type) )
- delete events[type][handle];
-
- if ( jQuery.event.specialAll[type] )
- jQuery.event.specialAll[type].teardown.call(elem, namespaces);
-
- // remove generic event handler if no more handlers exist
- for ( ret in events[type] ) break;
- if ( !ret ) {
- if ( !jQuery.event.special[type] || jQuery.event.special[type].teardown.call(elem, namespaces) === false ) {
- if (elem.removeEventListener)
- elem.removeEventListener(type, jQuery.data(elem, "handle"), false);
- else if (elem.detachEvent)
- elem.detachEvent("on" + type, jQuery.data(elem, "handle"));
- }
- ret = null;
- delete events[type];
- }
- }
- });
- }
+// IE can't serialize <link> and <script> tags normally
+if ( !jQuery.support.htmlSerialize ) {
+ wrapMap._default = [ 1, "div<div>", "</div>" ];
+}
- // Remove the expando if it's no longer used
- for ( ret in events ) break;
- if ( !ret ) {
- var handle = jQuery.data( elem, "handle" );
- if ( handle ) handle.elem = null;
- jQuery.removeData( elem, "events" );
- jQuery.removeData( elem, "handle" );
- }
+jQuery.fn.extend({
+ text: function( text ) {
+ if ( jQuery.isFunction(text) ) {
+ return this.each(function(i) {
+ var self = jQuery(this);
+ self.text( text.call(this, i, self.text()) );
+ });
+ }
+
+ if ( typeof text !== "object" && text !== undefined ) {
+ return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) );
}
+
+ return jQuery.text( this );
},
- // bubbling is internal
- trigger: function( event, data, elem, bubbling ) {
- // Event object or event type
- var type = event.type || event;
+ wrapAll: function( html ) {
+ if ( jQuery.isFunction( html ) ) {
+ return this.each(function(i) {
+ jQuery(this).wrapAll( html.call(this, i) );
+ });
+ }
- if( !bubbling ){
- event = typeof event === "object" ?
- // jQuery.Event object
- event[expando] ? event :
- // Object literal
- jQuery.extend( jQuery.Event(type), event ) :
- // Just the event type (string)
- jQuery.Event(type);
+ if ( this[0] ) {
+ // The elements to wrap the target around
+ var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true);
- if ( type.indexOf("!") >= 0 ) {
- event.type = type = type.slice(0, -1);
- event.exclusive = true;
+ if ( this[0].parentNode ) {
+ wrap.insertBefore( this[0] );
}
- // Handle a global trigger
- if ( !elem ) {
- // Don't bubble custom events when global (to avoid too much overhead)
- event.stopPropagation();
- // Only trigger if we've ever bound an event for it
- if ( this.global[type] )
- jQuery.each( jQuery.cache, function(){
- if ( this.events && this.events[type] )
- jQuery.event.trigger( event, data, this.handle.elem );
- });
- }
+ wrap.map(function() {
+ var elem = this;
- // Handle triggering a single element
+ while ( elem.firstChild && elem.firstChild.nodeType === 1 ) {
+ elem = elem.firstChild;
+ }
- // don't do events on text and comment nodes
- if ( !elem || elem.nodeType == 3 || elem.nodeType == 8 )
- return undefined;
+ return elem;
+ }).append(this);
+ }
- // Clean up in case it is reused
- event.result = undefined;
- event.target = elem;
+ return this;
+ },
- // Clone the incoming data, if any
- data = jQuery.makeArray(data);
- data.unshift( event );
+ wrapInner: function( html ) {
+ if ( jQuery.isFunction( html ) ) {
+ return this.each(function(i) {
+ jQuery(this).wrapInner( html.call(this, i) );
+ });
}
- event.currentTarget = elem;
+ return this.each(function() {
+ var self = jQuery( this ), contents = self.contents();
- // Trigger the event, it is assumed that "handle" is a function
- var handle = jQuery.data(elem, "handle");
- if ( handle )
- handle.apply( elem, data );
+ if ( contents.length ) {
+ contents.wrapAll( html );
+
+ } else {
+ self.append( html );
+ }
+ });
+ },
+
+ wrap: function( html ) {
+ return this.each(function() {
+ jQuery( this ).wrapAll( html );
+ });
+ },
+
+ unwrap: function() {
+ return this.parent().each(function() {
+ if ( !jQuery.nodeName( this, "body" ) ) {
+ jQuery( this ).replaceWith( this.childNodes );
+ }
+ }).end();
+ },
+
+ append: function() {
+ return this.domManip(arguments, true, function( elem ) {
+ if ( this.nodeType === 1 ) {
+ this.appendChild( elem );
+ }
+ });
+ },
- // Handle triggering native .onfoo handlers (and on links since we don't call .click() for links)
- if ( (!elem[type] || (jQuery.nodeName(elem, 'a') && type == "click")) && elem["on"+type] && elem["on"+type].apply( elem, data ) === false )
- event.result = false;
+ prepend: function() {
+ return this.domManip(arguments, true, function( elem ) {
+ if ( this.nodeType === 1 ) {
+ this.insertBefore( elem, this.firstChild );
+ }
+ });
+ },
- // Trigger the native events (except for clicks on links)
- if ( !bubbling && elem[type] && !event.isDefaultPrevented() && !(jQuery.nodeName(elem, 'a') && type == "click") ) {
- this.triggered = true;
- try {
- elem[ type ]();
- // prevent IE from throwing an error for some hidden elements
- } catch (e) {}
+ before: function() {
+ if ( this[0] && this[0].parentNode ) {
+ return this.domManip(arguments, false, function( elem ) {
+ this.parentNode.insertBefore( elem, this );
+ });
+ } else if ( arguments.length ) {
+ var set = jQuery(arguments[0]);
+ set.push.apply( set, this.toArray() );
+ return this.pushStack( set, "before", arguments );
}
+ },
- this.triggered = false;
+ after: function() {
+ if ( this[0] && this[0].parentNode ) {
+ return this.domManip(arguments, false, function( elem ) {
+ this.parentNode.insertBefore( elem, this.nextSibling );
+ });
+ } else if ( arguments.length ) {
+ var set = this.pushStack( this, "after", arguments );
+ set.push.apply( set, jQuery(arguments[0]).toArray() );
+ return set;
+ }
+ },
+
+ // keepData is for internal use only--do not document
+ remove: function( selector, keepData ) {
+ for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
+ if ( !selector || jQuery.filter( selector, [ elem ] ).length ) {
+ if ( !keepData && elem.nodeType === 1 ) {
+ jQuery.cleanData( elem.getElementsByTagName("*") );
+ jQuery.cleanData( [ elem ] );
+ }
- if ( !event.isPropagationStopped() ) {
- var parent = elem.parentNode || elem.ownerDocument;
- if ( parent )
- jQuery.event.trigger(event, data, parent, true);
+ if ( elem.parentNode ) {
+ elem.parentNode.removeChild( elem );
+ }
+ }
}
+
+ return this;
},
- handle: function(event) {
- // returned undefined or false
- var all, handlers;
+ empty: function() {
+ for ( var i = 0, elem; (elem = this[i]) != null; i++ ) {
+ // Remove element nodes and prevent memory leaks
+ if ( elem.nodeType === 1 ) {
+ jQuery.cleanData( elem.getElementsByTagName("*") );
+ }
- event = arguments[0] = jQuery.event.fix( event || window.event );
- event.currentTarget = this;
+ // Remove any remaining nodes
+ while ( elem.firstChild ) {
+ elem.removeChild( elem.firstChild );
+ }
+ }
+
+ return this;
+ },
- // Namespaced event handlers
- var namespaces = event.type.split(".");
- event.type = namespaces.shift();
+ clone: function( events ) {
+ // Do the clone
+ var ret = this.map(function() {
+ if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) {
+ // IE copies events bound via attachEvent when
+ // using cloneNode. Calling detachEvent on the
+ // clone will also remove the events from the orignal
+ // In order to get around this, we use innerHTML.
+ // Unfortunately, this means some modifications to
+ // attributes in IE that are actually only stored
+ // as properties will not be copied (such as the
+ // the name attribute on an input).
+ var html = this.outerHTML, ownerDocument = this.ownerDocument;
+ if ( !html ) {
+ var div = ownerDocument.createElement("div");
+ div.appendChild( this.cloneNode(true) );
+ html = div.innerHTML;
+ }
- // Cache this now, all = true means, any handler
- all = !namespaces.length && !event.exclusive;
+ return jQuery.clean([html.replace(rinlinejQuery, "")
+ // Handle the case in IE 8 where action=/test/> self-closes a tag
+ .replace(/=([^="'>\s]+\/)>/g, '="$1">')
+ .replace(rleadingWhitespace, "")], ownerDocument)[0];
+ } else {
+ return this.cloneNode(true);
+ }
+ });
- var namespace = RegExp("(^|\\.)" + namespaces.slice().sort().join(".*\\.") + "(\\.|$)");
+ // Copy the events from the original to the clone
+ if ( events === true ) {
+ cloneCopyEvent( this, ret );
+ cloneCopyEvent( this.find("*"), ret.find("*") );
+ }
- handlers = ( jQuery.data(this, "events") || {} )[event.type];
+ // Return the cloned set
+ return ret;
+ },
- for ( var j in handlers ) {
- var handler = handlers[j];
+ html: function( value ) {
+ if ( value === undefined ) {
+ return this[0] && this[0].nodeType === 1 ?
+ this[0].innerHTML.replace(rinlinejQuery, "") :
+ null;
- // Filter the functions by class
- if ( all || namespace.test(handler.type) ) {
- // Pass in a reference to the handler function itself
- // So that we can later remove it
- event.handler = handler;
- event.data = handler.data;
+ // See if we can take a shortcut and just use innerHTML
+ } else if ( typeof value === "string" && !rnocache.test( value ) &&
+ (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) &&
+ !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) {
- var ret = handler.apply(this, arguments);
+ value = value.replace(rxhtmlTag, fcloseTag);
- if( ret !== undefined ){
- event.result = ret;
- if ( ret === false ) {
- event.preventDefault();
- event.stopPropagation();
+ try {
+ for ( var i = 0, l = this.length; i < l; i++ ) {
+ // Remove element nodes and prevent memory leaks
+ if ( this[i].nodeType === 1 ) {
+ jQuery.cleanData( this[i].getElementsByTagName("*") );
+ this[i].innerHTML = value;
}
}
- if( event.isImmediatePropagationStopped() )
- break;
-
+ // If using innerHTML throws an exception, use the fallback method
+ } catch(e) {
+ this.empty().append( value );
}
+
+ } else if ( jQuery.isFunction( value ) ) {
+ this.each(function(i){
+ var self = jQuery(this), old = self.html();
+ self.empty().append(function(){
+ return value.call( this, i, old );
+ });
+ });
+
+ } else {
+ this.empty().append( value );
}
+
+ return this;
},
- props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode metaKey newValue originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
+ replaceWith: function( value ) {
+ if ( this[0] && this[0].parentNode ) {
+ // Make sure that the elements are removed from the DOM before they are inserted
+ // this can help fix replacing a parent with child elements
+ if ( jQuery.isFunction( value ) ) {
+ return this.each(function(i) {
+ var self = jQuery(this), old = self.html();
+ self.replaceWith( value.call( this, i, old ) );
+ });
+ }
- fix: function(event) {
- if ( event[expando] )
- return event;
+ if ( typeof value !== "string" ) {
+ value = jQuery(value).detach();
+ }
- // store a copy of the original event object
- // and "clone" to set read-only properties
- var originalEvent = event;
- event = jQuery.Event( originalEvent );
+ return this.each(function() {
+ var next = this.nextSibling, parent = this.parentNode;
- for ( var i = this.props.length, prop; i; ){
- prop = this.props[ --i ];
- event[ prop ] = originalEvent[ prop ];
- }
+ jQuery(this).remove();
- // Fix target property, if necessary
- if ( !event.target )
- event.target = event.srcElement || document; // Fixes #1925 where srcElement might not be defined either
+ if ( next ) {
+ jQuery(next).before( value );
+ } else {
+ jQuery(parent).append( value );
+ }
+ });
+ } else {
+ return this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value );
+ }
+ },
- // check if target is a textnode (safari)
- if ( event.target.nodeType == 3 )
- event.target = event.target.parentNode;
+ detach: function( selector ) {
+ return this.remove( selector, true );
+ },
- // Add relatedTarget, if necessary
- if ( !event.relatedTarget && event.fromElement )
- event.relatedTarget = event.fromElement == event.target ? event.toElement : event.fromElement;
+ domManip: function( args, table, callback ) {
+ var results, first, value = args[0], scripts = [], fragment, parent;
- // Calculate pageX/Y if missing and clientX/Y available
- if ( event.pageX == null && event.clientX != null ) {
- var doc = document.documentElement, body = document.body;
- event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc.clientLeft || 0);
- event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc.clientTop || 0);
+ // We can't cloneNode fragments that contain checked, in WebKit
+ if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) {
+ return this.each(function() {
+ jQuery(this).domManip( args, table, callback, true );
+ });
}
- // Add which for key events
- if ( !event.which && ((event.charCode || event.charCode === 0) ? event.charCode : event.keyCode) )
- event.which = event.charCode || event.keyCode;
+ if ( jQuery.isFunction(value) ) {
+ return this.each(function(i) {
+ var self = jQuery(this);
+ args[0] = value.call(this, i, table ? self.html() : undefined);
+ self.domManip( args, table, callback );
+ });
+ }
- // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs)
- if ( !event.metaKey && event.ctrlKey )
- event.metaKey = event.ctrlKey;
+ if ( this[0] ) {
+ parent = value && value.parentNode;
- // Add which for click: 1 == left; 2 == middle; 3 == right
- // Note: button is not normalized, so don't use it
- if ( !event.which && event.button )
- event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) ));
+ // If we're in a fragment, just use that instead of building a new one
+ if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) {
+ results = { fragment: parent };
- return event;
- },
+ } else {
+ results = buildFragment( args, this, scripts );
+ }
+
+ fragment = results.fragment;
+
+ if ( fragment.childNodes.length === 1 ) {
+ first = fragment = fragment.firstChild;
+ } else {
+ first = fragment.firstChild;
+ }
- proxy: function( fn, proxy ){
- proxy = proxy || function(){ return fn.apply(this, arguments); };
- // Set the guid of unique handler to the same of original handler, so it can be removed
- proxy.guid = fn.guid = fn.guid || proxy.guid || this.guid++;
- // So proxy can be declared as an argument
- return proxy;
- },
+ if ( first ) {
+ table = table && jQuery.nodeName( first, "tr" );
+
+ for ( var i = 0, l = this.length; i < l; i++ ) {
+ callback.call(
+ table ?
+ root(this[i], first) :
+ this[i],
+ i > 0 || results.cacheable || this.length > 1 ?
+ fragment.cloneNode(true) :
+ fragment
+ );
+ }
+ }
- special: {
- ready: {
- // Make sure the ready event is setup
- setup: bindReady,
- teardown: function() {}
+ if ( scripts.length ) {
+ jQuery.each( scripts, evalScript );
+ }
}
- },
- specialAll: {
- live: {
- setup: function( selector, namespaces ){
- jQuery.event.add( this, namespaces[0], liveHandler );
- },
- teardown: function( namespaces ){
- if ( namespaces.length ) {
- var remove = 0, name = RegExp("(^|\\.)" + namespaces[0] + "(\\.|$)");
-
- jQuery.each( (jQuery.data(this, "events").live || {}), function(){
- if ( name.test(this.type) )
- remove++;
- });
+ return this;
- if ( remove < 1 )
- jQuery.event.remove( this, namespaces[0], liveHandler );
- }
- }
+ function root( elem, cur ) {
+ return jQuery.nodeName(elem, "table") ?
+ (elem.getElementsByTagName("tbody")[0] ||
+ elem.appendChild(elem.ownerDocument.createElement("tbody"))) :
+ elem;
}
}
-};
+});
-jQuery.Event = function( src ){
- // Allow instantiation without the 'new' keyword
- if( !this.preventDefault )
- return new jQuery.Event(src);
+function cloneCopyEvent(orig, ret) {
+ var i = 0;
- // Event object
- if( src && src.type ){
- this.originalEvent = src;
- this.type = src.type;
- // Event type
- }else
- this.type = src;
+ ret.each(function() {
+ if ( this.nodeName !== (orig[i] && orig[i].nodeName) ) {
+ return;
+ }
- // timeStamp is buggy for some events on Firefox(#3843)
- // So we won't rely on the native value
- this.timeStamp = now();
+ var oldData = jQuery.data( orig[i++] ), curData = jQuery.data( this, oldData ), events = oldData && oldData.events;
- // Mark it as fixed
- this[expando] = true;
-};
+ if ( events ) {
+ delete curData.handle;
+ curData.events = {};
-function returnFalse(){
- return false;
-}
-function returnTrue(){
- return true;
+ for ( var type in events ) {
+ for ( var handler in events[ type ] ) {
+ jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data );
+ }
+ }
+ }
+ });
}
-// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
-// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
-jQuery.Event.prototype = {
- preventDefault: function() {
- this.isDefaultPrevented = returnTrue;
+function buildFragment( args, nodes, scripts ) {
+ var fragment, cacheable, cacheresults,
+ doc = (nodes && nodes[0] ? nodes[0].ownerDocument || nodes[0] : document);
+
+ // Only cache "small" (1/2 KB) strings that are associated with the main document
+ // Cloning options loses the selected state, so don't cache them
+ // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment
+ // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache
+ if ( args.length === 1 && typeof args[0] === "string" && args[0].length < 512 && doc === document &&
+ !rnocache.test( args[0] ) && (jQuery.support.checkClone || !rchecked.test( args[0] )) ) {
+
+ cacheable = true;
+ cacheresults = jQuery.fragments[ args[0] ];
+ if ( cacheresults ) {
+ if ( cacheresults !== 1 ) {
+ fragment = cacheresults;
+ }
+ }
+ }
- var e = this.originalEvent;
- if( !e )
- return;
- // if preventDefault exists run it on the original event
- if (e.preventDefault)
- e.preventDefault();
- // otherwise set the returnValue property of the original event to false (IE)
- e.returnValue = false;
- },
- stopPropagation: function() {
- this.isPropagationStopped = returnTrue;
+ if ( !fragment ) {
+ fragment = doc.createDocumentFragment();
+ jQuery.clean( args, doc, fragment, scripts );
+ }
- var e = this.originalEvent;
- if( !e )
- return;
- // if stopPropagation exists run it on the original event
- if (e.stopPropagation)
- e.stopPropagation();
- // otherwise set the cancelBubble property of the original event to true (IE)
- e.cancelBubble = true;
- },
- stopImmediatePropagation:function(){
- this.isImmediatePropagationStopped = returnTrue;
- this.stopPropagation();
- },
- isDefaultPrevented: returnFalse,
- isPropagationStopped: returnFalse,
- isImmediatePropagationStopped: returnFalse
-};
-// Checks if an event happened on an element within another element
-// Used in jQuery.event.special.mouseenter and mouseleave handlers
-var withinElement = function(event) {
- // Check if mouse(over|out) are still within the same parent element
- var parent = event.relatedTarget;
- // Traverse up the tree
- while ( parent && parent != this )
- try { parent = parent.parentNode; }
- catch(e) { parent = this; }
-
- if( parent != this ){
- // set the correct event type
- event.type = event.data;
- // handle event if we actually just moused on to a non sub-element
- jQuery.event.handle.apply( this, arguments );
+ if ( cacheable ) {
+ jQuery.fragments[ args[0] ] = cacheresults ? fragment : 1;
}
-};
+
+ return { fragment: fragment, cacheable: cacheable };
+}
+
+jQuery.fragments = {};
jQuery.each({
- mouseover: 'mouseenter',
- mouseout: 'mouseleave'
-}, function( orig, fix ){
- jQuery.event.special[ fix ] = {
- setup: function(){
- jQuery.event.add( this, orig, withinElement, fix );
- },
- teardown: function(){
- jQuery.event.remove( this, orig, withinElement );
+ appendTo: "append",
+ prependTo: "prepend",
+ insertBefore: "before",
+ insertAfter: "after",
+ replaceAll: "replaceWith"
+}, function( name, original ) {
+ jQuery.fn[ name ] = function( selector ) {
+ var ret = [], insert = jQuery( selector ),
+ parent = this.length === 1 && this[0].parentNode;
+
+ if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) {
+ insert[ original ]( this[0] );
+ return this;
+
+ } else {
+ for ( var i = 0, l = insert.length; i < l; i++ ) {
+ var elems = (i > 0 ? this.clone(true) : this).get();
+ jQuery.fn[ original ].apply( jQuery(insert[i]), elems );
+ ret = ret.concat( elems );
+ }
+
+ return this.pushStack( ret, name, insert.selector );
}
};
});
-jQuery.fn.extend({
- bind: function( type, data, fn ) {
- return type == "unload" ? this.one(type, data, fn) : this.each(function(){
- jQuery.event.add( this, type, fn || data, fn && data );
- });
- },
+jQuery.extend({
+ clean: function( elems, context, fragment, scripts ) {
+ context = context || document;
- one: function( type, data, fn ) {
- var one = jQuery.event.proxy( fn || data, function(event) {
- jQuery(this).unbind(event, one);
- return (fn || data).apply( this, arguments );
- });
- return this.each(function(){
- jQuery.event.add( this, type, one, fn && data);
- });
- },
+ // !context.createElement fails in IE with an error but returns typeof 'object'
+ if ( typeof context.createElement === "undefined" ) {
+ context = context.ownerDocument || context[0] && context[0].ownerDocument || document;
+ }
- unbind: function( type, fn ) {
- return this.each(function(){
- jQuery.event.remove( this, type, fn );
- });
- },
+ var ret = [];
- trigger: function( type, data ) {
- return this.each(function(){
- jQuery.event.trigger( type, data, this );
- });
- },
+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+ if ( typeof elem === "number" ) {
+ elem += "";
+ }
- triggerHandler: function( type, data ) {
- if( this[0] ){
- var event = jQuery.Event(type);
- event.preventDefault();
- event.stopPropagation();
- jQuery.event.trigger( event, data, this[0] );
- return event.result;
- }
- },
+ if ( !elem ) {
+ continue;
+ }
- toggle: function( fn ) {
- // Save reference to arguments for access in closure
- var args = arguments, i = 1;
+ // Convert html string into DOM nodes
+ if ( typeof elem === "string" && !rhtml.test( elem ) ) {
+ elem = context.createTextNode( elem );
- // link all the functions, so any of them can unbind this click handler
- while( i < args.length )
- jQuery.event.proxy( fn, args[i++] );
+ } else if ( typeof elem === "string" ) {
+ // Fix "XHTML"-style tags in all browsers
+ elem = elem.replace(rxhtmlTag, fcloseTag);
- return this.click( jQuery.event.proxy( fn, function(event) {
- // Figure out which function to execute
- this.lastToggle = ( this.lastToggle || 0 ) % i;
+ // Trim whitespace, otherwise indexOf won't work as expected
+ var tag = (rtagName.exec( elem ) || ["", ""])[1].toLowerCase(),
+ wrap = wrapMap[ tag ] || wrapMap._default,
+ depth = wrap[0],
+ div = context.createElement("div");
- // Make sure that clicks stop
- event.preventDefault();
+ // Go to html and back, then peel off extra wrappers
+ div.innerHTML = wrap[1] + elem + wrap[2];
- // and execute the function
- return args[ this.lastToggle++ ].apply( this, arguments ) || false;
- }));
- },
+ // Move to the right depth
+ while ( depth-- ) {
+ div = div.lastChild;
+ }
+
+ // Remove IE's autoinserted <tbody> from table fragments
+ if ( !jQuery.support.tbody ) {
+
+ // String was a <table>, *may* have spurious <tbody>
+ var hasBody = rtbody.test(elem),
+ tbody = tag === "table" && !hasBody ?
+ div.firstChild && div.firstChild.childNodes :
- hover: function(fnOver, fnOut) {
- return this.mouseenter(fnOver).mouseleave(fnOut);
- },
+ // String was a bare <thead> or <tfoot>
+ wrap[1] === "<table>" && !hasBody ?
+ div.childNodes :
+ [];
- ready: function(fn) {
- // Attach the listeners
- bindReady();
+ for ( var j = tbody.length - 1; j >= 0 ; --j ) {
+ if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) {
+ tbody[ j ].parentNode.removeChild( tbody[ j ] );
+ }
+ }
- // If the DOM is already ready
- if ( jQuery.isReady )
- // Execute the function immediately
- fn.call( document, jQuery );
+ }
- // Otherwise, remember the function for later
- else
- // Add the function to the wait list
- jQuery.readyList.push( fn );
+ // IE completely kills leading whitespace when innerHTML is used
+ if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) {
+ div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild );
+ }
- return this;
- },
+ elem = div.childNodes;
+ }
- live: function( type, fn ){
- var proxy = jQuery.event.proxy( fn );
- proxy.guid += this.selector + type;
+ if ( elem.nodeType ) {
+ ret.push( elem );
+ } else {
+ ret = jQuery.merge( ret, elem );
+ }
+ }
- jQuery(document).bind( liveConvert(type, this.selector), this.selector, proxy );
+ if ( fragment ) {
+ for ( var i = 0; ret[i]; i++ ) {
+ if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) {
+ scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] );
+
+ } else {
+ if ( ret[i].nodeType === 1 ) {
+ ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) );
+ }
+ fragment.appendChild( ret[i] );
+ }
+ }
+ }
- return this;
+ return ret;
},
+
+ cleanData: function( elems ) {
+ var data, id, cache = jQuery.cache,
+ special = jQuery.event.special,
+ deleteExpando = jQuery.support.deleteExpando;
+
+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+ id = elem[ jQuery.expando ];
+
+ if ( id ) {
+ data = cache[ id ];
+
+ if ( data.events ) {
+ for ( var type in data.events ) {
+ if ( special[ type ] ) {
+ jQuery.event.remove( elem, type );
+
+ } else {
+ removeEvent( elem, type, data.handle );
+ }
+ }
+ }
+
+ if ( deleteExpando ) {
+ delete elem[ jQuery.expando ];
- die: function( type, fn ){
- jQuery(document).unbind( liveConvert(type, this.selector), fn ? { guid: fn.guid + this.selector + type } : null );
- return this;
+ } else if ( elem.removeAttribute ) {
+ elem.removeAttribute( jQuery.expando );
+ }
+
+ delete cache[ id ];
+ }
+ }
}
});
+// exclude the following css properties to add px
+var rexclude = /z-?index|font-?weight|opacity|zoom|line-?height/i,
+ ralpha = /alpha\([^)]*\)/,
+ ropacity = /opacity=([^)]*)/,
+ rfloat = /float/i,
+ rdashAlpha = /-([a-z])/ig,
+ rupper = /([A-Z])/g,
+ rnumpx = /^-?\d+(?:px)?$/i,
+ rnum = /^-?\d/,
+
+ cssShow = { position: "absolute", visibility: "hidden", display:"block" },
+ cssWidth = [ "Left", "Right" ],
+ cssHeight = [ "Top", "Bottom" ],
+
+ // cache check for defaultView.getComputedStyle
+ getComputedStyle = document.defaultView && document.defaultView.getComputedStyle,
+ // normalize float css property
+ styleFloat = jQuery.support.cssFloat ? "cssFloat" : "styleFloat",
+ fcamelCase = function( all, letter ) {
+ return letter.toUpperCase();
+ };
-function liveHandler( event ){
- var check = RegExp("(^|\\.)" + event.type + "(\\.|$)"),
- stop = true,
- elems = [];
-
- jQuery.each(jQuery.data(this, "events").live || [], function(i, fn){
- if ( check.test(fn.type) ) {
- var elem = jQuery(event.target).closest(fn.data)[0];
- if ( elem )
- elems.push({ elem: elem, fn: fn });
+jQuery.fn.css = function( name, value ) {
+ return access( this, name, value, true, function( elem, name, value ) {
+ if ( value === undefined ) {
+ return jQuery.curCSS( elem, name );
+ }
+
+ if ( typeof value === "number" && !rexclude.test(name) ) {
+ value += "px";
}
- });
-
- elems.sort(function(a,b) {
- return jQuery.data(a.elem, "closest") - jQuery.data(b.elem, "closest");
- });
- jQuery.each(elems, function(){
- if ( this.fn.call(this.elem, event, this.fn.data) === false )
- return (stop = false);
+ jQuery.style( elem, name, value );
});
+};
- return stop;
-}
+jQuery.extend({
+ style: function( elem, name, value ) {
+ // don't set styles on text and comment nodes
+ if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 ) {
+ return undefined;
+ }
-function liveConvert(type, selector){
- return ["live", type, selector.replace(/\./g, "`").replace(/ /g, "|")].join(".");
-}
+ // ignore negative width and height values #1599
+ if ( (name === "width" || name === "height") && parseFloat(value) < 0 ) {
+ value = undefined;
+ }
-jQuery.extend({
- isReady: false,
- readyList: [],
- // Handle when the DOM is ready
- ready: function() {
- // Make sure that the DOM is not already loaded
- if ( !jQuery.isReady ) {
- // Remember that the DOM is ready
- jQuery.isReady = true;
+ var style = elem.style || elem, set = value !== undefined;
- // If there are functions bound, to execute
- if ( jQuery.readyList ) {
- // Execute all of them
- jQuery.each( jQuery.readyList, function(){
- this.call( document, jQuery );
- });
+ // IE uses filters for opacity
+ if ( !jQuery.support.opacity && name === "opacity" ) {
+ if ( set ) {
+ // IE has trouble with opacity if it does not have layout
+ // Force it by setting the zoom level
+ style.zoom = 1;
- // Reset the list of functions
- jQuery.readyList = null;
+ // Set the alpha filter to set the opacity
+ var opacity = parseInt( value, 10 ) + "" === "NaN" ? "" : "alpha(opacity=" + value * 100 + ")";
+ var filter = style.filter || jQuery.curCSS( elem, "filter" ) || "";
+ style.filter = ralpha.test(filter) ? filter.replace(ralpha, opacity) : opacity;
}
- // Trigger any bound ready events
- jQuery(document).triggerHandler("ready");
+ return style.filter && style.filter.indexOf("opacity=") >= 0 ?
+ (parseFloat( ropacity.exec(style.filter)[1] ) / 100) + "":
+ "";
+ }
+
+ // Make sure we're using the right name for getting the float value
+ if ( rfloat.test( name ) ) {
+ name = styleFloat;
}
- }
-});
-var readyBound = false;
+ name = name.replace(rdashAlpha, fcamelCase);
-function bindReady(){
- if ( readyBound ) return;
- readyBound = true;
+ if ( set ) {
+ style[ name ] = value;
+ }
- // Mozilla, Opera and webkit nightlies currently support this event
- if ( document.addEventListener ) {
- // Use the handy event callback
- document.addEventListener( "DOMContentLoaded", function(){
- document.removeEventListener( "DOMContentLoaded", arguments.callee, false );
- jQuery.ready();
- }, false );
+ return style[ name ];
+ },
- // If IE event model is used
- } else if ( document.attachEvent ) {
- // ensure firing before onload,
- // maybe late but safe also for iframes
- document.attachEvent("onreadystatechange", function(){
- if ( document.readyState === "complete" ) {
- document.detachEvent( "onreadystatechange", arguments.callee );
- jQuery.ready();
- }
- });
+ css: function( elem, name, force, extra ) {
+ if ( name === "width" || name === "height" ) {
+ var val, props = cssShow, which = name === "width" ? cssWidth : cssHeight;
- // If IE and not an iframe
- // continually check to see if the document is ready
- if ( document.documentElement.doScroll && window == window.top ) (function(){
- if ( jQuery.isReady ) return;
+ function getWH() {
+ val = name === "width" ? elem.offsetWidth : elem.offsetHeight;
- try {
- // If IE is used, use the trick by Diego Perini
- // http://javascript.nwbox.com/IEContentLoaded/
- document.documentElement.doScroll("left");
- } catch( error ) {
- setTimeout( arguments.callee, 0 );
- return;
+ if ( extra === "border" ) {
+ return;
+ }
+
+ jQuery.each( which, function() {
+ if ( !extra ) {
+ val -= parseFloat(jQuery.curCSS( elem, "padding" + this, true)) || 0;
+ }
+
+ if ( extra === "margin" ) {
+ val += parseFloat(jQuery.curCSS( elem, "margin" + this, true)) || 0;
+ } else {
+ val -= parseFloat(jQuery.curCSS( elem, "border" + this + "Width", true)) || 0;
+ }
+ });
}
- // and execute any waiting functions
- jQuery.ready();
- })();
- }
+ if ( elem.offsetWidth !== 0 ) {
+ getWH();
+ } else {
+ jQuery.swap( elem, props, getWH );
+ }
- // A fallback to window.onload, that will always work
- jQuery.event.add( window, "load", jQuery.ready );
-}
+ return Math.max(0, Math.round(val));
+ }
-jQuery.each( ("blur,focus,load,resize,scroll,unload,click,dblclick," +
- "mousedown,mouseup,mousemove,mouseover,mouseout,mouseenter,mouseleave," +
- "change,select,submit,keydown,keypress,keyup,error").split(","), function(i, name){
+ return jQuery.curCSS( elem, name, force );
+ },
- // Handle event binding
- jQuery.fn[name] = function(fn){
- return fn ? this.bind(name, fn) : this.trigger(name);
- };
-});
+ curCSS: function( elem, name, force ) {
+ var ret, style = elem.style, filter;
-// Prevent memory leaks in IE
-// And prevent errors on refresh with events like mouseover in other browsers
-// Window isn't included so as not to unbind existing unload events
-jQuery( window ).bind( 'unload', function(){
- for ( var id in jQuery.cache )
- // Skip the window
- if ( id != 1 && jQuery.cache[ id ].handle )
- jQuery.event.remove( jQuery.cache[ id ].handle.elem );
-});
-(function(){
+ // IE uses filters for opacity
+ if ( !jQuery.support.opacity && name === "opacity" && elem.currentStyle ) {
+ ret = ropacity.test(elem.currentStyle.filter || "") ?
+ (parseFloat(RegExp.$1) / 100) + "" :
+ "";
- jQuery.support = {};
+ return ret === "" ?
+ "1" :
+ ret;
+ }
- var root = document.documentElement,
- script = document.createElement("script"),
- div = document.createElement("div"),
- id = "script" + (new Date).getTime();
+ // Make sure we're using the right name for getting the float value
+ if ( rfloat.test( name ) ) {
+ name = styleFloat;
+ }
- div.style.display = "none";
- div.innerHTML = ' <link/><table></table><a href="/a" style="color:red;float:left;opacity:.5;">a</a><select><option>text</option></select><object><param/></object>';
+ if ( !force && style && style[ name ] ) {
+ ret = style[ name ];
- var all = div.getElementsByTagName("*"),
- a = div.getElementsByTagName("a")[0];
+ } else if ( getComputedStyle ) {
- // Can't get basic test support
- if ( !all || !all.length || !a ) {
- return;
- }
+ // Only "float" is needed here
+ if ( rfloat.test( name ) ) {
+ name = "float";
+ }
- jQuery.support = {
- // IE strips leading whitespace when .innerHTML is used
- leadingWhitespace: div.firstChild.nodeType == 3,
+ name = name.replace( rupper, "-$1" ).toLowerCase();
- // Make sure that tbody elements aren't automatically inserted
- // IE will insert them into empty tables
- tbody: !div.getElementsByTagName("tbody").length,
+ var defaultView = elem.ownerDocument.defaultView;
- // Make sure that you can get all elements in an <object> element
- // IE 7 always returns no results
- objectAll: !!div.getElementsByTagName("object")[0]
- .getElementsByTagName("*").length,
+ if ( !defaultView ) {
+ return null;
+ }
- // Make sure that link elements get serialized correctly by innerHTML
- // This requires a wrapper element in IE
- htmlSerialize: !!div.getElementsByTagName("link").length,
+ var computedStyle = defaultView.getComputedStyle( elem, null );
- // Get the style information from getAttribute
- // (IE uses .cssText insted)
- style: /red/.test( a.getAttribute("style") ),
+ if ( computedStyle ) {
+ ret = computedStyle.getPropertyValue( name );
+ }
- // Make sure that URLs aren't manipulated
- // (IE normalizes it by default)
- hrefNormalized: a.getAttribute("href") === "/a",
+ // We should always get a number back from opacity
+ if ( name === "opacity" && ret === "" ) {
+ ret = "1";
+ }
- // Make sure that element opacity exists
- // (IE uses filter instead)
- opacity: a.style.opacity === "0.5",
+ } else if ( elem.currentStyle ) {
+ var camelCase = name.replace(rdashAlpha, fcamelCase);
- // Verify style float existence
- // (IE uses styleFloat instead of cssFloat)
- cssFloat: !!a.style.cssFloat,
+ ret = elem.currentStyle[ name ] || elem.currentStyle[ camelCase ];
- // Will be defined later
- scriptEval: false,
- noCloneEvent: true,
- boxModel: null
- };
+ // From the awesome hack by Dean Edwards
+ // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
- script.type = "text/javascript";
- try {
- script.appendChild( document.createTextNode( "window." + id + "=1;" ) );
- } catch(e){}
+ // If we're not dealing with a regular pixel number
+ // but a number that has a weird ending, we need to convert it to pixels
+ if ( !rnumpx.test( ret ) && rnum.test( ret ) ) {
+ // Remember the original values
+ var left = style.left, rsLeft = elem.runtimeStyle.left;
- root.insertBefore( script, root.firstChild );
+ // Put in the new values to get a computed value out
+ elem.runtimeStyle.left = elem.currentStyle.left;
+ style.left = camelCase === "fontSize" ? "1em" : (ret || 0);
+ ret = style.pixelLeft + "px";
- // Make sure that the execution of code works by injecting a script
- // tag with appendChild/createTextNode
- // (IE doesn't support this, fails, and uses .text instead)
- if ( window[ id ] ) {
- jQuery.support.scriptEval = true;
- delete window[ id ];
- }
+ // Revert the changed values
+ style.left = left;
+ elem.runtimeStyle.left = rsLeft;
+ }
+ }
- root.removeChild( script );
+ return ret;
+ },
- if ( div.attachEvent && div.fireEvent ) {
- div.attachEvent("onclick", function(){
- // Cloning a node shouldn't copy over any
- // bound event handlers (IE does this)
- jQuery.support.noCloneEvent = false;
- div.detachEvent("onclick", arguments.callee);
- });
- div.cloneNode(true).fireEvent("onclick");
+ // A method for quickly swapping in/out CSS properties to get correct calculations
+ swap: function( elem, options, callback ) {
+ var old = {};
+
+ // Remember the old values, and insert the new ones
+ for ( var name in options ) {
+ old[ name ] = elem.style[ name ];
+ elem.style[ name ] = options[ name ];
+ }
+
+ callback.call( elem );
+
+ // Revert the old values
+ for ( var name in options ) {
+ elem.style[ name ] = old[ name ];
+ }
}
+});
- // Figure out if the W3C box model works as expected
- // document.body must exist before we can do this
- jQuery(function(){
- var div = document.createElement("div");
- div.style.width = div.style.paddingLeft = "1px";
+if ( jQuery.expr && jQuery.expr.filters ) {
+ jQuery.expr.filters.hidden = function( elem ) {
+ var width = elem.offsetWidth, height = elem.offsetHeight,
+ skip = elem.nodeName.toLowerCase() === "tr";
- document.body.appendChild( div );
- jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2;
- document.body.removeChild( div ).style.display = 'none';
- });
-})();
+ return width === 0 && height === 0 && !skip ?
+ true :
+ width > 0 && height > 0 && !skip ?
+ false :
+ jQuery.curCSS(elem, "display") === "none";
+ };
-var styleFloat = jQuery.support.cssFloat ? "cssFloat" : "styleFloat";
+ jQuery.expr.filters.visible = function( elem ) {
+ return !jQuery.expr.filters.hidden( elem );
+ };
+}
+var jsc = now(),
+ rscript = /<script(.|\s)*?\/script>/gi,
+ rselectTextarea = /select|textarea/i,
+ rinput = /color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week/i,
+ jsre = /=\?(&|$)/,
+ rquery = /\?/,
+ rts = /(\?|&)_=.*?(&|$)/,
+ rurl = /^(\w+:)?\/\/([^\/?#]+)/,
+ r20 = /%20/g,
+
+ // Keep a copy of the old load method
+ _load = jQuery.fn.load;
-jQuery.props = {
- "for": "htmlFor",
- "class": "className",
- "float": styleFloat,
- cssFloat: styleFloat,
- styleFloat: styleFloat,
- readonly: "readOnly",
- maxlength: "maxLength",
- cellspacing: "cellSpacing",
- rowspan: "rowSpan",
- tabindex: "tabIndex"
-};
jQuery.fn.extend({
- // Keep a copy of the old load
- _load: jQuery.fn.load,
-
load: function( url, params, callback ) {
- if ( typeof url !== "string" )
- return this._load( url );
+ if ( typeof url !== "string" ) {
+ return _load.call( this, url );
+
+ // Don't do a request if no elements are being requested
+ } else if ( !this.length ) {
+ return this;
+ }
var off = url.indexOf(" ");
if ( off >= 0 ) {
@@ -3242,7 +4801,7 @@ jQuery.fn.extend({
var type = "GET";
// If the second parameter was provided
- if ( params )
+ if ( params ) {
// If it's a function
if ( jQuery.isFunction( params ) ) {
// We assume that it's the callback
@@ -3250,10 +4809,11 @@ jQuery.fn.extend({
params = null;
// Otherwise, build a param string
- } else if( typeof params === "object" ) {
- params = jQuery.param( params );
+ } else if ( typeof params === "object" ) {
+ params = jQuery.param( params, jQuery.ajaxSettings.traditional );
type = "POST";
}
+ }
var self = this;
@@ -3263,27 +4823,30 @@ jQuery.fn.extend({
type: type,
dataType: "html",
data: params,
- complete: function(res, status){
+ complete: function( res, status ) {
// If successful, inject the HTML into all the matched elements
- if ( status == "success" || status == "notmodified" )
+ if ( status === "success" || status === "notmodified" ) {
// See if a selector was specified
self.html( selector ?
// Create a dummy div to hold the results
- jQuery("<div/>")
+ jQuery("<div />")
// inject the contents of the document in, removing the scripts
// to avoid any 'Permission Denied' errors in IE
- .append(res.responseText.replace(/<script(.|\s)*?\/script>/g, ""))
+ .append(res.responseText.replace(rscript, ""))
// Locate the specified elements
.find(selector) :
// If not, just inject the full result
res.responseText );
+ }
- if( callback )
+ if ( callback ) {
self.each( callback, [res.responseText, status, res] );
+ }
}
});
+
return this;
},
@@ -3291,40 +4854,41 @@ jQuery.fn.extend({
return jQuery.param(this.serializeArray());
},
serializeArray: function() {
- return this.map(function(){
+ return this.map(function() {
return this.elements ? jQuery.makeArray(this.elements) : this;
})
- .filter(function(){
+ .filter(function() {
return this.name && !this.disabled &&
- (this.checked || /select|textarea/i.test(this.nodeName) ||
- /text|hidden|password|search/i.test(this.type));
+ (this.checked || rselectTextarea.test(this.nodeName) ||
+ rinput.test(this.type));
})
- .map(function(i, elem){
+ .map(function( i, elem ) {
var val = jQuery(this).val();
- return val == null ? null :
+
+ return val == null ?
+ null :
jQuery.isArray(val) ?
- jQuery.map( val, function(val, i){
- return {name: elem.name, value: val};
+ jQuery.map( val, function( val, i ) {
+ return { name: elem.name, value: val };
}) :
- {name: elem.name, value: val};
+ { name: elem.name, value: val };
}).get();
}
});
// Attach a bunch of functions for handling common AJAX events
-jQuery.each( "ajaxStart,ajaxStop,ajaxComplete,ajaxError,ajaxSuccess,ajaxSend".split(","), function(i,o){
- jQuery.fn[o] = function(f){
+jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "), function( i, o ) {
+ jQuery.fn[o] = function( f ) {
return this.bind(o, f);
};
});
-var jsc = now();
-
jQuery.extend({
get: function( url, data, callback, type ) {
- // shift arguments if data argument was ommited
+ // shift arguments if data argument was omited
if ( jQuery.isFunction( data ) ) {
+ type = type || callback;
callback = data;
data = null;
}
@@ -3347,7 +4911,9 @@ jQuery.extend({
},
post: function( url, data, callback, type ) {
+ // shift arguments if data argument was omited
if ( jQuery.isFunction( data ) ) {
+ type = type || callback;
callback = data;
data = {};
}
@@ -3377,13 +4943,21 @@ jQuery.extend({
data: null,
username: null,
password: null,
+ traditional: false,
*/
// Create the request object; Microsoft failed to properly
- // implement the XMLHttpRequest in IE7, so we use the ActiveXObject when it is available
+ // implement the XMLHttpRequest in IE7 (can't request local files),
+ // so we use the ActiveXObject when it is available
// This function can be overriden by calling jQuery.ajaxSetup
- xhr:function(){
- return window.ActiveXObject ? new ActiveXObject("Microsoft.XMLHTTP") : new XMLHttpRequest();
- },
+ xhr: window.XMLHttpRequest && (window.location.protocol !== "file:" || !window.ActiveXObject) ?
+ function() {
+ return new window.XMLHttpRequest();
+ } :
+ function() {
+ try {
+ return new window.ActiveXObject("Microsoft.XMLHTTP");
+ } catch(e) {}
+ },
accepts: {
xml: "application/xml, text/xml",
html: "text/html",
@@ -3396,36 +4970,41 @@ jQuery.extend({
// Last-Modified header cache for next request
lastModified: {},
+ etag: {},
- ajax: function( s ) {
- // Extend the settings, but re-extend 's' so that it can be
- // checked again later (in the test suite, specifically)
- s = jQuery.extend(true, s, jQuery.extend(true, {}, jQuery.ajaxSettings, s));
-
- var jsonp, jsre = /=\?(&|$)/g, status, data,
+ ajax: function( origSettings ) {
+ var s = jQuery.extend(true, {}, jQuery.ajaxSettings, origSettings);
+
+ var jsonp, status, data,
+ callbackContext = origSettings && origSettings.context || s,
type = s.type.toUpperCase();
// convert data if not already a string
- if ( s.data && s.processData && typeof s.data !== "string" )
- s.data = jQuery.param(s.data);
+ if ( s.data && s.processData && typeof s.data !== "string" ) {
+ s.data = jQuery.param( s.data, s.traditional );
+ }
// Handle JSONP Parameter Callbacks
- if ( s.dataType == "jsonp" ) {
- if ( type == "GET" ) {
- if ( !s.url.match(jsre) )
- s.url += (s.url.match(/\?/) ? "&" : "?") + (s.jsonp || "callback") + "=?";
- } else if ( !s.data || !s.data.match(jsre) )
+ if ( s.dataType === "jsonp" ) {
+ if ( type === "GET" ) {
+ if ( !jsre.test( s.url ) ) {
+ s.url += (rquery.test( s.url ) ? "&" : "?") + (s.jsonp || "callback") + "=?";
+ }
+ } else if ( !s.data || !jsre.test(s.data) ) {
s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?";
+ }
s.dataType = "json";
}
// Build temporary JSONP function
- if ( s.dataType == "json" && (s.data && s.data.match(jsre) || s.url.match(jsre)) ) {
- jsonp = "jsonp" + jsc++;
+ if ( s.dataType === "json" && (s.data && jsre.test(s.data) || jsre.test(s.url)) ) {
+ jsonp = s.jsonpCallback || ("jsonp" + jsc++);
// Replace the =? sequence both in the query string and the data
- if ( s.data )
+ if ( s.data ) {
s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1");
+ }
+
s.url = s.url.replace(jsre, "=" + jsonp + "$1");
// We need to make sure
@@ -3433,75 +5012,85 @@ jQuery.extend({
s.dataType = "script";
// Handle JSONP-style loading
- window[ jsonp ] = function(tmp){
+ window[ jsonp ] = window[ jsonp ] || function( tmp ) {
data = tmp;
success();
complete();
// Garbage collect
window[ jsonp ] = undefined;
- try{ delete window[ jsonp ]; } catch(e){}
- if ( head )
+
+ try {
+ delete window[ jsonp ];
+ } catch(e) {}
+
+ if ( head ) {
head.removeChild( script );
+ }
};
}
- if ( s.dataType == "script" && s.cache == null )
+ if ( s.dataType === "script" && s.cache === null ) {
s.cache = false;
+ }
- if ( s.cache === false && type == "GET" ) {
+ if ( s.cache === false && type === "GET" ) {
var ts = now();
+
// try replacing _= if it is there
- var ret = s.url.replace(/(\?|&)_=.*?(&|$)/, "$1_=" + ts + "$2");
+ var ret = s.url.replace(rts, "$1_=" + ts + "$2");
+
// if nothing was replaced, add timestamp to the end
- s.url = ret + ((ret == s.url) ? (s.url.match(/\?/) ? "&" : "?") + "_=" + ts : "");
+ s.url = ret + ((ret === s.url) ? (rquery.test(s.url) ? "&" : "?") + "_=" + ts : "");
}
// If data is available, append data to url for get requests
- if ( s.data && type == "GET" ) {
- s.url += (s.url.match(/\?/) ? "&" : "?") + s.data;
-
- // IE likes to send both get and post data, prevent this
- s.data = null;
+ if ( s.data && type === "GET" ) {
+ s.url += (rquery.test(s.url) ? "&" : "?") + s.data;
}
// Watch for a new set of requests
- if ( s.global && ! jQuery.active++ )
+ if ( s.global && ! jQuery.active++ ) {
jQuery.event.trigger( "ajaxStart" );
+ }
// Matches an absolute URL, and saves the domain
- var parts = /^(\w+:)?\/\/([^\/?#]+)/.exec( s.url );
+ var parts = rurl.exec( s.url ),
+ remote = parts && (parts[1] && parts[1] !== location.protocol || parts[2] !== location.host);
// If we're requesting a remote document
// and trying to load JSON or Script with a GET
- if ( s.dataType == "script" && type == "GET" && parts
- && ( parts[1] && parts[1] != location.protocol || parts[2] != location.host )){
-
- var head = document.getElementsByTagName("head")[0];
+ if ( s.dataType === "script" && type === "GET" && remote ) {
+ var head = document.getElementsByTagName("head")[0] || document.documentElement;
var script = document.createElement("script");
script.src = s.url;
- if (s.scriptCharset)
+ if ( s.scriptCharset ) {
script.charset = s.scriptCharset;
+ }
// Handle Script loading
if ( !jsonp ) {
var done = false;
// Attach handlers for all browsers
- script.onload = script.onreadystatechange = function(){
+ script.onload = script.onreadystatechange = function() {
if ( !done && (!this.readyState ||
- this.readyState == "loaded" || this.readyState == "complete") ) {
+ this.readyState === "loaded" || this.readyState === "complete") ) {
done = true;
success();
complete();
// Handle memory leak in IE
script.onload = script.onreadystatechange = null;
- head.removeChild( script );
+ if ( head && script.parentNode ) {
+ head.removeChild( script );
+ }
}
};
}
- head.appendChild(script);
+ // Use insertBefore instead of appendChild to circumvent an IE6 bug.
+ // This arises when a base node is used (#2709 and #4378).
+ head.insertBefore( script, head.firstChild );
// We handle everything using the script element injection
return undefined;
@@ -3512,158 +5101,197 @@ jQuery.extend({
// Create the request object
var xhr = s.xhr();
+ if ( !xhr ) {
+ return;
+ }
+
// Open the socket
// Passing null username, generates a login popup on Opera (#2865)
- if( s.username )
+ if ( s.username ) {
xhr.open(type, s.url, s.async, s.username, s.password);
- else
+ } else {
xhr.open(type, s.url, s.async);
+ }
// Need an extra try/catch for cross domain requests in Firefox 3
try {
// Set the correct header, if data is being sent
- if ( s.data )
+ if ( s.data || origSettings && origSettings.contentType ) {
xhr.setRequestHeader("Content-Type", s.contentType);
+ }
+
+ // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+ if ( s.ifModified ) {
+ if ( jQuery.lastModified[s.url] ) {
+ xhr.setRequestHeader("If-Modified-Since", jQuery.lastModified[s.url]);
+ }
- // Set the If-Modified-Since header, if ifModified mode.
- if ( s.ifModified )
- xhr.setRequestHeader("If-Modified-Since",
- jQuery.lastModified[s.url] || "Thu, 01 Jan 1970 00:00:00 GMT" );
+ if ( jQuery.etag[s.url] ) {
+ xhr.setRequestHeader("If-None-Match", jQuery.etag[s.url]);
+ }
+ }
// Set header so the called script knows that it's an XMLHttpRequest
- xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest");
+ // Only send the header if it's not a remote XHR
+ if ( !remote ) {
+ xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest");
+ }
// Set the Accepts header for the server, depending on the dataType
xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ?
s.accepts[ s.dataType ] + ", */*" :
s.accepts._default );
- } catch(e){}
+ } catch(e) {}
// Allow custom headers/mimetypes and early abort
- if ( s.beforeSend && s.beforeSend(xhr, s) === false ) {
+ if ( s.beforeSend && s.beforeSend.call(callbackContext, xhr, s) === false ) {
// Handle the global AJAX counter
- if ( s.global && ! --jQuery.active )
+ if ( s.global && ! --jQuery.active ) {
jQuery.event.trigger( "ajaxStop" );
+ }
+
// close opended socket
xhr.abort();
return false;
}
- if ( s.global )
- jQuery.event.trigger("ajaxSend", [xhr, s]);
+ if ( s.global ) {
+ trigger("ajaxSend", [xhr, s]);
+ }
// Wait for a response to come back
- var onreadystatechange = function(isTimeout){
- // The request was aborted, clear the interval and decrement jQuery.active
- if (xhr.readyState == 0) {
- if (ival) {
- // clear poll interval
- clearInterval(ival);
- ival = null;
- // Handle the global AJAX counter
- if ( s.global && ! --jQuery.active )
- jQuery.event.trigger( "ajaxStop" );
+ var onreadystatechange = xhr.onreadystatechange = function( isTimeout ) {
+ // The request was aborted
+ if ( !xhr || xhr.readyState === 0 || isTimeout === "abort" ) {
+ // Opera doesn't call onreadystatechange before this point
+ // so we simulate the call
+ if ( !requestDone ) {
+ complete();
+ }
+
+ requestDone = true;
+ if ( xhr ) {
+ xhr.onreadystatechange = jQuery.noop;
}
+
// The transfer is complete and the data is available, or the request timed out
- } else if ( !requestDone && xhr && (xhr.readyState == 4 || isTimeout == "timeout") ) {
+ } else if ( !requestDone && xhr && (xhr.readyState === 4 || isTimeout === "timeout") ) {
requestDone = true;
+ xhr.onreadystatechange = jQuery.noop;
- // clear poll interval
- if (ival) {
- clearInterval(ival);
- ival = null;
- }
+ status = isTimeout === "timeout" ?
+ "timeout" :
+ !jQuery.httpSuccess( xhr ) ?
+ "error" :
+ s.ifModified && jQuery.httpNotModified( xhr, s.url ) ?
+ "notmodified" :
+ "success";
- status = isTimeout == "timeout" ? "timeout" :
- !jQuery.httpSuccess( xhr ) ? "error" :
- s.ifModified && jQuery.httpNotModified( xhr, s.url ) ? "notmodified" :
- "success";
+ var errMsg;
- if ( status == "success" ) {
+ if ( status === "success" ) {
// Watch for, and catch, XML document parse errors
try {
// process the data (runs the xml through httpData regardless of callback)
data = jQuery.httpData( xhr, s.dataType, s );
- } catch(e) {
+ } catch(err) {
status = "parsererror";
+ errMsg = err;
}
}
// Make sure that the request was successful or notmodified
- if ( status == "success" ) {
- // Cache Last-Modified header, if ifModified mode.
- var modRes;
- try {
- modRes = xhr.getResponseHeader("Last-Modified");
- } catch(e) {} // swallow exception thrown by FF if header is not available
-
- if ( s.ifModified && modRes )
- jQuery.lastModified[s.url] = modRes;
-
+ if ( status === "success" || status === "notmodified" ) {
// JSONP handles its own success callback
- if ( !jsonp )
+ if ( !jsonp ) {
success();
- } else
- jQuery.handleError(s, xhr, status);
+ }
+ } else {
+ jQuery.handleError(s, xhr, status, errMsg);
+ }
// Fire the complete handlers
complete();
- if ( isTimeout )
+ if ( isTimeout === "timeout" ) {
xhr.abort();
+ }
// Stop memory leaks
- if ( s.async )
+ if ( s.async ) {
xhr = null;
+ }
}
};
- if ( s.async ) {
- // don't attach the handler to the request, just poll it instead
- var ival = setInterval(onreadystatechange, 13);
+ // Override the abort handler, if we can (IE doesn't allow it, but that's OK)
+ // Opera doesn't fire onreadystatechange at all on abort
+ try {
+ var oldAbort = xhr.abort;
+ xhr.abort = function() {
+ if ( xhr ) {
+ oldAbort.call( xhr );
+ }
- // Timeout checker
- if ( s.timeout > 0 )
- setTimeout(function(){
- // Check to see if the request is still happening
- if ( xhr && !requestDone )
- onreadystatechange( "timeout" );
- }, s.timeout);
+ onreadystatechange( "abort" );
+ };
+ } catch(e) { }
+
+ // Timeout checker
+ if ( s.async && s.timeout > 0 ) {
+ setTimeout(function() {
+ // Check to see if the request is still happening
+ if ( xhr && !requestDone ) {
+ onreadystatechange( "timeout" );
+ }
+ }, s.timeout);
}
// Send the data
try {
- xhr.send(s.data);
+ xhr.send( type === "POST" || type === "PUT" || type === "DELETE" ? s.data : null );
} catch(e) {
jQuery.handleError(s, xhr, null, e);
+ // Fire the complete handlers
+ complete();
}
// firefox 1.5 doesn't fire statechange for sync requests
- if ( !s.async )
+ if ( !s.async ) {
onreadystatechange();
+ }
- function success(){
+ function success() {
// If a local callback was specified, fire it and pass it the data
- if ( s.success )
- s.success( data, status );
+ if ( s.success ) {
+ s.success.call( callbackContext, data, status, xhr );
+ }
// Fire the global callback
- if ( s.global )
- jQuery.event.trigger( "ajaxSuccess", [xhr, s] );
+ if ( s.global ) {
+ trigger( "ajaxSuccess", [xhr, s] );
+ }
}
- function complete(){
+ function complete() {
// Process result
- if ( s.complete )
- s.complete(xhr, status);
+ if ( s.complete ) {
+ s.complete.call( callbackContext, xhr, status);
+ }
// The request was completed
- if ( s.global )
- jQuery.event.trigger( "ajaxComplete", [xhr, s] );
+ if ( s.global ) {
+ trigger( "ajaxComplete", [xhr, s] );
+ }
// Handle the global AJAX counter
- if ( s.global && ! --jQuery.active )
+ if ( s.global && ! --jQuery.active ) {
jQuery.event.trigger( "ajaxStop" );
+ }
+ }
+
+ function trigger(type, args) {
+ (s.context ? jQuery(s.context) : jQuery.event).trigger(type, args);
}
// return XMLHttpRequest to allow aborting the request etc.
@@ -3672,11 +5300,14 @@ jQuery.extend({
handleError: function( s, xhr, status, e ) {
// If a local callback was specified, fire it
- if ( s.error ) s.error( xhr, status, e );
+ if ( s.error ) {
+ s.error.call( s.context || s, xhr, status, e );
+ }
// Fire the global callback
- if ( s.global )
- jQuery.event.trigger( "ajaxError", [xhr, s, e] );
+ if ( s.global ) {
+ (s.context ? jQuery(s.context) : jQuery.event).trigger( "ajaxError", [xhr, s, e] );
+ }
},
// Counter for holding the number of active queries
@@ -3686,46 +5317,57 @@ jQuery.extend({
httpSuccess: function( xhr ) {
try {
// IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450
- return !xhr.status && location.protocol == "file:" ||
- ( xhr.status >= 200 && xhr.status < 300 ) || xhr.status == 304 || xhr.status == 1223;
- } catch(e){}
+ return !xhr.status && location.protocol === "file:" ||
+ // Opera returns 0 when status is 304
+ ( xhr.status >= 200 && xhr.status < 300 ) ||
+ xhr.status === 304 || xhr.status === 1223 || xhr.status === 0;
+ } catch(e) {}
+
return false;
},
// Determines if an XMLHttpRequest returns NotModified
httpNotModified: function( xhr, url ) {
- try {
- var xhrRes = xhr.getResponseHeader("Last-Modified");
+ var lastModified = xhr.getResponseHeader("Last-Modified"),
+ etag = xhr.getResponseHeader("Etag");
- // Firefox always returns 200. check Last-Modified date
- return xhr.status == 304 || xhrRes == jQuery.lastModified[url];
- } catch(e){}
- return false;
+ if ( lastModified ) {
+ jQuery.lastModified[url] = lastModified;
+ }
+
+ if ( etag ) {
+ jQuery.etag[url] = etag;
+ }
+
+ // Opera returns 0 when status is 304
+ return xhr.status === 304 || xhr.status === 0;
},
httpData: function( xhr, type, s ) {
- var ct = xhr.getResponseHeader("content-type"),
- xml = type == "xml" || !type && ct && ct.indexOf("xml") >= 0,
+ var ct = xhr.getResponseHeader("content-type") || "",
+ xml = type === "xml" || !type && ct.indexOf("xml") >= 0,
data = xml ? xhr.responseXML : xhr.responseText;
- if ( xml && data.documentElement.tagName == "parsererror" )
- throw "parsererror";
+ if ( xml && data.documentElement.nodeName === "parsererror" ) {
+ jQuery.error( "parsererror" );
+ }
// Allow a pre-filtering function to sanitize the response
- // s != null is checked to keep backwards compatibility
- if( s && s.dataFilter )
+ // s is checked to keep backwards compatibility
+ if ( s && s.dataFilter ) {
data = s.dataFilter( data, type );
+ }
// The filter can actually parse the response
- if( typeof data === "string" ){
+ if ( typeof data === "string" ) {
+ // Get the JavaScript object, if JSON is used.
+ if ( type === "json" || !type && ct.indexOf("json") >= 0 ) {
+ data = jQuery.parseJSON( data );
// If the type is "script", eval it in global context
- if ( type == "script" )
+ } else if ( type === "script" || !type && ct.indexOf("javascript") >= 0 ) {
jQuery.globalEval( data );
-
- // Get the JavaScript object, if JSON is used.
- if ( type == "json" )
- data = window["eval"]("(" + data + ")");
+ }
}
return data;
@@ -3733,39 +5375,73 @@ jQuery.extend({
// Serialize an array of form elements or a set of
// key/values into a query string
- param: function( a ) {
- var s = [ ];
-
- function add( key, value ){
- s[ s.length ] = encodeURIComponent(key) + '=' + encodeURIComponent(value);
- };
-
- // If an array was passed in, assume that it is an array
- // of form elements
- if ( jQuery.isArray(a) || a.jquery )
+ param: function( a, traditional ) {
+ var s = [];
+
+ // Set traditional to true for jQuery <= 1.3.2 behavior.
+ if ( traditional === undefined ) {
+ traditional = jQuery.ajaxSettings.traditional;
+ }
+
+ // If an array was passed in, assume that it is an array of form elements.
+ if ( jQuery.isArray(a) || a.jquery ) {
// Serialize the form elements
- jQuery.each( a, function(){
+ jQuery.each( a, function() {
add( this.name, this.value );
});
-
- // Otherwise, assume that it's an object of key/value pairs
- else
- // Serialize the key/values
- for ( var j in a )
- // If the value is an array then the key names need to be repeated
- if ( jQuery.isArray(a[j]) )
- jQuery.each( a[j], function(){
- add( j, this );
- });
- else
- add( j, jQuery.isFunction(a[j]) ? a[j]() : a[j] );
+
+ } else {
+ // If traditional, encode the "old" way (the way 1.3.2 or older
+ // did it), otherwise encode params recursively.
+ for ( var prefix in a ) {
+ buildParams( prefix, a[prefix] );
+ }
+ }
// Return the resulting serialization
- return s.join("&").replace(/%20/g, "+");
- }
+ return s.join("&").replace(r20, "+");
+
+ function buildParams( prefix, obj ) {
+ if ( jQuery.isArray(obj) ) {
+ // Serialize array item.
+ jQuery.each( obj, function( i, v ) {
+ if ( traditional || /\[\]$/.test( prefix ) ) {
+ // Treat each array item as a scalar.
+ add( prefix, v );
+ } else {
+ // If array item is non-scalar (array or object), encode its
+ // numeric index to resolve deserialization ambiguity issues.
+ // Note that rack (as of 1.0.0) can't currently deserialize
+ // nested arrays properly, and attempting to do so may cause
+ // a server error. Possible fixes are to modify rack's
+ // deserialization algorithm or to provide an option or flag
+ // to force array serialization to be shallow.
+ buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v );
+ }
+ });
+
+ } else if ( !traditional && obj != null && typeof obj === "object" ) {
+ // Serialize object item.
+ jQuery.each( obj, function( k, v ) {
+ buildParams( prefix + "[" + k + "]", v );
+ });
+
+ } else {
+ // Serialize scalar item.
+ add( prefix, obj );
+ }
+ }
+ function add( key, value ) {
+ // If value is a function, invoke it and return its value
+ value = jQuery.isFunction(value) ? value() : value;
+ s[ s.length ] = encodeURIComponent(key) + "=" + encodeURIComponent(value);
+ }
+ }
});
var elemdisplay = {},
+ rfxtypes = /toggle|show|hide/,
+ rfxnum = /^([+-]=)?([\d+-.]+)(.*)$/,
timerId,
fxAttrs = [
// height animations
@@ -3776,39 +5452,35 @@ var elemdisplay = {},
[ "opacity" ]
];
-function genFx( type, num ){
- var obj = {};
- jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function(){
- obj[ this ] = type;
- });
- return obj;
-}
-
jQuery.fn.extend({
- show: function(speed,callback){
- if ( speed ) {
+ show: function( speed, callback ) {
+ if ( speed || speed === 0) {
return this.animate( genFx("show", 3), speed, callback);
+
} else {
- for ( var i = 0, l = this.length; i < l; i++ ){
+ for ( var i = 0, l = this.length; i < l; i++ ) {
var old = jQuery.data(this[i], "olddisplay");
this[i].style.display = old || "";
if ( jQuery.css(this[i], "display") === "none" ) {
- var tagName = this[i].tagName, display;
+ var nodeName = this[i].nodeName, display;
+
+ if ( elemdisplay[ nodeName ] ) {
+ display = elemdisplay[ nodeName ];
- if ( elemdisplay[ tagName ] ) {
- display = elemdisplay[ tagName ];
} else {
- var elem = jQuery("<" + tagName + " />").appendTo("body");
+ var elem = jQuery("<" + nodeName + " />").appendTo("body");
display = elem.css("display");
- if ( display === "none" )
+
+ if ( display === "none" ) {
display = "block";
+ }
elem.remove();
- elemdisplay[ tagName ] = display;
+ elemdisplay[ nodeName ] = display;
}
jQuery.data(this[i], "olddisplay", display);
@@ -3817,28 +5489,30 @@ jQuery.fn.extend({
// Set the display of the elements in a second loop
// to avoid the constant reflow
- for ( var i = 0, l = this.length; i < l; i++ ){
- this[i].style.display = jQuery.data(this[i], "olddisplay") || "";
+ for ( var j = 0, k = this.length; j < k; j++ ) {
+ this[j].style.display = jQuery.data(this[j], "olddisplay") || "";
}
return this;
}
},
- hide: function(speed,callback){
- if ( speed ) {
+ hide: function( speed, callback ) {
+ if ( speed || speed === 0 ) {
return this.animate( genFx("hide", 3), speed, callback);
+
} else {
- for ( var i = 0, l = this.length; i < l; i++ ){
+ for ( var i = 0, l = this.length; i < l; i++ ) {
var old = jQuery.data(this[i], "olddisplay");
- if ( !old && old !== "none" )
+ if ( !old && old !== "none" ) {
jQuery.data(this[i], "olddisplay", jQuery.css(this[i], "display"));
+ }
}
// Set the display of the elements in a second loop
// to avoid the constant reflow
- for ( var i = 0, l = this.length; i < l; i++ ){
- this[i].style.display = "none";
+ for ( var j = 0, k = this.length; j < k; j++ ) {
+ this[j].style.display = "none";
}
return this;
@@ -3848,77 +5522,107 @@ jQuery.fn.extend({
// Save the old toggle function
_toggle: jQuery.fn.toggle,
- toggle: function( fn, fn2 ){
+ toggle: function( fn, fn2 ) {
var bool = typeof fn === "boolean";
- return jQuery.isFunction(fn) && jQuery.isFunction(fn2) ?
- this._toggle.apply( this, arguments ) :
- fn == null || bool ?
- this.each(function(){
- var state = bool ? fn : jQuery(this).is(":hidden");
- jQuery(this)[ state ? "show" : "hide" ]();
- }) :
- this.animate(genFx("toggle", 3), fn, fn2);
+ if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) {
+ this._toggle.apply( this, arguments );
+
+ } else if ( fn == null || bool ) {
+ this.each(function() {
+ var state = bool ? fn : jQuery(this).is(":hidden");
+ jQuery(this)[ state ? "show" : "hide" ]();
+ });
+
+ } else {
+ this.animate(genFx("toggle", 3), fn, fn2);
+ }
+
+ return this;
},
- fadeTo: function(speed,to,callback){
- return this.animate({opacity: to}, speed, callback);
+ fadeTo: function( speed, to, callback ) {
+ return this.filter(":hidden").css("opacity", 0).show().end()
+ .animate({opacity: to}, speed, callback);
},
animate: function( prop, speed, easing, callback ) {
var optall = jQuery.speed(speed, easing, callback);
- return this[ optall.queue === false ? "each" : "queue" ](function(){
+ if ( jQuery.isEmptyObject( prop ) ) {
+ return this.each( optall.complete );
+ }
+ return this[ optall.queue === false ? "each" : "queue" ](function() {
var opt = jQuery.extend({}, optall), p,
- hidden = this.nodeType == 1 && jQuery(this).is(":hidden"),
+ hidden = this.nodeType === 1 && jQuery(this).is(":hidden"),
self = this;
for ( p in prop ) {
- if ( prop[p] == "hide" && hidden || prop[p] == "show" && !hidden )
+ var name = p.replace(rdashAlpha, fcamelCase);
+
+ if ( p !== name ) {
+ prop[ name ] = prop[ p ];
+ delete prop[ p ];
+ p = name;
+ }
+
+ if ( prop[p] === "hide" && hidden || prop[p] === "show" && !hidden ) {
return opt.complete.call(this);
+ }
- if ( ( p == "height" || p == "width" ) && this.style ) {
+ if ( ( p === "height" || p === "width" ) && this.style ) {
// Store display property
opt.display = jQuery.css(this, "display");
// Make sure that nothing sneaks out
opt.overflow = this.style.overflow;
}
+
+ if ( jQuery.isArray( prop[p] ) ) {
+ // Create (if needed) and add to specialEasing
+ (opt.specialEasing = opt.specialEasing || {})[p] = prop[p][1];
+ prop[p] = prop[p][0];
+ }
}
- if ( opt.overflow != null )
+ if ( opt.overflow != null ) {
this.style.overflow = "hidden";
+ }
opt.curAnim = jQuery.extend({}, prop);
- jQuery.each( prop, function(name, val){
+ jQuery.each( prop, function( name, val ) {
var e = new jQuery.fx( self, opt, name );
- if ( /toggle|show|hide/.test(val) )
- e[ val == "toggle" ? hidden ? "show" : "hide" : val ]( prop );
- else {
- var parts = val.toString().match(/^([+-]=)?([\d+-.]+)(.*)$/),
+ if ( rfxtypes.test(val) ) {
+ e[ val === "toggle" ? hidden ? "show" : "hide" : val ]( prop );
+
+ } else {
+ var parts = rfxnum.exec(val),
start = e.cur(true) || 0;
if ( parts ) {
- var end = parseFloat(parts[2]),
+ var end = parseFloat( parts[2] ),
unit = parts[3] || "px";
// We need to compute starting value
- if ( unit != "px" ) {
+ if ( unit !== "px" ) {
self.style[ name ] = (end || 1) + unit;
start = ((end || 1) / e.cur(true)) * start;
self.style[ name ] = start + unit;
}
// If a +=/-= token was provided, we're doing a relative animation
- if ( parts[1] )
- end = ((parts[1] == "-=" ? -1 : 1) * end) + start;
+ if ( parts[1] ) {
+ end = ((parts[1] === "-=" ? -1 : 1) * end) + start;
+ }
e.custom( start, end, unit );
- } else
+
+ } else {
e.custom( start, val, "" );
+ }
}
});
@@ -3927,26 +5631,31 @@ jQuery.fn.extend({
});
},
- stop: function(clearQueue, gotoEnd){
+ stop: function( clearQueue, gotoEnd ) {
var timers = jQuery.timers;
- if (clearQueue)
+ if ( clearQueue ) {
this.queue([]);
+ }
- this.each(function(){
+ this.each(function() {
// go in reverse order so anything added to the queue during the loop is ignored
- for ( var i = timers.length - 1; i >= 0; i-- )
- if ( timers[i].elem == this ) {
- if (gotoEnd)
+ for ( var i = timers.length - 1; i >= 0; i-- ) {
+ if ( timers[i].elem === this ) {
+ if (gotoEnd) {
// force the next step to be the last
timers[i](true);
+ }
+
timers.splice(i, 1);
}
+ }
});
// start the next in the queue if the last step wasn't forced
- if (!gotoEnd)
+ if ( !gotoEnd ) {
this.dequeue();
+ }
return this;
}
@@ -3960,16 +5669,15 @@ jQuery.each({
slideToggle: genFx("toggle", 1),
fadeIn: { opacity: "show" },
fadeOut: { opacity: "hide" }
-}, function( name, props ){
- jQuery.fn[ name ] = function( speed, callback ){
+}, function( name, props ) {
+ jQuery.fn[ name ] = function( speed, callback ) {
return this.animate( props, speed, callback );
};
});
jQuery.extend({
-
- speed: function(speed, easing, fn) {
- var opt = typeof speed === "object" ? speed : {
+ speed: function( speed, easing, fn ) {
+ var opt = speed && typeof speed === "object" ? speed : {
complete: fn || !fn && easing ||
jQuery.isFunction( speed ) && speed,
duration: speed,
@@ -3981,11 +5689,13 @@ jQuery.extend({
// Queueing
opt.old = opt.complete;
- opt.complete = function(){
- if ( opt.queue !== false )
+ opt.complete = function() {
+ if ( opt.queue !== false ) {
jQuery(this).dequeue();
- if ( jQuery.isFunction( opt.old ) )
+ }
+ if ( jQuery.isFunction( opt.old ) ) {
opt.old.call( this );
+ }
};
return opt;
@@ -4002,42 +5712,45 @@ jQuery.extend({
timers: [],
- fx: function( elem, options, prop ){
+ fx: function( elem, options, prop ) {
this.options = options;
this.elem = elem;
this.prop = prop;
- if ( !options.orig )
+ if ( !options.orig ) {
options.orig = {};
+ }
}
});
jQuery.fx.prototype = {
-
// Simple function for setting a style value
- update: function(){
- if ( this.options.step )
+ update: function() {
+ if ( this.options.step ) {
this.options.step.call( this.elem, this.now, this );
+ }
(jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this );
// Set display property to block for height/width animations
- if ( ( this.prop == "height" || this.prop == "width" ) && this.elem.style )
+ if ( ( this.prop === "height" || this.prop === "width" ) && this.elem.style ) {
this.elem.style.display = "block";
+ }
},
// Get the current size
- cur: function(force){
- if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) )
+ cur: function( force ) {
+ if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) {
return this.elem[ this.prop ];
+ }
var r = parseFloat(jQuery.css(this.elem, this.prop, force));
return r && r > -10000 ? r : parseFloat(jQuery.curCSS(this.elem, this.prop)) || 0;
},
// Start an animation from one number to another
- custom: function(from, to, unit){
+ custom: function( from, to, unit ) {
this.startTime = now();
this.start = from;
this.end = to;
@@ -4046,47 +5759,36 @@ jQuery.fx.prototype = {
this.pos = this.state = 0;
var self = this;
- function t(gotoEnd){
+ function t( gotoEnd ) {
return self.step(gotoEnd);
}
t.elem = this.elem;
if ( t() && jQuery.timers.push(t) && !timerId ) {
- timerId = setInterval(function(){
- var timers = jQuery.timers;
-
- for ( var i = 0; i < timers.length; i++ )
- if ( !timers[i]() )
- timers.splice(i--, 1);
-
- if ( !timers.length ) {
- clearInterval( timerId );
- timerId = undefined;
- }
- }, 13);
+ timerId = setInterval(jQuery.fx.tick, 13);
}
},
// Simple 'show' function
- show: function(){
+ show: function() {
// Remember where we started, so that we can go back to it later
- this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop );
+ this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
this.options.show = true;
// Begin the animation
// Make sure that we start at a small width/height to avoid any
// flash of content
- this.custom(this.prop == "width" || this.prop == "height" ? 1 : 0, this.cur());
+ this.custom(this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur());
// Start by showing the element
- jQuery(this.elem).show();
+ jQuery( this.elem ).show();
},
// Simple 'hide' function
- hide: function(){
+ hide: function() {
// Remember where we started, so that we can go back to it later
- this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop );
+ this.options.orig[this.prop] = jQuery.style( this.elem, this.prop );
this.options.hide = true;
// Begin the animation
@@ -4094,8 +5796,8 @@ jQuery.fx.prototype = {
},
// Each step of an animation
- step: function(gotoEnd){
- var t = now();
+ step: function( gotoEnd ) {
+ var t = now(), done = true;
if ( gotoEnd || t >= this.options.duration + this.startTime ) {
this.now = this.end;
@@ -4104,10 +5806,11 @@ jQuery.fx.prototype = {
this.options.curAnim[ this.prop ] = true;
- var done = true;
- for ( var i in this.options.curAnim )
- if ( this.options.curAnim[i] !== true )
+ for ( var i in this.options.curAnim ) {
+ if ( this.options.curAnim[i] !== true ) {
done = false;
+ }
+ }
if ( done ) {
if ( this.options.display != null ) {
@@ -4115,31 +5818,40 @@ jQuery.fx.prototype = {
this.elem.style.overflow = this.options.overflow;
// Reset the display
- this.elem.style.display = this.options.display;
- if ( jQuery.css(this.elem, "display") == "none" )
+ var old = jQuery.data(this.elem, "olddisplay");
+ this.elem.style.display = old ? old : this.options.display;
+
+ if ( jQuery.css(this.elem, "display") === "none" ) {
this.elem.style.display = "block";
+ }
}
// Hide the element if the "hide" operation was done
- if ( this.options.hide )
+ if ( this.options.hide ) {
jQuery(this.elem).hide();
+ }
// Reset the properties, if the item has been hidden or shown
- if ( this.options.hide || this.options.show )
- for ( var p in this.options.curAnim )
- jQuery.attr(this.elem.style, p, this.options.orig[p]);
+ if ( this.options.hide || this.options.show ) {
+ for ( var p in this.options.curAnim ) {
+ jQuery.style(this.elem, p, this.options.orig[p]);
+ }
+ }
// Execute the complete function
this.options.complete.call( this.elem );
}
return false;
+
} else {
var n = t - this.startTime;
this.state = n / this.options.duration;
// Perform the easing function, defaults to swing
- this.pos = jQuery.easing[this.options.easing || (jQuery.easing.swing ? "swing" : "linear")](this.state, n, 0, 1, this.options.duration);
+ var specialEasing = this.options.specialEasing && this.options.specialEasing[this.prop];
+ var defaultEasing = this.options.easing || (jQuery.easing.swing ? "swing" : "linear");
+ this.pos = jQuery.easing[specialEasing || defaultEasing](this.state, n, 0, 1, this.options.duration);
this.now = this.start + ((this.end - this.start) * this.pos);
// Perform the next step of the animation
@@ -4148,232 +5860,381 @@ jQuery.fx.prototype = {
return true;
}
-
};
jQuery.extend( jQuery.fx, {
- speeds:{
+ tick: function() {
+ var timers = jQuery.timers;
+
+ for ( var i = 0; i < timers.length; i++ ) {
+ if ( !timers[i]() ) {
+ timers.splice(i--, 1);
+ }
+ }
+
+ if ( !timers.length ) {
+ jQuery.fx.stop();
+ }
+ },
+
+ stop: function() {
+ clearInterval( timerId );
+ timerId = null;
+ },
+
+ speeds: {
slow: 600,
fast: 200,
// Default speed
_default: 400
},
- step: {
- opacity: function(fx){
- jQuery.attr(fx.elem.style, "opacity", fx.now);
+ step: {
+ opacity: function( fx ) {
+ jQuery.style(fx.elem, "opacity", fx.now);
},
- _default: function(fx){
- if ( fx.elem.style && fx.elem.style[ fx.prop ] != null )
- fx.elem.style[ fx.prop ] = fx.now + fx.unit;
- else
+ _default: function( fx ) {
+ if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) {
+ fx.elem.style[ fx.prop ] = (fx.prop === "width" || fx.prop === "height" ? Math.max(0, fx.now) : fx.now) + fx.unit;
+ } else {
fx.elem[ fx.prop ] = fx.now;
+ }
}
}
});
-if ( document.documentElement["getBoundingClientRect"] )
- jQuery.fn.offset = function() {
- if ( !this[0] ) return { top: 0, left: 0 };
- if ( this[0] === this[0].ownerDocument.body ) return jQuery.offset.bodyOffset( this[0] );
- var box = this[0].getBoundingClientRect(), doc = this[0].ownerDocument, body = doc.body, docElem = doc.documentElement,
+
+if ( jQuery.expr && jQuery.expr.filters ) {
+ jQuery.expr.filters.animated = function( elem ) {
+ return jQuery.grep(jQuery.timers, function( fn ) {
+ return elem === fn.elem;
+ }).length;
+ };
+}
+
+function genFx( type, num ) {
+ var obj = {};
+
+ jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function() {
+ obj[ this ] = type;
+ });
+
+ return obj;
+}
+if ( "getBoundingClientRect" in document.documentElement ) {
+ jQuery.fn.offset = function( options ) {
+ var elem = this[0];
+
+ if ( options ) {
+ return this.each(function( i ) {
+ jQuery.offset.setOffset( this, options, i );
+ });
+ }
+
+ if ( !elem || !elem.ownerDocument ) {
+ return null;
+ }
+
+ if ( elem === elem.ownerDocument.body ) {
+ return jQuery.offset.bodyOffset( elem );
+ }
+
+ var box = elem.getBoundingClientRect(), doc = elem.ownerDocument, body = doc.body, docElem = doc.documentElement,
clientTop = docElem.clientTop || body.clientTop || 0, clientLeft = docElem.clientLeft || body.clientLeft || 0,
- top = box.top + (self.pageYOffset || jQuery.boxModel && docElem.scrollTop || body.scrollTop ) - clientTop,
- left = box.left + (self.pageXOffset || jQuery.boxModel && docElem.scrollLeft || body.scrollLeft) - clientLeft;
+ top = box.top + (self.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop ) - clientTop,
+ left = box.left + (self.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft) - clientLeft;
+
return { top: top, left: left };
};
-else
- jQuery.fn.offset = function() {
- if ( !this[0] ) return { top: 0, left: 0 };
- if ( this[0] === this[0].ownerDocument.body ) return jQuery.offset.bodyOffset( this[0] );
- jQuery.offset.initialized || jQuery.offset.initialize();
- var elem = this[0], offsetParent = elem.offsetParent, prevOffsetParent = elem,
+} else {
+ jQuery.fn.offset = function( options ) {
+ var elem = this[0];
+
+ if ( options ) {
+ return this.each(function( i ) {
+ jQuery.offset.setOffset( this, options, i );
+ });
+ }
+
+ if ( !elem || !elem.ownerDocument ) {
+ return null;
+ }
+
+ if ( elem === elem.ownerDocument.body ) {
+ return jQuery.offset.bodyOffset( elem );
+ }
+
+ jQuery.offset.initialize();
+
+ var offsetParent = elem.offsetParent, prevOffsetParent = elem,
doc = elem.ownerDocument, computedStyle, docElem = doc.documentElement,
body = doc.body, defaultView = doc.defaultView,
- prevComputedStyle = defaultView.getComputedStyle(elem, null),
+ prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle,
top = elem.offsetTop, left = elem.offsetLeft;
while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) {
- computedStyle = defaultView.getComputedStyle(elem, null);
- top -= elem.scrollTop, left -= elem.scrollLeft;
+ if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
+ break;
+ }
+
+ computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle;
+ top -= elem.scrollTop;
+ left -= elem.scrollLeft;
+
if ( elem === offsetParent ) {
- top += elem.offsetTop, left += elem.offsetLeft;
- if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && /^t(able|d|h)$/i.test(elem.tagName)) )
- top += parseInt( computedStyle.borderTopWidth, 10) || 0,
- left += parseInt( computedStyle.borderLeftWidth, 10) || 0;
+ top += elem.offsetTop;
+ left += elem.offsetLeft;
+
+ if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && /^t(able|d|h)$/i.test(elem.nodeName)) ) {
+ top += parseFloat( computedStyle.borderTopWidth ) || 0;
+ left += parseFloat( computedStyle.borderLeftWidth ) || 0;
+ }
+
prevOffsetParent = offsetParent, offsetParent = elem.offsetParent;
}
- if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" )
- top += parseInt( computedStyle.borderTopWidth, 10) || 0,
- left += parseInt( computedStyle.borderLeftWidth, 10) || 0;
+
+ if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) {
+ top += parseFloat( computedStyle.borderTopWidth ) || 0;
+ left += parseFloat( computedStyle.borderLeftWidth ) || 0;
+ }
+
prevComputedStyle = computedStyle;
}
- if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" )
- top += body.offsetTop,
+ if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) {
+ top += body.offsetTop;
left += body.offsetLeft;
+ }
- if ( prevComputedStyle.position === "fixed" )
- top += Math.max(docElem.scrollTop, body.scrollTop),
- left += Math.max(docElem.scrollLeft, body.scrollLeft);
+ if ( jQuery.offset.supportsFixedPosition && prevComputedStyle.position === "fixed" ) {
+ top += Math.max( docElem.scrollTop, body.scrollTop );
+ left += Math.max( docElem.scrollLeft, body.scrollLeft );
+ }
return { top: top, left: left };
};
+}
jQuery.offset = {
initialize: function() {
- if ( this.initialized ) return;
- var body = document.body, container = document.createElement('div'), innerDiv, checkDiv, table, td, rules, prop, bodyMarginTop = body.style.marginTop,
- html = '<div style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;"><div></div></div><table style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;" cellpadding="0" cellspacing="0"><tr><td></td></tr></table>';
+ var body = document.body, container = document.createElement("div"), innerDiv, checkDiv, table, td, bodyMarginTop = parseFloat( jQuery.curCSS(body, "marginTop", true) ) || 0,
+ html = "<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";
- rules = { position: 'absolute', top: 0, left: 0, margin: 0, border: 0, width: '1px', height: '1px', visibility: 'hidden' };
- for ( prop in rules ) container.style[prop] = rules[prop];
+ jQuery.extend( container.style, { position: "absolute", top: 0, left: 0, margin: 0, border: 0, width: "1px", height: "1px", visibility: "hidden" } );
container.innerHTML = html;
- body.insertBefore(container, body.firstChild);
- innerDiv = container.firstChild, checkDiv = innerDiv.firstChild, td = innerDiv.nextSibling.firstChild.firstChild;
+ body.insertBefore( container, body.firstChild );
+ innerDiv = container.firstChild;
+ checkDiv = innerDiv.firstChild;
+ td = innerDiv.nextSibling.firstChild.firstChild;
this.doesNotAddBorder = (checkDiv.offsetTop !== 5);
this.doesAddBorderForTableAndCells = (td.offsetTop === 5);
- innerDiv.style.overflow = 'hidden', innerDiv.style.position = 'relative';
+ checkDiv.style.position = "fixed", checkDiv.style.top = "20px";
+ // safari subtracts parent border width here which is 5px
+ this.supportsFixedPosition = (checkDiv.offsetTop === 20 || checkDiv.offsetTop === 15);
+ checkDiv.style.position = checkDiv.style.top = "";
+
+ innerDiv.style.overflow = "hidden", innerDiv.style.position = "relative";
this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5);
- body.style.marginTop = '1px';
- this.doesNotIncludeMarginInBodyOffset = (body.offsetTop === 0);
- body.style.marginTop = bodyMarginTop;
+ this.doesNotIncludeMarginInBodyOffset = (body.offsetTop !== bodyMarginTop);
- body.removeChild(container);
- this.initialized = true;
+ body.removeChild( container );
+ body = container = innerDiv = checkDiv = table = td = null;
+ jQuery.offset.initialize = jQuery.noop;
},
- bodyOffset: function(body) {
- jQuery.offset.initialized || jQuery.offset.initialize();
+ bodyOffset: function( body ) {
var top = body.offsetTop, left = body.offsetLeft;
- if ( jQuery.offset.doesNotIncludeMarginInBodyOffset )
- top += parseInt( jQuery.curCSS(body, 'marginTop', true), 10 ) || 0,
- left += parseInt( jQuery.curCSS(body, 'marginLeft', true), 10 ) || 0;
+
+ jQuery.offset.initialize();
+
+ if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) {
+ top += parseFloat( jQuery.curCSS(body, "marginTop", true) ) || 0;
+ left += parseFloat( jQuery.curCSS(body, "marginLeft", true) ) || 0;
+ }
+
return { top: top, left: left };
+ },
+
+ setOffset: function( elem, options, i ) {
+ // set position first, in-case top/left are set even on static elem
+ if ( /static/.test( jQuery.curCSS( elem, "position" ) ) ) {
+ elem.style.position = "relative";
+ }
+ var curElem = jQuery( elem ),
+ curOffset = curElem.offset(),
+ curTop = parseInt( jQuery.curCSS( elem, "top", true ), 10 ) || 0,
+ curLeft = parseInt( jQuery.curCSS( elem, "left", true ), 10 ) || 0;
+
+ if ( jQuery.isFunction( options ) ) {
+ options = options.call( elem, i, curOffset );
+ }
+
+ var props = {
+ top: (options.top - curOffset.top) + curTop,
+ left: (options.left - curOffset.left) + curLeft
+ };
+
+ if ( "using" in options ) {
+ options.using.call( elem, props );
+ } else {
+ curElem.css( props );
+ }
}
};
jQuery.fn.extend({
position: function() {
- var left = 0, top = 0, results;
-
- if ( this[0] ) {
- // Get *real* offsetParent
- var offsetParent = this.offsetParent(),
-
- // Get correct offsets
- offset = this.offset(),
- parentOffset = /^body|html$/i.test(offsetParent[0].tagName) ? { top: 0, left: 0 } : offsetParent.offset();
-
- // Subtract element margins
- // note: when an element has margin: auto the offsetLeft and marginLeft
- // are the same in Safari causing offset.left to incorrectly be 0
- offset.top -= num( this, 'marginTop' );
- offset.left -= num( this, 'marginLeft' );
-
- // Add offsetParent borders
- parentOffset.top += num( offsetParent, 'borderTopWidth' );
- parentOffset.left += num( offsetParent, 'borderLeftWidth' );
-
- // Subtract the two offsets
- results = {
- top: offset.top - parentOffset.top,
- left: offset.left - parentOffset.left
- };
+ if ( !this[0] ) {
+ return null;
}
- return results;
+ var elem = this[0],
+
+ // Get *real* offsetParent
+ offsetParent = this.offsetParent(),
+
+ // Get correct offsets
+ offset = this.offset(),
+ parentOffset = /^body|html$/i.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset();
+
+ // Subtract element margins
+ // note: when an element has margin: auto the offsetLeft and marginLeft
+ // are the same in Safari causing offset.left to incorrectly be 0
+ offset.top -= parseFloat( jQuery.curCSS(elem, "marginTop", true) ) || 0;
+ offset.left -= parseFloat( jQuery.curCSS(elem, "marginLeft", true) ) || 0;
+
+ // Add offsetParent borders
+ parentOffset.top += parseFloat( jQuery.curCSS(offsetParent[0], "borderTopWidth", true) ) || 0;
+ parentOffset.left += parseFloat( jQuery.curCSS(offsetParent[0], "borderLeftWidth", true) ) || 0;
+
+ // Subtract the two offsets
+ return {
+ top: offset.top - parentOffset.top,
+ left: offset.left - parentOffset.left
+ };
},
offsetParent: function() {
- var offsetParent = this[0].offsetParent || document.body;
- while ( offsetParent && (!/^body|html$/i.test(offsetParent.tagName) && jQuery.css(offsetParent, 'position') == 'static') )
- offsetParent = offsetParent.offsetParent;
- return jQuery(offsetParent);
+ return this.map(function() {
+ var offsetParent = this.offsetParent || document.body;
+ while ( offsetParent && (!/^body|html$/i.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) {
+ offsetParent = offsetParent.offsetParent;
+ }
+ return offsetParent;
+ });
}
});
// Create scrollLeft and scrollTop methods
-jQuery.each( ['Left', 'Top'], function(i, name) {
- var method = 'scroll' + name;
+jQuery.each( ["Left", "Top"], function( i, name ) {
+ var method = "scroll" + name;
jQuery.fn[ method ] = function(val) {
- if (!this[0]) return null;
-
- return val !== undefined ?
+ var elem = this[0], win;
+
+ if ( !elem ) {
+ return null;
+ }
+ if ( val !== undefined ) {
// Set the scroll offset
- this.each(function() {
- this == window || this == document ?
- window.scrollTo(
- !i ? val : jQuery(window).scrollLeft(),
- i ? val : jQuery(window).scrollTop()
- ) :
+ return this.each(function() {
+ win = getWindow( this );
+
+ if ( win ) {
+ win.scrollTo(
+ !i ? val : jQuery(win).scrollLeft(),
+ i ? val : jQuery(win).scrollTop()
+ );
+
+ } else {
this[ method ] = val;
- }) :
+ }
+ });
+ } else {
+ win = getWindow( elem );
// Return the scroll offset
- this[0] == window || this[0] == document ?
- self[ i ? 'pageYOffset' : 'pageXOffset' ] ||
- jQuery.boxModel && document.documentElement[ method ] ||
- document.body[ method ] :
- this[0][ method ];
+ return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] :
+ jQuery.support.boxModel && win.document.documentElement[ method ] ||
+ win.document.body[ method ] :
+ elem[ method ];
+ }
};
});
+
+function getWindow( elem ) {
+ return ("scrollTo" in elem && elem.document) ?
+ elem :
+ elem.nodeType === 9 ?
+ elem.defaultView || elem.parentWindow :
+ false;
+}
// Create innerHeight, innerWidth, outerHeight and outerWidth methods
-jQuery.each([ "Height", "Width" ], function(i, name){
+jQuery.each([ "Height", "Width" ], function( i, name ) {
- var tl = i ? "Left" : "Top", // top or left
- br = i ? "Right" : "Bottom", // bottom or right
- lower = name.toLowerCase();
+ var type = name.toLowerCase();
// innerHeight and innerWidth
- jQuery.fn["inner" + name] = function(){
+ jQuery.fn["inner" + name] = function() {
return this[0] ?
- jQuery.css( this[0], lower, false, "padding" ) :
+ jQuery.css( this[0], type, false, "padding" ) :
null;
};
// outerHeight and outerWidth
- jQuery.fn["outer" + name] = function(margin) {
+ jQuery.fn["outer" + name] = function( margin ) {
return this[0] ?
- jQuery.css( this[0], lower, false, margin ? "margin" : "border" ) :
+ jQuery.css( this[0], type, false, margin ? "margin" : "border" ) :
null;
};
- var type = name.toLowerCase();
-
jQuery.fn[ type ] = function( size ) {
// Get window width or height
- return this[0] == window ?
+ var elem = this[0];
+ if ( !elem ) {
+ return size == null ? null : this;
+ }
+
+ if ( jQuery.isFunction( size ) ) {
+ return this.each(function( i ) {
+ var self = jQuery( this );
+ self[ type ]( size.call( this, i, self[ type ]() ) );
+ });
+ }
+
+ return ("scrollTo" in elem && elem.document) ? // does it walk and quack like a window?
// Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode
- document.compatMode == "CSS1Compat" && document.documentElement[ "client" + name ] ||
- document.body[ "client" + name ] :
+ elem.document.compatMode === "CSS1Compat" && elem.document.documentElement[ "client" + name ] ||
+ elem.document.body[ "client" + name ] :
// Get document width or height
- this[0] == document ?
+ (elem.nodeType === 9) ? // is it a document
// Either scroll[Width/Height] or offset[Width/Height], whichever is greater
Math.max(
- document.documentElement["client" + name],
- document.body["scroll" + name], document.documentElement["scroll" + name],
- document.body["offset" + name], document.documentElement["offset" + name]
+ elem.documentElement["client" + name],
+ elem.body["scroll" + name], elem.documentElement["scroll" + name],
+ elem.body["offset" + name], elem.documentElement["offset" + name]
) :
// Get or set width or height on the element
size === undefined ?
// Get width or height on the element
- (this.length ? jQuery.css( this[0], type ) : null) :
+ jQuery.css( elem, type ) :
// Set the width or height on the element (default to pixels if value is unitless)
this.css( type, typeof size === "string" ? size : size + "px" );
};
});
-})();
+// Expose jQuery to the global object
+window.jQuery = window.$ = jQuery;
+
+})(window);
diff --git a/libs/jquery/themes/base/jquery-ui.css b/libs/jquery/themes/base/jquery-ui.css
index 9e3c6129f8..6af2affc18 100644
--- a/libs/jquery/themes/base/jquery-ui.css
+++ b/libs/jquery/themes/base/jquery-ui.css
@@ -1,6 +1,6 @@
/*
* jQuery UI CSS Framework
-* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
*/
@@ -35,10 +35,209 @@
/* Overlays */
.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+/* Accordion
+----------------------------------*/
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+/* IE7-/Win - Fix extra vertical space in lists */
+.ui-accordion a { zoom: 1; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }/* Autocomplete
+----------------------------------*/
+.ui-autocomplete { position: absolute; cursor: default; }
+.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/* Menu
+----------------------------------*/
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
+/* Button
+----------------------------------*/
+
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+
+
+
+
+
+/* Datepicker
+----------------------------------*/
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/* Dialog
+----------------------------------*/
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/* Progressbar
+----------------------------------*/
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/* Resizable
+----------------------------------*/
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Slider
+----------------------------------*/
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs
+----------------------------------*/
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
/*
* jQuery UI CSS Framework
-* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
* To view and modify this theme, visit http://jqueryui.com/themeroller/
*/
@@ -47,6 +246,7 @@
/* Component containers
----------------------------------*/
.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; }
+.ui-widget .ui-widget { font-size: 1em; }
.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; }
.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; }
.ui-widget-content a { color: #222222/*{fcContent}*/; }
@@ -55,23 +255,24 @@
/* Interaction states
----------------------------------*/
-.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; outline: none; }
-.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; outline: none; }
-.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; outline: none; }
-.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; outline: none; }
-.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; outline: none; }
-.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; outline: none; text-decoration: none; }
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; }
+.ui-widget :active { outline: none; }
/* Interaction Cues
----------------------------------*/
-.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; }
-.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636/*{fcHighlight}*/; }
-.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; }
-.ui-state-error a, .ui-widget-content .ui-state-error a { color: #cd0a0a/*{fcError}*/; }
-.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a/*{fcError}*/; }
-.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
-.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }
-.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
/* Icons
----------------------------------*/
@@ -222,6 +423,8 @@
.ui-icon-seek-next { background-position: -32px -160px; }
.ui-icon-seek-prev { background-position: -48px -160px; }
.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
.ui-icon-seek-first { background-position: -80px -160px; }
.ui-icon-stop { background-position: -96px -160px; }
.ui-icon-eject { background-position: -112px -160px; }
@@ -266,139 +469,16 @@
----------------------------------*/
/* Corner radius */
-.ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-top { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-bottom { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-right { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-left { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-all { -moz-border-radius: 4px/*{cornerRadius}*/; -webkit-border-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-top { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-right { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-left { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-all { -moz-border-radius: 4px/*{cornerRadius}*/; -webkit-border-radius: 4px/*{cornerRadius}*/; border-radius: 4px/*{cornerRadius}*/; }
/* Overlays */
.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; }
-.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; }/* Accordion
-----------------------------------*/
-.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
-.ui-accordion .ui-accordion-li-fix { display: inline; }
-.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
-.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; }
-.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
-.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; }
-.ui-accordion .ui-accordion-content-active { display: block; }/* Datepicker
-----------------------------------*/
-.ui-datepicker { width: 17em; padding: .2em .2em 0; }
-.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
-.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
-.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
-.ui-datepicker .ui-datepicker-prev { left:2px; }
-.ui-datepicker .ui-datepicker-next { right:2px; }
-.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
-.ui-datepicker .ui-datepicker-next-hover { right:1px; }
-.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
-.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
-.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; }
-.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
-.ui-datepicker select.ui-datepicker-month,
-.ui-datepicker select.ui-datepicker-year { width: 49%;}
-.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; }
-.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
-.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
-.ui-datepicker td { border: 0; padding: 1px; }
-.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
-.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
-.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
-.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
-
-/* with multiple calendars */
-.ui-datepicker.ui-datepicker-multi { width:auto; }
-.ui-datepicker-multi .ui-datepicker-group { float:left; }
-.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
-.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
-.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
-.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
-.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
-.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
-.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
-.ui-datepicker-row-break { clear:both; width:100%; }
-
-/* RTL support */
-.ui-datepicker-rtl { direction: rtl; }
-.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
-.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
-.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
-.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
-.ui-datepicker-rtl .ui-datepicker-group { float:right; }
-.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
-.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
-
-/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
-.ui-datepicker-cover {
- display: none; /*sorry for IE5*/
- display/**/: block; /*sorry for IE5*/
- position: absolute; /*must have*/
- z-index: -1; /*must have*/
- filter: mask(); /*must have*/
- top: -4px; /*must have*/
- left: -4px; /*must have*/
- width: 200px; /*must have*/
- height: 200px; /*must have*/
-}/* Dialog
-----------------------------------*/
-.ui-dialog { position: relative; padding: .2em; width: 300px; }
-.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; }
-.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; }
-.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
-.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
-.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
-.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
-.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
-.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
-.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
-.ui-draggable .ui-dialog-titlebar { cursor: move; }
-/* Progressbar
-----------------------------------*/
-.ui-progressbar { height:2em; text-align: left; }
-.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/* Resizable
-----------------------------------*/
-.ui-resizable { position: relative;}
-.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
-.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
-.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; }
-.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; }
-.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; }
-.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; }
-.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
-.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
-.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
-.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Slider
-----------------------------------*/
-.ui-slider { position: relative; text-align: left; }
-.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
-.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; }
-
-.ui-slider-horizontal { height: .8em; }
-.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
-.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
-.ui-slider-horizontal .ui-slider-range-min { left: 0; }
-.ui-slider-horizontal .ui-slider-range-max { right: 0; }
-
-.ui-slider-vertical { width: .8em; height: 100px; }
-.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
-.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
-.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
-.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs
-----------------------------------*/
-.ui-tabs { padding: .2em; zoom: 1; }
-.ui-tabs .ui-tabs-nav { list-style: none; position: relative; padding: .2em .2em 0; }
-.ui-tabs .ui-tabs-nav li { position: relative; float: left; border-bottom-width: 0 !important; margin: 0 .2em -1px 0; padding: 0; }
-.ui-tabs .ui-tabs-nav li a { float: left; text-decoration: none; padding: .5em 1em; }
-.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 1px; border-bottom-width: 0; }
-.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
-.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
-.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border-width: 0; background: none; }
-.ui-tabs .ui-tabs-hide { display: none !important; }
+.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; }
\ No newline at end of file
--
GitLab